Akrylsyror och derivat
Filtrerade sökresultat
1,1,1,3,3,3-hexafluorisopropylakrylat, 98+%, stab. med 50 ppm 4-metoxifenol, Thermo Scientific Chemicals
CAS: 2160-89-6 Molekylformel: C6H4F6O2 Molekylvikt (g/mol): 222.09 MDL-nummer: MFCD00040104 InChI-nyckel: MNSWITGNWZSAMC-UHFFFAOYSA-N Synonym: 1,1,1,3,3,3-hexafluoroisopropyl acrylate,hexafluoroisopropyl acrylate,1,1,1,3,3,3-hexafluoropropan-2-yl acrylate,2-propenoic acid, 2,2,2-trifluoro-1-trifluoromethyl ethyl ester,acrylic acid 1,1,1,3,3,3-hexafluoroisopropyl ester,hexafluoro-2-propyl acrylate,mnswitgnwzsamc-uhfffaoysa,1h-1-trifluoromethyl trifluoroethyl acrylate PubChem CID: 75096 IUPAC-namn: 1,1,1,3,3,3-hexafluorpropan-2-ylprop-2-enoat LEDER: FC(F)(F)C(OC(=O)C=C)C(F)(F)F
| Molekylformel | C6H4F6O2 |
|---|---|
| PubChem CID | 75096 |
| MDL-nummer | MFCD00040104 |
| IUPAC-namn | 1,1,1,3,3,3-hexafluorpropan-2-ylprop-2-enoat |
| CAS | 2160-89-6 |
| InChI-nyckel | MNSWITGNWZSAMC-UHFFFAOYSA-N |
| LEDER | FC(F)(F)C(OC(=O)C=C)C(F)(F)F |
| Molekylvikt (g/mol) | 222.09 |
| Synonym | 1,1,1,3,3,3-hexafluoroisopropyl acrylate,hexafluoroisopropyl acrylate,1,1,1,3,3,3-hexafluoropropan-2-yl acrylate,2-propenoic acid, 2,2,2-trifluoro-1-trifluoromethyl ethyl ester,acrylic acid 1,1,1,3,3,3-hexafluoroisopropyl ester,hexafluoro-2-propyl acrylate,mnswitgnwzsamc-uhfffaoysa,1h-1-trifluoromethyl trifluoroethyl acrylate |
Akrylsyra, 98%, extra ren, stabiliserad, Thermo Scientific Chemicals
CAS: 79-10-7 Molekylformel: C3H4O2 Molekylvikt (g/mol): 72.06 MDL-nummer: MFCD00004367 InChI-nyckel: NIXOWILDQLNWCW-UHFFFAOYSA-N Synonym: acrylic acid,2-propenoic acid,propenoic acid,vinylformic acid,acroleic acid,propene acid,ethylenecarboxylic acid,polyacrylate,propenoate,carbomer PubChem CID: 6581 ChEBI: CHEBI:18308 IUPAC-namn: prop-2-ensyra LEDER: C=CC(=O)O
| Molekylformel | C3H4O2 |
|---|---|
| PubChem CID | 6581 |
| MDL-nummer | MFCD00004367 |
| IUPAC-namn | prop-2-ensyra |
| CAS | 79-10-7 |
| InChI-nyckel | NIXOWILDQLNWCW-UHFFFAOYSA-N |
| LEDER | C=CC(=O)O |
| ChEBI | CHEBI:18308 |
| Molekylvikt (g/mol) | 72.06 |
| Synonym | acrylic acid,2-propenoic acid,propenoic acid,vinylformic acid,acroleic acid,propene acid,ethylenecarboxylic acid,polyacrylate,propenoate,carbomer |
Metylakrylat, 99%, stabiliserat, Thermo Scientific Chemicals
