Oorganiska salter
Filtrerade sökresultat
Etynylmagnesiumbromid, 0,5 M lösning i THF, AcroSeal™ , Thermo Scientific Chemicals
CAS: 4301-14-8 Molekylformel: C2HBrMg Molekylvikt (g/mol): 129.24 MDL-nummer: MFCD00075342 InChI-nyckel: HUGJUYPSXULVQQ-UHFFFAOYSA-M Synonym: ethynylmagnesium bromide,bromo ethynyl magnesium,ethynylmagnesium bromide solution,ethinylmagnesium bromide,ethynyl magnesiumbromide,pubchem18180,ethynyl-magnesium bromide,ethinyl magnesium bromide,ethynyl magnesium bromide,hugjuypsxulvqq-uhfffaoysa-m,grignard reagent PubChem CID: 4071243 IUPAC-namn: brom(etynyl)magnesium LEDER: Br[Mg]C#C
| Molekylformel | C2HBrMg |
|---|---|
| PubChem CID | 4071243 |
| MDL-nummer | MFCD00075342 |
| IUPAC-namn | brom(etynyl)magnesium |
| CAS | 4301-14-8 |
| InChI-nyckel | HUGJUYPSXULVQQ-UHFFFAOYSA-M |
| LEDER | Br[Mg]C#C |
| Molekylvikt (g/mol) | 129.24 |
| Synonym | ethynylmagnesium bromide,bromo ethynyl magnesium,ethynylmagnesium bromide solution,ethinylmagnesium bromide,ethynyl magnesiumbromide,pubchem18180,ethynyl-magnesium bromide,ethinyl magnesium bromide,ethynyl magnesium bromide,hugjuypsxulvqq-uhfffaoysa-m,grignard reagent |
| Densitet | 0.8870g/mL |
|---|---|
| Molekylformel | C16H36FN |
| MDL-nummer | MFCD00011747 |
| Formel vikt | 261.46 |
| IUPAC-namn | tetrabutylazanium;fluorid |
| InChI-nyckel | FPGGTKZVZWFYPV-UHFFFAOYSA-M |
| Hälsofara 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Wear protective gloves/protective clothing/eye p |
| ChEBI | CHEBI:51990 |
| Hälsofara 2 | GHS H Statement Causes severe skin burns and eye damage. Suspected of causing cancer. May cause respiratory irritation. Highly flammable liquid and vapor. May form explosive peroxides. May cause drowsiness or dizzines |
| Hälsofara 1 | GHS-signalord: Fara |
| Merck Index | 15,9332 |
| Fysisk form | Lösning |
| Koncentration eller sammansättning (efter analyt eller komponenter) | 0.90 to 1.10M |
| Färg | Brun till grön |
| PubChem CID | 2724141 |
| Flampunkt | −17°C |
| Linjär formel | [CH3(CH2)3]4NF |
| CAS | 7732-18-5 |
| LEDER | [F-].CCCC[N+](CCCC)(CCCC)CCCC |
| Molekylvikt (g/mol) | 261.47 |
| EINECS-nummer | 207-057-2 |
| Synonym | tetrabutylammonium fluoride,tbaf,tetrabutylazanium fluoride,tetrabutyl ammonium fluoride,tetra-n-butylammonium fluoride,tetrabutylamine, fluoride,n,n,n-tributylbutan-1-aminium fluoride,1-butanaminium, n,n,n-tributyl-, fluoride,n,n,n-tributyl-1-butanaminium fluoride,1-butanaminium, n,n,n-tributyl-, fluoride 1:1 |
Natriumetoxid, 21 % i etanol, AcroSeal™ , Thermo Scientific Chemicals
CAS: 141-52-6 Molekylformel: C2H5NaO Molekylvikt (g/mol): 68.04 MDL-nummer: MFCD00012417 InChI-nyckel: QDRKDTQENPPHOJ-UHFFFAOYSA-N Synonym: sodium ethoxide,sodium ethylate,sodium ethanolate,sodiumethoxide,ethoxysodium,ethanol, sodium salt,caustic alcohol,naoet,etona,ethanol, sodium salt 1:1 PubChem CID: 2723922 ChEBI: CHEBI:52096 IUPAC-namn: natrium;etanolat LEDER: CC[O-].[Na+]
| Molekylformel | C2H5NaO |
|---|---|
| PubChem CID | 2723922 |
| MDL-nummer | MFCD00012417 |
