Anilin och substituerade aniliner
Filtrerade sökresultat
o-Dianisidine, 98+%
CAS: 119-90-4 Molekylformel: C14H16N2O2 Molekylvikt (g/mol): 244.294 MDL-nummer: MFCD00008372 InChI-nyckel: JRBJSXQPQWSCCF-UHFFFAOYSA-N Synonym: 3,3'-dimethoxybenzidine,o-dianisidine,dianisidine,cellitazol b,neutrosel navy bn,diacel navy dc,disperse black 6,blue base nb,blue bn base,blue base irga b PubChem CID: 8411 ChEBI: CHEBI:82321 IUPAC-namn: 4-(4-amino-3-metoxifenyl)-2-metoxianilin LEDER: COC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)OC)N
| Molekylformel | C14H16N2O2 |
|---|---|
| PubChem CID | 8411 |
| MDL-nummer | MFCD00008372 |
| IUPAC-namn | 4-(4-amino-3-metoxifenyl)-2-metoxianilin |
| CAS | 119-90-4 |
| InChI-nyckel | JRBJSXQPQWSCCF-UHFFFAOYSA-N |
| LEDER | COC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)OC)N |
| ChEBI | CHEBI:82321 |
| Molekylvikt (g/mol) | 244.294 |
| Synonym | 3,3'-dimethoxybenzidine,o-dianisidine,dianisidine,cellitazol b,neutrosel navy bn,diacel navy dc,disperse black 6,blue base nb,blue bn base,blue base irga b |
o-Dianisidine dihydrochloride, 98%
CAS: 20325-40-0 Molekylformel: C14H18Cl2N2O2 Molekylvikt (g/mol): 317.21 MDL-nummer: MFCD00012488 InChI-nyckel: UXTIAFYTYOEQHV-UHFFFAOYSA-N Synonym: 3,3'-dimethoxybenzidine dihydrochloride,o-dianisidine dihydrochloride,3,3'-dimethoxy-1,1'-biphenyl-4,4'-diamine dihydrochloride,unii-qv96qa6ukk,dianisidine dihydrochloride,ccris 998,o-dianisidine hcl,qv96qa6ukk,c.i. disperse black 6 dihydrochloride PubChem CID: 62311 IUPAC-namn: 4-(4-amino-3-metoxifenyl)-2-metoxianilin;dihydroklorid LEDER: COC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)OC)N.Cl.Cl
| Molekylformel | C14H18Cl2N2O2 |
|---|---|
| PubChem CID | 62311 |
| MDL-nummer | MFCD00012488 |
| IUPAC-namn | 4-(4-amino-3-metoxifenyl)-2-metoxianilin;dihydroklorid |
| CAS | 20325-40-0 |
| InChI-nyckel | UXTIAFYTYOEQHV-UHFFFAOYSA-N |
| LEDER | COC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)OC)N.Cl.Cl |
| Molekylvikt (g/mol) | 317.21 |
| Synonym | 3,3'-dimethoxybenzidine dihydrochloride,o-dianisidine dihydrochloride,3,3'-dimethoxy-1,1'-biphenyl-4,4'-diamine dihydrochloride,unii-qv96qa6ukk,dianisidine dihydrochloride,ccris 998,o-dianisidine hcl,qv96qa6ukk,c.i. disperse black 6 dihydrochloride |
3,5-Dinitroaniline, 98%
CAS: 618-87-1 MDL-nummer: MFCD00007263 InChI-nyckel: MPBZUKLDHPOCLS-UHFFFAOYSA-N Synonym: benzenamine, 3,5-dinitro,aniline, 3,5-dinitro,unii-0ahr6k1n73,ccris 3109,3,5-dinitrophenylamine,3-5-dinitro-phenylamine,3,5-dinitroanilin,aniline,5-dinitro,acmc-209mx8,benzenamine,3,5-dinitro PubChem CID: 12068 IUPAC-namn: 3,5-dinitroanilin LEDER: C1=C(C=C(C=C1[N+](=O)[O-])[N+](=O)[O-])N
| PubChem CID | 12068 |
|---|---|
| MDL-nummer | MFCD00007263 |
| IUPAC-namn | 3,5-dinitroanilin |
| CAS | 618-87-1 |
| InChI-nyckel | MPBZUKLDHPOCLS-UHFFFAOYSA-N |
| LEDER | C1=C(C=C(C=C1[N+](=O)[O-])[N+](=O)[O-])N |
| Synonym | benzenamine, 3,5-dinitro,aniline, 3,5-dinitro,unii-0ahr6k1n73,ccris 3109,3,5-dinitrophenylamine,3-5-dinitro-phenylamine,3,5-dinitroanilin,aniline,5-dinitro,acmc-209mx8,benzenamine,3,5-dinitro |
