Filtrerade sökresultat
Väteperoxid 6 % (vikt/volym) (20 volymer), extra ren SLR, Fisher Chemical™
CAS: 7722-84-1 Molekylformel: H2O2 Molekylvikt (g/mol): 34.014 MDL-nummer: 11333 InChI-nyckel: MHAJPDPJQMAIIY-UHFFFAOYSA-N Synonym: oxydol,perhydrol,superoxol,interox,hydrogen dioxide,inhibine,peroxaan,albone,hioxyl,kastone PubChem CID: 784 ChEBI: CHEBI:16240 IUPAC-namn: väteperoxid LEDER: OO
| Molekylformel | H2O2 |
|---|---|
| PubChem CID | 784 |
| MDL-nummer | 11333 |
| IUPAC-namn | väteperoxid |
| CAS | 7722-84-1 |
| InChI-nyckel | MHAJPDPJQMAIIY-UHFFFAOYSA-N |
| LEDER | OO |
| ChEBI | CHEBI:16240 |
| Molekylvikt (g/mol) | 34.014 |
| Synonym | oxydol,perhydrol,superoxol,interox,hydrogen dioxide,inhibine,peroxaan,albone,hioxyl,kastone |
Thermo Scientific Chemicals Ethidium bromidavfärgningspåsar, med aktiveringslösning.
Natriumhydroxid, 0,05N standardiserad lösning, Thermo Scientific Chemicals
CAS: 1310-73-2 Molekylformel: HNaO Molekylvikt (g/mol): 39.997 MDL-nummer: MFCD00003548 InChI-nyckel: HEMHJVSKTPXQMS-UHFFFAOYSA-M Synonym: sodium hydroxide,caustic soda,sodium hydrate,white caustic,soda lye,aetznatron,ascarite,sodium hydroxide na oh,sodium hydroxide solution,soda, caustic PubChem CID: 14798 ChEBI: CHEBI:32145 IUPAC-namn: natrium;hydroxid LEDER: [OH-].[Na+]
| Molekylformel | HNaO |
|---|---|
| PubChem CID | 14798 |
| MDL-nummer | MFCD00003548 |
| IUPAC-namn | natrium;hydroxid |
| CAS | 1310-73-2 |
| InChI-nyckel | HEMHJVSKTPXQMS-UHFFFAOYSA-M |
| LEDER | [OH-].[Na+] |
| ChEBI | CHEBI:32145 |
| Molekylvikt (g/mol) | 39.997 |
| Synonym | sodium hydroxide,caustic soda,sodium hydrate,white caustic,soda lye,aetznatron,ascarite,sodium hydroxide na oh,sodium hydroxide solution,soda, caustic |
Etylendiamintetraättiksyra (0,5 M lösning/pH 8,0), Fisher BioReagents
CAS: 60-00-4 Molekylformel: C10H16N2O8 Molekylvikt (g/mol): 292.24 MDL-nummer: MFCD00003541 InChI-nyckel: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 IUPAC-namn: 2-[2-[bis(karboximetyl)amino]etyl-(karboximetyl)amino]ättiksyra LEDER: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| Molekylformel | C10H16N2O8 |
|---|---|
| PubChem CID | 6049 |
| MDL-nummer | MFCD00003541 |
| IUPAC-namn | 2-[2-[bis(karboximetyl)amino]etyl-(karboximetyl)amino]ättiksyra |
| CAS | 60-00-4 |
| InChI-nyckel | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| LEDER | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| ChEBI | CHEBI:42191 |
| Molekylvikt (g/mol) | 292.24 |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
Silvernitratlösning 0,1 M (0,1 N), NIST Standardlösning redo att användas, för volymetrisk analys, uppfyller analytiska specifikationer för pH.Eur., Bp, Usp, Fisher Chemical™
CAS: 7761-88-8 Molekylformel: AgNO3 Molekylvikt (g/mol): 169.87 MDL-nummer: MFCD00003414 InChI-nyckel: SQGYOTSLMSWVJD-UHFFFAOYSA-N Synonym: silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol PubChem CID: 24470 ChEBI: CHEBI:32130 IUPAC-namn: silver(1+)nitrat LEDER: [Ag+].[O-][N+]([O-])=O
| Molekylformel | AgNO3 |
|---|---|
| PubChem CID | 24470 |
| MDL-nummer | MFCD00003414 |
| IUPAC-namn | silver(1+)nitrat |
| CAS | 7761-88-8 |
| InChI-nyckel | SQGYOTSLMSWVJD-UHFFFAOYSA-N |
| LEDER | [Ag+].[O-][N+]([O-])=O |
| ChEBI | CHEBI:32130 |
| Molekylvikt (g/mol) | 169.87 |
