Filtrerade sökresultat
Thermo Scientific Chemicals Ethidium bromidavfärgningspåsar, med aktiveringslösning.
Jodlösning 0,05 M (0,1 N), NIST Standardlösning redo att användas, för volymetrisk analys, uppfyller analytiska specifikationer från Ph.Eur., BP, Fisher Chemical™
CAS: 7553-56-2 Molekylformel: I2 Molekylvikt (g/mol): 253.81 MDL-nummer: MFCD00011355 MFCD00164163 InChI-nyckel: PNDPGZBMCMUPRI-UHFFFAOYSA-N Synonym: iodine,diiodine,iodine crystals,iodine sublimed,tincture iodine,vistarin,eranol,iodio,iodine solution,iode PubChem CID: 807 ChEBI: CHEBI:17606 IUPAC-namn: molekylärt jod LEDER: II
| Molekylformel | I2 |
|---|---|
| PubChem CID | 807 |
| MDL-nummer | MFCD00011355 MFCD00164163 |
| IUPAC-namn | molekylärt jod |
| CAS | 7553-56-2 |
| InChI-nyckel | PNDPGZBMCMUPRI-UHFFFAOYSA-N |
| LEDER | II |
| ChEBI | CHEBI:17606 |
| Molekylvikt (g/mol) | 253.81 |
| Synonym | iodine,diiodine,iodine crystals,iodine sublimed,tincture iodine,vistarin,eranol,iodio,iodine solution,iode |
Barium chloride, 10% w/v aq. soln.
CAS: 10361-37-2 Molekylformel: BaCl2 Molekylvikt (g/mol): 208.23 MDL-nummer: MFCD00003445 InChI-nyckel: WDIHJSXYQDMJHN-UHFFFAOYSA-L Synonym: barium chloride,barium dichloride,barium chloride solution,ccris 2286,barium chloride, anhydrous,barium chloride, ultra dry,bariumchlorid,dichlorobarium,dsstox_cid_24508 PubChem CID: 25204 ChEBI: CHEBI:63317 IUPAC-namn: barium(2+);diklorid LEDER: [Cl-].[Cl-].[Ba++]
| Molekylformel | BaCl2 |
|---|---|
| PubChem CID | 25204 |
| MDL-nummer | MFCD00003445 |
| IUPAC-namn | barium(2+);diklorid |
| CAS | 10361-37-2 |
| InChI-nyckel | WDIHJSXYQDMJHN-UHFFFAOYSA-L |
| LEDER | [Cl-].[Cl-].[Ba++] |
| ChEBI | CHEBI:63317 |
| Molekylvikt (g/mol) | 208.23 |
| Synonym | barium chloride,barium dichloride,barium chloride solution,ccris 2286,barium chloride, anhydrous,barium chloride, ultra dry,bariumchlorid,dichlorobarium,dsstox_cid_24508 |
Natriumhydroxid, 0,05N standardiserad lösning, Thermo Scientific Chemicals
CAS: 1310-73-2 Molekylformel: HNaO Molekylvikt (g/mol): 39.997 MDL-nummer: MFCD00003548 InChI-nyckel: HEMHJVSKTPXQMS-UHFFFAOYSA-M Synonym: sodium hydroxide,caustic soda,sodium hydrate,white caustic,soda lye,aetznatron,ascarite,sodium hydroxide na oh,sodium hydroxide solution,soda, caustic PubChem CID: 14798 ChEBI: CHEBI:32145 IUPAC-namn: natrium;hydroxid LEDER: [OH-].[Na+]
| Molekylformel | HNaO |
|---|---|
| PubChem CID | 14798 |
| MDL-nummer | MFCD00003548 |
| IUPAC-namn | natrium;hydroxid |
| CAS | 1310-73-2 |
| InChI-nyckel | HEMHJVSKTPXQMS-UHFFFAOYSA-M |
| LEDER | [OH-].[Na+] |
| ChEBI | CHEBI:32145 |
| Molekylvikt (g/mol) | 39.997 |
| Synonym | sodium hydroxide,caustic soda,sodium hydrate,white caustic,soda lye,aetznatron,ascarite,sodium hydroxide na oh,sodium hydroxide solution,soda, caustic |
Väteperoxid 6 % (vikt/volym) (20 volymer), extra ren SLR, Fisher Chemical™
CAS: 7722-84-1 Molekylformel: H2O2 Molekylvikt (g/mol): 34.014 MDL-nummer: 11333 InChI-nyckel: MHAJPDPJQMAIIY-UHFFFAOYSA-N Synonym: oxydol,perhydrol,superoxol,interox,hydrogen dioxide,inhibine,peroxaan,albone,hioxyl,kastone PubChem CID: 784 ChEBI: CHEBI:16240 IUPAC-namn: väteperoxid LEDER: OO
| Molekylformel | H2O2 |
|---|---|
| PubChem CID | 784 |
| MDL-nummer | 11333 |
| IUPAC-namn | väteperoxid |
| CAS | 7722-84-1 |
| InChI-nyckel | MHAJPDPJQMAIIY-UHFFFAOYSA-N |
| LEDER | OO |
| ChEBI | CHEBI:16240 |
