Filtrerade sökresultat
Lithium bis(trimethylsilyl)amide, 1M solution in THF, AcroSeal™
CAS: 4039-32-1 | C6H18LiNSi2 | 167.33 g/mol
| Molekylformel | C6H18LiNSi2 |
|---|---|
| Densitet | 0.9 |
| Formel vikt | 167.33 |
| IUPAC-namn | litium;bis(trimetylsilyl)azanid |
| InChI-nyckel | YNESATAKKCNGOF-UHFFFAOYSA-N |
| Hälsofara 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Wear protective gloves/protective clothing/eye p |
| Hälsofara 2 | GHS H Statement Highly flammable liquid and vapor. Causes severe skin burns and eye damage. May cause respiratory irritation. Suspected of causing cancer. May form explosive peroxides. Reacts violently with water.<br/ |
| Kokpunkt | 65.0°C |
| Hälsofara 1 | GHS-signalord: Fara |
| Löslighetsinformation | Solubility in water: reacts. |
| PubChem CID | 2733832 |
| Flampunkt | −21°C |
| Fieser | 04,296; 05,393; 07,197; 12,280; 13,165; 14,194 |
| Linjär formel | ((CH3)3Si)2NLi |
| CAS | 109-99-9 |
| LEDER | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| Molekylvikt (g/mol) | 167.33 |
| EINECS-nummer | 223-725-6 |
| Synonym | lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| Kemiskt namn eller material | Lithium bis(trimethylsilyl)amide |
Diisobutylaluminium hydride, 1M solution in hexane, AcroSeal™
CAS: 1191-15-7 | C8H19Al | 142.22 g/mol
| Molekylformel | C8H19Al |
|---|---|
| Densitet | 0.701 |
| MDL-nummer | MFCD00008928 |
| Formel vikt | 142.22 |
| Hälsofara 3 | GHS P Statement IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsing. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Wear protective g |
| Hälsofara 2 | GHS H Statement May be fatal if swallowed and enters airways. Toxic to aquatic life with long lasting effects. Causes severe skin burns and eye damage. May cause drowsiness or dizziness. May cause damage to organs through p |
| Hälsofara 1 | GHS-signalord: Fara |
| Löslighetsinformation | Solubility in water: reacts |
| Merck Index | 15, 3212 |
| Fysisk form | Lösning |
| Flampunkt | −23°C |
| Smältpunkt | -70.0°C |
| Fieser | 01,260; 02,140; 03,101; 04,158; 05,224; 06,198; 07,111; 08,173; 09,171; 10,149; 11,185; 12,191; 13,115; 14,138; 15,137; 16,27; 17,123 |
| Linjär formel | [(CH3)2CHCH2]2AlH |
| CAS | 110-54-3 |
| Namnnotering | 1M Solution in Hexane |
| Molekylvikt (g/mol) | 142.22 |
| EINECS-nummer | 214-729-9 |
| Synonym | DIBAL-H |
| Kemiskt namn eller material | Diisobutylaluminium hydride |
| Beilstein | 04, IV, 4400 |
Sodium tetraethylborate, 97%, pure, Thermo Scientific Chemicals
CAS: 15523-24-7 Molekylformel: C8H20BNa Molekylvikt (g/mol): 150.04 MDL-nummer: MFCD00061547 InChI-nyckel: SZSBMTRYJRHYNI-UHFFFAOYSA-N Synonym: sodium tetraethylborate,sodium tetraethylboranuide,borate 1-,tetraethyl-, sodium 1:1,sodium tetraethylborate 1-,et4bna,sodiotetraethylboron v,borate 1-, tetraethyl-, sodium,sodium tetraethylborate 1g PubChem CID: 23681030 IUPAC-namn: natrium;tetraetylboranuid LEDER: [B-](CC)(CC)(CC)CC.[Na+]
