Learn More
Gliclazide, ACROS Organics™
Brand: Acros Organics 461070010
Additional Details : CAS Number : 21187-98-4 Weight : 0.00100kg
| Quantity | 1g |
|---|
Chemical Identifiers
| 21187-98-4 | |
| 323.41 | |
| gliclazide, glimicron, diamicron, nordialex, diaikron, gliclazida, gliklazid, glyclazide, gliclazidum inn-latin, gliclazida inn-spanish | |
| CHEBI:31654 | |
| CC1=CC=C(C=C1)S(=O)(=O)NC(=O)NN2CC3CCCC3C2 |
| C15H21N3O3S | |
| BOVGTQGAOIONJV-UHFFFAOYSA-N | |
| 3475 | |
| 1-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-3-(4-methylphenyl)sulfonylurea |
Specifications
| Gliclazide | |
| 0.5% max. (1 g, 105°C) | |
| 1g | |
| C15H21N3O3S | |
| Solubility in water: insoluble. Other solubilities: soluble in dmf, slightly soluble in methanol, ethanol | |
| CC1=CC=C(C=C1)S(=O)(=O)NC(=O)NN2CC3CCCC3C2 | |
| 323.41 | |
| CHEBI:31654 | |
| ≥98.5% (HPLC) |
| Authentic | |
| 163.0°C to 169.0°C | |
| 21187-98-4 | |
| gliclazide, glimicron, diamicron, nordialex, diaikron, gliclazida, gliklazid, glyclazide, gliclazidum inn-latin, gliclazida inn-spanish | |
| BOVGTQGAOIONJV-UHFFFAOYSA-N | |
| 1-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-3-(4-methylphenyl)sulfonylurea | |
| 3475 | |
| 323.41 |
Safety and Handling
- Gliclazide
Signal Word
- Warning
Hazard Category
- Reproductive toxicity Category 2
Hazard Statement
- H361-Suspected of damaging fertility or the unborn child.
Precautionary Statement
- P201-Obtain special instructions before use.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P308+P313-IF exposed or concerned: Get medical advice/attention.