missing translation for 'onlineSavingsMsg'
Läs mer
Läs mer
Famotidine, 98+%, Thermo Scientific™
A competitive histamine H2 receptor antagonist
Brand: Thermo Scientific Alfa Aesar J63165.03
| Kvantitet | 1g |
|---|
Denna artikel kan inte returneras.
Se returpolicy
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
SolubilitySoluble in water and methanol
Notes
Store in cool place. Keep container tightly closed in a dry and well-ventilated place. Keep away from strong oxidizing agents.
Kemiska identifierare
| 76824-35-6 | |
| 337.435 | |
| XUFQPHANEAPEMJ-UHFFFAOYSA-N | |
| 5702160 | |
| 3-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide |
| C8H15N7O2S3 | |
| MFCD00079297 | |
| famotidine, pepcid ac, apogastine, amfamox, antodine, bestidine, digervin, dispromil, famodil, gastridin | |
| CHEBI:4975 | |
| C1=C(N=C(S1)N=C(N)N)CSCCC(=NS(=O)(=O)N)N |
Specifikationer
| Famotidine | |
| C8H15N7O2S3 | |
| 1g | |
| famotidine, pepcid ac, apogastine, amfamox, antodine, bestidine, digervin, dispromil, famodil, gastridin | |
| XUFQPHANEAPEMJ-UHFFFAOYSA-N | |
| 3-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide | |
| 5702160 | |
| 337.45 |
| 76824-35-6 | |
| MFCD00079297 | |
| 14,3930 | |
| Soluble in water and methanol | |
| C1=C(N=C(S1)N=C(N)N)CSCCC(=NS(=O)(=O)N)N | |
| 337.435 | |
| CHEBI:4975 | |
| ≥98% |
Korrigering av produktinnehåll
Din input är viktig för oss. Fyll i det här formuläret för att ge feedback relaterad till innehållet på denna produkt.
Produkttitel
Hittar du en möjlighet till förbättring?Dela en innehållskorrigering