| Molekylformel | C8H20BNa |
|---|---|
| PubChem CID | 23681030 |
| MDL-nummer | MFCD00061547 |
| IUPAC-namn | natrium;tetraetylboranuid |
| CAS | 15523-24-7 |
| InChI-nyckel | SZSBMTRYJRHYNI-UHFFFAOYSA-N |
| LEDER | [B-](CC)(CC)(CC)CC.[Na+] |
| Molekylvikt (g/mol) | 150.04 |
| Synonym | sodium tetraethylborate,sodium tetraethylboranuide,borate 1-,tetraethyl-, sodium 1:1,sodium tetraethylborate 1-,et4bna,sodiotetraethylboron v,borate 1-, tetraethyl-, sodium,sodium tetraethylborate 1g |
Chlorotrimethylsilane, 98%
CAS: 75-77-4 Molekylformel: C3H9ClSi Molekylvikt (g/mol): 108.64 MDL-nummer: MFCD00000502 InChI-nyckel: IJOOHPMOJXWVHK-UHFFFAOYSA-N Synonym: trimethylchlorosilane,trimethylsilyl chloride,silane, chlorotrimethyl,trimethyl chlorosilane,monochlorotrimethylsilicon,tmcs,chloro trimethyl silane,silane, trimethylchloro,silicane, chlorotrimethyl,tmscl PubChem CID: 6397 ChEBI: CHEBI:85069 IUPAC-namn: klor(trimetyl)silan LEDER: C[Si](C)(C)Cl
| Molekylformel | C3H9ClSi |
|---|---|
| PubChem CID | 6397 |
| MDL-nummer | MFCD00000502 |
| IUPAC-namn | klor(trimetyl)silan |
| CAS | 75-77-4 |
| InChI-nyckel | IJOOHPMOJXWVHK-UHFFFAOYSA-N |
| LEDER | C[Si](C)(C)Cl |
| ChEBI | CHEBI:85069 |
| Molekylvikt (g/mol) | 108.64 |
| Synonym | trimethylchlorosilane,trimethylsilyl chloride,silane, chlorotrimethyl,trimethyl chlorosilane,monochlorotrimethylsilicon,tmcs,chloro trimethyl silane,silane, trimethylchloro,silicane, chlorotrimethyl,tmscl |
Hexamethyldisilazane, 98+%
CAS: 999-97-3 Molekylformel: C6H19NSi2 Molekylvikt (g/mol): 161.395 MDL-nummer: MFCD00008259 InChI-nyckel: FFUAGWLWBBFQJT-UHFFFAOYSA-N Synonym: hexamethyldisilazane,bis trimethylsilyl amine,hmds,1,1,1,3,3,3-hexamethyldisilazane,hexamethylsilazane,silanamine, 1,1,1-trimethyl-n-trimethylsilyl,tri-sil,1,1,1-trimethyl-n-trimethylsilyl silanamine,hexamethyldisilizane,disilazane, 1,1,1,3,3,3-hexamethyl PubChem CID: 13838 ChEBI: CHEBI:85068 IUPAC-namn: [dimetyl-(trimetylsilylamino)silyl]metan LEDER: C[Si](C)(C)N[Si](C)(C)C
| Molekylformel | C6H19NSi2 |
|---|---|
| PubChem CID | 13838 |
| MDL-nummer | MFCD00008259 |
| IUPAC-namn | [dimetyl-(trimetylsilylamino)silyl]metan |
| CAS | 999-97-3 |
| InChI-nyckel | FFUAGWLWBBFQJT-UHFFFAOYSA-N |
| LEDER | C[Si](C)(C)N[Si](C)(C)C |
| ChEBI | CHEBI:85068 |
| Molekylvikt (g/mol) | 161.395 |
| Synonym | hexamethyldisilazane,bis trimethylsilyl amine,hmds,1,1,1,3,3,3-hexamethyldisilazane,hexamethylsilazane,silanamine, 1,1,1-trimethyl-n-trimethylsilyl,tri-sil,1,1,1-trimethyl-n-trimethylsilyl silanamine,hexamethyldisilizane,disilazane, 1,1,1,3,3,3-hexamethyl |
Hexamethyldisiloxane, 98+%
CAS: 107-46-0 InChI-nyckel: UQEAIHBTYFGYIE-UHFFFAOYSA-N Synonym: hexamethyldisiloxane,disiloxane, hexamethyl,hexamethyl disiloxane,oxybis trimethylsilane,fluka ag,hmdso,bis trimethylsilyl ether,belsil dm 0.65,bis trimethylsilyl oxide PubChem CID: 24764 ChEBI: CHEBI:78002 IUPAC-namn: trimetyl(trimetylsilyloxi)silan LEDER: C[Si](C)(C)O[Si](C)(C)C
