Läs mer
Tolfenamic acid, 99+%, Thermo Scientific™
NSAID that activates calcium-activated potassium channels
Brand: Thermo Scientific Alfa Aesar J61256.09
| Kvantitet | 10g |
|---|
Se fler versioner av denna produkt
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsTolfenamic acid is a non-steroidal anti-inflammatory agent. It interferes with synthesis of β-amyloid precursor protein, and thus Aβ peptides, by promoting degradation of an essential transcription factor. It inhibits fMLP- and A23187-induced Ca2+ influx in human PMNL with an IC50 value of approximately 20 µM.
Solubility
Soluble in water (slightly), acetone (∼10 mg/ml), DMSO (52 mg/ml at 25°C), methanol (∼10 mg/ml) and ethanol (50 mg/ml).
Notes
Stable under recommended storage conditions. Incompatible with oxidizing agents.
Kemiska identifierare
| 13710-19-5 | |
| 261.705 | |
| YEZNLOUZAIOMLT-UHFFFAOYSA-N | |
| 610479 | |
| 2-(3-chloro-2-methylanilino)benzoic acid |
| C14H12ClNO2 | |
| MFCD00133865 | |
| tolfenamic acid, clotam, n-3-chloro-2-methylphenyl anthranilic acid, 2-3-chloro-2-methylphenyl amino benzoic acid, tolfedine, acido tolfenamico, acide tolfenamique, acidum tolfenamicum, tolfine, n-2-methyl-3-chlorophenyl anthranilic acid | |
| CHEBI:32243 | |
| CC1=C(C=CC=C1Cl)NC2=CC=CC=C2C(=O)O |
Specifikationer
| Tolfenamic acid | |
| C14H12ClNO2 | |
| 10g | |
| 14,9513 | |
| Soluble in water (slightly),acetone (∽10mg/ml),DMSO (52mg/ml at 25°C),methanol (∽10mg/ml) and ethanol (50mg/ml). | |
| CC1=C(C=CC=C1Cl)NC2=CC=CC=C2C(=O)O | |
| 261.705 | |
| CHEBI:32243 | |
| ≥99% |
| 13710-19-5 | |
| MFCD00133865 | |
| UN2811 | |
| tolfenamic acid, clotam, n-3-chloro-2-methylphenyl anthranilic acid, 2-3-chloro-2-methylphenyl amino benzoic acid, tolfedine, acido tolfenamico, acide tolfenamique, acidum tolfenamicum, tolfine, n-2-methyl-3-chlorophenyl anthranilic acid | |
| YEZNLOUZAIOMLT-UHFFFAOYSA-N | |
| 2-(3-chloro-2-methylanilino)benzoic acid | |
| 610479 | |
| 261.7 |
Säkerhet och hantering
- Tolfenamic acid
Signalord
- Fara
Riskkategorier
- Akut toxicitet Kategorija 3
Faroangivelser
- H301-Giftigt vid förtäring.
Skyddsangivelse
- P264-Tvätta grundligt efter användning.
- P301+P310-VID FÖRTÄRING: Kontakta genast GIFTINFORMATIONSCENTRALEN/läkare
Kompletterande information
- MIXTURE LIST-Contain: Tolfenamic acid
Genom att klicka på Skicka bekräftar du att du kan bli kontaktad av Fisher Scientific angående feedbacken du har lämnat i detta formulär. Vi kommer inte att dela din information för andra ändamål. All kontaktinformation som tillhandahålls ska också underhållas i enlighet med vår Sekretesspolicy.