| Synonym | silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol |
Lithium diisopropylamide, 2M sol. in THF/n-heptane/ethylbenzene, AcroSeal™
CAS: 4111-54-0 Molekylformel: C6H14LiN Molekylvikt (g/mol): 107.125 MDL-nummer: MFCD00064449 InChI-nyckel: ZCSHNCUQKCANBX-UHFFFAOYSA-N Synonym: lithium diisopropylamide,unii-ol028kiw1i,lithium di-isopropylamide,lithium diisopropyl amide,2-propanamine, n-1-methylethyl-, lithium salt,ol028kiw1i,lithium di propan-2-yl azanide,2-propanamine, n-1-methylethyl-, lithium salt 1:1,lithium n,n-diisopropylamide,ipr2nli PubChem CID: 2724682 IUPAC-namn: litium;di(propan-2-yl)azanid LEDER: [Li+].CC(C)[N-]C(C)C
| Molekylformel | C6H14LiN |
|---|---|
| PubChem CID | 2724682 |
| MDL-nummer | MFCD00064449 |
| IUPAC-namn | litium;di(propan-2-yl)azanid |
| CAS | 4111-54-0 |
| InChI-nyckel | ZCSHNCUQKCANBX-UHFFFAOYSA-N |
| LEDER | [Li+].CC(C)[N-]C(C)C |
| Molekylvikt (g/mol) | 107.125 |
| Synonym | lithium diisopropylamide,unii-ol028kiw1i,lithium di-isopropylamide,lithium diisopropyl amide,2-propanamine, n-1-methylethyl-, lithium salt,ol028kiw1i,lithium di propan-2-yl azanide,2-propanamine, n-1-methylethyl-, lithium salt 1:1,lithium n,n-diisopropylamide,ipr2nli |
Borane-tetrahydrofuran complex, 1M solution in THF, Stabilized, AcroSeal™
CAS: 14044-65-6 | C4H11BO | 85.94 g/mol
| Formel vikt | 85.94 |
|---|---|
| IUPAC-namn | oxolan boran |
| InChI-nyckel | RMCYTHFAWCWRFA-UHFFFAOYSA-N |
| Hälsofara 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Handle under inert gas. Protect from moisture. Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. |
| Hälsofara 2 | GHS H Statement May cause respiratory irritation. Causes serious eye damage. In contact with water releases flammable gases which may ignite spontaneously. Causes skin irritation. Harmful if swallowed. Highly flammable liquid and vapour. Suspected of causing cancer. Reacts violently with water. May form explosive peroxides. May cause drowsiness or dizziness. |
| Hälsofara 1 | Danger |
| PubChem CID | 11062302 |
| Förpackning | AcroSeal™ Glasflaska |
| Fieser | 01,199; 02,106; 03,76; 04,124; 05,184; 06,161; 07,89; 12,65; 17,101 |
| Namnnotering | 1M solution in tetrahydrofuran, stabilized |
| LEDER | B.C1CCOC1 |
| Molekylvikt (g/mol) | 85.94 |
| Densitet | 0.876 |
| Molekylformel | C4H11BO |
| Behandling(er) | Stabilized |
| MDL-nummer | MFCD00012429 |
| Löslighetsinformation | Solubility in water: reacts. |
| Merck Index | 15, 1336 |
| Koncentration | 0.96 to 1.08M |
| Fysisk form | Vätska |
| Färg | Färglös |
| Flampunkt | −22°C |
| CAS | 109-99-9 |
| EINECS-nummer | 237-881-8 |
| Synonym | borane-tetrahydrofuran complex,tetrahydrofuran borane,bh3.thf,borane tetrahydrofuran complex solution,borane-d3-thf complex solution,borane-tetrahydrofuran,unii-5ear4err1l,oxolane borane,boron; oxolane,borane thf |
| TSCA | TSCA |
| Kemiskt namn eller material | Borane-tetrahydrofuran complex |
| Densitet | 0.9 |
|---|---|
| Molekylformel | AlH4Li |
| MDL-nummer | MFCD00011075 |
| Formel vikt | 37.95 |
| IUPAC-namn | litium(1+)-aluminium |
| InChI-nyckel | OCZDCIYGECBNKL-UHFFFAOYSA-N |
| Hälsofara 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Handle under inert gas. Protect from moisture. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. |
