Elektrokemibuffertar
- (32)
- (109)
- (1)
- (27)
- (2)
- (1)
- (25)
- (12)
- (14)
- (26)
- (33)
- (2)
- (1)
- (2)
- (2)
- (6)
- (6)
- (6)
- (6)
- (6)
- (2)
- (2)
- (4)
- (4)
- (11)
- (13)
- (12)
- (2)
- (6)
- (40)
- (36)
- (16)
- (8)
- (12)
- (2)
- (14)
- (20)
- (16)
Filtrerade sökresultat
Buffer solution pH 4.01 (+/-0.022 @ 25oC) No Color Specpure NIST Traceable
CAS: 1336-21-6 | H5NO | 35.05 g/mol
| Molekylformel | H5NO |
|---|---|
| Rekommenderad förvaring | Omgivningstemperaturer |
| MDL-nummer | MFCD00066650 |
| IUPAC-namn | azan;hydroxid |
| InChI-nyckel | VHUUQVKOLVNVRT-UHFFFAOYSA-N |
| ChEBI | CHEBI:18219 |
| Löslighetsinformation | Miscible with water. |
| Fysisk form | Vätska |
| Färg | Färglös |
| PubChem CID | 14923 |
| Odör | Odorless |
| Ångtryck | 23 hPa (17mm Hg) at 20°C |
| LEDER | N.O |
| Molekylvikt (g/mol) | 35.05 |
| TSCA | Yes |
| Kemiskt namn eller material | Buffer solution |
Buffertlösning pH 7,00 (+/-0,024 @ 25oC) Ingen Färg Specpure NIST Spårbar, Thermo Scientific Chemicals
CAS: 1336-21-6 | H5NO | 35.05 g/mol
| Molekylformel | H5NO |
|---|---|
| Rekommenderad förvaring | Omgivningstemperaturer |
| Spårbarhet till NIST | Yes |
| MDL-nummer | MFCD00066650 |
| InChI-nyckel | VHUUQVKOLVNVRT-UHFFFAOYSA-N |
| ChEBI | CHEBI:18219 |
| Löslighetsinformation | pH 7.00 buffers are in solution form. Miscible with water. |
| Fysisk form | Vätska |
| Kvalitet | Specpure |
| Färg | Färglös |
| PubChem CID | 14923 |
| Odör | Odorless |
| CAS | 1336-21-6 |
| LEDER | N.O |
| Molekylvikt (g/mol) | 35.05 |
| TSCA | Yes |
| Kemiskt namn eller material | Buffer solution |
| Koncentration eller sammansättning (efter analyt eller komponenter) | Sodium hydroxide: 0.7%; Potassium dihydrogen phosphate: 0.7%; water: 98.6% |
|---|---|
| Rekommenderad förvaring | Omgivningstemperaturer |
| Färg | Gult |
| MDL-nummer | MFCD00146252 |
| CAS | 7732-18-5 |
| Ångtryck | 23 hPa (17mm Hg) at 20°C |
| TSCA | Yes |
| Kemiskt namn eller material | Buffer solution |
| Löslighetsinformation | Miscible with water. |
| Fysisk form | Vätska |
Natriumbikarbonat, 1 M buffertlösning, pH 8,5, Thermo Scientific Chemicals
CAS: 144-55-8 Molekylformel: CHNaO3 Molekylvikt (g/mol): 84.01 MDL-nummer: MFCD00003528 InChI-nyckel: UIIMBOGNXHQVGW-UHFFFAOYSA-M PubChem CID: 516892 ChEBI: CHEBI:32139 IUPAC-namn: natrium; vätekarbonat LEDER: [Na+].OC([O-])=O
| Molekylformel | CHNaO3 |
|---|---|
| PubChem CID | 516892 |
| MDL-nummer | MFCD00003528 |
| IUPAC-namn | natrium; vätekarbonat |
| CAS | 144-55-8 |
| InChI-nyckel | UIIMBOGNXHQVGW-UHFFFAOYSA-M |
| LEDER | [Na+].OC([O-])=O |
| ChEBI | CHEBI:32139 |
| Molekylvikt (g/mol) | 84.01 |
Thermo Scientific Chemicals Borat, 0,5 M buffertlösning, pH 8,5
CAS: 1330-43-4 Molekylformel: B4Na2O7 Molekylvikt (g/mol): 201.21 MDL-nummer: MFCD00081185 InChI-nyckel: NXSVMNYRVBQCMO-UHFFFAOYSA-N IUPAC-namn: dinatriumbicyklo[3.3.1]tetraboroxan-3,7-bis(ylium)-1,5-diuid-1,5-bis(olat) LEDER: [Na+].[Na+].[O-][B-]12O[B+]O[B-]([O-])(O[B+]O1)O2
