| Molekylformel |
C14H25N4NaO11P2 |
| Rekommenderad förvaring |
4°C, sealed storage, away from moisture∣In solvent : -80°C, 6 months∣-20°C, 1 month (sealed storage, away from moisture) |
| Formel vikt |
510.31 |
| Hållbarhet |
4°C, sealed storage, away from moisture∣In solvent : -80°C, 6 months∣-20°C, 1 month (sealed storage, away from moisture) |
| Hälsofara 1 |
H302∣H315∣H319∣H332∣H335 |
| Löslighetsinformation |
H2O : ≥ 100 mg/mL (195.96 mM) ∣DMSO : 1 mg/mL (1.96 mM; ultrasonic and warming and heat to 80°C) |
| Anteckningar om renhetsgrad |
Research |
| Fysisk form |
Solid |
| Kvalitet |
Research |
| Färg |
White |
| CAS |
33818-15-4 |
| LEDER |
O[C@H]1[C@H](N(C=CC(N)=N2)C2=O)O[C@H](COP(OP(OCC[N+](C)(C)C)([O-])=O)(O[Na])=O)[C@H]1O |
| Molekylvikt (g/mol) |
510.31 |
| Synonym |
Cytidine diphosphate-choline sodiumCDP-Choline sodiumCytidine 5'-diphosphocholine sodium |
| Kemiskt namn eller material |
Citicoline sodium |
| Procent renhet |
99.82% |
| För användning med (applikation) |
Neuroscience-Neurodegeneration |