| IUPAC-namn | natrium;etanolat |
| CAS | 141-52-6 |
| InChI-nyckel | QDRKDTQENPPHOJ-UHFFFAOYSA-N |
| LEDER | CC[O-].[Na+] |
| ChEBI | CHEBI:52096 |
| Molekylvikt (g/mol) | 68.04 |
| Synonym | sodium ethoxide,sodium ethylate,sodium ethanolate,sodiumethoxide,ethoxysodium,ethanol, sodium salt,caustic alcohol,naoet,etona,ethanol, sodium salt 1:1 |
Trietylsilan, 99 %, AcroSeal™ , Thermo Scientific Chemicals
CAS: 617-86-7 Molekylformel: C6H16Si Molekylvikt (g/mol): 116.28 InChI-nyckel: QXTIBZLKQPJVII-UHFFFAOYSA-N Synonym: triethylsilane,hydride,silane, triethyl,triethylhydrosilane,triethylsilyl,silane e3h,c6h16si,triethylsilyl radical,silane, triethyl-,,triethylsilane tes PubChem CID: 6327258 IUPAC-namn: trietylkisel LEDER: CC[Si](CC)CC
| Molekylformel | C6H16Si |
|---|---|
| PubChem CID | 6327258 |
| IUPAC-namn | trietylkisel |
| CAS | 617-86-7 |
| InChI-nyckel | QXTIBZLKQPJVII-UHFFFAOYSA-N |
| LEDER | CC[Si](CC)CC |
| Molekylvikt (g/mol) | 116.28 |
| Synonym | triethylsilane,hydride,silane, triethyl,triethylhydrosilane,triethylsilyl,silane e3h,c6h16si,triethylsilyl radical,silane, triethyl-,,triethylsilane tes |
Sodium methoxide, 5.4M (30 wt.%) solution in methanol, AcroSeal™
CAS: 124-41-4 Molekylformel: CH3NaO Molekylvikt (g/mol): 54.02 MDL-nummer: MFCD00012179 InChI-nyckel: WQDUMFSSJAZKTM-UHFFFAOYSA-N Synonym: sodium methanolate,sodium methoxide,sodium methylate,methoxysodium,methanol, sodium salt,feldalat nm,metilato sodico spanish,unii-ig663u5emc,methylate de sodium french,hsdb 755 PubChem CID: 10942334 IUPAC-namn: natrium;metanolat LEDER: C[O-].[Na+]
| Molekylformel | CH3NaO |
|---|---|
| PubChem CID | 10942334 |
| MDL-nummer | MFCD00012179 |
| IUPAC-namn | natrium;metanolat |
| CAS | 124-41-4 |
| InChI-nyckel | WQDUMFSSJAZKTM-UHFFFAOYSA-N |
| LEDER | C[O-].[Na+] |
| Molekylvikt (g/mol) | 54.02 |
| Synonym | sodium methanolate,sodium methoxide,sodium methylate,methoxysodium,methanol, sodium salt,feldalat nm,metilato sodico spanish,unii-ig663u5emc,methylate de sodium french,hsdb 755 |
| Densitet | 0.8700g/mL |
|---|---|
| Molekylformel | BF3 |
| MDL-nummer | MFCD00011316 |
| Formel vikt | 67.81 |
| IUPAC-namn | trifluorboran |
| InChI-nyckel | WTEOIRVLGSZEPR-UHFFFAOYSA-N |
| Hälsofara 3 | GHS P Statement IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. Wear protective gloves/protective |
| Hälsofara 2 | GHS H Statement Highly flammable liquid and vapor. Causes severe skin burns and eye damage. Fatal if inhaled. Toxic if swallowed. Reacts violently with water. Toxic in contact with skin. Causes damage to organs |
| Hälsofara 1 | GHS-signalord: Fara |
| Kokpunkt | 65.0°C |
| Löslighetsinformation | Solubility in water: may decompose |
| PubChem CID | 11062313 |
| Förpackning | AcroSeal™ Glasflaska |
| Flampunkt | 4°C |
| Smältpunkt | -98.0°C |
| Linjär formel | BF3 |
| CAS | 67-56-1 |
| LEDER | FB(F)F |
| Molekylvikt (g/mol) | 67.81 |
| EINECS-nummer | 206-766-4 |
