Läs mer
Furosemide, 97+%, Thermo Scientific™
Loop diuretic that inhibits the Na+/2Cl-/K+ (NKCC) cotransporter
1245.00 SEK - 4005.00 SEK
Kemiska identifierare
| CAS | 54-31-9 |
|---|---|
| Molekylformel | C12H11ClN2O5S |
| Molekylvikt (g/mol) | 330.739 |
| MDL-nummer | MFCD00010549 |
| InChI-nyckel | ZZUFCTLCJUWOSV-UHFFFAOYSA-N |
| Synonym | furosemide, frusemide, lasix, furosemid, furanthril, errolon, fusid, aisemide, beronald, desdemin |
| PubChem CID | 3440 |
| ChEBI | CHEBI:47426 |
| IUPAC-namn | 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoic acid |
| LEDER | C1=COC(=C1)CNC2=CC(=C(C=C2C(=O)O)S(=O)(=O)N)Cl |
| Produktkod | Brand | Kvantitet | Pris | Kvantitet och tillgänglighet | |||||
|---|---|---|---|---|---|---|---|---|---|
| Produktkod | Brand | Kvantitet | Pris | Kvantitet och tillgänglighet | |||||
|
15404059
|
Thermo Scientific Alfa Aesar
J61457.06 |
5g |
1245.00 SEK
5g |
Vänligen Logga in för att beställa denna produkten. Behöver du ett Webbkonto? Registrera ditt konto idag! | |||||
|
15414059
|
Thermo Scientific Alfa Aesar
J61457.09 |
10g |
2050.00 SEK
10g |
Vänligen Logga in för att beställa denna produkten. Behöver du ett Webbkonto? Registrera ditt konto idag! | |||||
|
15424059
|
Thermo Scientific Alfa Aesar
J61457.14 |
25g |
4005.00 SEK
25g |
Vänligen Logga in för att beställa denna produkten. Behöver du ett Webbkonto? Registrera ditt konto idag! | |||||
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Kemiska identifierare
| 54-31-9 | |
| 330.739 | |
| ZZUFCTLCJUWOSV-UHFFFAOYSA-N | |
| 3440 | |
| 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoic acid |
| C12H11ClN2O5S | |
| MFCD00010549 | |
| furosemide, frusemide, lasix, furosemid, furanthril, errolon, fusid, aisemide, beronald, desdemin | |
| CHEBI:47426 | |
| C1=COC(=C1)CNC2=CC(=C(C=C2C(=O)O)S(=O)(=O)N)Cl |
Specifikationer
| Furosemide | |
| C12H11ClN2O5S | |
| 14,4309 | |
| Soluble in acetone, DMF or methanol; Slightly soluble in water | |
| C1=COC(=C1)CNC2=CC(=C(C=C2C(=O)O)S(=O)(=O)N)Cl | |
| 330.739 | |
| CHEBI:47426 | |
| ≥97% |
| 54-31-9 | |
| MFCD00010549 | |
| furosemide, frusemide, lasix, furosemid, furanthril, errolon, fusid, aisemide, beronald, desdemin | |
| ZZUFCTLCJUWOSV-UHFFFAOYSA-N | |
| 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoic acid | |
| 3440 | |
| 330.74 |
Säkerhet och hantering
GHS H Statement
H360
May damage fertility or the unborn child.
P201-P202-P281-P308+P313-P501c
H360
missing translation for 'einecsNumber' : 200-203-6
missing translation for 'rtecsNumber' : CB2625000
missing translation for 'tsca' : No
Rekommenderad förvaring : Ambient temperatures
RUO – Research Use Only
Din input är viktig för oss. Fyll i det här formuläret för att ge feedback relaterad till innehållet på denna produkt.