Karboxylsyraestrar
Filtrerade sökresultat
Metylmetakrylat, 99 %, stabiliserat, Thermo Scientific Chemicals
CAS: 80-62-6 Molekylformel: C5H8O2 Molekylvikt (g/mol): 100.12 MDL-nummer: MFCD00008587 InChI-nyckel: VVQNEPGJFQJSBK-UHFFFAOYSA-N Synonym: methyl methacrylate,methylmethacrylate,methacrylic acid methyl ester,methyl methylacrylate,methyl 2-methylpropenoate,pegalan,methyl-methacrylat,diakon,acryester m,methyl 2-methyl-2-propenoate PubChem CID: 6658 ChEBI: CHEBI:34840 IUPAC-namn: metyl-2-metylprop-2-enoat LEDER: CC(=C)C(=O)OC
| Molekylformel | C5H8O2 |
|---|---|
| PubChem CID | 6658 |
| MDL-nummer | MFCD00008587 |
| IUPAC-namn | metyl-2-metylprop-2-enoat |
| CAS | 80-62-6 |
| InChI-nyckel | VVQNEPGJFQJSBK-UHFFFAOYSA-N |
| LEDER | CC(=C)C(=O)OC |
| ChEBI | CHEBI:34840 |
| Molekylvikt (g/mol) | 100.12 |
| Synonym | methyl methacrylate,methylmethacrylate,methacrylic acid methyl ester,methyl methylacrylate,methyl 2-methylpropenoate,pegalan,methyl-methacrylat,diakon,acryester m,methyl 2-methyl-2-propenoate |
Methyl benzoate, 99%
CAS: 93-58-3 Molekylformel: C8H8O2 Molekylvikt (g/mol): 136.15 InChI-nyckel: QPJVMBTYPHYUOC-UHFFFAOYSA-N Synonym: methylbenzoate,benzoic acid, methyl ester,clorius,benzoic acid methyl ester,niobe oil,oil of niobe,methyl benzenecarboxylate,essence of niobe,oniobe oil,oxidate le PubChem CID: 7150 ChEBI: CHEBI:72775 IUPAC-namn: metylbensoat LEDER: COC(=O)C1=CC=CC=C1
| Molekylformel | C8H8O2 |
|---|---|
| PubChem CID | 7150 |
| IUPAC-namn | metylbensoat |
| CAS | 93-58-3 |
| InChI-nyckel | QPJVMBTYPHYUOC-UHFFFAOYSA-N |
| LEDER | COC(=O)C1=CC=CC=C1 |
| ChEBI | CHEBI:72775 |
| Molekylvikt (g/mol) | 136.15 |
| Synonym | methylbenzoate,benzoic acid, methyl ester,clorius,benzoic acid methyl ester,niobe oil,oil of niobe,methyl benzenecarboxylate,essence of niobe,oniobe oil,oxidate le |
Dimethyl Phthalate, 99%
CAS: 131-11-3 Molekylformel: C10H10O4 Molekylvikt (g/mol): 194.19 MDL-nummer: MFCD00008425 InChI-nyckel: NIQCNGHVCWTJSM-UHFFFAOYSA-N Synonym: dimethyl phthalate,dimethylphthalate,solvanom,solvarone,avolin,fermine,phthalic acid dimethyl ester,mipax,palatinol m,unimoll dm PubChem CID: 8554 ChEBI: CHEBI:4609 IUPAC-namn: dimetylbensen-1,2-dikarboxylat LEDER: COC(=O)C1=CC=CC=C1C(=O)OC
| Molekylformel | C10H10O4 |
|---|---|
| PubChem CID | 8554 |
| MDL-nummer | MFCD00008425 |
| IUPAC-namn | dimetylbensen-1,2-dikarboxylat |
| CAS | 131-11-3 |
| InChI-nyckel | NIQCNGHVCWTJSM-UHFFFAOYSA-N |
| LEDER | COC(=O)C1=CC=CC=C1C(=O)OC |
| ChEBI | CHEBI:4609 |
