Läs mer
Ketoconazole, 98%, Thermo Scientific™
Potent inhibitor of cytochrome P450c17
Brand: Thermo Scientific Alfa Aesar J63367.14
| Kvantitet | 25g |
|---|
Se fler versioner av denna produkt
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsKetoconazole is used to treat candidiasis, chronic mucocutaneous candidiasis, oral thrush, candiduria, blastomycosis, coccidioidomycosis, histoplasmosis, chromomycosis, and paracoccidioidomycosis. Ketoconazole is an antifungal agent.
Solubility
Soluble in DMSO, ethanol, chloroform, water, and methanol.
Notes
Store away from strong oxidizing agents. Keep container tightly closed. Store in cool, dry conditions in well sealed containers.
Kemiska identifierare
| 65277-42-1 | |
| 534.452 | |
| XMAYWYJOQHXEEK-SIULDFEJSA-N | |
| 76973198 | |
| CC(=O)N1CCN(CC1)C2=CC=C(C=C2)OCC3COC(O3)(CN4C=CN=C4)C5=C(C=C(C=C5)Cl)Cl |
| C26H28Cl2N4O4 | |
| MFCD00058579 | |
| ketoconazole | |
| 2,2,2-trideuterio-1-[4-[4-[[(2R,4S)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethanone |
Specifikationer
| Ketoconazole | |
| C26H28Cl2N4O4 | |
| 25g | |
| 14,5302 | |
| Soluble in DMSO,ethanol,chloroform,water,and methanol. | |
| CC(=O)N1CCN(CC1)C2=CC=C(C=C2)OCC3COC(O3)(CN4C=CN=C4)C5=C(C=C(C=C5)Cl)Cl | |
| 534.452 | |
| 531.43 |
| 65277-42-1 | |
| MFCD00058579 | |
| UN2811 | |
| ketoconazole | |
| XMAYWYJOQHXEEK-SIULDFEJSA-N | |
| 2,2,2-trideuterio-1-[4-[4-[[(2R,4S)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethanone | |
| 76973198 | |
| 98% |
Din input är viktig för oss. Fyll i det här formuläret för att ge feedback relaterad till innehållet på denna produkt.