| Molekylvikt (g/mol) | 34.014 |
| Synonym | oxydol,perhydrol,superoxol,interox,hydrogen dioxide,inhibine,peroxaan,albone,hioxyl,kastone |
Etylendiamintetraättiksyra (0,5 M lösning/pH 8,0), Fisher BioReagents
CAS: 60-00-4 Molekylformel: C10H16N2O8 Molekylvikt (g/mol): 292.24 MDL-nummer: MFCD00003541 InChI-nyckel: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 IUPAC-namn: 2-[2-[bis(karboximetyl)amino]etyl-(karboximetyl)amino]ättiksyra LEDER: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| Molekylformel | C10H16N2O8 |
|---|---|
| PubChem CID | 6049 |
| MDL-nummer | MFCD00003541 |
| IUPAC-namn | 2-[2-[bis(karboximetyl)amino]etyl-(karboximetyl)amino]ättiksyra |
| CAS | 60-00-4 |
| InChI-nyckel | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| LEDER | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| ChEBI | CHEBI:42191 |
| Molekylvikt (g/mol) | 292.24 |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
Silvernitratlösning 0,1 M (0,1 N), NIST Standardlösning redo att användas, för volymetrisk analys, uppfyller analytiska specifikationer för pH.Eur., Bp, Usp, Fisher Chemical™
CAS: 7761-88-8 Molekylformel: AgNO3 Molekylvikt (g/mol): 169.87 MDL-nummer: MFCD00003414 InChI-nyckel: SQGYOTSLMSWVJD-UHFFFAOYSA-N Synonym: silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol PubChem CID: 24470 ChEBI: CHEBI:32130 IUPAC-namn: silver(1+)nitrat LEDER: [Ag+].[O-][N+]([O-])=O
| Molekylformel | AgNO3 |
|---|---|
| PubChem CID | 24470 |
| MDL-nummer | MFCD00003414 |
| IUPAC-namn | silver(1+)nitrat |
| CAS | 7761-88-8 |
| InChI-nyckel | SQGYOTSLMSWVJD-UHFFFAOYSA-N |
| LEDER | [Ag+].[O-][N+]([O-])=O |
| ChEBI | CHEBI:32130 |
| Molekylvikt (g/mol) | 169.87 |
| Synonym | silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol |
Borane-tetrahydrofuran complex, 1M solution in THF, Stabilized, AcroSeal™
CAS: 14044-65-6 | C4H11BO | 85.94 g/mol
| Formel vikt | 85.94 |
|---|---|
| IUPAC-namn | oxolan boran |
| InChI-nyckel | RMCYTHFAWCWRFA-UHFFFAOYSA-N |
| Hälsofara 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Handle under inert gas. Protect from moisture. Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. |
| Hälsofara 2 | GHS H Statement May cause respiratory irritation. Causes serious eye damage. In contact with water releases flammable gases which may ignite spontaneously. Causes skin irritation. Harmful if swallowed. Highly flammable liquid and vapour. Suspected of causing cancer. Reacts violently with water. May form explosive peroxides. May cause drowsiness or dizziness. |
| Hälsofara 1 | Danger |
| PubChem CID | 11062302 |
| Förpackning | AcroSeal™ Glasflaska |
| Fieser | 01,199; 02,106; 03,76; 04,124; 05,184; 06,161; 07,89; 12,65; 17,101 |
| Namnnotering | 1M solution in tetrahydrofuran, stabilized |
| LEDER | B.C1CCOC1 |
| Molekylvikt (g/mol) | 85.94 |
| Densitet | 0.876 |
| Molekylformel | C4H11BO |
| Behandling(er) | Stabilized |
| MDL-nummer | MFCD00012429 |
| Löslighetsinformation | Solubility in water: reacts. |
| Merck Index | 15, 1336 |
| Koncentration | 0.96 to 1.08M |
| Fysisk form | Vätska |
| Färg | Färglös |
| Flampunkt | −22°C |
| CAS | 109-99-9 |
| EINECS-nummer | 237-881-8 |
| Synonym | borane-tetrahydrofuran complex,tetrahydrofuran borane,bh3.thf,borane tetrahydrofuran complex solution,borane-d3-thf complex solution,borane-tetrahydrofuran,unii-5ear4err1l,oxolane borane,boron; oxolane,borane thf |