| PubChem CID | 24764 |
|---|---|
| IUPAC-namn | trimetyl(trimetylsilyloxi)silan |
| CAS | 107-46-0 |
| InChI-nyckel | UQEAIHBTYFGYIE-UHFFFAOYSA-N |
| LEDER | C[Si](C)(C)O[Si](C)(C)C |
| ChEBI | CHEBI:78002 |
| Synonym | hexamethyldisiloxane,disiloxane, hexamethyl,hexamethyl disiloxane,oxybis trimethylsilane,fluka ag,hmdso,bis trimethylsilyl ether,belsil dm 0.65,bis trimethylsilyl oxide |
3-(Trimethoxysilyl)propyl methacrylate, 98%
CAS: 2530-85-0 Molekylformel: C10H20O5Si Molekylvikt (g/mol): 248.35 MDL-nummer: MFCD00008593 InChI-nyckel: XDLMVUHYZWKMMD-UHFFFAOYSA-N Synonym: 3-trimethoxysilyl propyl methacrylate,3-methacryloxypropyltrimethoxysilane,methacryloxypropyltrimethoxysilane,dynasylan memo,silicone a-174,union carbide a-174,mops-m,silane a-174,nuca 174,2-propenoic acid, 2-methyl-, 3-trimethoxysilyl propyl ester PubChem CID: 17318 IUPAC-namn: 3-trimetoxisilylpropyl-2-metylprop-2-enoat LEDER: CC(=C)C(=O)OCCC[Si](OC)(OC)OC
| Molekylformel | C10H20O5Si |
|---|---|
| PubChem CID | 17318 |
| MDL-nummer | MFCD00008593 |
| IUPAC-namn | 3-trimetoxisilylpropyl-2-metylprop-2-enoat |
| CAS | 2530-85-0 |
| InChI-nyckel | XDLMVUHYZWKMMD-UHFFFAOYSA-N |
| LEDER | CC(=C)C(=O)OCCC[Si](OC)(OC)OC |
| Molekylvikt (g/mol) | 248.35 |
| Synonym | 3-trimethoxysilyl propyl methacrylate,3-methacryloxypropyltrimethoxysilane,methacryloxypropyltrimethoxysilane,dynasylan memo,silicone a-174,union carbide a-174,mops-m,silane a-174,nuca 174,2-propenoic acid, 2-methyl-, 3-trimethoxysilyl propyl ester |
N,O-Bis(trimethylsilyl)trifluoroacetamide, 98+%
CAS: 25561-30-2 Molekylformel: C8H18F3NOSi2 MDL-nummer: MFCD00008269 Synonym: bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate PubChem CID: 9601896
| Molekylformel | C8H18F3NOSi2 |
|---|---|
| PubChem CID | 9601896 |
| MDL-nummer | MFCD00008269 |
| CAS | 25561-30-2 |
| Synonym | bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate |
3-aminopropyltrietoxisilan, 99 %, AcroSeal™ , Thermo Scientific Chemicals
CAS: 919-30-2 Molekylformel: C9H23NO3Si Molekylvikt (g/mol): 221.37 MDL-nummer: MFCD00008207,MFCD01324904 InChI-nyckel: WYTZZXDRDKSJID-UHFFFAOYSA-N Synonym: 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane PubChem CID: 13521 IUPAC-namn: 3-trietoxisilylpropan-1-amin LEDER: CCO[Si](CCCN)(OCC)OCC
| Molekylformel | C9H23NO3Si |
|---|---|
| PubChem CID | 13521 |
| MDL-nummer | MFCD00008207,MFCD01324904 |
| IUPAC-namn | 3-trietoxisilylpropan-1-amin |
| CAS | 919-30-2 |
| InChI-nyckel | WYTZZXDRDKSJID-UHFFFAOYSA-N |
| LEDER | CCO[Si](CCCN)(OCC)OCC |
| Molekylvikt (g/mol) | 221.37 |
| Synonym | 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane |
Dichlorodimethylsilane, 99+%, AcroSeal™
