Fenylpropanoider och polyketider
Filtrerade sökresultat
4-Hydroxybenzylideneacetone, 97%
CAS: 3160-35-8 Molekylformel: C10H10O2 Molekylvikt (g/mol): 162.19 MDL-nummer: MFCD00016490 InChI-nyckel: OCNIKEFATSKIBE-NSCUHMNNSA-N Synonym: p-hydroxybenzalacetone,4-hydroxybenzylideneacetone,4-hydroxybenzal acetone,4-hydroxycinnamoylmethane,4-hydroxybenzalacetone,p-hydroxybenzylidene acetone,4-p-hydroxyphenyl-3-buten-2-one,4-4-hydroxyphenyl but-3-en-2-one,3-buten-2-one, 4-4-hydroxyphenyl,3-buten-2-one, 4-p-hydroxyphenyl PubChem CID: 796857 LEDER: CC(=O)\C=C\C1=CC=C(O)C=C1
| Molekylformel | C10H10O2 |
|---|---|
| PubChem CID | 796857 |
| MDL-nummer | MFCD00016490 |
| CAS | 3160-35-8 |
| InChI-nyckel | OCNIKEFATSKIBE-NSCUHMNNSA-N |
| LEDER | CC(=O)\C=C\C1=CC=C(O)C=C1 |
| Molekylvikt (g/mol) | 162.19 |
| Synonym | p-hydroxybenzalacetone,4-hydroxybenzylideneacetone,4-hydroxybenzal acetone,4-hydroxycinnamoylmethane,4-hydroxybenzalacetone,p-hydroxybenzylidene acetone,4-p-hydroxyphenyl-3-buten-2-one,4-4-hydroxyphenyl but-3-en-2-one,3-buten-2-one, 4-4-hydroxyphenyl,3-buten-2-one, 4-p-hydroxyphenyl |
Genistein, 99%, synthetic
CAS: 446-72-0 Molekylformel: C15H10O5 Molekylvikt (g/mol): 270.24 MDL-nummer: MFCD00016952 InChI-nyckel: TZBJGXHYKVUXJN-UHFFFAOYSA-N Synonym: genistein,prunetol,genisteol,4',5,7-trihydroxyisoflavone,genisterin,sophoricol,5,7,4'-trihydroxyisoflavone,bonistein,5,7-dihydroxy-3-4-hydroxyphenyl-4h-chromen-4-one,genestein PubChem CID: 5280961 ChEBI: CHEBI:28088 IUPAC-namn: 5,7-dihydroxi-3-(4-hydroxifenyl)kromen-4-on LEDER: OC1=CC=C(C=C1)C1=COC2=CC(O)=CC(O)=C2C1=O
| Molekylformel | C15H10O5 |
|---|---|
| PubChem CID | 5280961 |
| MDL-nummer | MFCD00016952 |
| IUPAC-namn | 5,7-dihydroxi-3-(4-hydroxifenyl)kromen-4-on |
| CAS | 446-72-0 |
| InChI-nyckel | TZBJGXHYKVUXJN-UHFFFAOYSA-N |
| LEDER | OC1=CC=C(C=C1)C1=COC2=CC(O)=CC(O)=C2C1=O |
| ChEBI | CHEBI:28088 |
| Molekylvikt (g/mol) | 270.24 |
| Synonym | genistein,prunetol,genisteol,4',5,7-trihydroxyisoflavone,genisterin,sophoricol,5,7,4'-trihydroxyisoflavone,bonistein,5,7-dihydroxy-3-4-hydroxyphenyl-4h-chromen-4-one,genestein |
3,4,9,10-Perylenetetracarboxylic dianhydride, 98%