CAS: 96-33-3 Molekylformel: C4H6O2 Molekylvikt (g/mol): 86.09 MDL-nummer: MFCD00008627 InChI-nyckel: BAPJBEWLBFYGME-UHFFFAOYSA-N Synonym: methyl acrylate,methylacrylate,acrylic acid methyl ester,2-propenoic acid, methyl ester,methyl 2-propenoate,methyl propenoate,methylacrylaat,metilacrilato,methyl-acrylat,methoxycarbonylethylene PubChem CID: 7294 ChEBI: CHEBI:82482 IUPAC-namn: metylprop-2-enoat LEDER: COC(=O)C=C
| Molekylformel | C4H6O2 |
|---|---|
| PubChem CID | 7294 |
| MDL-nummer | MFCD00008627 |
| IUPAC-namn | metylprop-2-enoat |
| CAS | 96-33-3 |
| InChI-nyckel | BAPJBEWLBFYGME-UHFFFAOYSA-N |
| LEDER | COC(=O)C=C |
| ChEBI | CHEBI:82482 |
| Molekylvikt (g/mol) | 86.09 |
| Synonym | methyl acrylate,methylacrylate,acrylic acid methyl ester,2-propenoic acid, methyl ester,methyl 2-propenoate,methyl propenoate,methylacrylaat,metilacrilato,methyl-acrylat,methoxycarbonylethylene |
Ethyl acrylate, 99.5%, stabilized
CAS: 140-88-5 Molekylformel: C5H8O2 Molekylvikt (g/mol): 100.12 MDL-nummer: MFCD00009188 InChI-nyckel: JIGUQPWFLRLWPJ-UHFFFAOYSA-N Synonym: ethyl acrylate,acrylic acid ethyl ester,ethyl propenoate,2-propenoic acid, ethyl ester,ethyl 2-propenoate,ethylacrylaat,ethylakrylat,etil acrilato,acrylic acid, ethyl ester,aethylacrylat PubChem CID: 8821 ChEBI: CHEBI:82327 IUPAC-namn: etylprop-2-enoat LEDER: CCOC(=O)C=C
| Molekylformel | C5H8O2 |
|---|---|
| PubChem CID | 8821 |
| MDL-nummer | MFCD00009188 |
| IUPAC-namn | etylprop-2-enoat |
| CAS | 140-88-5 |
| InChI-nyckel | JIGUQPWFLRLWPJ-UHFFFAOYSA-N |
| LEDER | CCOC(=O)C=C |
| ChEBI | CHEBI:82327 |
| Molekylvikt (g/mol) | 100.12 |
| Synonym | ethyl acrylate,acrylic acid ethyl ester,ethyl propenoate,2-propenoic acid, ethyl ester,ethyl 2-propenoate,ethylacrylaat,ethylakrylat,etil acrilato,acrylic acid, ethyl ester,aethylacrylat |
Butyl acrylate, 99+%, stabilized
CAS: 141-32-2 Molekylformel: C7H12O2 Molekylvikt (g/mol): 128.17 MDL-nummer: MFCD00009446 InChI-nyckel: CQEYYJKEWSMYFG-UHFFFAOYSA-N Synonym: butyl acrylate,n-butyl acrylate,acrylic acid butyl ester,n-butyl propenoate,2-propenoic acid, butyl ester,butyl 2-propenoate,butylacrylate,acrylic acid, butyl ester,acrylic acid n-butyl ester,butylester kyseliny akrylove PubChem CID: 8846 ChEBI: CHEBI:3245 IUPAC-namn: butylprop-2-enoat LEDER: CCCCOC(=O)C=C
| Molekylformel | C7H12O2 |
|---|---|
| PubChem CID | 8846 |
| MDL-nummer | MFCD00009446 |
| IUPAC-namn | butylprop-2-enoat |
| CAS | 141-32-2 |
| InChI-nyckel | CQEYYJKEWSMYFG-UHFFFAOYSA-N |
| LEDER | CCCCOC(=O)C=C |
| ChEBI | CHEBI:3245 |
| Molekylvikt (g/mol) | 128.17 |
