missing translation for 'onlineSavingsMsg'
Läs mer
Läs mer
Flumazenil, 98%, Thermo Scientific™
Benzodiazepine antagonist
Brand: Thermo Scientific Alfa Aesar J62537.MC
| Kvantitet | 100mg |
|---|
Denna artikel kan inte returneras.
Se returpolicy
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Kemiska identifierare
| 78755-81-4 | |
| 303.293 | |
| OFBIFZUFASYYRE-UHFFFAOYSA-N | |
| 3373 | |
| ethyl 8-fluoro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate |
| C15H14FN3O3 | |
| MFCD00242764 | |
| flumazenil, anexate, flumazepil, romazicon, lanexat, mazicon, flumazenilum, flumazenilo, flumazenilum latin, flumazenilo spanish | |
| CHEBI:5103 | |
| CCOC(=O)C1=C2CN(C(=O)C3=C(N2C=N1)C=CC(=C3)F)C |
Specifikationer
| Flumazenil | |
| C15H14FN3O3 | |
| 100mg | |
| flumazenil, anexate, flumazepil, romazicon, lanexat, mazicon, flumazenilum, flumazenilo, flumazenilum latin, flumazenilo spanish | |
| OFBIFZUFASYYRE-UHFFFAOYSA-N | |
| ethyl 8-fluoro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate | |
| 3373 | |
| 303.29 |
| 78755-81-4 | |
| MFCD00242764 | |
| 14,4135 | |
| Soluble in DMSO to 25mM | |
| CCOC(=O)C1=C2CN(C(=O)C3=C(N2C=N1)C=CC(=C3)F)C | |
| 303.293 | |
| CHEBI:5103 | |
| 98% |
Produkttitel
Genom att klicka på Skicka bekräftar du att du kan bli kontaktad av Fisher Scientific angående feedbacken du har lämnat i detta formulär. Vi kommer inte att dela din information för andra ändamål. All kontaktinformation som tillhandahålls ska också underhållas i enlighet med vår Sekretesspolicy.
Hittar du en möjlighet till förbättring?