Reaktiva icke-metalliska salter
- (1)
- (1)
- (7)
- (3)
- (1)
- (19)
- (4)
- (1)
- (4)
- (17)
- (3)
- (2)
- (1)
- (1)
- (9)
- (1)
- (1)
- (3)
- (12)
- (1)
- (2)
- (1)
- (4)
- (1)
- (3)
- (8)
- (20)
- (4)
- (2)
- (1)
- (2)
- (3)
- (2)
- (5)
- (3)
- (3)
- (3)
- (3)
- (2)
- (2)
- (3)
- (2)
- (3)
- (3)
- (1)
- (3)
- (3)
- (2)
- (3)
- (4)
- (1)
- (3)
- (4)
- (2)
- (5)
- (3)
- (1)
- (3)
- (2)
- (14)
- (3)
- (3)
- (19)
- (6)
- (1)
- (3)
- (3)
- (5)
- (10)
- (2)
- (2)
- (20)
- (2)
- (7)
- (3)
- (6)
- (6)
- (3)
- (4)
- (3)
Filtrerade sökresultat
Fosforpentasulfid, 98+%, Thermo Scientific Chemicals
CAS: 1314-80-3 Molekylformel: P4S10 Molekylvikt (g/mol): 444.48 MDL-nummer: MFCD00011441 InChI-nyckel: CYQAYERJWZKYML-UHFFFAOYSA-N Synonym: phosphorus pentasulfide,sulfur phosphide,diphosphorus pentasulfide,diphosphorus pentasulphide,tetraphosphorus decasulfide,phosphoric sulfide,phosphorus persulfide,phosphorus pentasulphide,thiophosphoric anhydride,sirnik fosforecny czech PubChem CID: 14817 LEDER: P12(=S)SP3(=S)SP(=S)(S1)SP(=S)(S2)S3
| Molekylformel | P4S10 |
|---|---|
| PubChem CID | 14817 |
| MDL-nummer | MFCD00011441 |
| CAS | 1314-80-3 |
| InChI-nyckel | CYQAYERJWZKYML-UHFFFAOYSA-N |
| LEDER | P12(=S)SP3(=S)SP(=S)(S1)SP(=S)(S2)S3 |
| Molekylvikt (g/mol) | 444.48 |
| Synonym | phosphorus pentasulfide,sulfur phosphide,diphosphorus pentasulfide,diphosphorus pentasulphide,tetraphosphorus decasulfide,phosphoric sulfide,phosphorus persulfide,phosphorus pentasulphide,thiophosphoric anhydride,sirnik fosforecny czech |
Fosfortribromid, 99 %, Thermo Scientific Chemicals
CAS: 7789-60-8 Molekylformel: Br3P Molekylvikt (g/mol): 270.69 MDL-nummer: MFCD00011436 InChI-nyckel: IPNPIHIZVLFAFP-UHFFFAOYSA-N Synonym: phosphorus tribromide,phosphorous tribromide,tribromophosphine,phosphorus iii bromide,phosphorous bromide,pbr3,phosphorus bromide,phosphorus bromide pbr3,unii-58r3866pua,tribro-mophosphine PubChem CID: 24614 IUPAC-namn: tribromofosfan LEDER: P(Br)(Br)Br
| Molekylformel | Br3P |
|---|---|
| PubChem CID | 24614 |
| MDL-nummer | MFCD00011436 |
| IUPAC-namn | tribromofosfan |
| CAS | 7789-60-8 |
| InChI-nyckel | IPNPIHIZVLFAFP-UHFFFAOYSA-N |
| LEDER | P(Br)(Br)Br |
| Molekylvikt (g/mol) | 270.69 |
| Synonym | phosphorus tribromide,phosphorous tribromide,tribromophosphine,phosphorus iii bromide,phosphorous bromide,pbr3,phosphorus bromide,phosphorus bromide pbr3,unii-58r3866pua,tribro-mophosphine |
Sulfaguanidin, 98 %, Thermo Scientific Chemicals
CAS: 57-67-0 Molekylformel: C7H10N4O2S Molekylvikt (g/mol): 214.25 MDL-nummer: MFCD00038136 InChI-nyckel: BRBKOPJOKNSWSG-UHFFFAOYSA-N Synonym: sulfaguanidine,sulphaguanidine,sulfaguanidin,guanicil,sulfaguine,aterian,sulfanilguanidine,sulfanilylguanidine,sulfoguanidine,abiguanil PubChem CID: 5324 IUPAC-namn: 2-(4-aminofenyl)sulfonylguanidin LEDER: C1=CC(=CC=C1N)S(=O)(=O)N=C(N)N
| Molekylformel | C7H10N4O2S |
|---|---|
| PubChem CID | 5324 |
| MDL-nummer | MFCD00038136 |
| IUPAC-namn | 2-(4-aminofenyl)sulfonylguanidin |
| CAS | 57-67-0 |
| InChI-nyckel | BRBKOPJOKNSWSG-UHFFFAOYSA-N |