| Molekylvikt (g/mol) | 194.19 |
| Synonym | dimethyl phthalate,dimethylphthalate,solvanom,solvarone,avolin,fermine,phthalic acid dimethyl ester,mipax,palatinol m,unimoll dm |
Methyl Propionate, 99+%
CAS: 554-12-1 Molekylformel: C4H8O2 Molekylvikt (g/mol): 88.11 MDL-nummer: MFCD00009306 InChI-nyckel: RJUFJBKOKNCXHH-UHFFFAOYSA-N Synonym: methyl propionate,propanoic acid, methyl ester,methyl propylate,methylpropionate,propionic acid, methyl ester,propionate de methyle,propanoic acid methyl ester,fema number 2742,propionic acid methyl ester,methyl propionate natural PubChem CID: 11124 IUPAC-namn: metylpropanoat LEDER: CCC(=O)OC
| Molekylformel | C4H8O2 |
|---|---|
| PubChem CID | 11124 |
| MDL-nummer | MFCD00009306 |
| IUPAC-namn | metylpropanoat |
| CAS | 554-12-1 |
| InChI-nyckel | RJUFJBKOKNCXHH-UHFFFAOYSA-N |
| LEDER | CCC(=O)OC |
| Molekylvikt (g/mol) | 88.11 |
| Synonym | methyl propionate,propanoic acid, methyl ester,methyl propylate,methylpropionate,propionic acid, methyl ester,propionate de methyle,propanoic acid methyl ester,fema number 2742,propionic acid methyl ester,methyl propionate natural |
Glycidylmetakrylat, 97 %, stabiliserat, Thermo Scientific Chemicals
CAS: 106-91-2 InChI-nyckel: VOZRXNHHFUQHIL-UHFFFAOYSA-N Synonym: glycidyl methacrylate,2,3-epoxypropyl methacrylate,sy-monomer g,glycidol methacrylate,acriester g,blemmer g,blemmer gma,light ester g,glycidylmethacrylate,2-methacryloxy methyl oxirane PubChem CID: 7837 IUPAC-namn: oxiran-2-ylmetyl-2-metylprop-2-enoat LEDER: CC(=C)C(=O)OCC1CO1
| PubChem CID | 7837 |
|---|---|
| IUPAC-namn | oxiran-2-ylmetyl-2-metylprop-2-enoat |
| CAS | 106-91-2 |
| InChI-nyckel | VOZRXNHHFUQHIL-UHFFFAOYSA-N |
| LEDER | CC(=C)C(=O)OCC1CO1 |
| Synonym | glycidyl methacrylate,2,3-epoxypropyl methacrylate,sy-monomer g,glycidol methacrylate,acriester g,blemmer g,blemmer gma,light ester g,glycidylmethacrylate,2-methacryloxy methyl oxirane |
Hydroxypropyl methacrylate, 97+%, mixture of isomers, stabilized
CAS: 27813-02-1 Molekylformel: C7H12O3 Molekylvikt (g/mol): 144.17 MDL-nummer: MFCD00004536 InChI-nyckel: ZMARGGQEAJXRFP-UHFFFAOYNA-N Synonym: 2-hydroxypropyl methacrylate,2-hydroxypropylmethacrylate,hpma,beta-hydroxypropyl methacrylate,acryester hp,2-hydroxypropyl 2-methylacrylate,poly 2-hydroxypropyl methacrylate,2-hydroxypropyl 2-methyl-2-propenoate,2-propenoic acid, 2-methyl-, 2-hydroxypropyl ester,2-hpma PubChem CID: 13539 ChEBI: CHEBI:53440 IUPAC-namn: 2-hydroxipropyl-2-metylprop-2-enoat LEDER: CC(CO)OC(=O)C(C)=C
| Molekylformel | C7H12O3 |