CAS: 128-69-8 Molekylformel: C24H8O6 Molekylvikt (g/mol): 392.32 MDL-nummer: MFCD00006916 InChI-nyckel: CLYVDMAATCIVBF-UHFFFAOYSA-N Synonym: 3,4,9,10-perylenetetracarboxylic dianhydride,pigment red 224,ptcda,perylene-3,4,9,10-tetracarboxylic dianhydride,perylenetetracarboxylic anhydride,anthra 2,1,9-def:6,5,10-d'e'f' diisochromene-1,3,8,10-tetraone,perylo 3,4-cd:9,10-c'd' dipyran-1,3,8,10-tetrone,perylenetetracarboxylic acid dianhydride,3,4:9,10-perylenetetracarboxylic anhydride PubChem CID: 67191 IUPAC-namn: 7,18-dioxaheptacyklo[14.6.2.2²,⁵.0³,¹².0⁴,⁹.013,²³.0²⁰,²⁴]hexaco sa-1(22),2(26),3,5(25),9,11,13,15,20,23-dekaen-6,8,17,19-tetron LEDER: O=C1OC(=O)C2=CC=C3C4=CC=C5C(=O)OC(=O)C6=CC=C(C7=CC=C1C2=C37)C4=C56
| Molekylformel | C24H8O6 |
|---|---|
| PubChem CID | 67191 |
| MDL-nummer | MFCD00006916 |
| IUPAC-namn | 7,18-dioxaheptacyklo[14.6.2.2²,⁵.0³,¹².0⁴,⁹.013,²³.0²⁰,²⁴]hexaco sa-1(22),2(26),3,5(25),9,11,13,15,20,23-dekaen-6,8,17,19-tetron |
| CAS | 128-69-8 |
| InChI-nyckel | CLYVDMAATCIVBF-UHFFFAOYSA-N |
| LEDER | O=C1OC(=O)C2=CC=C3C4=CC=C5C(=O)OC(=O)C6=CC=C(C7=CC=C1C2=C37)C4=C56 |
| Molekylvikt (g/mol) | 392.32 |
| Synonym | 3,4,9,10-perylenetetracarboxylic dianhydride,pigment red 224,ptcda,perylene-3,4,9,10-tetracarboxylic dianhydride,perylenetetracarboxylic anhydride,anthra 2,1,9-def:6,5,10-d'e'f' diisochromene-1,3,8,10-tetraone,perylo 3,4-cd:9,10-c'd' dipyran-1,3,8,10-tetrone,perylenetetracarboxylic acid dianhydride,3,4:9,10-perylenetetracarboxylic anhydride |
Thermo Scientific Chemicals 7-dietylamino-4-metylkumarin, 99 %
CAS: 91-44-1 Molekylformel: C14H17NO2 Molekylvikt (g/mol): 231.29 MDL-nummer: MFCD00006864 InChI-nyckel: AFYCEAFSNDLKSX-UHFFFAOYSA-N Synonym: 7-diethylamino-4-methylcoumarin,coumarin 1,7-diethylamino-4-methyl-2h-chromen-2-one,coumarin 47,coumarin 460,4-methyl-7-diethylamino coumarin,blancophor aw,blancophor ffg,4-methyl-7-diethylaminocoumarin,hakkol p PubChem CID: 7050 ChEBI: CHEBI:51938 IUPAC-namn: 7-(dietylamino)-4-metylkromen-2-on LEDER: CCN(CC)C1=CC2=C(C=C1)C(=CC(=O)O2)C
| Molekylformel | C14H17NO2 |
|---|---|
| PubChem CID | 7050 |
| MDL-nummer | MFCD00006864 |
| IUPAC-namn | 7-(dietylamino)-4-metylkromen-2-on |
| CAS | 91-44-1 |
| InChI-nyckel | AFYCEAFSNDLKSX-UHFFFAOYSA-N |
| LEDER | CCN(CC)C1=CC2=C(C=C1)C(=CC(=O)O2)C |
| ChEBI | CHEBI:51938 |
| Molekylvikt (g/mol) | 231.29 |
| Synonym | 7-diethylamino-4-methylcoumarin,coumarin 1,7-diethylamino-4-methyl-2h-chromen-2-one,coumarin 47,coumarin 460,4-methyl-7-diethylamino coumarin,blancophor aw,blancophor ffg,4-methyl-7-diethylaminocoumarin,hakkol p |
Morin hydrate