| Hälsofara 2 | GHS H Statement In contact with water releases flammable gases which may ignite spontaneously. Highly flammable liquid and vapor. Causes severe skin burns and eye damage. May cause respiratory irritation. May form explosive peroxides. Suspected of causing cancer. Harmful if swallowed. May cause drowsiness or dizziness. |
| Hälsofara 1 | Danger |
| Löslighetsinformation | Solubility in water: vigorous reaction. |
| Merck Index | 15, 344 |
| Koncentration | 9.5 to 10.5% (as LiAlH4) |
| Fysisk form | Viskös vätska |
| UN-nummer | 1411 |
| Färg | Gult |
| PubChem CID | 21226445 |
| Flampunkt | −17°C |
| Linjär formel | LiAlH4 |
| CAS | 109-99-9 |
| Namnnotering | 2.4M Solution in THF |
| LEDER | [Li+].[AlH4-] |
| Molekylvikt (g/mol) | 37.95 |
| Synonym | lithium aluminum hydride,lithium aluminum hydride,aluminum lithium hydride,lithiumaluminiumhydride,aluminum iii lithium hydride,lithium alanate,lithium aluminum tetrahydride,lithiumaluminiumhydrid,litiumaluminum hydride,lithim aluminum hydride |
| Kemiskt namn eller material | Lithium Aluminum hydride |
| Procent renhet | 9.2 to 10.5% (as LiAlH4) |
Thermo Scientific Chemicals Bradford Dye Reagent, färdig att använda lösning.
Lämplig för bestämning av proteinkoncentration (100 till 1500 μg)
| DOT-information | Transport Hazard Class: 8; Packing Group: III; Proper Shipping Name: PHOSPHORIC ACID SOLUTION |
|---|---|
| Rekommenderad förvaring | Håll kallt |
| Färg | Blått |
| Hälsofara 3 | P234-P260-P264b-P270-P271-P280-P303+P361+P353-P304+P340-P305+P351+P338-P310-P330-P331-P363-P390-P501c |
| Namnnotering | Ready-to-Use soln. |
| Hälsofara 2 | GHS H Statement H314-H318-H371 Causes severe skin burns and eye damage. Causes serious eye damage. May cause damage to organs. |
| Hälsofara 1 | H290-H302+H332-H314-H335-H371 |
| TSCA | No |
| Kemiskt namn eller material | Bradford Dye Reagent |
| Löslighetsinformation | Miscible with water. |
| Fysisk form | Vätska |
| UN-nummer | UN1805 |
Väteperoxid 30-32 % (vikt/vikt) (100 volymer), certifierad AR för analys, Fisher Chemical™
CAS: 7722-84-1 Molekylformel: H2O2 Molekylvikt (g/mol): 34.014 MDL-nummer: 11333 InChI-nyckel: MHAJPDPJQMAIIY-UHFFFAOYSA-N Synonym: oxydol,perhydrol,superoxol,interox,hydrogen dioxide,inhibine,peroxaan,albone,hioxyl,kastone PubChem CID: 784 ChEBI: CHEBI:16240 IUPAC-namn: väteperoxid LEDER: OO
| Molekylformel | H2O2 |
|---|---|
| PubChem CID | 784 |
| MDL-nummer | 11333 |
| IUPAC-namn | väteperoxid |
| CAS | 7722-84-1 |
| InChI-nyckel | MHAJPDPJQMAIIY-UHFFFAOYSA-N |
| LEDER | OO |
| ChEBI | CHEBI:16240 |
| Molekylvikt (g/mol) | 34.014 |
| Synonym | oxydol,perhydrol,superoxol,interox,hydrogen dioxide,inhibine,peroxaan,albone,hioxyl,kastone |
Vinylmagnesium bromide, 0.7M solution in THF, AcroSeal™
CAS: 1826-67-1 Molekylformel: C2H3BrMg Molekylvikt (g/mol): 131.26 MDL-nummer: MFCD00000042 InChI-nyckel: XHHHAXOHMKAOSL-UHFFFAOYSA-M Synonym: vinylmagnesium bromide,bromo ethenyl magnesium,vinyl magnesium bromide,magnesium, bromoethenyl,vinylmagnesium bromide solution,vinylmagnesium bromide solution, 1.0 m in thf,bromovinylmagnesium,bromo vinyl magnesium,vinyl magnesiumbromide,grignard reagent PubChem CID: 74584 LEDER: Br[Mg]C=C
| Molekylformel | C2H3BrMg |
|---|---|
| PubChem CID | 74584 |
| MDL-nummer | MFCD00000042 |