|---|---|
| PubChem CID | 13539 |
| MDL-nummer | MFCD00004536 |
| IUPAC-namn | 2-hydroxipropyl-2-metylprop-2-enoat |
| CAS | 27813-02-1 |
| InChI-nyckel | ZMARGGQEAJXRFP-UHFFFAOYNA-N |
| LEDER | CC(CO)OC(=O)C(C)=C |
| ChEBI | CHEBI:53440 |
| Molekylvikt (g/mol) | 144.17 |
| Synonym | 2-hydroxypropyl methacrylate,2-hydroxypropylmethacrylate,hpma,beta-hydroxypropyl methacrylate,acryester hp,2-hydroxypropyl 2-methylacrylate,poly 2-hydroxypropyl methacrylate,2-hydroxypropyl 2-methyl-2-propenoate,2-propenoic acid, 2-methyl-, 2-hydroxypropyl ester,2-hpma |
Allyl methacrylate, 98%, stabilized
CAS: 96-05-9 Molekylformel: C7H10O2 Molekylvikt (g/mol): 126.16 MDL-nummer: MFCD00008592 InChI-nyckel: FBCQUCJYYPMKRO-UHFFFAOYSA-N Synonym: allyl methacrylate,ageflex ama,methacrylic acid, allyl ester,2-propenoic acid, 2-methyl-, 2-propenyl ester,allylmethacrylate,allyl 2-methylacrylate,allylester kyseliny methakrylove,methacrylic acid allyl ester,unii-g2ig50653z,allylester kyseliny methakrylove czech PubChem CID: 7274 IUPAC-namn: prop-2-enyl-2-metylprop-2-enoat LEDER: CC(=C)C(=O)OCC=C
| Molekylformel | C7H10O2 |
|---|---|
| PubChem CID | 7274 |
| MDL-nummer | MFCD00008592 |
| IUPAC-namn | prop-2-enyl-2-metylprop-2-enoat |
| CAS | 96-05-9 |
| InChI-nyckel | FBCQUCJYYPMKRO-UHFFFAOYSA-N |
| LEDER | CC(=C)C(=O)OCC=C |
| Molekylvikt (g/mol) | 126.16 |
| Synonym | allyl methacrylate,ageflex ama,methacrylic acid, allyl ester,2-propenoic acid, 2-methyl-, 2-propenyl ester,allylmethacrylate,allyl 2-methylacrylate,allylester kyseliny methakrylove,methacrylic acid allyl ester,unii-g2ig50653z,allylester kyseliny methakrylove czech |
Dimethyl acetylenedicarboxylate, 98%
CAS: 762-42-5 Molekylformel: C6H6O4 Molekylvikt (g/mol): 142.11 InChI-nyckel: VHILMKFSCRWWIJ-UHFFFAOYSA-N Synonym: dimethyl acetylenedicarboxylate,2-butynedioic acid, dimethyl ester,1,4-dimethyl but-2-ynedioate,dimethyl butynedioate,dimethyl 2-butynedioate,acetylenedicarboxylic acid dimethyl ester,dmad,methyl acetylenedicarboxylate,bis methoxycarbonyl acetylene,di carbomethoxy acetylene PubChem CID: 12980 IUPAC-namn: dimetylbut-2-ynedioat LEDER: COC(=O)C#CC(=O)OC
| Molekylformel | C6H6O4 |
|---|---|
| PubChem CID | 12980 |
| IUPAC-namn | dimetylbut-2-ynedioat |
| CAS | 762-42-5 |
| InChI-nyckel | VHILMKFSCRWWIJ-UHFFFAOYSA-N |
| LEDER | COC(=O)C#CC(=O)OC |
| Molekylvikt (g/mol) | 142.11 |
| Synonym | dimethyl acetylenedicarboxylate,2-butynedioic acid, dimethyl ester,1,4-dimethyl but-2-ynedioate,dimethyl butynedioate,dimethyl 2-butynedioate,acetylenedicarboxylic acid dimethyl ester,dmad,methyl acetylenedicarboxylate,bis methoxycarbonyl acetylene,di carbomethoxy acetylene |
