Läs mer
Nimesulide, Thermo Scientific™
Highly selective cyclooxygenase-2 inhibitor which induces apoptosis
Brand: Thermo Scientific Alfa Aesar J63699.06
| Kvantitet | 5g |
|---|
Se fler versioner av denna produkt
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
SolubilitySoluble in water (<50 µg/ml), 1:10 DMSO:PBS (pH 7.2) (<200 µg/ml), ethanol (1 mg/ml), DMSO (15 mg/ml), DMF (15 mg/ml), chloroform, dichloromethane, acetone (freely soluble), and 1N NaOH.
Notes
Store in cool place. Keep container tightly closed in a dry and well-ventilated place. Store away from strong oxidizing agents.
Kemiska identifierare
| 51803-78-2 | |
| 308.308 | |
| HYWYRSMBCFDLJT-UHFFFAOYSA-N | |
| 4495 | |
| N-(4-nitro-2-phenoxyphenyl)methanesulfonamide |
| C13H12N2O5S | |
| MFCD00079470 | |
| nimesulide, mesulid, n-4-nitro-2-phenoxyphenyl methanesulfonamide, flogovital, sulidene, nimed, 4-nitro-2-phenoxymethanesulfonanilide, nisulid, nimesulidum inn-latin, nimesulida inn-spanish | |
| CHEBI:44445 | |
| CS(=O)(=O)NC1=C(C=C(C=C1)[N+](=O)[O-])OC2=CC=CC=C2 |
Specifikationer
| Nimesulide | |
| C13H12N2O5S | |
| 5g | |
| 14,6548 | |
| Soluble in water (<50 μg/ml),1:10 DMSO:PBS (pH 7.2) (<200 μg/ml),ethanol (1mg/ml),DMSO (15mg/ml),DMF (15mg/ml),chloroform,dichloromethane,acetone (freely soluble),and 1N NaOH. | |
| CS(=O)(=O)NC1=C(C=C(C=C1)[N+](=O)[O-])OC2=CC=CC=C2 | |
| 308.308 | |
| CHEBI:44445 |
| 51803-78-2 | |
| MFCD00079470 | |
| UN2811 | |
| nimesulide, mesulid, n-4-nitro-2-phenoxyphenyl methanesulfonamide, flogovital, sulidene, nimed, 4-nitro-2-phenoxymethanesulfonanilide, nisulid, nimesulidum inn-latin, nimesulida inn-spanish | |
| HYWYRSMBCFDLJT-UHFFFAOYSA-N | |
| N-(4-nitro-2-phenoxyphenyl)methanesulfonamide | |
| 4495 | |
| 308.31 |
Genom att klicka på Skicka bekräftar du att du kan bli kontaktad av Fisher Scientific angående feedbacken du har lämnat i detta formulär. Vi kommer inte att dela din information för andra ändamål. All kontaktinformation som tillhandahålls ska också underhållas i enlighet med vår Sekretesspolicy.