Läs mer
Trazodone hydrochloride, 98+%, Thermo Scientific™
A serotonin uptake inhibitor
Brand: Thermo Scientific Alfa Aesar J63070.06
| Kvantitet | 5g |
|---|
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Kemiska identifierare
| 25332-39-2 | |
| 408.327 | |
| OHHDIOKRWWOXMT-UHFFFAOYSA-N | |
| 62935 | |
| 2-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one;hydrochloride |
| C19H23Cl2N5O | |
| MFCD00079603 | |
| trazodone hydrochloride, trazodone hcl, desyrel, bimaran, molipaxin, devidon, pragmazone, thombran, tombran, tritico | |
| CHEBI:9655 | |
| C1CN(CCN1CCCN2C(=O)N3C=CC=CC3=N2)C4=CC(=CC=C4)Cl.Cl |
Specifikationer
| Trazodone hydrochloride | |
| C19H23Cl2N5O | |
| 5g | |
| trazodone hydrochloride, trazodone hcl, desyrel, bimaran, molipaxin, devidon, pragmazone, thombran, tombran, tritico | |
| OHHDIOKRWWOXMT-UHFFFAOYSA-N | |
| 2-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one;hydrochloride | |
| 62935 | |
| 408.33 |
| 25332-39-2 | |
| MFCD00079603 | |
| 14,9579 | |
| Soluble at 25mg/ml in methanol; Also soluble in 0;1M HCl or DMSO; Insoluble in water /n | |
| C1CN(CCN1CCCN2C(=O)N3C=CC=CC3=N2)C4=CC(=CC=C4)Cl.Cl | |
| 408.327 | |
| CHEBI:9655 |
Genom att klicka på Skicka bekräftar du att du kan bli kontaktad av Fisher Scientific angående feedbacken du har lämnat i detta formulär. Vi kommer inte att dela din information för andra ändamål. All kontaktinformation som tillhandahålls ska också underhållas i enlighet med vår Sekretesspolicy.