| Synonym | boron trifluoride-methanol solution,boron trifluoride-methanol complex,boron trifluoride methanol,boron trifluoride-methanol solution in methanol,bf3 methanol,.bf3 in methanol,boron fluoride methanol,bf3 meoh,borontrifluoride methanol,boron trifluoride solution |
| Kemiskt namn eller material | Boron trifluoride |
| Densitet | 1.0700g/mL |
|---|---|
| Molekylformel | Cl2Zn |
| MDL-nummer | MFCD00011295 |
| Formel vikt | 136.29 |
| IUPAC-namn | diklorosink |
| InChI-nyckel | JIAARYAFYJHUJI-UHFFFAOYSA-L |
| Hälsofara 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsi |
| ChEBI | CHEBI:49976 |
| Hälsofara 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if swallowed. May cause respiratory irritation. Very toxic to aquatic life with long lasting effects. Highly flammable liquid and vapor. May form explos |
| Hälsofara 1 | GHS-signalord: Fara |
| Merck Index | 15, 10331 |
| Fysisk form | Vätska |
| Koncentration eller sammansättning (efter analyt eller komponenter) | 23 to 27% |
| Färg | Färglös |
| PubChem CID | 5727 |
| Flampunkt | −11°C |
| Linjär formel | ZnCl2 |
| CAS | 96-47-9 |
| Namnnotering | 2M solution in 2-Methyltetrahydrofuran |
| LEDER | Cl[Zn]Cl |
| Molekylvikt (g/mol) | 136.29 |
| EINECS-nummer | 231-592- |
| Synonym | zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride |
| Kemiskt namn eller material | Zinc chloride |
| Formel vikt | 136.3 |
|---|---|
| IUPAC-namn | diklorosink |
| InChI-nyckel | JIAARYAFYJHUJI-UHFFFAOYSA-L |
| Hälsofara 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Wear protective gloves/protective clothing/eye p |
| ChEBI | CHEBI:49976 |
| Hälsofara 2 | GHS H Statement Causes severe skin burns and eye damage. Very toxic to aquatic life with long lasting effects. Highly flammable liquid and vapor. Suspected of causing cancer. May cause respiratory irritation. May form |
| Hälsofara 1 | GHS-signalord: Fara |
| Koncentration eller sammansättning (efter analyt eller komponenter) | 0.65 to 0.8M (argentometry) |
| PubChem CID | 5727 |
| Förpackning | AcroSeal™ Glasflaska |
| Linjär formel | ZnCl2 |
| LEDER | Cl[Zn]Cl |
| Molekylvikt (g/mol) | 136.3 |
| Densitet | 0.9800g/mL |
| Molekylformel | Cl2Zn |
| MDL-nummer | MFCD00011295 |
| Kokpunkt | 66.0°C |
| Löslighetsinformation | Solubility in water: miscible |
| Merck Index | 15, 10331 |
| Fysisk form | Vätska |
| Färg | Rött |
| Flampunkt | −22°C |
| CAS | 109-99-9 |
| EINECS-nummer | 231-592- |
| Synonym | zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride |
| Kemiskt namn eller material | Zinc chloride |
Propargyl bromide, 80wt.% solution in toluene, stabilized, AcroSeal™
CAS: 106-96-7 | C3H3Br | 118.96 g/mol
| Formel vikt | 118.96 |
|---|---|
| IUPAC-namn | 3-bromprop-1-yn |
| InChI-nyckel | YORCIIVHUBAYBQ-UHFFFAOYSA-N |
| Hälsofara 3 | GHS P Statement Use personal protective equipment as required. Avoid breathing dust/fume/gas/mist/vapors/spray. Do not breathe dust/fume/gas/mist/vapors/spray. IF SWALLOWED: Immediately call a POISON CENTRE or doctor/physician. Do NOT induce vomiting. IF INHALED: Remove victim to fresh air and keep at rest in a position comfortable for breathing. IF ON SKIN: Wash with plenty of soap and water. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Ground/Bond container and receiving equipment. |
