Learn More
4-tert-Butylcatechol, 99%, ACROS Organics™
Brand: Acros Organics 154350100
Additional Details : CAS Number : 98-29-3 Weight : 10.00000kg Transport : UN number : 3261 Chem class : 8 Pack group : II
| Packaging | Plastic drum |
|---|---|
| Quantity | 10kg |
Chemical Identifiers
| 98-29-3 | |
| 166.22 | |
| XESZUVZBAMCAEJ-UHFFFAOYSA-N | |
| 7381 | |
| CC(C)(C)C1=CC=C(O)C(O)=C1 |
| C10H14O2 | |
| MFCD00002201 | |
| 4-tert-butylcatechol, p-tert-butylcatechol, 4-tert-butylpyrocatechol, p-tert-butyl catechol, 4-tert-butyl benzene-1,2-diol, 4-t-butylpyrocatechol, p-tert-butylpyrocatechol, 4-t-butylcatechol, 1,2-benzenediol, 4-1,1-dimethylethyl, 4-tert-butylcatechin | |
| 4-tert-butylbenzene-1,2-diol |
Specifications
| 4-tert-Butylcatechol | |
| 129°C | |
| 1.049 | |
| 285.0°C | |
| 10kg | |
| 98-29-3 | |
| 100.0 | |
| C10H14O2 | |
| MFCD00002201 | |
| 15,54 | |
| Solubility in water: 0.2% (25°C). Other solubilities: soluble in hot water,very sol. in alcohol,ethers,esters and ketones,partly sol. in chlorinated and aromatic hydrocarb.,slightly sol. in aliphatics. 240g/100g acetone,80g/100g benzene;60g/100g | |
| CC(C)(C)C1=CC=C(O)C(O)=C1 | |
| 166.22 | |
| 166.22 | |
| Technical |
| 1.0490g/mL | |
| Plastic drum | |
| 90 mm2/s (25°C) | |
| 53.0°C to 56.0°C | |
| 99% | |
| 98.5 | |
| 0.7% max. Catechol (GC) | |
| (CH3)3CC6H3(OH)2 | |
| 06,IV,6014 | |
| 4-tert-butylcatechol, p-tert-butylcatechol, 4-tert-butylpyrocatechol, p-tert-butyl catechol, 4-tert-butyl benzene-1,2-diol, 4-t-butylpyrocatechol, p-tert-butylpyrocatechol, 4-t-butylcatechol, 1,2-benzenediol, 4-1,1-dimethylethyl, 4-tert-butylcatechin | |
| XESZUVZBAMCAEJ-UHFFFAOYSA-N | |
| 4-tert-butylbenzene-1,2-diol | |
| 7381 | |
| 99% |