CAS: 654055-01-3 Molekylformel: C15H10O7 Molekylvikt (g/mol): 302.24 MDL-nummer: MFCD00217054 InChI-nyckel: YXOLAZRVSSWPPT-UHFFFAOYSA-N Synonym: morin hydrate,morinhydrate,bois d,arc hydrate,2-2,4-dihydroxyphenyl-3,5,7-trihydroxy-4h-chromen-4-one hydrate,morin hydrate, powder,morin flavonol,morin hydrate aurantica,2-2,4-dihydroxyphenyl-3,5,7-trihydroxy-chromen-4-one hydrate,2 inverted exclamation marka,3,4 inverted exclamation marka,5,7-pentahydroxyflavone PubChem CID: 16219651 IUPAC-namn: 2-(2,4-dihydroxifenyl)-3,5,7-trihydroxikromen-4-on;hydrat LEDER: OC1=CC(O)=C(C=C1)C1=C(O)C(=O)C2=C(O)C=C(O)C=C2O1
| Molekylformel | C15H10O7 |
|---|---|
| PubChem CID | 16219651 |
| MDL-nummer | MFCD00217054 |
| IUPAC-namn | 2-(2,4-dihydroxifenyl)-3,5,7-trihydroxikromen-4-on;hydrat |
| CAS | 654055-01-3 |
| InChI-nyckel | YXOLAZRVSSWPPT-UHFFFAOYSA-N |
| LEDER | OC1=CC(O)=C(C=C1)C1=C(O)C(=O)C2=C(O)C=C(O)C=C2O1 |
| Molekylvikt (g/mol) | 302.24 |
| Synonym | morin hydrate,morinhydrate,bois d,arc hydrate,2-2,4-dihydroxyphenyl-3,5,7-trihydroxy-4h-chromen-4-one hydrate,morin hydrate, powder,morin flavonol,morin hydrate aurantica,2-2,4-dihydroxyphenyl-3,5,7-trihydroxy-chromen-4-one hydrate,2 inverted exclamation marka,3,4 inverted exclamation marka,5,7-pentahydroxyflavone |
trans-4-Methoxycinnamic acid, 98%
CAS: 943-89-5 Molekylformel: C10H10O3 Molekylvikt (g/mol): 178.19 MDL-nummer: MFCD00004398 InChI-nyckel: AFDXODALSZRGIH-QPJJXVBHSA-N Synonym: 4-methoxycinnamic acid,p-methoxycinnamic acid,3-4-methoxyphenyl acrylic acid,trans-4-methoxycinnamic acid,4-methoxycinnamate,para-methoxycinnamic acid,o-methyl-p-coumaric acid,cinnamic acid, p-methoxy,e-3-4-methoxyphenyl acrylic acid,e-3-4-methoxyphenyl-2-propenoic acid PubChem CID: 699414 IUPAC-namn: (E)-3-(4-metoxifenyl)prop-2-ensyra LEDER: COC1=CC=C(\C=C\C(O)=O)C=C1
| Molekylformel | C10H10O3 |
|---|---|
| PubChem CID | 699414 |
| MDL-nummer | MFCD00004398 |
| IUPAC-namn | (E)-3-(4-metoxifenyl)prop-2-ensyra |
| CAS | 943-89-5 |
| InChI-nyckel | AFDXODALSZRGIH-QPJJXVBHSA-N |
| LEDER | COC1=CC=C(\C=C\C(O)=O)C=C1 |
| Molekylvikt (g/mol) | 178.19 |
| Synonym | 4-methoxycinnamic acid,p-methoxycinnamic acid,3-4-methoxyphenyl acrylic acid,trans-4-methoxycinnamic acid,4-methoxycinnamate,para-methoxycinnamic acid,o-methyl-p-coumaric acid,cinnamic acid, p-methoxy,e-3-4-methoxyphenyl acrylic acid,e-3-4-methoxyphenyl-2-propenoic acid |
(S)-(+)-Ibuprofen, 99 %, Thermo Scientific Chemicals
