missing translation for 'onlineSavingsMsg'
Läs mer
Läs mer
L-Thyroxine, 98%, Thermo Scientific™
1285.00 SEK - 4315.00 SEK
Kemiska identifierare
| CAS | 51-48-9 |
|---|---|
| Molekylformel | C15H11I4NO4 |
| Molekylvikt (g/mol) | 776.87 |
| MDL-nummer | MFCD00002595 |
| InChI-nyckel | XUIIKFGFIJCVMT-UHFFFAOYNA-N |
| Synonym | l-thyroxine, levothyroxine, thyroxine, thyroxin, synthroid, tetraiodothyronine, thyrax, levothyroxin, thyratabs, thyreoideum |
| PubChem CID | 5819 |
| ChEBI | CHEBI:18332 |
| IUPAC-namn | 2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid |
| LEDER | NC(CC1=CC(I)=C(OC2=CC(I)=C(O)C(I)=C2)C(I)=C1)C(O)=O |
| Produktkod | Brand | Kvantitet | Pris | Kvantitet och tillgänglighet | |||||
|---|---|---|---|---|---|---|---|---|---|
| Produktkod | Brand | Kvantitet | Pris | Kvantitet och tillgänglighet | |||||
|
15464939
|
Thermo Scientific Alfa Aesar
J62606.03 |
1g |
1285.00 SEK
1g |
Vänligen Logga in för att beställa denna produkten. Behöver du ett Webbkonto? Registrera ditt konto idag! | |||||
|
15474939
|
Thermo Scientific Alfa Aesar
J62606.06 |
5g |
4315.00 SEK
5g |
Vänligen Logga in för att beställa denna produkten. Behöver du ett Webbkonto? Registrera ditt konto idag! | |||||
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Kemiska identifierare
| 51-48-9 | |
| 776.87 | |
| XUIIKFGFIJCVMT-UHFFFAOYNA-N | |
| 5819 | |
| 2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid |
| C15H11I4NO4 | |
| MFCD00002595 | |
| l-thyroxine, levothyroxine, thyroxine, thyroxin, synthroid, tetraiodothyronine, thyrax, levothyroxin, thyratabs, thyreoideum | |
| CHEBI:18332 | |
| NC(CC1=CC(I)=C(OC2=CC(I)=C(O)C(I)=C2)C(I)=C1)C(O)=O |
Specifikationer
| L-Thyroxine | |
| Odorless | |
| MFCD00002595 | |
| Light sensitive | |
| l-thyroxine, levothyroxine, thyroxine, thyroxin, synthroid, tetraiodothyronine, thyrax, levothyroxin, thyratabs, thyreoideum | |
| XUIIKFGFIJCVMT-UHFFFAOYNA-N | |
| 2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid | |
| 5819 | |
| 776.87 |
| 51-48-9 | |
| C15H11I4NO4 | |
| 2228515 | |
| 14,9415 | |
| Dissolves in 4M ammonium hydroxide in Methanol at 50mg/ml | |
| NC(CC1=CC(I)=C(OC2=CC(I)=C(O)C(I)=C2)C(I)=C1)C(O)=O | |
| 776.87 | |
| CHEBI:18332 | |
| 98% |
Säkerhet och hantering
P264-P270-P301+P312-P330-P501c
H302
missing translation for 'einecsNumber' : 200-101-1
missing translation for 'rtecsNumber' : YP2833500
missing translation for 'tsca' : Yes
Rekommenderad förvaring : Ambient temperatures
RUO – Research Use Only
Hittar du en möjlighet till förbättring?Dela en innehållskorrigering
Korrigering av produktinnehåll
Din input är viktig för oss. Fyll i det här formuläret för att ge feedback relaterad till innehållet på denna produkt.
Produkttitel