Learn More
L(-)-Phenylephrine hydrochloride, 99%, ACROS Organics™
Brand: Acros Organics 207240250
Additional Details : CAS Number : 61-76-7 Weight : 0.07500kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 25g |
Chemical Identifiers
| 61-76-7 | |
| 203.67 | |
| OCYSGIYOVXAGKQ-UHFFFAOYNA-N | |
| 5284443 | |
| 3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride |
| C9H14ClNO2 | |
| MFCD00012605,MFCD00044749 | |
| phenylephrine hydrochloride, phenylephrine hcl, l-phenylephrine hydrochloride, metaoxedrine chloride, neosympatol, synethenate, almefrin, consdrin, emagrin, fenilfar | |
| CHEBI:8094 | |
| [H+].[Cl-].CNCC(O)C1=CC=CC(O)=C1 |
Specifications
| L(-)-Phenylephrine hydrochloride | |
| 1% max. (1 g, 105°C) | |
| −47° (20°C c=2,H2O) | |
| White | |
| 25g | |
| 99% | |
| HOC6H4CH(CH2NHCH3)OH·HCl | |
| 15, 7398 | |
| OCYSGIYOVXAGKQ-UHFFFAOYNA-N | |
| 3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride | |
| 5284443 | |
| 203.67 | |
| 99% |
| Authentic | |
| Glass bottle | |
| -47 | |
| 140°C to 145°C | |
| 61-76-7 | |
| C9H14ClNO2 | |
| MFCD00012605,MFCD00044749 | |
| phenylephrine hydrochloride, phenylephrine hcl, l-phenylephrine hydrochloride, metaoxedrine chloride, neosympatol, synethenate, almefrin, consdrin, emagrin, fenilfar | |
| [H+].[Cl-].CNCC(O)C1=CC=CC(O)=C1 | |
| 203.67 | |
| CHEBI:8094 | |
| Crystalline Powder |
Safety and Handling
- L(-)-Phenylephrine hydrochloride
Signal Word
- Warning
Hazard Category
- Acute toxicity Category 4
- Serious eye damage/eye irritation Category 2
- Skin corrosion/irritation Category 2
- Specific target organ toxicity Category 3
Hazard Statement
- H315-Causes skin irritation.
- H319-Causes serious eye irritation.
- H335-May cause respiratory irritation.
- H302-Harmful if swallowed.
Precautionary Statement
- P261-Avoid breathing dust/fume/gas/mist/vapours/spray.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P301+P312-IF SWALLOWED: Call a POISON CENTER or doctor/physician/ if you feel unwell.
- P302+P352-IF ON SKIN: Wash with plenty of water/.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.