CAS: 51146-56-6 Molekylformel: C13H18O2 Molekylvikt (g/mol): 206.28 MDL-nummer: MFCD00069289 InChI-nyckel: HEFNNWSXXWATRW-JTQLQIEISA-N Synonym: s-+-ibuprofen,dexibuprofen,s +-ibuprofen,s-2-4-isobutylphenyl propanoic acid,s-ibuprofen,d-ibuproten,s-+-2-4-isobutylphenyl propionic acid,s-+-4-isobutyl-alpha-methylphenylacetic acid,+-s-p-isobutylhydratropic acid,seractil PubChem CID: 39912 ChEBI: CHEBI:43415 IUPAC-namn: (2S)-2-[4-(2-metylpropyl)fenyl]propansyra LEDER: CC(C)CC1=CC=C(C=C1)C(C)C(=O)O
| Molekylformel | C13H18O2 |
|---|---|
| PubChem CID | 39912 |
| MDL-nummer | MFCD00069289 |
| IUPAC-namn | (2S)-2-[4-(2-metylpropyl)fenyl]propansyra |
| CAS | 51146-56-6 |
| InChI-nyckel | HEFNNWSXXWATRW-JTQLQIEISA-N |
| LEDER | CC(C)CC1=CC=C(C=C1)C(C)C(=O)O |
| ChEBI | CHEBI:43415 |
| Molekylvikt (g/mol) | 206.28 |
| Synonym | s-+-ibuprofen,dexibuprofen,s +-ibuprofen,s-2-4-isobutylphenyl propanoic acid,s-ibuprofen,d-ibuproten,s-+-2-4-isobutylphenyl propionic acid,s-+-4-isobutyl-alpha-methylphenylacetic acid,+-s-p-isobutylhydratropic acid,seractil |
Ibuprofen, 99 %, Thermo Scientific Chemicals
CAS: 15687-27-1 Molekylformel: C13H18O2 Molekylvikt (g/mol): 206.29 MDL-nummer: MFCD00010393 InChI-nyckel: HEFNNWSXXWATRW-UHFFFAOYNA-N PubChem CID: 3672 ChEBI: CHEBI:5855 IUPAC-namn: 2-[4-(2-metylpropyl)fenyl]propansyra LEDER: CC(C)CC1=CC=C(C=C1)C(C)C(O)=O
| Molekylformel | C13H18O2 |
|---|---|
| PubChem CID | 3672 |
| MDL-nummer | MFCD00010393 |
| IUPAC-namn | 2-[4-(2-metylpropyl)fenyl]propansyra |
| CAS | 15687-27-1 |
| InChI-nyckel | HEFNNWSXXWATRW-UHFFFAOYNA-N |
| LEDER | CC(C)CC1=CC=C(C=C1)C(C)C(O)=O |
| ChEBI | CHEBI:5855 |
| Molekylvikt (g/mol) | 206.29 |
Cinnamylalkohol, 98% trans, Thermo Scientific Chemicals
CAS: 104-54-1 Molekylformel: C9H10O Molekylvikt (g/mol): 134.18 MDL-nummer: MFCD00002921 InChI-nyckel: OOCCDEMITAIZTP-QPJJXVBHSA-N Synonym: cinnamyl alcohol,cinnamic alcohol,3-phenyl-2-propen-1-ol,3-phenylprop-2-en-1-ol,zimtalcohol,styryl carbinol,e-3-phenylprop-2-en-1-ol,3-phenylallyl alcohol,trans-cinnamyl alcohol,styryl alcohol PubChem CID: 5315892 ChEBI: CHEBI:33227 IUPAC-namn: (E)-3-fenylprop-2-en-1-ol LEDER: C1=CC=C(C=C1)C=CCO
| Molekylformel | C9H10O |
|---|---|
| PubChem CID | 5315892 |
| MDL-nummer | MFCD00002921 |
| IUPAC-namn | (E)-3-fenylprop-2-en-1-ol |
| CAS | 104-54-1 |
| InChI-nyckel | OOCCDEMITAIZTP-QPJJXVBHSA-N |
| LEDER | C1=CC=C(C=C1)C=CCO |
| ChEBI | CHEBI:33227 |
| Molekylvikt (g/mol) | 134.18 |
| Synonym | cinnamyl alcohol,cinnamic alcohol,3-phenyl-2-propen-1-ol,3-phenylprop-2-en-1-ol,zimtalcohol,styryl carbinol,e-3-phenylprop-2-en-1-ol,3-phenylallyl alcohol,trans-cinnamyl alcohol,styryl alcohol |
