Learn More
Flurbiprofen, 98%, ACROS Organics™
Brand: Acros Organics 454660250
Additional Details : CAS Number : 5104-49-4 Weight : 0.02000kg Transport : UN number : 2811 Chem class : 6.1 Pack group : III
| Quantity | 25g |
|---|
Chemical Identifiers
| 5104-49-4 | |
| 244.27 | |
| SYTBZMRGLBWNTM-UHFFFAOYNA-N | |
| 3394 | |
| 2-(3-fluoro-4-phenylphenyl)propanoic acid |
| C15H13FO2 | |
| MFCD00079303 | |
| flurbiprofen, ansaid, froben, antadys, cebutid, flurofen, anside, flurbiprofene, flurbiprofeno, flurbiprofenum | |
| CHEBI:5130 | |
| CC(C(O)=O)C1=CC=C(C(F)=C1)C1=CC=CC=C1 |
Specifications
| Flurbiprofen | |
| 110.0°C to 114.0°C | |
| 5104-49-4 | |
| C15H13FO2 | |
| 15,4229 | |
| Solubility in water: insoluble. Other solubilities: soluble in methanol, readily soluble in most polar solvents | |
| CC(C(O)=O)C1=CC=C(C(F)=C1)C1=CC=CC=C1 | |
| 244.27 | |
| CHEBI:5130 | |
| 98% |
| Authentic | |
| 25g | |
| 97.5% min. (HPLC) | |
| MFCD00079303 | |
| flurbiprofen, ansaid, froben, antadys, cebutid, flurofen, anside, flurbiprofene, flurbiprofeno, flurbiprofenum | |
| SYTBZMRGLBWNTM-UHFFFAOYNA-N | |
| 2-(3-fluoro-4-phenylphenyl)propanoic acid | |
| 3394 | |
| 244.27 |
Safety and Handling
- Flurbiprofen
Signal Word
- Danger
Hazard Category
- Acute toxicity Category 3
- Serious eye damage/eye irritation Category 2
- Skin corrosion/irritation Category 2
- Specific target organ toxicity Category 3
Hazard Statement
- H315-Causes skin irritation.
- H319-Causes serious eye irritation.
- H335-May cause respiratory irritation.
- H301-Toxic if swallowed.
Precautionary Statement
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P301+P310-IF SWALLOWED: Immediately call a POISON CENTER/doctor /