| Synonym | butyl acrylate,n-butyl acrylate,acrylic acid butyl ester,n-butyl propenoate,2-propenoic acid, butyl ester,butyl 2-propenoate,butylacrylate,acrylic acid, butyl ester,acrylic acid n-butyl ester,butylester kyseliny akrylove |
Etylendiakrylat, 95%, stabiliserat, Thermo Scientific Chemicals
CAS: 2274-11-5 Molekylformel: C8H10O4 Molekylvikt (g/mol): 170.17 MDL-nummer: MFCD00008629 InChI-nyckel: KUDUQBURMYMBIJ-UHFFFAOYSA-N LEDER: C=CC(=O)OCCOC(=O)C=C
| Molekylformel | C8H10O4 |
|---|---|
| MDL-nummer | MFCD00008629 |
| CAS | 2274-11-5 |
| InChI-nyckel | KUDUQBURMYMBIJ-UHFFFAOYSA-N |
| LEDER | C=CC(=O)OCCOC(=O)C=C |
| Molekylvikt (g/mol) | 170.17 |
tert-Butyl acrylate, 99%, stabilized
CAS: 1663-39-4 Molekylformel: C7H12O2 Molekylvikt (g/mol): 128.17 MDL-nummer: MFCD00008809 InChI-nyckel: ISXSCDLOGDJUNJ-UHFFFAOYSA-N Synonym: tert-butyl acrylate,t-butyl acrylate,tert-butyl propenoate,2-propenoic acid, 1,1-dimethylethyl ester,acrylic acid tert-butyl ester,tert-butylacrylate,acrylic acid, tert-butyl ester,unii-92m2cd1o3g,ccris 7035,2-propenoic acid tert-butyl ester PubChem CID: 15458 IUPAC-namn: tert-butylprop-2-enoat LEDER: CC(C)(C)OC(=O)C=C
| Molekylformel | C7H12O2 |
|---|---|
| PubChem CID | 15458 |
| MDL-nummer | MFCD00008809 |
| IUPAC-namn | tert-butylprop-2-enoat |
| CAS | 1663-39-4 |
| InChI-nyckel | ISXSCDLOGDJUNJ-UHFFFAOYSA-N |
| LEDER | CC(C)(C)OC(=O)C=C |
| Molekylvikt (g/mol) | 128.17 |
| Synonym | tert-butyl acrylate,t-butyl acrylate,tert-butyl propenoate,2-propenoic acid, 1,1-dimethylethyl ester,acrylic acid tert-butyl ester,tert-butylacrylate,acrylic acid, tert-butyl ester,unii-92m2cd1o3g,ccris 7035,2-propenoic acid tert-butyl ester |
2-Ethylhexyl acrylate, 99+%, stabilized
CAS: 103-11-7 Molekylformel: C11H20O2 Molekylvikt (g/mol): 184.28 MDL-nummer: MFCD00009495 InChI-nyckel: GOXQRTZXKQZDDN-UHFFFAOYSA-N Synonym: 2-ethylhexyl acrylate,2-propenoic acid, 2-ethylhexyl ester,2-ethyl-1-hexyl acrylate,2-ethylhexyl 2-propenoate,acrylic acid, 2-ethylhexyl ester,2-ethylhexylacrylate,acrylic acid 2-ethylhexyl ester,1-hexanol, 2-ethyl-, acrylate,ccris 3430,2-ethylhexylester kyseliny akrylove PubChem CID: 7636 ChEBI: CHEBI:82465 IUPAC-namn: 2-etylhexylprop-2-enoat LEDER: CCCCC(CC)COC(=O)C=C
| Molekylformel | C11H20O2 |
|---|---|
| PubChem CID | 7636 |
| MDL-nummer | MFCD00009495 |
| IUPAC-namn | 2-etylhexylprop-2-enoat |
| CAS | 103-11-7 |
| InChI-nyckel | GOXQRTZXKQZDDN-UHFFFAOYSA-N |
| LEDER | CCCCC(CC)COC(=O)C=C |
