Filtrerade sökresultat
Taurodeoxicholsyra, natriumsalthydrat, 97 %, Thermo Scientific Chemicals
CAS: 207737-97-1 Molekylformel: C26H44NNaO6S Molekylvikt (g/mol): 521.69 MDL-nummer: MFCD00149238 InChI-nyckel: YXHRQQJFKOHLAP-FVCKGWAHSA-M Synonym: Sodium taurodeoxylate PubChem CID: 23702150 IUPAC-namn: natrium;2-[[(4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxi-10,13-dimetyl-2,3,4,5,6,7,8,9,11, 12,14,15,16,17-tetradekahydro-lH-cyklopenta[a]fenantren-17-yl]pentanoyl]amino]etansulfonat;hydrat LEDER: [Na+].[H][C@@]12CC[C@H]([C@H](C)CCC(=O)NCCS([O-])(=O)=O)[C@@]1(C)[C@@H](O)C[C@@]1([H])[C@@]2([H])CC[C@]2([H])C[C@H](O)CC[C@]12C
| Molekylformel | C26H44NNaO6S |
|---|---|
| PubChem CID | 23702150 |
| MDL-nummer | MFCD00149238 |
| IUPAC-namn | natrium;2-[[(4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxi-10,13-dimetyl-2,3,4,5,6,7,8,9,11, 12,14,15,16,17-tetradekahydro-lH-cyklopenta[a]fenantren-17-yl]pentanoyl]amino]etansulfonat;hydrat |
| CAS | 207737-97-1 |
| InChI-nyckel | YXHRQQJFKOHLAP-FVCKGWAHSA-M |
| LEDER | [Na+].[H][C@@]12CC[C@H]([C@H](C)CCC(=O)NCCS([O-])(=O)=O)[C@@]1(C)[C@@H](O)C[C@@]1([H])[C@@]2([H])CC[C@]2([H])C[C@H](O)CC[C@]12C |
| Molekylvikt (g/mol) | 521.69 |
| Synonym | Sodium taurodeoxylate |
Molecular Probes™ Pluronic™ F-127 (20 % lösning i DMSO)
Pluronic™ F-127 (20 % lösning i DMSO)
Molecular Probes™ Pluronic™ F-127, 0,2μ m filtrerad (10 % lösning i vatten)
Pluronic™ F-127, 0,2μ m filtrerad (10 % lösning i vatten)
Thermo Scientific™ PCC-Pfree™ Tvättmedelskoncentrat
En fosfatfri, tensidbaserad rengöringslösning för användning på många laboratorieytor och glasvaror; RBS pF-alternativ för Europa.
Thermo Scientific™ PCC-54™ Tvättmedelskoncentrat
En laboratorierengöringslösning för laboratorieredskap, ytmaterial och glasvaror, inklusive bägare, pipetter, linser, speglar; RBS-35 alternativ.
| Volym (metrisk) | 3 L |
|---|---|
| Innehåll och lagring | Store in original container protected from direct sunlight in a dry, cool and well-ventilated area, between the following temperatures: 20 to 25°C. |
| Form | Liquid |
| Beskrivning | PCC-54 Detergent Concentrate |
| Sammansättning | PCC-PFree, 2%- 20% Solution |
| Produktlinje | PCC-54™ |
IGEPAL∣r CA-630
CAS: 9002-93-1 Molekylformel: C16H26O2 Molekylvikt (g/mol): 250.38 MDL-nummer: MFCD00132505 InChI-nyckel: JYCQQPHGFMYQCF-UHFFFAOYSA-N Synonym: Octylphenyl-polyethylene glycol IUPAC-namn: 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethan-1-ol LEDER: CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1
| Molekylformel | C16H26O2 |
|---|---|
| MDL-nummer | MFCD00132505 |
| IUPAC-namn | 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethan-1-ol |
| CAS | 9002-93-1 |
| InChI-nyckel | JYCQQPHGFMYQCF-UHFFFAOYSA-N |
| LEDER | CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1 |
| Molekylvikt (g/mol) | 250.38 |
| Synonym | Octylphenyl-polyethylene glycol |