CAS: 75-78-5 Molekylformel: C2H6Cl2Si Molekylvikt (g/mol): 129.06 MDL-nummer: MFCD00000491 InChI-nyckel: LIKFHECYJZWXFJ-UHFFFAOYSA-N Synonym: dimethyldichlorosilane,silane, dichlorodimethyl,dichloro dimethyl silane,inerton aw-dmcs,dichlorodimethylsilicon,dimethyl-dichlorsilan,inerton dw-dmc,repel-silan,dimethylsilane dichloride,dimethyl dichlorosilane PubChem CID: 6398 IUPAC-namn: diklor(dimetyl)silan LEDER: C[Si](C)(Cl)Cl
| Molekylformel | C2H6Cl2Si |
|---|---|
| PubChem CID | 6398 |
| MDL-nummer | MFCD00000491 |
| IUPAC-namn | diklor(dimetyl)silan |
| CAS | 75-78-5 |
| InChI-nyckel | LIKFHECYJZWXFJ-UHFFFAOYSA-N |
| LEDER | C[Si](C)(Cl)Cl |
| Molekylvikt (g/mol) | 129.06 |
| Synonym | dimethyldichlorosilane,silane, dichlorodimethyl,dichloro dimethyl silane,inerton aw-dmcs,dichlorodimethylsilicon,dimethyl-dichlorsilan,inerton dw-dmc,repel-silan,dimethylsilane dichloride,dimethyl dichlorosilane |
3-Aminopropyltriethoxysilane, 99%
CAS: 919-30-2 Molekylformel: C9H23NO3Si Molekylvikt (g/mol): 221.37 MDL-nummer: MFCD00008207,MFCD01324904 InChI-nyckel: WYTZZXDRDKSJID-UHFFFAOYSA-N Synonym: 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane PubChem CID: 13521 IUPAC-namn: 3-trietoxisilylpropan-1-amin LEDER: CCO[Si](CCCN)(OCC)OCC
| Molekylformel | C9H23NO3Si |
|---|---|
| PubChem CID | 13521 |
| MDL-nummer | MFCD00008207,MFCD01324904 |
| IUPAC-namn | 3-trietoxisilylpropan-1-amin |
| CAS | 919-30-2 |
| InChI-nyckel | WYTZZXDRDKSJID-UHFFFAOYSA-N |
| LEDER | CCO[Si](CCCN)(OCC)OCC |
| Molekylvikt (g/mol) | 221.37 |
| Synonym | 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane |
Diisobutylaluminiumhydrid, 1,2M (20 vikt%) lösning i toluen, AcroSeal™ , Thermo Scientific Chemicals
CAS: 1191-15-7 | C8H19Al | 142.22 g/mol
| Molekylformel | C8H19Al |
|---|---|
| Densitet | 0.848 |
| MDL-nummer | MFCD00008928 |
| Formel vikt | 142.22 |
| Hälsofara 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsi |
| Hälsofara 2 | GHS H Statement Causes severe skin burns and eye damage. May be fatal if swallowed and enters airways. May cause damage to organs through prolonged or repeated exposure. Suspected of damaging the unborn child. May cause dro |
| Kokpunkt | 110.0°C |
| Hälsofara 1 | GHS-signalord: Fara |
| Löslighetsinformation | Solubility in water: reacts violently. Other solubilities: miscible with saturated aliphatic and aromatic,hydrocarbons |
| Merck Index | 15, 3212 |
| Fysisk form | Lösning |
| Flampunkt | 4°C |
| Fieser | 01,260; 02,140; 03,101; 04,158; 05,224; 06,198; 07,111; 08,173; 09,171; 10,149; 11,185; 12,191; 13,115; 14,138; 15,137; 16,27; 17,123 |
| Linjär formel | [(CH3)2CHCH2]2AIH |
| CAS | 108-88-3 |
| Molekylvikt (g/mol) | 142.22 |
| EINECS-nummer | 214-729-9 |
| Synonym | DIBAL-H |
| Kemiskt namn eller material | Diisobutylaluminium hydride |
| Beilstein | 04, IV, 4400 |
| Molekylformel | C{4}H{9}Li |
|---|---|
| CAS | 109-72-8 |
| Fysisk form | Vätska |