| ChEBI | CHEBI:82465 |
| Molekylvikt (g/mol) | 184.28 |
| Synonym | 2-ethylhexyl acrylate,2-propenoic acid, 2-ethylhexyl ester,2-ethyl-1-hexyl acrylate,2-ethylhexyl 2-propenoate,acrylic acid, 2-ethylhexyl ester,2-ethylhexylacrylate,acrylic acid 2-ethylhexyl ester,1-hexanol, 2-ethyl-, acrylate,ccris 3430,2-ethylhexylester kyseliny akrylove |
2-Hydroxyethyl acrylate, 97%, stabilized
CAS: 818-61-1 Molekylformel: C5H8O3 Molekylvikt (g/mol): 116.12 MDL-nummer: MFCD00002865 InChI-nyckel: OMIGHNLMNHATMP-UHFFFAOYSA-N Synonym: 2-hydroxyethyl acrylate,hydroxyethyl acrylate,2-propenoic acid, 2-hydroxyethyl ester,ethylene glycol monoacrylate,bisomer 2hea,acrylic acid 2-hydroxyethyl ester,2-acryloyloxy ethanol,ethylene glycol, acrylate,acrylic acid, 2-hydroxyethyl ester,2-hydroxyethylacrylate PubChem CID: 13165 IUPAC-namn: 2-hydroxietylprop-2-enoat LEDER: C=CC(=O)OCCO
| Molekylformel | C5H8O3 |
|---|---|
| PubChem CID | 13165 |
| MDL-nummer | MFCD00002865 |
| IUPAC-namn | 2-hydroxietylprop-2-enoat |
| CAS | 818-61-1 |
| InChI-nyckel | OMIGHNLMNHATMP-UHFFFAOYSA-N |
| LEDER | C=CC(=O)OCCO |
| Molekylvikt (g/mol) | 116.12 |
| Synonym | 2-hydroxyethyl acrylate,hydroxyethyl acrylate,2-propenoic acid, 2-hydroxyethyl ester,ethylene glycol monoacrylate,bisomer 2hea,acrylic acid 2-hydroxyethyl ester,2-acryloyloxy ethanol,ethylene glycol, acrylate,acrylic acid, 2-hydroxyethyl ester,2-hydroxyethylacrylate |
1H,1H,2H,2H-heptadekafluordecylakrylat, 97%, stabiliserat, Thermo Scientific Chemicals
3-(Trimethoxysilyl)propyl acrylate, 90%, stabilized
CAS: 4369-14-6 Molekylformel: C9H18O5Si Molekylvikt (g/mol): 234.32 MDL-nummer: MFCD00054803 InChI-nyckel: KBQVDAIIQCXKPI-UHFFFAOYSA-N Synonym: 3-trimethoxysilyl propyl acrylate,3-acryloyloxy propyltrimethoxysilane,3-acryloxypropyltrimethoxysilane,2-propenoic acid, 3-trimethoxysilyl propyl ester,3-acryloxypropyl trimethoxysilane,3-trimethoxysilyl propyl 2-propenoate,3-acryloyloxypropyltrimethoxysilane,3-acryloxypropyltrimethoxysilane, stab. with 100ppm bht,acmc-1aoz6,acrylic acid, 3-trimethoxysilyl propyl ester PubChem CID: 151204 IUPAC-namn: 3-trimetoxisilylpropylprop-2-enoat LEDER: CO[Si](CCCOC(=O)C=C)(OC)OC
| Molekylformel | C9H18O5Si |
|---|---|
| PubChem CID | 151204 |
| MDL-nummer | MFCD00054803 |
| IUPAC-namn | 3-trimetoxisilylpropylprop-2-enoat |
| CAS | 4369-14-6 |
| InChI-nyckel | KBQVDAIIQCXKPI-UHFFFAOYSA-N |
| LEDER | CO[Si](CCCOC(=O)C=C)(OC)OC |
| Molekylvikt (g/mol) | 234.32 |