2-hydroxietylmetakrylat, 97 %, stabiliserat, Thermo Scientific Chemicals
CAS: 868-77-9 Molekylformel: C6H10O3 Molekylvikt (g/mol): 130.14 MDL-nummer: MFCD00002863 InChI-nyckel: WOBHKFSMXKNTIM-UHFFFAOYSA-N Synonym: 2-hydroxyethyl methacrylate,glycol methacrylate,hydroxyethyl methacrylate,glycol monomethacrylate,hema,ethylene glycol methacrylate,2-methacryloyloxy ethanol,2-hydroxyethylmethacrylate,mhoromer,monomer mg-1 PubChem CID: 13360 ChEBI: CHEBI:34288 IUPAC-namn: 2-hydroxietyl-2-metylprop-2-enoat LEDER: CC(=C)C(=O)OCCO
| Molekylformel | C6H10O3 |
|---|---|
| PubChem CID | 13360 |
| MDL-nummer | MFCD00002863 |
| IUPAC-namn | 2-hydroxietyl-2-metylprop-2-enoat |
| CAS | 868-77-9 |
| InChI-nyckel | WOBHKFSMXKNTIM-UHFFFAOYSA-N |
| LEDER | CC(=C)C(=O)OCCO |
| ChEBI | CHEBI:34288 |
| Molekylvikt (g/mol) | 130.14 |
| Synonym | 2-hydroxyethyl methacrylate,glycol methacrylate,hydroxyethyl methacrylate,glycol monomethacrylate,hema,ethylene glycol methacrylate,2-methacryloyloxy ethanol,2-hydroxyethylmethacrylate,mhoromer,monomer mg-1 |
Methyl 1-cyclohexene-1-carboxylate, 98%
CAS: 18448-47-0 MDL-nummer: MFCD00001544 InChI-nyckel: KXPWRCPEMHIZGU-UHFFFAOYSA-N Synonym: methyl 1-cyclohexene-1-carboxylate,methyl cyclohex-1-enecarboxylate,methyl 1-cyclohexenecarboxylate,methyl cyclohex-1-ene-1-carboxylate,1-cyclohexene-1-carboxylic acid, methyl ester,cyclohexenecarboxylic acid, methyl ester,cyclohexene-1-carboxylic acid methyl ester,methyl1-cyclohexene-1-carboxylate,pubchem11031,1-carbomethoxy cyclohexene PubChem CID: 87647 IUPAC-namn: metylcyklohexen-1-karboxylat LEDER: COC(=O)C1=CCCCC1
| PubChem CID | 87647 |
|---|---|
| MDL-nummer | MFCD00001544 |
| IUPAC-namn | metylcyklohexen-1-karboxylat |
| CAS | 18448-47-0 |
| InChI-nyckel | KXPWRCPEMHIZGU-UHFFFAOYSA-N |
| LEDER | COC(=O)C1=CCCCC1 |
| Synonym | methyl 1-cyclohexene-1-carboxylate,methyl cyclohex-1-enecarboxylate,methyl 1-cyclohexenecarboxylate,methyl cyclohex-1-ene-1-carboxylate,1-cyclohexene-1-carboxylic acid, methyl ester,cyclohexenecarboxylic acid, methyl ester,cyclohexene-1-carboxylic acid methyl ester,methyl1-cyclohexene-1-carboxylate,pubchem11031,1-carbomethoxy cyclohexene |
Dimethyl trans-1,4-cyclohexanedicarboxylate, 99+%