7-dietylamino-4-metylkumarin, 99 %, Thermo Scientific Chemicals
CAS: 91-44-1 Molekylformel: C14H17NO2 Molekylvikt (g/mol): 231.295 MDL-nummer: MFCD00006864 InChI-nyckel: AFYCEAFSNDLKSX-UHFFFAOYSA-N Synonym: 7-diethylamino-4-methylcoumarin,coumarin 1,7-diethylamino-4-methyl-2h-chromen-2-one,coumarin 47,coumarin 460,4-methyl-7-diethylamino coumarin,blancophor aw,blancophor ffg,4-methyl-7-diethylaminocoumarin,hakkol p PubChem CID: 7050 ChEBI: CHEBI:51938 IUPAC-namn: 7-(dietylamino)-4-metylkromen-2-on LEDER: CCN(CC)C1=CC2=C(C=C1)C(=CC(=O)O2)C
| Molekylformel | C14H17NO2 |
|---|---|
| PubChem CID | 7050 |
| MDL-nummer | MFCD00006864 |
| IUPAC-namn | 7-(dietylamino)-4-metylkromen-2-on |
| CAS | 91-44-1 |
| InChI-nyckel | AFYCEAFSNDLKSX-UHFFFAOYSA-N |
| LEDER | CCN(CC)C1=CC2=C(C=C1)C(=CC(=O)O2)C |
| ChEBI | CHEBI:51938 |
| Molekylvikt (g/mol) | 231.295 |
| Synonym | 7-diethylamino-4-methylcoumarin,coumarin 1,7-diethylamino-4-methyl-2h-chromen-2-one,coumarin 47,coumarin 460,4-methyl-7-diethylamino coumarin,blancophor aw,blancophor ffg,4-methyl-7-diethylaminocoumarin,hakkol p |
4-(Bromomethyl)-7-methoxycoumarin, 97%
CAS: 35231-44-8 Molekylformel: C11H9BrO3 Molekylvikt (g/mol): 269.09 MDL-nummer: MFCD00006869 InChI-nyckel: CTENSLORRMFPDH-UHFFFAOYSA-N Synonym: 4-bromomethyl-7-methoxycoumarin,4-bromomethyl-7-methoxy-2h-chromen-2-one,br-mmc,ccris 7996,4-bromomethyl-7-methoxychromen-2-one,2h-1-benzopyran-2-one, 4-bromomethyl-7-methoxy,4-bromomethyl-7-methoxy-2-oxo-2h-benzopyran,acmc-1agnd,4-brommethyl-7-methoxy-2h-chromen-2-on,4-bromomethyl-7-methoxy coumarin PubChem CID: 121894 IUPAC-namn: 4-(brommetyl)-7-metoxikromen-2-on LEDER: COC1=CC=C2C(CBr)=CC(=O)OC2=C1
| Molekylformel | C11H9BrO3 |
|---|---|
| PubChem CID | 121894 |
| MDL-nummer | MFCD00006869 |
| IUPAC-namn | 4-(brommetyl)-7-metoxikromen-2-on |
| CAS | 35231-44-8 |
| InChI-nyckel | CTENSLORRMFPDH-UHFFFAOYSA-N |
| LEDER | COC1=CC=C2C(CBr)=CC(=O)OC2=C1 |
| Molekylvikt (g/mol) | 269.09 |
| Synonym | 4-bromomethyl-7-methoxycoumarin,4-bromomethyl-7-methoxy-2h-chromen-2-one,br-mmc,ccris 7996,4-bromomethyl-7-methoxychromen-2-one,2h-1-benzopyran-2-one, 4-bromomethyl-7-methoxy,4-bromomethyl-7-methoxy-2-oxo-2h-benzopyran,acmc-1agnd,4-brommethyl-7-methoxy-2h-chromen-2-on,4-bromomethyl-7-methoxy coumarin |
Engeletin, MedChemExpress