| Molekylformel | B4Na2O7 |
|---|---|
| MDL-nummer | MFCD00081185 |
| IUPAC-namn | dinatriumbicyklo[3.3.1]tetraboroxan-3,7-bis(ylium)-1,5-diuid-1,5-bis(olat) |
| CAS | 1330-43-4 |
| InChI-nyckel | NXSVMNYRVBQCMO-UHFFFAOYSA-N |
| LEDER | [Na+].[Na+].[O-][B-]12O[B+]O[B-]([O-])(O[B+]O1)O2 |
| Molekylvikt (g/mol) | 201.21 |
Thermo Scientific Chemicals Natriumborat, 0,5 M buffertlösning, pH 8,5
CAS: 1330-43-4 Molekylformel: B4Na2O7 Molekylvikt (g/mol): 201.21 MDL-nummer: MFCD00081185 InChI-nyckel: NXSVMNYRVBQCMO-UHFFFAOYSA-N IUPAC-namn: dinatriumbicyklo[3.3.1]tetraboroxan-3,7-bis(ylium)-1,5-diuid-1,5-bis(olat) LEDER: [Na+].[Na+].[O-][B-]12O[B+]O[B-]([O-])(O[B+]O1)O2
| Molekylformel | B4Na2O7 |
|---|---|
| MDL-nummer | MFCD00081185 |
| IUPAC-namn | dinatriumbicyklo[3.3.1]tetraboroxan-3,7-bis(ylium)-1,5-diuid-1,5-bis(olat) |
| CAS | 1330-43-4 |
| InChI-nyckel | NXSVMNYRVBQCMO-UHFFFAOYSA-N |
| LEDER | [Na+].[Na+].[O-][B-]12O[B+]O[B-]([O-])(O[B+]O1)O2 |
| Molekylvikt (g/mol) | 201.21 |
Buffer solution, pH 2.00 (+/-0.026 @ 25oC), No Color, Specpure, NIST Traceable
For Calibration of pH Meters | CAS: 7447-40-7
| Rekommenderad förvaring | Omgivningstemperaturer |
|---|---|
| Spårbarhet till NIST | Yes |
| MDL-nummer | MFCD00146252 |
| Hälsofara 3 | P234-P390 |
| Hälsofara 2 | In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. Wear suitable gloves and eye/face protection. This material and/or its container must be disposed of as hazardous waste. |
| Hälsofara 1 | H290 |
| Löslighetsinformation | Soluble in water. |
| Fysisk form | Vätska |
| Koncentration eller sammansättning (efter analyt eller komponenter) | Potassium chloride: 0.7%; Hydrochloric acid: 0.7%; water: 98.6% |
| Färg | Färglös |
| CAS | 7732-18-5 |
| Ångtryck | 23 hPa (17mm Hg) at 20°C |
| TSCA | Yes |
| Kemiskt namn eller material | Buffer solution |
| Rekommenderad förvaring | Håll kallt |
|---|---|
| Färg | Färglös |
| MDL-nummer | MFCD00012462 |
| Odör | Odorless |
| Hälsofara 3 | GHS P Statement P280-P264-P305+P351+P338-P337+P313 Wear protective gloves/protective clothing/eye protection/face protection. Wash thoroughly after handling. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. If eye irritation persists: Get medical advice/attention. |
| Hälsofara 2 | GHS H Statement H319 Causes serious eye irritation. |
| pH | 6.0 |
| Hälsofara 1 | Warning |
| TSCA | Yes |
| Kemiskt namn eller material | Sodium citrate buffer soln. |
| Löslighetsinformation | Fully miscible in water. |
| Koncentration | 0.5 M |
| Fysisk form | Vätska |
| Rekommenderad förvaring | Håll kallt |
|---|---|
| Färg | Färglös |
| MDL-nummer | MFCD00012462 |
| Odör | Odorless |
| Hälsofara 3 | GHS P Statement P280-P305+P351+P338-P310 Wear protective gloves/protective clothing/eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. |
| Hälsofara 2 | GHS H Statement H318 Causes serious eye damage. |
