Learn More
1,1-Diphenylethylene, 98%, ACROS Organics™
Brand: Acros Organics 117261000
Additional Details : CAS Number : 530-48-3 Weight : 0.15000kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 100g |
Chemical Identifiers
| 530-48-3 | |
| 180.25 | |
| 1,1-diphenylethylene, ethene-1,1-diyldibenzene, 1,1-diphenylethene, benzene, 1,1'-ethenylidenebis, 1-phenylethenyl benzene, unii-bx0l5b6lll, as-diphenylethylene, .alpha.-phenylstyrene, 1-phenylvinyl benzene, bx0l5b6lll | |
| 1-phenylethenylbenzene |
| C14H12 | |
| ZMYIIHDQURVDRB-UHFFFAOYSA-N | |
| 10740 | |
| C=C(C1=CC=CC=C1)C2=CC=CC=C2 |
Specifications
| 1, 1-Diphenylethylene | |
| >112°C | |
| Glass bottle | |
| 1.02 | |
| Colorless | |
| 100g | |
| 97.5 | |
| 97.5% min. (GC) | |
| (C6H5)2C=CH2 | |
| 15,3356 | |
| ZMYIIHDQURVDRB-UHFFFAOYSA-N | |
| 1-phenylethenylbenzene | |
| 10740 | |
| Liquid |
| 1.0200g/mL | |
| Authentic | |
| 1.6065 to 1.6085 | |
| 270.0°C to 271.0°C | |
| 6.0°C | |
| 530-48-3 | |
| 100.0 | |
| C14H12 | |
| 05,639 | |
| 1,1-diphenylethylene, ethene-1,1-diyldibenzene, 1,1-diphenylethene, benzene, 1,1'-ethenylidenebis, 1-phenylethenyl benzene, unii-bx0l5b6lll, as-diphenylethylene, .alpha.-phenylstyrene, 1-phenylvinyl benzene, bx0l5b6lll | |
| C=C(C1=CC=CC=C1)C2=CC=CC=C2 | |
| 180.25 | |
| 180.25 | |
| 98% |