Learn More
Triphenylphosphine resin, 1% crosslinked with DVB, 1.0-1.5mmol/g, 100-200 mesh, ACROS Organics™
Brand: Acros Organics 366870250
Additional Details : CAS Number : 39319-11-4 Weight : 0.07500kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 25g |
Chemical Identifiers
| 39319-11-4 | |
| 262.292 | |
| RIOQSEWOXXDEQQ-UHFFFAOYSA-N | |
| triphenylphosphane |
| C18H15P | |
| MFCD00148025 | |
| 11776 | |
| C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3 |
Specifications
| Triphenylphosphine resin | |
| 39319-11-4 | |
| 25g | |
| MFCD00148025 | |
| C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3 | |
| 262.292 | |
| 100 To 200 Mesh |
| 1% crosslinked with DVB, 1.0-1.5mmol/g | |
| Glass bottle | |
| C18H15P | |
| RIOQSEWOXXDEQQ-UHFFFAOYSA-N | |
| triphenylphosphane | |
| 11776 |