| Hälsofara 2 | GHS H Statement May cause damage to organs through prolonged or repeated exposure. Suspected of damaging fertility or the unborn child. May cause drowsiness or dizziness. May be fatal if swallowed and enters airways. Causes severe skin burns and eye damage. Toxic if swallowed. Highly flammable liquid and vapor. |
| Hälsofara 1 | GHS-signalord: Fara |
| PubChem CID | 7842 |
| Förpackning | AcroSeal™ Glasflaska |
| Linjär formel | HC≡CCH2Br |
| Namnnotering | Stabilized |
| LEDER | C#CCBr |
| Molekylvikt (g/mol) | 118.96 |
| Densitet | 1.3800g/mL |
| Molekylformel | C3H3Br |
| MDL-nummer | MFCD00000241 |
| Brytningsindex | 1.4900 to 1.4960 |
| Kokpunkt | 88.0°C to 90.0°C |
| Löslighetsinformation | Solubility in water: immiscible |
| Fysisk form | Kristallint pulver |
| Färg | Vitt till gult |
| Flampunkt | 4°C |
| CAS | 108-88-3 |
| EINECS-nummer | 203-447-1 |
| Synonym | propargyl bromide,3-bromopropyne,3-bromo-1-propyne,1-propyne, 3-bromo,2-propynyl bromide,propynyl bromide,1-bromo-2-propyne,propyne, 3-bromo,gamma-bromoallylene,1-brom-2-propin |
| Kemiskt namn eller material | Propargyl bromide |
| Procent renhet | 73 to 87% (propargyl bromide) (GC), 13 to 27% (toluene) (GC) |
Potassium trimethylsilanolate, 2M solution in THF, AcroSeal™
CAS: 10519-96-7 Molekylformel: C3H10KOSi Molekylvikt (g/mol): 129.30 MDL-nummer: MFCD00013421 InChI-nyckel: COTHYYYVPUZALV-UHFFFAOYSA-N Synonym: potassium trimethylsilanolate,trimethylsiloxypotassium,silanol, trimethyl-, potassium salt,trimethylsilanol potassium salt,potassium trimethyl silanolate,silanol, 1,1,1-trimethyl-, potassium salt 1:1,kosime3,kotms,tmsok,c3h9osi.k PubChem CID: 23668039 LEDER: [K].C[Si](C)(C)O
| Molekylformel | C3H10KOSi |
|---|---|
| PubChem CID | 23668039 |
| MDL-nummer | MFCD00013421 |
| CAS | 10519-96-7 |
| InChI-nyckel | COTHYYYVPUZALV-UHFFFAOYSA-N |
| LEDER | [K].C[Si](C)(C)O |
| Molekylvikt (g/mol) | 129.30 |
| Synonym | potassium trimethylsilanolate,trimethylsiloxypotassium,silanol, trimethyl-, potassium salt,trimethylsilanol potassium salt,potassium trimethyl silanolate,silanol, 1,1,1-trimethyl-, potassium salt 1:1,kosime3,kotms,tmsok,c3h9osi.k |
| Densitet | 0.9150g/mL |
|---|---|
| Molekylformel | CH3BNNa |
| MDL-nummer | MFCD00003516 |
| Formel vikt | 62.84 |
| IUPAC-namn | natrium;cyanobor(1-) |
| InChI-nyckel | CVDUGUOQTVTBJH-UHFFFAOYSA-N |
| Hälsofara 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Wear protective gloves/protective clothing/eye p |
| Hälsofara 2 | GHS H Statement Highly flammable liquid and vapor. Toxic in contact with skin. Toxic if swallowed. Toxic if inhaled. May cause respiratory irritation. Causes severe skin burns and eye damage. Suspected of causin |
| Hälsofara 1 | GHS-signalord: Fara |
| Utseende | Clear colorless solution |
