Läs mer
Maprotiline hydrochloride, 99%, Thermo Scientific™
Selective norepinephrine uptake inhibitor
Brand: Thermo Scientific Alfa Aesar J62321.06
| Kvantitet | 5g |
|---|
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsMaprotiline Hydrochloride has also been shown to block apoptosis of spiny neurons and inhibit SLC6A2.
Solubility
Soluble to 50mg/ml in water. Soluble in ethanol at 10mM
Notes
Store in cool place. Keep container tightly closed in a dry and well-ventilated place. Keep away from strong oxidizing agents.
Kemiska identifierare
| 10347-81-6 | |
| 313.87 | |
| NZDMFGKECODQRY-UHFFFAOYSA-N | |
| 71478 | |
| [H+].[Cl-].CNCCCC12CCC(C3=CC=CC=C13)C1=CC=CC=C21 |
| C20H24ClN | |
| MFCD00079464 | |
| maprotiline hydrochloride, maprotiline hcl, ludiomil, psymion, maprotilline hcl, ciba 34276 ba, unii-7c8j54pvfi, deprilept, 9-gamma-methylaminopropyl-9,10-dihydro-9,10-ethanoanthracene hydrochloride | |
| hydrogen methyl(3-{tetracyclo[6.6.2.0²,⁷.0⁹,¹⁴]hexadeca-2,4,6,9,11,13-hexaen-1-yl}propyl)amine chloride |
Specifikationer
| Maprotiline hydrochloride | |
| C20H24ClN | |
| 5g | |
| 14,5748 | |
| Soluble to 50mg/ml in water; Soluble in ethanol at 10mM | |
| [H+].[Cl-].CNCCCC12CCC(C3=CC=CC=C13)C1=CC=CC=C21 | |
| 313.87 | |
| 313.87 |
| 10347-81-6 | |
| MFCD00079464 | |
| 5463242 | |
| maprotiline hydrochloride, maprotiline hcl, ludiomil, psymion, maprotilline hcl, ciba 34276 ba, unii-7c8j54pvfi, deprilept, 9-gamma-methylaminopropyl-9,10-dihydro-9,10-ethanoanthracene hydrochloride | |
| NZDMFGKECODQRY-UHFFFAOYSA-N | |
| hydrogen methyl(3-{tetracyclo[6.6.2.0²,⁷.0⁹,¹⁴]hexadeca-2,4,6,9,11,13-hexaen-1-yl}propyl)amine chloride | |
| 71478 | |
| 99% |
Genom att klicka på Skicka bekräftar du att du kan bli kontaktad av Fisher Scientific angående feedbacken du har lämnat i detta formulär. Vi kommer inte att dela din information för andra ändamål. All kontaktinformation som tillhandahålls ska också underhållas i enlighet med vår Sekretesspolicy.