CAS: 3399-22-2 Molekylformel: C10H16O4 Molekylvikt (g/mol): 200.23 MDL-nummer: MFCD00063917,MFCD00001460,MFCD00216473 InChI-nyckel: LNGAGQAGYITKCW-UHFFFAOYSA-N Synonym: dimethyl 1,4-cyclohexanedicarboxylate,dimethyl trans-1,4-cyclohexanedicarboxylate,1r,4r-dimethyl cyclohexane-1,4-dicarboxylate,cis-dimethyl cyclohexane-1,4-dicarboxylate,dimethyl trans-cyclohexane-1,4-dicarboxylate,1,4-cyclohexanedicarboxylic acid, dimethyl ester,dimethyl hexahydroterephthalate,trans-dimethyl cyclohexane-1,4-dicarboxylate,1,4-cyclohexanedicarboxylic acid, dimethyl ester, trans,unii-ys87mds0zv PubChem CID: 7198 IUPAC-namn: dimetylcyklohexan-1,4-dikarboxylat LEDER: COC(=O)C1CCC(CC1)C(=O)OC
| Molekylformel | C10H16O4 |
|---|---|
| PubChem CID | 7198 |
| MDL-nummer | MFCD00063917,MFCD00001460,MFCD00216473 |
| IUPAC-namn | dimetylcyklohexan-1,4-dikarboxylat |
| CAS | 3399-22-2 |
| InChI-nyckel | LNGAGQAGYITKCW-UHFFFAOYSA-N |
| LEDER | COC(=O)C1CCC(CC1)C(=O)OC |
| Molekylvikt (g/mol) | 200.23 |
| Synonym | dimethyl 1,4-cyclohexanedicarboxylate,dimethyl trans-1,4-cyclohexanedicarboxylate,1r,4r-dimethyl cyclohexane-1,4-dicarboxylate,cis-dimethyl cyclohexane-1,4-dicarboxylate,dimethyl trans-cyclohexane-1,4-dicarboxylate,1,4-cyclohexanedicarboxylic acid, dimethyl ester,dimethyl hexahydroterephthalate,trans-dimethyl cyclohexane-1,4-dicarboxylate,1,4-cyclohexanedicarboxylic acid, dimethyl ester, trans,unii-ys87mds0zv |
Ethyl propiolate, 99%
CAS: 623-47-2 Molekylformel: C5H6O2 Molekylvikt (g/mol): 98.10 MDL-nummer: MFCD00009184 InChI-nyckel: FMVJYQGSRWVMQV-UHFFFAOYSA-N Synonym: ethyl propiolate,ethyl acetylenecarboxylate,2-propynoic acid, ethyl ester,propiolic acid ethyl ester,ethyl propynoate,ethoxycarbonyl acetylene,ethyl 2-propynoate,propiolic acid, ethyl ester,unii-w235g5u52s,propynoic acid ethyl ester PubChem CID: 12182 ChEBI: CHEBI:51740 IUPAC-namn: etylprop-2-ynoat LEDER: CCOC(=O)C#C
| Molekylformel | C5H6O2 |
|---|---|
| PubChem CID | 12182 |
| MDL-nummer | MFCD00009184 |
| IUPAC-namn | etylprop-2-ynoat |
| CAS | 623-47-2 |
| InChI-nyckel | FMVJYQGSRWVMQV-UHFFFAOYSA-N |
| LEDER | CCOC(=O)C#C |
| ChEBI | CHEBI:51740 |
| Molekylvikt (g/mol) | 98.10 |
| Synonym | ethyl propiolate,ethyl acetylenecarboxylate,2-propynoic acid, ethyl ester,propiolic acid ethyl ester,ethyl propynoate,ethoxycarbonyl acetylene,ethyl 2-propynoate,propiolic acid, ethyl ester,unii-w235g5u52s,propynoic acid ethyl ester |
Isopropenylacetat, 99 %, Thermo Scientific Chemicals
CAS: 108-22-5 Molekylformel: C5H8O2 Molekylvikt (g/mol): 100.12 MDL-nummer: MFCD00008709 InChI-nyckel: HETCEOQFVDFGSY-UHFFFAOYSA-N Synonym: isopropenyl acetate,2-acetoxypropene,1-methylvinyl acetate,2-acetoxypropylene,methylvinyl acetate,1-propen-2-ol, acetate,propen-2-yl acetate,acetic acid isopropenyl ester,1-acetoxy-1-methylethylene,1-propen-2-yl acetate PubChem CID: 7916 IUPAC-namn: prop-l-en-2-ylacetat LEDER: CC(=C)OC(C)=O