| Synonym | 3-trimethoxysilyl propyl acrylate,3-acryloyloxy propyltrimethoxysilane,3-acryloxypropyltrimethoxysilane,2-propenoic acid, 3-trimethoxysilyl propyl ester,3-acryloxypropyl trimethoxysilane,3-trimethoxysilyl propyl 2-propenoate,3-acryloyloxypropyltrimethoxysilane,3-acryloxypropyltrimethoxysilane, stab. with 100ppm bht,acmc-1aoz6,acrylic acid, 3-trimethoxysilyl propyl ester |
Poly(acrylamide), carboxyl modified, high carboxyl content, approx. MW 100,000, Thermo Scientific Chemicals
CAS: 62649-23-4 Molekylformel: (C3H5NO)n Molekylvikt (g/mol): 237.19 MDL-nummer: MFCD00084393 InChI-nyckel: DTBMFUOWAASNDB-UHFFFAOYSA-M Synonym: 2-propenamide, polymer with 2-propenoic acid and sodium 2-propenoate,sodium acrylamide acrylic acid acrylate PubChem CID: 23696299 IUPAC-namn: sodium;prop-2-enamide;prop-2-enoate;prop-2-enoic acid LEDER: NC(=O)C(-*)C-*
| Molekylformel | (C3H5NO)n |
|---|---|
| PubChem CID | 23696299 |
| MDL-nummer | MFCD00084393 |
| IUPAC-namn | sodium;prop-2-enamide;prop-2-enoate;prop-2-enoic acid |
| CAS | 62649-23-4 |
| InChI-nyckel | DTBMFUOWAASNDB-UHFFFAOYSA-M |
| LEDER | NC(=O)C(-*)C-* |
| Molekylvikt (g/mol) | 237.19 |
| Synonym | 2-propenamide, polymer with 2-propenoic acid and sodium 2-propenoate,sodium acrylamide acrylic acid acrylate |
Ethylene glycol methyl ether acrylate, 98%, stabilized
CAS: 3121-61-7 Molekylformel: C6H10O3 Molekylvikt (g/mol): 130.14 MDL-nummer: MFCD00048149,MFCD00803685 InChI-nyckel: HFCUBKYHMMPGBY-UHFFFAOYSA-N Synonym: 2-methoxyethyl acrylate,methoxyethyl acrylate,2-methoxyethoxy acrylate,2-propenoic acid, 2-methoxyethyl ester,methyl cellosolve acrylate,2-methoxyethanol, acrylate,ethylene glycol monomethyl ether acrylate,acrylic acid, 2-methoxyethyl ester,ethylene glycol methyl ether acrylate,sipomer mca PubChem CID: 18392 IUPAC-namn: 2-metoxietylprop-2-enoat LEDER: COCCOC(=O)C=C
| Molekylformel | C6H10O3 |
|---|---|
| PubChem CID | 18392 |
| MDL-nummer | MFCD00048149,MFCD00803685 |
| IUPAC-namn | 2-metoxietylprop-2-enoat |
| CAS | 3121-61-7 |
| InChI-nyckel | HFCUBKYHMMPGBY-UHFFFAOYSA-N |
| LEDER | COCCOC(=O)C=C |
| Molekylvikt (g/mol) | 130.14 |
| Synonym | 2-methoxyethyl acrylate,methoxyethyl acrylate,2-methoxyethoxy acrylate,2-propenoic acid, 2-methoxyethyl ester,methyl cellosolve acrylate,2-methoxyethanol, acrylate,ethylene glycol monomethyl ether acrylate,acrylic acid, 2-methoxyethyl ester,ethylene glycol methyl ether acrylate,sipomer mca |