Läs mer
Fluoxetine hydrochloride, 99%, Thermo Scientific™
A selective serotonin reuptake inhibitor
Brand: Thermo Scientific Alfa Aesar J61197.MF
| Kvantitet | 50mg |
|---|
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsFluoxetine hydrochloride is a selective serotonin reuptake inhibitor. It is used to treat major depressive disorder, bulimia nervosa (an eating disorder) obsessive-compulsive disorder, panic disorder and premenstrual dysphoric disorder (PMDD).
Solubility
Soluble in dimethylsulfoxide and water.
Notes
Incompatible with strong oxidizing agents.
Kemiska identifierare
| 56296-78-7 | |
| 345.79 | |
| GIYXAJPCNFJEHY-UHFFFAOYSA-N | |
| 62857 | |
| CNCCC(C1=CC=CC=C1)OC2=CC=C(C=C2)C(F)(F)F.Cl |
| C17H19ClF3NO | |
| MFCD00214288 | |
| fluoxetine hydrochloride, prozac, fluoxetine hcl, sarafem, flunirin, fluoxeren, adofen, fluctin, lovan | |
| N-methyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine;hydrochloride |
Specifikationer
| Fluoxetine hydrochloride | |
| C17H19ClF3NO | |
| 50mg | |
| fluoxetine hydrochloride, prozac, fluoxetine hcl, sarafem, flunirin, fluoxeren, adofen, fluctin, lovan | |
| GIYXAJPCNFJEHY-UHFFFAOYSA-N | |
| N-methyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine;hydrochloride | |
| 62857 | |
| 99% |
| 56296-78-7 | |
| MFCD00214288 | |
| 14,4185 | |
| Soluble in dimethylsulfoxide and water. | |
| CNCCC(C1=CC=CC=C1)OC2=CC=C(C=C2)C(F)(F)F.Cl | |
| 345.79 | |
| 345.79 |
Genom att klicka på Skicka bekräftar du att du kan bli kontaktad av Fisher Scientific angående feedbacken du har lämnat i detta formulär. Vi kommer inte att dela din information för andra ändamål. All kontaktinformation som tillhandahålls ska också underhållas i enlighet med vår Sekretesspolicy.