Läs mer
Irinotecan hydrochloride, Thermo Scientific™
Topoisomerase I inhibitor
Brand: Thermo Scientific Alfa Aesar J60743.MF
| Kvantitet | 50mg |
|---|
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Kemiska identifierare
| 100286-90-6 | |
| 623.15 | |
| GURKHSYORGJETM-WAQYZQTGSA-N | |
| 74990 | |
| hydrogen (19S)-10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.0²,¹¹.0⁴,⁹.0¹⁵,²⁰]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl [1,4'-bipiperidine]-1'-carboxylate chloride |
| C33H39ClN4O6 | |
| MFCD01862255 | |
| irinotecan hydrochloride, irinotecan hcl, topotecin, campto, cpt-11, cpt 11, camptothecin 11 hydrochloride, camptothecin 11, unii-06x131e4oe | |
| CHEBI:5971 | |
| [H+].[Cl-].CCC1=C2C=C(OC(=O)N3CCC(CC3)N3CCCCC3)C=CC2=NC2=C1CN1C2=CC2=C(COC(=O)[C@]2(O)CC)C1=O |
Specifikationer
| Irinotecan hydrochloride | |
| C33H39ClN4O6 | |
| 50mg | |
| irinotecan hydrochloride, irinotecan hcl, topotecin, campto, cpt-11, cpt 11, camptothecin 11 hydrochloride, camptothecin 11, unii-06x131e4oe | |
| GURKHSYORGJETM-WAQYZQTGSA-N | |
| hydrogen (19S)-10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.0²,¹¹.0⁴,⁹.0¹⁵,²⁰]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl [1,4'-bipiperidine]-1'-carboxylate chloride | |
| 74990 | |
| 623.14 |
| 100286-90-6 | |
| MFCD01862255 | |
| 14,5091 | |
| Soluble in DMSO or DMF at approximately 20mg/ml; Sparingly soluble in aqueous buffers; /n | |
| [H+].[Cl-].CCC1=C2C=C(OC(=O)N3CCC(CC3)N3CCCCC3)C=CC2=NC2=C1CN1C2=CC2=C(COC(=O)[C@]2(O)CC)C1=O | |
| 623.15 | |
| CHEBI:5971 |
Säkerhet och hantering
- Irinotecan hydrochloride
Signalord
- Varning
Riskkategorier
- Akut toxicitet Kategorija 4
Faroangivelser
- H302-Skadligt vid förtäring.
Skyddsangivelse
- P264-Tvätta grundligt efter användning.
- P301+P330+P331-VID FÖRTÄRING: Skölj munnen. Framkalla INTE kräkning.
- P312-Vid obehag, kontakta GIFTINFORMATIONSCENTRALEN/läkare/ .
Kompletterande information
- MIXTURE LIST-Innehåller: Irinotecan hydrochloride
Din input är viktig för oss. Fyll i det här formuläret för att ge feedback relaterad till innehållet på denna produkt.