| Molekylformel | C5H8O2 |
|---|---|
| PubChem CID | 7916 |
| MDL-nummer | MFCD00008709 |
| IUPAC-namn | prop-l-en-2-ylacetat |
| CAS | 108-22-5 |
| InChI-nyckel | HETCEOQFVDFGSY-UHFFFAOYSA-N |
| LEDER | CC(=C)OC(C)=O |
| Molekylvikt (g/mol) | 100.12 |
| Synonym | isopropenyl acetate,2-acetoxypropene,1-methylvinyl acetate,2-acetoxypropylene,methylvinyl acetate,1-propen-2-ol, acetate,propen-2-yl acetate,acetic acid isopropenyl ester,1-acetoxy-1-methylethylene,1-propen-2-yl acetate |
Methyl DL-lactate, 99%
CAS: 547-64-8 MDL-nummer: MFCD00066367 InChI-nyckel: LPEKGGXMPWTOCB-UHFFFAOYSA-N Synonym: methyl lactate,dl-methyl lactate,methyl dl-lactate,lactic acid methyl ester,methyl 2-hydroxypropionate,lactic acid, methyl ester,+--methyl lactate,propanoic acid, 2-hydroxy-, methyl ester,methyl alpha-hydroxypropionate,methyl-lactate PubChem CID: 11040 ChEBI: CHEBI:83221 IUPAC-namn: metyl-2-hydroxipropanoat LEDER: CC(C(=O)OC)O
| PubChem CID | 11040 |
|---|---|
| MDL-nummer | MFCD00066367 |
| IUPAC-namn | metyl-2-hydroxipropanoat |
| CAS | 547-64-8 |
| InChI-nyckel | LPEKGGXMPWTOCB-UHFFFAOYSA-N |
| LEDER | CC(C(=O)OC)O |
| ChEBI | CHEBI:83221 |
| Synonym | methyl lactate,dl-methyl lactate,methyl dl-lactate,lactic acid methyl ester,methyl 2-hydroxypropionate,lactic acid, methyl ester,+--methyl lactate,propanoic acid, 2-hydroxy-, methyl ester,methyl alpha-hydroxypropionate,methyl-lactate |
Methyl (R)-(+)-lactate, 98%
CAS: 17392-83-5 Molekylformel: C4H8O3 Molekylvikt (g/mol): 104.11 MDL-nummer: MFCD00004517 InChI-nyckel: LPEKGGXMPWTOCB-UHFFFAOYNA-N Synonym: methyl r-+-lactate,methyl d-lactate,r-methyl 2-hydroxypropanoate,methyl r-lactate,+-methyl d-lactate,methyl 2r-2-hydroxypropanoate,d-lactic acid methyl ester,methyl lactate, +,unii-45mz1t3tbv,r-methyl lactate PubChem CID: 637514 ChEBI: CHEBI:74611 LEDER: COC(=O)C(C)O
| Molekylformel | C4H8O3 |
|---|---|
| PubChem CID | 637514 |
| MDL-nummer | MFCD00004517 |
| CAS | 17392-83-5 |
| InChI-nyckel | LPEKGGXMPWTOCB-UHFFFAOYNA-N |
| LEDER | COC(=O)C(C)O |
| ChEBI | CHEBI:74611 |
| Molekylvikt (g/mol) | 104.11 |
| Synonym | methyl r-+-lactate,methyl d-lactate,r-methyl 2-hydroxypropanoate,methyl r-lactate,+-methyl d-lactate,methyl 2r-2-hydroxypropanoate,d-lactic acid methyl ester,methyl lactate, +,unii-45mz1t3tbv,r-methyl lactate |