| LEDER | C1=CC(=CC=C1N)S(=O)(=O)N=C(N)N |
| Molekylvikt (g/mol) | 214.25 |
| Synonym | sulfaguanidine,sulphaguanidine,sulfaguanidin,guanicil,sulfaguine,aterian,sulfanilguanidine,sulfanilylguanidine,sulfoguanidine,abiguanil |
Nitrosoniumhexafluorfosfat, 96 %, Thermo Scientific Chemicals
CAS: 16921-91-8 Molekylformel: F6NOP Molekylvikt (g/mol): 174.97 MDL-nummer: MFCD00040324 InChI-nyckel: SAKPNYRUBHJGAR-UHFFFAOYSA-N Synonym: nitrosonium hexafluorophosphate,nitrilooxonium hexafluorophosphate,nopf6,nitrosyl hexafluorophosphate,nitrosonium hexafluorophosphat,nitrosylhexafluorophosphate,azanylidyneoxidanium hexafluorophosphate,hexafluoro-$l^ 5-phosphanuide; nitrosonium PubChem CID: 10910083 IUPAC-namn: azanylidynoxidanium;hexafluorfosfat LEDER: N#[O+].F[P-](F)(F)(F)(F)F
| Molekylformel | F6NOP |
|---|---|
| PubChem CID | 10910083 |
| MDL-nummer | MFCD00040324 |
| IUPAC-namn | azanylidynoxidanium;hexafluorfosfat |
| CAS | 16921-91-8 |
| InChI-nyckel | SAKPNYRUBHJGAR-UHFFFAOYSA-N |
| LEDER | N#[O+].F[P-](F)(F)(F)(F)F |
| Molekylvikt (g/mol) | 174.97 |
| Synonym | nitrosonium hexafluorophosphate,nitrilooxonium hexafluorophosphate,nopf6,nitrosyl hexafluorophosphate,nitrosonium hexafluorophosphat,nitrosylhexafluorophosphate,azanylidyneoxidanium hexafluorophosphate,hexafluoro-$l^ 5-phosphanuide; nitrosonium |
Tiofosgen, 85 %, Thermo Scientific Chemicals
CAS: 463-71-8 MDL-nummer: MFCD00004918 InChI-nyckel: ZWZVWGITAAIFPS-UHFFFAOYSA-N Synonym: thiophosgene,carbonothioic dichloride,carbon chlorosulfide,thiocarbonyl chloride,thiocarbonic dichloride,dichlorothiocarbonyl,thiofosgen,phosgene, thio,thiokarbonylchlorid,carbonyl chloride, thio PubChem CID: 10040 ChEBI: CHEBI:29366 IUPAC-namn: tiokarbonyldiklorid LEDER: C(=S)(Cl)Cl
| PubChem CID | 10040 |
|---|---|
| MDL-nummer | MFCD00004918 |
| IUPAC-namn | tiokarbonyldiklorid |
| CAS | 463-71-8 |
| InChI-nyckel | ZWZVWGITAAIFPS-UHFFFAOYSA-N |
| LEDER | C(=S)(Cl)Cl |
| ChEBI | CHEBI:29366 |
| Synonym | thiophosgene,carbonothioic dichloride,carbon chlorosulfide,thiocarbonyl chloride,thiocarbonic dichloride,dichlorothiocarbonyl,thiofosgen,phosgene, thio,thiokarbonylchlorid,carbonyl chloride, thio |
Fosfor(V)oxid, 98 %, Thermo Scientific Chemicals
CAS: 1314-56-3 Molekylformel: O5P2 Molekylvikt (g/mol): 141.94 MDL-nummer: MFCD00011440 InChI-nyckel: DLYUQMMRRRQYAE-UHFFFAOYSA-N Synonym: Phosphorus pentoxide IUPAC-namn: tricyklo[3.3.1.13,7]tetrafosfoxan-1,3,5,7-tetron LEDER: O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3
| Molekylformel | O5P2 |
|---|---|
| MDL-nummer | MFCD00011440 |
| IUPAC-namn | tricyklo[3.3.1.13,7]tetrafosfoxan-1,3,5,7-tetron |
| CAS | 1314-56-3 |
| InChI-nyckel | DLYUQMMRRRQYAE-UHFFFAOYSA-N |
| LEDER | O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3 |
| Molekylvikt (g/mol) | 141.94 |
| Synonym | Phosphorus pentoxide |
Fosforpentoxid, 98+%, ACS-reagens, Thermo Scientific Chemicals
