Azobensener
Filtrerade sökresultat
4,4'-Diaminoazobenzene, 95%
CAS: 538-41-0 Molekylformel: C12H12N4 Molekylvikt (g/mol): 212.26 MDL-nummer: MFCD00041892 InChI-nyckel: KQIKKETXZQDHGE-UHFFFAOYSA-N Synonym: 4,4'-azodianiline,p-azoaniline,p-diaminoazobenzene,4,4'-diaminoazobenzene,azodianiline,p'-amino-p-aminoazobenzene,4,4'-azobisbenzenamine,benzenamine, 4,4'-azobis,4,4-azodianiline,4,4'-diazenediylbisaniline PubChem CID: 10855 LEDER: NC1=CC=C(C=C1)N=NC1=CC=C(N)C=C1
| Molekylformel | C12H12N4 |
|---|---|
| PubChem CID | 10855 |
| MDL-nummer | MFCD00041892 |
| CAS | 538-41-0 |
| InChI-nyckel | KQIKKETXZQDHGE-UHFFFAOYSA-N |
| LEDER | NC1=CC=C(C=C1)N=NC1=CC=C(N)C=C1 |
| Molekylvikt (g/mol) | 212.26 |
| Synonym | 4,4'-azodianiline,p-azoaniline,p-diaminoazobenzene,4,4'-diaminoazobenzene,azodianiline,p'-amino-p-aminoazobenzene,4,4'-azobisbenzenamine,benzenamine, 4,4'-azobis,4,4-azodianiline,4,4'-diazenediylbisaniline |
4,4'-azodianilin, 95 %, Thermo Scientific Chemicals
CAS: 538-41-0 Molekylformel: C12H12N4 Molekylvikt (g/mol): 212.26 MDL-nummer: MFCD00041892 InChI-nyckel: KQIKKETXZQDHGE-UHFFFAOYSA-N Synonym: 4,4'-azodianiline,p-azoaniline,p-diaminoazobenzene,4,4'-diaminoazobenzene,azodianiline,p'-amino-p-aminoazobenzene,4,4'-azobisbenzenamine,benzenamine, 4,4'-azobis,4,4-azodianiline,4,4'-diazenediylbisaniline PubChem CID: 10855 IUPAC-namn: 4-[(4-aminofenyl)diazenyl]anilin LEDER: NC1=CC=C(C=C1)N=NC1=CC=C(N)C=C1
| Molekylformel | C12H12N4 |
|---|---|
| PubChem CID | 10855 |
| MDL-nummer | MFCD00041892 |
| IUPAC-namn | 4-[(4-aminofenyl)diazenyl]anilin |
| CAS | 538-41-0 |
| InChI-nyckel | KQIKKETXZQDHGE-UHFFFAOYSA-N |
| LEDER | NC1=CC=C(C=C1)N=NC1=CC=C(N)C=C1 |
| Molekylvikt (g/mol) | 212.26 |
| Synonym | 4,4'-azodianiline,p-azoaniline,p-diaminoazobenzene,4,4'-diaminoazobenzene,azodianiline,p'-amino-p-aminoazobenzene,4,4'-azobisbenzenamine,benzenamine, 4,4'-azobis,4,4-azodianiline,4,4'-diazenediylbisaniline |
Azobenzene, MedChemExpress
MedChemExpress Azobenzene can be used as an optical trigger for the design and synthesis of a large variety of photoresponsive systems.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
| Molekylformel | C12H10N2 |
|---|---|
| Rekommenderad förvaring | Powder -20°C 3 years, 4°C 2 years∣In solvent -80°C 6 months, -20°C 1 month |
| Formel vikt | 182.22 |
| Hållbarhet | Powder -20°C 3 years, 4°C 2 years∣In solvent -80°C 6 months, -20°C 1 month |
| Hälsofara 1 | H341∣H350 |
| Löslighetsinformation | DMSO : ≥ 150 mg/mL (823.18 mM) |
| Anteckningar om renhetsgrad | Research |
| Fysisk form | Solid |
| Kvalitet | Research |
| Färg | Orange |
| CAS | 103-33-3 |
| LEDER | C1(/N=N/C2=CC=CC=C2)=CC=CC=C1 |
| Molekylvikt (g/mol) | 182.22 |
| Kemiskt namn eller material | Azobenzene |
| Procent renhet | 98.0% |
4-Phenylazomaleinanil, 95%
CAS: 16201-96-0 Molekylformel: C16H11N3O2 Molekylvikt (g/mol): 277.283 MDL-nummer: MFCD00005506 InChI-nyckel: DVNPYLMPVFDKGZ-UHFFFAOYSA-N Synonym: 4-phenylazomaleinanil,n-p-phenylazophenyl maleimide,p-phenylazomaleinanil,1h-pyrrole-2,5-dione, 1-4-phenylazo phenyl,maleimide, n-p-phenylazo phenyl,1h-pyrrole-2, 1-4-phenylazo phenyl,1h-pyrrole-2,5-dione, 1-4-2-phenyldiazenyl phenyl PubChem CID: 85328 IUPAC-namn: 1-(4-phenyldiazenylphenyl)pyrrole-2,5-dione LEDER: C1=CC=C(C=C1)N=NC2=CC=C(C=C2)N3C(=O)C=CC3=O
| Molekylformel | C16H11N3O2 |
|---|---|
| PubChem CID | 85328 |
| MDL-nummer | MFCD00005506 |
| IUPAC-namn | 1-(4-phenyldiazenylphenyl)pyrrole-2,5-dione |
| CAS | 16201-96-0 |
| InChI-nyckel | DVNPYLMPVFDKGZ-UHFFFAOYSA-N |
| LEDER | C1=CC=C(C=C1)N=NC2=CC=C(C=C2)N3C(=O)C=CC3=O |
| Molekylvikt (g/mol) | 277.283 |
| Synonym | 4-phenylazomaleinanil,n-p-phenylazophenyl maleimide,p-phenylazomaleinanil,1h-pyrrole-2,5-dione, 1-4-phenylazo phenyl,maleimide, n-p-phenylazo phenyl,1h-pyrrole-2, 1-4-phenylazo phenyl,1h-pyrrole-2,5-dione, 1-4-2-phenyldiazenyl phenyl |