Filtrerade sökresultat
| Molekylformel | (C2H4O)y(C2H4O)w(C2H4O)x(C2H4O)zC18H34O6 |
|---|---|
| Densitet | 1.100g/cm³ |
| Rekommenderad förvaring | RT |
| MDL-nummer | MFCD00165986 |
| IUPAC-namn | 2-[2-[3,4-bis(2-hydroxietoxi)oxolan-2-yl]-2-(2-hydroxietoxi)etoxi]etyldodekanoat |
| InChI-nyckel | HMFKFHLTUCJZJO-UHFFFAOYNA-N |
| Viskositet | 400 mPa/s at 25°C |
| Hälsofara 3 | Emergency Overview May cause eye, skin, and respiratory tract irritation. Use personal protective equipment. Ensure adequate ventilation. Wash off immediately with plenty of water for at least 15 minutes. Get medical attention immediately if symptoms occur. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Obtain medical attention. Move to fresh air. If breathing is difficult, give oxygen. Get medical attention immediately if symptoms occur. Do not induce vomiting. Obtain medical attention. Obtain medical attention. . NFPA Health:1 Flammability:1 Instability:0 |
| Hälsofara 2 | CAUTION! |
| Kokpunkt | 100 °C |
| ChemAlert lagringssymbol | Gray |
| Identifiering | Pass Test |
| Tändningsrester | 0.25% max. |
| Fysisk form | Viskös vätska |
| Färg | Bärnsten |
| PubChem CID | 443314 |
| Hydroxylvärde | 96 to 108 |
| CAS | 9005-64-5 |
| LEDER | CCCCCCCCCCCC(=O)OCCOCC(OCCO)C1OCC(OCCO)C1OCCO |
| Molekylvikt (g/mol) | 522.68 |
| pH | 6 |
| Synonym | Polyoxyethylene-20-sorbitan Monolaurate,Polyoxyethylenesorbitan monolaurate |
| Vatten | 3% max. |
| Kemiskt namn eller material | Polysorbate 20 |
Natriumdodecylsulfat (SDS), vitt pulver, elektrofores, Fisher BioReagents™
Molekylformel: C12H25NaO4S Molekylvikt (g/mol): 288.38 MDL-nummer: MFCD00036175 InChI-nyckel: DBMJMQXJHONAFJ-UHFFFAOYSA-M Synonym: Sodium Lauryl Sulfate,SDS PubChem CID: 3423265 ChEBI: CHEBI:8984 IUPAC-namn: sodium dodecyl sulfate LEDER: [Na+].CCCCCCCCCCCCOS([O-])(=O)=O
| Molekylformel | C12H25NaO4S |
|---|---|
| PubChem CID | 3423265 |
| MDL-nummer | MFCD00036175 |
| IUPAC-namn | sodium dodecyl sulfate |
| InChI-nyckel | DBMJMQXJHONAFJ-UHFFFAOYSA-M |
| LEDER | [Na+].CCCCCCCCCCCCOS([O-])(=O)=O |
| ChEBI | CHEBI:8984 |
| Molekylvikt (g/mol) | 288.38 |
| Synonym | Sodium Lauryl Sulfate,SDS |
Agaros (bredt separationsintervall för DNA/RNA/genetisk analysgrad), Fisher BioReagents™
CAS: 9012-36-6 Molekylformel: C12H18O9
| Molekylformel | C12H18O9 |
|---|---|
| CAS | 9012-36-6 |
Agaros (Låg-EEO/Multi-Purpose/Molecular Biology Grade), Fisher BioReagents™
CAS: 9012-36-6 Molekylformel: C12H18O9
| Molekylformel | C12H18O9 |
|---|---|
| CAS | 9012-36-6 |
Ditiotreitol (vita kristaller eller pulver/elektrofores), Fisher BioReagents™
CAS: 12-3-3483 Molekylformel: C4H10O2S2 Molekylvikt (g/mol): 154.24 InChI-nyckel: VHJLVAABSRFDPM-IMJSIDKUSA-N Synonym: dithiothreitol,dl-1,4-dithiothreitol,dl-dithiothreitol,1,4-dithio-dl-threitol,d-1,4-dithiothreitol,d-dtt,2s,3s-1,4-dimercaptobutane-2,3-diol,threo-1,4-dimercapto-2,3-butanediol,1,4-dithiothreitol,dtt PubChem CID: 446094 ChEBI: CHEBI:42170 IUPAC-namn: (2S,3S)-1,4-bis(sulfanyl)butan-2,3-diol LEDER: C(C(C(CS)O)O)S
| Molekylformel | C4H10O2S2 |
|---|---|
| PubChem CID | 446094 |
| IUPAC-namn | (2S,3S)-1,4-bis(sulfanyl)butan-2,3-diol |
| CAS | 12-3-3483 |
| InChI-nyckel | VHJLVAABSRFDPM-IMJSIDKUSA-N |
| LEDER | C(C(C(CS)O)O)S |
| ChEBI | CHEBI:42170 |
| Molekylvikt (g/mol) | 154.24 |
| Synonym | dithiothreitol,dl-1,4-dithiothreitol,dl-dithiothreitol,1,4-dithio-dl-threitol,d-1,4-dithiothreitol,d-dtt,2s,3s-1,4-dimercaptobutane-2,3-diol,threo-1,4-dimercapto-2,3-butanediol,1,4-dithiothreitol,dtt |
Triton™ X-100 (Elektrofores), Fisher BioReagents™
CAS: 9002-93-1 Molekylformel: C16H26O2 Molekylvikt (g/mol): 250.38 MDL-nummer: MFCD00132505 InChI-nyckel: JYCQQPHGFMYQCF-UHFFFAOYSA-N Synonym: Polyethylene Glycol p-tert-Octylphenyl Ether PubChem CID: 5590 LEDER: CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1
| Molekylformel | C16H26O2 |
|---|---|
| PubChem CID | 5590 |
| MDL-nummer | MFCD00132505 |
| CAS | 9002-93-1 |
| InChI-nyckel | JYCQQPHGFMYQCF-UHFFFAOYSA-N |
| LEDER | CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1 |
| Molekylvikt (g/mol) | 250.38 |
| Synonym | Polyethylene Glycol p-tert-Octylphenyl Ether |
Akrylamid (vita, nålliknande kristaller/elektrofores), Fisher BioReagents
CAS: 79-06-1 Molekylformel: C3H5NO Molekylvikt (g/mol): 71.08 MDL-nummer: MFCD00008032 InChI-nyckel: HRPVXLWXLXDGHG-UHFFFAOYSA-N PubChem CID: 6579 ChEBI: CHEBI:28619 IUPAC-namn: prop-2-enamid LEDER: NC(=O)C=C
| Molekylformel | C3H5NO |
|---|---|
| PubChem CID | 6579 |
| MDL-nummer | MFCD00008032 |
| IUPAC-namn | prop-2-enamid |
| CAS | 79-06-1 |
| InChI-nyckel | HRPVXLWXLXDGHG-UHFFFAOYSA-N |
| LEDER | NC(=O)C=C |
| ChEBI | CHEBI:28619 |
| Molekylvikt (g/mol) | 71.08 |