| TSCA | TSCA |
| Kemiskt namn eller material | Borane-tetrahydrofuran complex |
Väteperoxid 30-32 % (vikt/vikt) (100 volymer), certifierad AR för analys, Fisher Chemical™
CAS: 7722-84-1 Molekylformel: H2O2 Molekylvikt (g/mol): 34.014 MDL-nummer: 11333 InChI-nyckel: MHAJPDPJQMAIIY-UHFFFAOYSA-N Synonym: oxydol,perhydrol,superoxol,interox,hydrogen dioxide,inhibine,peroxaan,albone,hioxyl,kastone PubChem CID: 784 ChEBI: CHEBI:16240 IUPAC-namn: väteperoxid LEDER: OO
| Molekylformel | H2O2 |
|---|---|
| PubChem CID | 784 |
| MDL-nummer | 11333 |
| IUPAC-namn | väteperoxid |
| CAS | 7722-84-1 |
| InChI-nyckel | MHAJPDPJQMAIIY-UHFFFAOYSA-N |
| LEDER | OO |
| ChEBI | CHEBI:16240 |
| Molekylvikt (g/mol) | 34.014 |
| Synonym | oxydol,perhydrol,superoxol,interox,hydrogen dioxide,inhibine,peroxaan,albone,hioxyl,kastone |
Thermo Scientific Chemicals Bradford Dye Reagent, färdig att använda lösning.
Lämplig för bestämning av proteinkoncentration (100 till 1500 μg)
| DOT-information | Transport Hazard Class: 8; Packing Group: III; Proper Shipping Name: PHOSPHORIC ACID SOLUTION |
|---|---|
| Rekommenderad förvaring | Håll kallt |
| Färg | Blått |
| Hälsofara 3 | P234-P260-P264b-P270-P271-P280-P303+P361+P353-P304+P340-P305+P351+P338-P310-P330-P331-P363-P390-P501c |
| Namnnotering | Ready-to-Use soln. |
| Hälsofara 2 | GHS H Statement H314-H318-H371 Causes severe skin burns and eye damage. Causes serious eye damage. May cause damage to organs. |
| Hälsofara 1 | H290-H302+H332-H314-H335-H371 |
| TSCA | No |
| Kemiskt namn eller material | Bradford Dye Reagent |
| Löslighetsinformation | Miscible with water. |
| Fysisk form | Vätska |
| UN-nummer | UN1805 |
Natriumbis(trimetylsilyl)amid, ren, 2M lösning i THF, AcroSeal™ , Thermo Scientific Chemicals
CAS: 1070-89-9 | C6H18NNaSi2 | 183.377 g/mol
| Densitet | 0.916 |
|---|---|
| Molekylformel | C6H18NNaSi2 |
| MDL-nummer | MFCD00009835 |
| Formel vikt | 183.38 |
| IUPAC-namn | natrium;bis(trimetylsilyl)azanid |
| InChI-nyckel | WRIKHQLVHPKCJU-UHFFFAOYSA-N |
| Hälsofara 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Immediately call a POISON CENTER or doctor/physician. Avoid breathing dust/fume/gas/mist/vapors/spray. Store in a dry place. Store in a closed container. Keep container tightly closed. |
| Hälsofara 2 | GHS P Statement Causes severe skin burns and eye damage. May cause respiratory irritation. Highly flammable liquid and vapor. Suspected of causing cancer. Suspected of causing genetic defects. Harmful to aquatic life with long lasting effects. Reacts violently with water. May form explosive peroxides. |
| Hälsofara 1 | Danger |
| Fysisk form | Vätska |
| Kvalitet | Ren |
| Färg | Orange till brunt |
| PubChem CID | 2724254 |
| Flampunkt | −21°C |
| Fieser | 01,1046; 03,261; 04,442; 06,529; 12,441; 16,307 |
| Linjär formel | [(CH3)3Si]2NNa |
| CAS | 109-99-9 |
| Namnnotering | 2M Solution in THF |
| LEDER | C[Si](C)(C)[N-][Si](C)(C)C.[Na+] |
| Molekylvikt (g/mol) | 183.377 |
| EINECS-nummer | 213-983-8 |
| Synonym | sodium bis trimethylsilyl amide,n-sodiohexamethyldisilazane,sodium hexamethyldisilazide,nahmds,sodiobis trimethylsilyl amine,sodium bis trimethylsilyl azanide,n-sodium hexamethyldisilazane,sodium-bis trimethylsilyl amide,hexamethyldisilazane sodium salt |
| TSCA | TSCA |
| Kemiskt namn eller material | Sodium bis(trimethylsilyl)amide |
| Procent renhet | 38 to 42% |