| CAS | 1826-67-1 |
| InChI-nyckel | XHHHAXOHMKAOSL-UHFFFAOYSA-M |
| LEDER | Br[Mg]C=C |
| Molekylvikt (g/mol) | 131.26 |
| Synonym | vinylmagnesium bromide,bromo ethenyl magnesium,vinyl magnesium bromide,magnesium, bromoethenyl,vinylmagnesium bromide solution,vinylmagnesium bromide solution, 1.0 m in thf,bromovinylmagnesium,bromo vinyl magnesium,vinyl magnesiumbromide,grignard reagent |
Väteperoxid, ren, 50 viktprocent lösning i vatten, stabiliserad, Thermo Scientific Chemicals
CAS: 7722-84-1 Molekylformel: H2O2 Molekylvikt (g/mol): 34.014 InChI-nyckel: MHAJPDPJQMAIIY-UHFFFAOYSA-N Synonym: oxydol,perhydrol,superoxol,interox,hydrogen dioxide,inhibine,peroxaan,albone,hioxyl,kastone PubChem CID: 784 ChEBI: CHEBI:16240 IUPAC-namn: väteperoxid LEDER: OO
| Molekylformel | H2O2 |
|---|---|
| PubChem CID | 784 |
| IUPAC-namn | väteperoxid |
| CAS | 7722-84-1 |
| InChI-nyckel | MHAJPDPJQMAIIY-UHFFFAOYSA-N |
| LEDER | OO |
| ChEBI | CHEBI:16240 |
| Molekylvikt (g/mol) | 34.014 |
| Synonym | oxydol,perhydrol,superoxol,interox,hydrogen dioxide,inhibine,peroxaan,albone,hioxyl,kastone |
Fenol/kloroform/isoamylalkohol (25:24:1), stabiliserad, mättad med 100 mM Tris-EDTA till pH 8,0, för molekylär, Thermo Scientific Chemicals
Fenol-kloroform-isoamylalkoholblandning i förhållandet 25:24:1 (v/v/v), CAS # 136112-00-0, 67-66-3, 123-51-3, är en lösning som används vid rening av nukleinsyror.
| Densitet | 1.28 |
|---|---|
| Molekylformel | C6H6O |
| Behandling(er) | Stabilized |
| MDL-nummer | MFCD00133763 |
| Formel vikt | 94.11 |
| Hälsofara 2 | Suspected of causing genetic defects, Suspected of damaging the unborn child, Causes damage to organs through prolonged or repeated exposure, Causes severe skin burns and eye damage, May cause drowsiness or dizziness, Suspected of causing cancer, Repeated exposure may cause skin dryness or cracking, Toxic if swallowed, in contact with skin or if inhaled |
| Hälsofara 1 | Germ cell mutagenicity (category 2), Reproductive toxicity (category 2), Specific target organ toxicity after repeated exposure (category 1), Skin corrosion/irritation (category 1), Specific target organ toxicity after single exposure (category 3), Carcinogenicity (category 2), Acute toxicity (category 3) |
| Merck Index | 14, 7241 |
| Fysisk form | Lösning |
| UN-nummer | 2927 |
| Kvalitet | Molekylärbiologi |
| Färg | Gul till Orange |
| Förpackning | Glasflaska |
| CAS | 123-51-3 |
| Namnnotering | DNase, RNase and Protease Free |
| pH | 7.8 to 8.2 (25°C) |
| Kemiskt namn eller material | Phenol/Chloroform/Isoamyl alcohol (25:24:1), stabilized, saturated with 100 mM Tris-EDTA to pH 8.0 |
Hydrogen chloride, 2M in diethyl ether
CAS: 7647-01-0 Molekylformel: ClH Molekylvikt (g/mol): 36.46 MDL-nummer: MFCD00011324 MFCD00792839 InChI-nyckel: VEXZGXHMUGYJMC-UHFFFAOYSA-N Synonym: hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof PubChem CID: 313 ChEBI: CHEBI:17883 IUPAC-namn: kloran LEDER: Cl
| Molekylformel | ClH |
|---|---|
| PubChem CID | 313 |
| MDL-nummer | MFCD00011324 MFCD00792839 |
| IUPAC-namn | kloran |
| CAS | 7647-01-0 |
| InChI-nyckel | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| LEDER | Cl |
| ChEBI | CHEBI:17883 |
| Molekylvikt (g/mol) | 36.46 |
| Synonym | hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof |