Läs mer
Naftopidil hydrochloride, 98+%, Thermo Scientific™
An alpha1-adrenoceptor antagonist
Brand: Thermo Scientific Alfa Aesar J63249.MA
| Kvantitet | 10mg |
|---|
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Kemiska identifierare
| 1164469-60-6 | |
| 428.957 | |
| VQAAEWMEVIOHTJ-UHFFFAOYSA-N | |
| 6603044 | |
| COC1=CC=CC=C1N2CCN(CC2)CC(COC3=CC=CC4=CC=CC=C43)O.Cl |
| C24H29ClN2O3 | |
| MFCD09971016 | |
| naftopidil hydrochloride, opera_id_518, 1-4-2-methoxyphenyl piperazin-1-yl-3-naphthalen-1-yloxypropan-2-ol hydrochloride, 4-2-methoxyphenyl-?-1-naphthalenyloxy methyl-1-piperazineethanol hydrochloride | |
| 1-[4-(2-methoxyphenyl)piperazin-1-yl]-3-naphthalen-1-yloxypropan-2-ol;hydrochloride |
Specifikationer
| Naftopidil hydrochloride | |
| C24H29ClN2O3 | |
| 10mg | |
| Soluble in DMSO; Also soluble in ethanol; Insoluble in water. | |
| COC1=CC=CC=C1N2CCN(CC2)CC(COC3=CC=CC4=CC=CC=C43)O.Cl | |
| 428.957 | |
| 428.96 |
| 1164469-60-6 | |
| MFCD09971016 | |
| naftopidil hydrochloride, opera_id_518, 1-4-2-methoxyphenyl piperazin-1-yl-3-naphthalen-1-yloxypropan-2-ol hydrochloride, 4-2-methoxyphenyl-?-1-naphthalenyloxy methyl-1-piperazineethanol hydrochloride | |
| VQAAEWMEVIOHTJ-UHFFFAOYSA-N | |
| 1-[4-(2-methoxyphenyl)piperazin-1-yl]-3-naphthalen-1-yloxypropan-2-ol;hydrochloride | |
| 6603044 | |
| ≥98% |
Din input är viktig för oss. Fyll i det här formuläret för att ge feedback relaterad till innehållet på denna produkt.