Learn More
Pyridoxal 5-Phosphate (Monohydrate), Fisher BioReagents
Brand: Fisher Bioreagents BP2676-25
Additional Details : CAS Number : 54-47-7 Weight : 0.08000kg
| Packaging | Amber Glass |
|---|---|
| Quantity | 25g |
Description
- PLP is useful for modifying lysyl and valyl residues and functions as a coenzyme in transamination reactions by forming a Schiff-base linkage with lysine groups on aminotransferase
- PLP is an active form of vitamin B6
- Also serves as a coenzyme in some decarboxylation and deamination reactions
Chemical Identifiers
| Pyridoxal 5-Phosphate | |
| 54-47-7 | |
| ≥98% |
| Monohydrate | |
| Powder/Solid | |
| C8H10NO6P |
Specifications
| Pyridoxal 5-Phosphate | |
| Off-white | |
| 25g | |
| 54-47-7 | |
| Conforms to reference | |
| ≥98% | |
| ≥98% | |
| 15, 8092 | |
| NGVDGCNFYWLIFO-UHFFFAOYSA-N | |
| (4-formyl-5-hydroxy-6-methylpyridin-3-yl)methyl dihydrogen phosphate | |
| 1051 |
| 247.14 | |
| 140°C | |
| Monohydrate | |
| Pass Test | |
| Amber Glass | |
| Powder/Solid | |
| C8H10NO6P | |
| PLP | |
| CC1=NC=C(C(=C1O)C=O)COP(=O)(O)O | |
| 247.143 | |
| CHEBI:18405 |