| pH | 5.0 |
| Hälsofara 1 | Danger |
| TSCA | No |
| Kemiskt namn eller material | Sodium citrate buffer soln. |
| Löslighetsinformation | It is soluble in water (29.4g/L) at 20°C. Insoluble in ethanol. |
| Koncentration | 0.5 M |
| Fysisk form | Vätska |
| Rekommenderad förvaring | Omgivningstemperaturer |
|---|---|
| MDL-nummer | MFCD00146206 |
| pH | 7.4 |
| TSCA | Yes |
| Kemiskt namn eller material | Sodium phosphate buffer soln. |
| Löslighetsinformation | Miscible with water. Immiscible with alcohol. |
| Koncentration | 0.2 M |
| Fysisk form | Vätska |
Thermo Scientific Chemicals Natriumborat, 0,5 M buffertlösning, pH 9,0
CAS: 1330-43-4 Molekylformel: B4Na2O7 Molekylvikt (g/mol): 201.21 MDL-nummer: MFCD00081185 InChI-nyckel: NXSVMNYRVBQCMO-UHFFFAOYSA-N IUPAC-namn: dinatriumbicyklo[3.3.1]tetraboroxan-3,7-bis(ylium)-1,5-diuid-1,5-bis(olat) LEDER: [Na+].[Na+].[O-][B-]12O[B+]O[B-]([O-])(O[B+]O1)O2
| Molekylformel | B4Na2O7 |
|---|---|
| MDL-nummer | MFCD00081185 |
| IUPAC-namn | dinatriumbicyklo[3.3.1]tetraboroxan-3,7-bis(ylium)-1,5-diuid-1,5-bis(olat) |
| CAS | 1330-43-4 |
| InChI-nyckel | NXSVMNYRVBQCMO-UHFFFAOYSA-N |
| LEDER | [Na+].[Na+].[O-][B-]12O[B+]O[B-]([O-])(O[B+]O1)O2 |
| Molekylvikt (g/mol) | 201.21 |
| Koncentration eller sammansättning (efter analyt eller komponenter) | Sodium hydroxide: 0.7%; Potassium dihydrogen phosphate: 0.7%; water: 98.6% |
|---|---|
| Rekommenderad förvaring | Omgivningstemperaturer |
| Färg | Rött |
| MDL-nummer | MFCD00146206 |
| CAS | 7732-18-5 |
| Ångtryck | 23 hPa (17mm Hg) at 20°C |
| TSCA | Yes |
| Kemiskt namn eller material | Buffer solution |
| Löslighetsinformation | Miscible with water. |
| Fysisk form | Vätska |
| Rekommenderad förvaring | Omgivningstemperaturer |
|---|---|
| MDL-nummer | MFCD00146206 |
| pH | 8.0 |
| TSCA | Yes |
| Kemiskt namn eller material | Sodium phosphate buffer soln. |
| Löslighetsinformation | Soluble in water (121mg/ml at 20°C). |
| Koncentration | 0.5 M |
| Fysisk form | Vätska |
| Rekommenderad förvaring | Omgivningstemperaturer |
|---|---|
| MDL-nummer | MFCD00146206 |
| pH | 7.0 |
| TSCA | Yes |
| Kemiskt namn eller material | Sodium phosphate buffer soln. |
| Löslighetsinformation | Fully miscible. |
| Koncentration | 0.5 M |
| Fysisk form | Vätska |
Thermo Scientific Chemicals Borat, 0,5 M buffertlösning, pH 9,5
CAS: 1330-43-4 Molekylformel: B4Na2O7 Molekylvikt (g/mol): 201.21 MDL-nummer: MFCD00081185 InChI-nyckel: NXSVMNYRVBQCMO-UHFFFAOYSA-N IUPAC-namn: dinatriumbicyklo[3.3.1]tetraboroxan-3,7-bis(ylium)-1,5-diuid-1,5-bis(olat) LEDER: [Na+].[Na+].[O-][B-]12O[B+]O[B-]([O-])(O[B+]O1)O2
| Molekylformel | B4Na2O7 |
|---|---|
| MDL-nummer | MFCD00081185 |
| IUPAC-namn | dinatriumbicyklo[3.3.1]tetraboroxan-3,7-bis(ylium)-1,5-diuid-1,5-bis(olat) |
| CAS | 1330-43-4 |
| InChI-nyckel | NXSVMNYRVBQCMO-UHFFFAOYSA-N |
| LEDER | [Na+].[Na+].[O-][B-]12O[B+]O[B-]([O-])(O[B+]O1)O2 |
| Molekylvikt (g/mol) | 201.21 |