MedChemExpress Engeletin is a flavanonol glycoside isolated from hymenaea martiana, inhibits NF-κB signaling-pathway activation, and possesses anti-inflammatory, analgesic, diuresis, detumescence, and antibiosis effects.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
| Molekylformel | C21H22O10 |
|---|---|
| Rekommenderad förvaring | Powder -20°C 3 years, 4°C 2 years∣In solvent -80°C 6 months, -20°C 1 month |
| Formel vikt | 434.39 |
| Hållbarhet | Powder -20°C 3 years, 4°C 2 years∣In solvent -80°C 6 months, -20°C 1 month |
| Löslighetsinformation | DMSO : ≥ 100 mg/mL (230.21 mM) |
| Anteckningar om renhetsgrad | Research |
| Fysisk form | Solid |
| Kvalitet | Research |
| Färg | White |
| CAS | 572-31-6 |
| LEDER | OC1=CC(O)=C(C([C@H](O[C@@]2([H])[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O2)[C@@H](C3=CC=C(O)C=C3)O4)=O)C4=C1 |
| Molekylvikt (g/mol) | 434.39 |
| Kemiskt namn eller material | Engeletin |
| Procent renhet | 98.88% |
| För användning med (applikation) | COVID-19-immunoregulation |
IKarisoside A, MedChemExpress
MedChemExpress IKarisoside A (Icarisoside-A) is a natural flavonol glycoside and has anti-inflammatory properties.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
Nicotiflorin, MedChemExpress
MedChemExpress Nicotiflorin is a flavonoid glycoside extracted from a traditional Chinese medicine Flos Carthami. Nicotiflorin shows potent antiglycation activity and neuroprotection effects.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
| Molekylformel | C27H30O15 |
|---|---|
| Rekommenderad förvaring | 4°C, protect from light∣In solvent : -80°C, 6 months∣-20°C, 1 month (protect from light) |
| Formel vikt | 594.52 |
| Hållbarhet | 4°C, protect from light∣In solvent : -80°C, 6 months∣-20°C, 1 month (protect from light) |
| Hälsofara 1 | H302 |
| Löslighetsinformation | DMSO : 250 mg/mL (420.51 mM; Need ultrasonic) |
| Anteckningar om renhetsgrad | Research |
| Fysisk form | Solid |
| Kvalitet | Research |
| Färg | Yellow |
| CAS | 17650-84-9 |
| LEDER | O=C1C(O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]3[C@@H]([C@@H]([C@H]([C@H](C)O3)O)O)O)O2)O)O)O)=C(C4=CC=C(O)C=C4)OC5=CC(O)=CC(O)=C15 |
| Molekylvikt (g/mol) | 594.52 |
| Kemiskt namn eller material | Nicotiflorin |
| Procent renhet | 99.19% |
| För användning med (applikation) | Neuroscience-Neuromodulation |
Sophoricoside, MedChemExpress
MedChemExpress Sophoricoside is an isoflavone glycoside isolated from Sophora japonica and has anti-inflammatory, anti-cancer and immunosuppressive effects.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More