| Löslighetsinformation | Solubility in water: reacts. Other solubilities: soluble in methanol; soluble in thf, 372g/L, at 28°C, 410g/L at 46°C, 422g/L at 62°C, soluble in diglyme 176g/L at 25°C, slightly soluble in ethanol, insoluble in ether, benzene, hexane |
| Merck Index | 15, 8742 |
| PubChem CID | 20587905 |
| Flampunkt | −18°C |
| Linjär formel | NaBH3CN |
| CAS | 109-99-9 |
| Namnnotering | 1M solution in THF |
| LEDER | [Na+].[BH3-]C#N |
| Molekylvikt (g/mol) | 62.84 |
| EINECS-nummer | 247-317-2 |
| Synonym | sodium cyanoborohydride,sodium cyanotrihydridoborate,unii-c4i8c58p9t,zlchem 216,sodium cyanoboron 1- |
| Kemiskt namn eller material | Sodium cyanoborohydride |
Titan(IV)klorid, 1M lösning i diklormetan, AcroSeal™ , Thermo Scientific Chemicals
CAS: 7550-45-0 | Cl4Ti | 189.71 g/mol
| Densitet | 1.3650g/mL |
|---|---|
| Molekylformel | Cl4Ti |
| MDL-nummer | MFCD00011267 |
| Formel vikt | 189.71 |
| IUPAC-namn | titan(4+);tetraklorid |
| InChI-nyckel | XJDNKRIXUMDJCW-UHFFFAOYSA-J |
| Hälsofara 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: Rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if pre |
| Hälsofara 2 | GHS H Statement Causes severe skin burns and eye damage. Suspected of causing cancer if inhaled. Toxic if inhaled. May cause drowsiness or dizziness. May cause respiratory irritation. Reacts violently with water. |
| Hälsofara 1 | GHS-signalord: Fara |
| Löslighetsinformation | Solubility in water: reacts |
| Merck Index | 15, 9634 |
| Fysisk form | Lösning |
| Koncentration eller sammansättning (efter analyt eller komponenter) | 0.95 to 1.10M |
| Färg | Brun till gul |
| PubChem CID | 160960 |
| CAS | 75-09-2 |
| Namnnotering | 1M Solution in Dichloromethane |
| LEDER | [Cl-].[Cl-].[Cl-].[Cl-].[Ti+4] |
| Molekylvikt (g/mol) | 189.71 |
| EINECS-nummer | 231-441-9 |
| Synonym | titanium iv chloride,titanium 4+ tetrachloride,acmc-1bjgv,titanium 4+ ion tetrachloride,parent,titanium +4 cation tetrachloride,titanium iv chloride 100ml,superlist names titanium chloride, t-4,titanic chloride; titanio tetracloruro di,unii-8o3pje5t7q; titanium chloride ticl4 |
| Kemiskt namn eller material | Titanium(IV) chloride |
Sodium methoxide, ACS reagent, 0.5M solution in methanol, AcroSeal™
CAS: 124-41-4 Molekylformel: CH3NaO Molekylvikt (g/mol): 54.02 MDL-nummer: MFCD00012179 InChI-nyckel: WQDUMFSSJAZKTM-UHFFFAOYSA-N Synonym: sodium methanolate,sodium methoxide,sodium methylate,methoxysodium,methanol, sodium salt,feldalat nm,metilato sodico spanish,unii-ig663u5emc,methylate de sodium french,hsdb 755 PubChem CID: 10942334 IUPAC-namn: natrium;metanolat LEDER: C[O-].[Na+]
| Molekylformel | CH3NaO |
|---|---|
| PubChem CID | 10942334 |
| MDL-nummer | MFCD00012179 |
| IUPAC-namn | natrium;metanolat |
| CAS | 124-41-4 |
| InChI-nyckel | WQDUMFSSJAZKTM-UHFFFAOYSA-N |
| LEDER | C[O-].[Na+] |
| Molekylvikt (g/mol) | 54.02 |
| Synonym | sodium methanolate,sodium methoxide,sodium methylate,methoxysodium,methanol, sodium salt,feldalat nm,metilato sodico spanish,unii-ig663u5emc,methylate de sodium french,hsdb 755 |