CAS: 1314-56-3 Molekylformel: O5P2 Molekylvikt (g/mol): 141.94 MDL-nummer: MFCD00011440 InChI-nyckel: DLYUQMMRRRQYAE-UHFFFAOYSA-N Synonym: Phosphoric anhydride IUPAC-namn: tricyklo[3.3.1.13,7]tetrafosfoxan-1,3,5,7-tetron LEDER: O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3
| Molekylformel | O5P2 |
|---|---|
| MDL-nummer | MFCD00011440 |
| IUPAC-namn | tricyklo[3.3.1.13,7]tetrafosfoxan-1,3,5,7-tetron |
| CAS | 1314-56-3 |
| InChI-nyckel | DLYUQMMRRRQYAE-UHFFFAOYSA-N |
| LEDER | O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3 |
| Molekylvikt (g/mol) | 141.94 |
| Synonym | Phosphoric anhydride |
Fosfor(III)bromid, 99 %, Thermo Scientific Chemicals
CAS: 7789-60-8 Molekylformel: Br3P Molekylvikt (g/mol): 270.686 MDL-nummer: MFCD00011436 InChI-nyckel: IPNPIHIZVLFAFP-UHFFFAOYSA-N Synonym: phosphorus tribromide,phosphorous tribromide,tribromophosphine,phosphorus iii bromide,phosphorous bromide,pbr3,phosphorus bromide,phosphorus bromide pbr3,unii-58r3866pua,tribro-mophosphine PubChem CID: 24614 IUPAC-namn: tribromofosfan LEDER: P(Br)(Br)Br
| Molekylformel | Br3P |
|---|---|
| PubChem CID | 24614 |
| MDL-nummer | MFCD00011436 |
| IUPAC-namn | tribromofosfan |
| CAS | 7789-60-8 |
| InChI-nyckel | IPNPIHIZVLFAFP-UHFFFAOYSA-N |
| LEDER | P(Br)(Br)Br |
| Molekylvikt (g/mol) | 270.686 |
| Synonym | phosphorus tribromide,phosphorous tribromide,tribromophosphine,phosphorus iii bromide,phosphorous bromide,pbr3,phosphorus bromide,phosphorus bromide pbr3,unii-58r3866pua,tribro-mophosphine |
Fosfonitrilkloridtrimer, 98 %, Thermo Scientific Chemicals
CAS: 940-71-6 Molekylformel: Cl6N3P3 Molekylvikt (g/mol): 347.65 MDL-nummer: MFCD00006474 InChI-nyckel: UBIJTWDKTYCPMQ-UHFFFAOYSA-N Synonym: phosphonitrilic chloride trimer,hexachlorocyclotriphosphazene,hexachlorophosphazene,triphosphonitrilic chloride,triphosphonitrile chloride,hexachlorotriphosphonitrile,cyclophosphazene dichloride trimer,hexachlorocyclophosphazatriene,hexachlorocyclotriphosphazatriene,phosphononitrilic chloride trimer PubChem CID: 220225 IUPAC-namn: 2,2,4,4,6,6-hexaklor-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-trifosfacyklohexa-1,3,5-trien LEDER: N1=P(N=P(N=P1(Cl)Cl)(Cl)Cl)(Cl)Cl
| Molekylformel | Cl6N3P3 |
|---|---|
| PubChem CID | 220225 |
| MDL-nummer | MFCD00006474 |
| IUPAC-namn | 2,2,4,4,6,6-hexaklor-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-trifosfacyklohexa-1,3,5-trien |
| CAS | 940-71-6 |
| InChI-nyckel | UBIJTWDKTYCPMQ-UHFFFAOYSA-N |
| LEDER | N1=P(N=P(N=P1(Cl)Cl)(Cl)Cl)(Cl)Cl |
| Molekylvikt (g/mol) | 347.65 |
| Synonym | phosphonitrilic chloride trimer,hexachlorocyclotriphosphazene,hexachlorophosphazene,triphosphonitrilic chloride,triphosphonitrile chloride,hexachlorotriphosphonitrile,cyclophosphazene dichloride trimer,hexachlorocyclophosphazatriene,hexachlorocyclotriphosphazatriene,phosphononitrilic chloride trimer |
Fosfonitrilkloridtrimer, 98 %, Thermo Scientific Chemicals