TOPS, MedChemExpress
MedChemExpress TOPS, a Trinder's reagent, is a novel highly water-soluble aniline derivative; are widely used in diagnostic tests and biochemical tests.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
| Molekylformel | C12H18NNaO3S |
|---|---|
| Rekommenderad förvaring | 4°C, sealed storage, away from moisture∣In solvent : -80°C, 6 months∣-20°C, 1 month (sealed storage, away from moisture) |
| Formel vikt | 279.33 |
| Hållbarhet | 4°C, sealed storage, away from moisture∣In solvent : -80°C, 6 months∣-20°C, 1 month (sealed storage, away from moisture) |
| Löslighetsinformation | DMSO : ≥ 42 mg/mL (150.36 mM) |
| Anteckningar om renhetsgrad | Research |
| Fysisk form | Solid |
| Kvalitet | Research |
| Färg | White |
| CAS | 40567-80-4 |
| LEDER | O=S(CCCN(CC)C1=CC=CC(C)=C1)(O[Na])=O |
| Molekylvikt (g/mol) | 279.33 |
| Kemiskt namn eller material | TOPS |
| Procent renhet | 98.96% |
TOOS, MedChemExpress
MedChemExpress TOOS, a Trinder's reagent, is a novel highly water-soluble aniline derivative; are widely used in diagnostic tests and biochemical tests.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
| Molekylformel | C12H18NNaO4S |
|---|---|
| Rekommenderad förvaring | 4°C, sealed storage, away from moisture∣In solvent : -80°C, 6 months∣-20°C, 1 month (sealed storage, away from moisture) |
| Formel vikt | 295.33 |
| Hållbarhet | 4°C, sealed storage, away from moisture∣In solvent : -80°C, 6 months∣-20°C, 1 month (sealed storage, away from moisture) |
| Hälsofara 1 | H302∣H315∣H319∣H335 |
| Löslighetsinformation | DMSO : ≥ 47 mg/mL (159.14 mM) |
| Anteckningar om renhetsgrad | Research |
| Fysisk form | Powder |
| Kvalitet | Research |
| Färg | White |
| CAS | 82692-93-1 |
| LEDER | O=S(CC(O)CN(CC)C1=CC=CC(C)=C1)(O[Na])=O |
| Molekylvikt (g/mol) | 295.33 |
| Synonym | TOOS sodium salt |
| Kemiskt namn eller material | TOOS |
| Procent renhet | 99.76% |
2,5-Dimethoxyaniline, 99%
CAS: 102-56-7 Molekylformel: C8H11NO2 Molekylvikt (g/mol): 153.18 MDL-nummer: MFCD00008368 InChI-nyckel: NAZDVUBIEPVUKE-UHFFFAOYSA-N Synonym: benzenamine, 2,5-dimethoxy,aminohydroquinone dimethyl ether,1-amino-2,5-dimethoxybenzene,2,5-dimethoxybenzenamine,aniline, 2,5-dimethoxy,unii-v3z5u3fl10,2,5 dimethoxyaniline,2,5-dimethoxyphenylamine,dimethoxyaniline 2,5-,2,5-dimethoxy aniline PubChem CID: 7613 IUPAC-namn: 2,5-dimethoxyaniline LEDER: COC1=CC=C(OC)C(N)=C1
| Molekylformel | C8H11NO2 |
|---|---|
| PubChem CID | 7613 |
| MDL-nummer | MFCD00008368 |
| IUPAC-namn | 2,5-dimethoxyaniline |
| CAS | 102-56-7 |
| InChI-nyckel | NAZDVUBIEPVUKE-UHFFFAOYSA-N |
| LEDER | COC1=CC=C(OC)C(N)=C1 |
| Molekylvikt (g/mol) | 153.18 |
| Synonym | benzenamine, 2,5-dimethoxy,aminohydroquinone dimethyl ether,1-amino-2,5-dimethoxybenzene,2,5-dimethoxybenzenamine,aniline, 2,5-dimethoxy,unii-v3z5u3fl10,2,5 dimethoxyaniline,2,5-dimethoxyphenylamine,dimethoxyaniline 2,5-,2,5-dimethoxy aniline |