Läs mer
Finasteride, Thermo Scientific™
Inhibitor of steroid 5-a-reductase
Brand: Thermo Scientific Alfa Aesar J63454.06
| Kvantitet | 5g |
|---|
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsFinasteride is used as a inhibitor of steroid 5-a-reductase, antiandrogen, an intracellular enzyme that converts the androgen testosterone into 5α dihydrotestosterone.
Solubility
Soluble in water, DMSO, ethanol, methanol, and chloroform.
Notes
Protect from heat. Store away from oxidizing agents.
Kemiska identifierare
| 98319-26-7 | |
| 372.553 | |
| DBEPLOCGEIEOCV-WSBQPABSSA-N | |
| 57363 | |
| (1S,3aS,3bS,5aR,9aR,9bS,11aS)-N-tert-butyl-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxamide |
| C23H36N2O2 | |
| MFCD00869737 | |
| finasteride, proscar, propecia, finastid, prostide, chibro-proscar, finasterida, finasteridum, finpecia, finasteridum inn-latin | |
| CHEBI:5062 | |
| CC12CCC3C(C1CCC2C(=O)NC(C)(C)C)CCC4C3(C=CC(=O)N4)C |
Specifikationer
| Finasteride | |
| C23H36N2O2 | |
| 5g | |
| finasteride, proscar, propecia, finastid, prostide, chibro-proscar, finasterida, finasteridum, finpecia, finasteridum inn-latin | |
| DBEPLOCGEIEOCV-WSBQPABSSA-N | |
| (1S,3aS,3bS,5aR,9aR,9bS,11aS)-N-tert-butyl-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxamide | |
| 57363 | |
| 372.54 |
| 98319-26-7 | |
| MFCD00869737 | |
| 14,4082 | |
| Soluble in water,DMSO,ethanol,methanol,and chloroform. | |
| CC12CCC3C(C1CCC2C(=O)NC(C)(C)C)CCC4C3(C=CC(=O)N4)C | |
| 372.553 | |
| CHEBI:5062 |
Genom att klicka på Skicka bekräftar du att du kan bli kontaktad av Fisher Scientific angående feedbacken du har lämnat i detta formulär. Vi kommer inte att dela din information för andra ändamål. All kontaktinformation som tillhandahålls ska också underhållas i enlighet med vår Sekretesspolicy.