CAS: 940-71-6 Molekylformel: Cl6N3P3 Molekylvikt (g/mol): 347.642 MDL-nummer: MFCD00006474 InChI-nyckel: UBIJTWDKTYCPMQ-UHFFFAOYSA-N Synonym: phosphonitrilic chloride trimer,hexachlorocyclotriphosphazene,hexachlorophosphazene,triphosphonitrilic chloride,triphosphonitrile chloride,hexachlorotriphosphonitrile,cyclophosphazene dichloride trimer,hexachlorocyclophosphazatriene,hexachlorocyclotriphosphazatriene,phosphononitrilic chloride trimer PubChem CID: 220225 IUPAC-namn: 2,2,4,4,6,6-hexaklor-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-trifosfacyklohexa-1,3,5-trien LEDER: N1=P(N=P(N=P1(Cl)Cl)(Cl)Cl)(Cl)Cl
| Molekylformel | Cl6N3P3 |
|---|---|
| PubChem CID | 220225 |
| MDL-nummer | MFCD00006474 |
| IUPAC-namn | 2,2,4,4,6,6-hexaklor-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-trifosfacyklohexa-1,3,5-trien |
| CAS | 940-71-6 |
| InChI-nyckel | UBIJTWDKTYCPMQ-UHFFFAOYSA-N |
| LEDER | N1=P(N=P(N=P1(Cl)Cl)(Cl)Cl)(Cl)Cl |
| Molekylvikt (g/mol) | 347.642 |
| Synonym | phosphonitrilic chloride trimer,hexachlorocyclotriphosphazene,hexachlorophosphazene,triphosphonitrilic chloride,triphosphonitrile chloride,hexachlorotriphosphonitrile,cyclophosphazene dichloride trimer,hexachlorocyclophosphazatriene,hexachlorocyclotriphosphazatriene,phosphononitrilic chloride trimer |
| Densitet | 1.4880g/mL |
|---|---|
| Molekylformel | Br3P |
| MDL-nummer | MFCD00011436 |
| Formel vikt | 270.69 |
| IUPAC-namn | tribromofosfan |
| InChI-nyckel | IPNPIHIZVLFAFP-UHFFFAOYSA-N |
| Hälsofara 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with wat |
| Hälsofara 2 | GHS H Statement Suspected of causing cancer if inhaled. Causes severe skin burns and eye damage. May cause respiratory irritation. May cause drowsiness or dizziness. Reacts violently with water. |
| Hälsofara 1 | GHS-signalord: Fara |
| Merck Index | 15, 7469 |
| Fysisk form | Vätska |
| Koncentration eller sammansättning (efter analyt eller komponenter) | 0.9 to 1.1M |
| Färg | Färglös till gul |
| PubChem CID | 24614 |
| Linjär formel | PBr2 |
| CAS | 75-09-2 |
| Namnnotering | 1.0M Solution in Dichloromethane |
| LEDER | P(Br)(Br)Br |
| Molekylvikt (g/mol) | 270.69 |
| EINECS-nummer | 232-178-2 |
| Synonym | phosphorus tribromide,phosphorous tribromide,tribromophosphine,phosphorus iii bromide,phosphorous bromide,pbr3,phosphorus bromide,phosphorus bromide pbr3,unii-58r3866pua,tribro-mophosphine |
| Kemiskt namn eller material | Phosphorus tribromide |
Fosforsyra, 85 % vikt/vikt aq. soln., ACS, Thermo Scientific™
CAS: 7664-38-2 Molekylformel: H3O4P Molekylvikt (g/mol): 97.994 MDL-nummer: MFCD00011340 InChI-nyckel: NBIIXXVUZAFLBC-UHFFFAOYSA-N Synonym: orthophosphoric acid,sonac,o-phosphoric acid,phosphorsaeure,acidum phosphoricum,evits,wc-reiniger,acide phosphorique,white,acido fosforico PubChem CID: 1004 ChEBI: CHEBI:26078 IUPAC-namn: fosforsyra LEDER: OP(=O)(O)O
| Molekylformel | H3O4P |
|---|---|
| PubChem CID | 1004 |
| MDL-nummer | MFCD00011340 |
| IUPAC-namn | fosforsyra |
| CAS | 7664-38-2 |
| InChI-nyckel | NBIIXXVUZAFLBC-UHFFFAOYSA-N |
| LEDER | OP(=O)(O)O |
| ChEBI | CHEBI:26078 |
| Molekylvikt (g/mol) | 97.994 |
| Synonym | orthophosphoric acid,sonac,o-phosphoric acid,phosphorsaeure,acidum phosphoricum,evits,wc-reiniger,acide phosphorique,white,acido fosforico |