Reaktiva icke-metalliska salter
Filtrerade sökresultat
Metansulfonsyralösning, Honeywell™ Fluka™
CAS: 75-75-2 Molekylformel: CH4O3S Molekylvikt (g/mol): 96.1 MDL-nummer: MFCD00007518 InChI-nyckel: AFVFQIVMOAPDHO-UHFFFAOYSA-N Synonym: methylsulfonic acid,methanesulphonic acid,methanesulfonicacid,kyselina methansulfonova,methansulfonsaeure,ccris 2783,kyselina methansulfonova czech,ch3so3h,methane sulfonic acid,sulfomethane PubChem CID: 6395 ChEBI: CHEBI:27376 IUPAC-namn: metansulfonsyra LEDER: CS(=O)(=O)O
| Molekylformel | CH4O3S |
|---|---|
| PubChem CID | 6395 |
| MDL-nummer | MFCD00007518 |
| IUPAC-namn | metansulfonsyra |
| CAS | 75-75-2 |
| InChI-nyckel | AFVFQIVMOAPDHO-UHFFFAOYSA-N |
| LEDER | CS(=O)(=O)O |
| ChEBI | CHEBI:27376 |
| Molekylvikt (g/mol) | 96.1 |
| Synonym | methylsulfonic acid,methanesulphonic acid,methanesulfonicacid,kyselina methansulfonova,methansulfonsaeure,ccris 2783,kyselina methansulfonova czech,ch3so3h,methane sulfonic acid,sulfomethane |
Fosforsyra, 85 % vikt/vikt aq. soln., ACS, Thermo Scientific™
CAS: 7664-38-2 Molekylformel: H3O4P Molekylvikt (g/mol): 97.994 MDL-nummer: MFCD00011340 InChI-nyckel: NBIIXXVUZAFLBC-UHFFFAOYSA-N Synonym: orthophosphoric acid,sonac,o-phosphoric acid,phosphorsaeure,acidum phosphoricum,evits,wc-reiniger,acide phosphorique,white,acido fosforico PubChem CID: 1004 ChEBI: CHEBI:26078 IUPAC-namn: fosforsyra LEDER: OP(=O)(O)O
| Molekylformel | H3O4P |
|---|---|
| PubChem CID | 1004 |
| MDL-nummer | MFCD00011340 |
| IUPAC-namn | fosforsyra |
| CAS | 7664-38-2 |
| InChI-nyckel | NBIIXXVUZAFLBC-UHFFFAOYSA-N |
| LEDER | OP(=O)(O)O |
| ChEBI | CHEBI:26078 |
| Molekylvikt (g/mol) | 97.994 |
| Synonym | orthophosphoric acid,sonac,o-phosphoric acid,phosphorsaeure,acidum phosphoricum,evits,wc-reiniger,acide phosphorique,white,acido fosforico |
Fosfomolybdotungstic reagens, European Pharmacopoeia Grade, Fisher Chemical™
SureTRACE
Supporting your traceability needs through proactive availability of certificates and change notifications.
Learn More
Supporting your traceability needs through proactive availability of certificates and change notifications.
Learn More
Sulfomolybdic Reagens, European Pharmacopoeia Grade, Fisher Chemical™
SureTRACE
Supporting your traceability needs through proactive availability of certificates and change notifications.
Learn More
Supporting your traceability needs through proactive availability of certificates and change notifications.
Learn More
Nitrosonium hexafluorophosphate, 95%
CAS: 16921-91-8 Molekylformel: F6NOP Molekylvikt (g/mol): 174.97 MDL-nummer: MFCD00040324 InChI-nyckel: SAKPNYRUBHJGAR-UHFFFAOYSA-N Synonym: nitrosonium hexafluorophosphate,nitrilooxonium hexafluorophosphate,nopf6,nitrosyl hexafluorophosphate,nitrosonium hexafluorophosphat,nitrosylhexafluorophosphate,azanylidyneoxidanium hexafluorophosphate,hexafluoro-$l^ 5-phosphanuide; nitrosonium PubChem CID: 10910083 IUPAC-namn: azanylidynoxidanium;hexafluorfosfat LEDER: N#[O+].F[P-](F)(F)(F)(F)F
| Molekylformel | F6NOP |
|---|---|
| PubChem CID | 10910083 |
| MDL-nummer | MFCD00040324 |
| IUPAC-namn | azanylidynoxidanium;hexafluorfosfat |
| CAS | 16921-91-8 |
| InChI-nyckel | SAKPNYRUBHJGAR-UHFFFAOYSA-N |
| LEDER | N#[O+].F[P-](F)(F)(F)(F)F |
| Molekylvikt (g/mol) | 174.97 |
| Synonym | nitrosonium hexafluorophosphate,nitrilooxonium hexafluorophosphate,nopf6,nitrosyl hexafluorophosphate,nitrosonium hexafluorophosphat,nitrosylhexafluorophosphate,azanylidyneoxidanium hexafluorophosphate,hexafluoro-$l^ 5-phosphanuide; nitrosonium |
Phosphorus(V) oxybromide, 98% min
CAS: 7789-59-5 Molekylformel: Br3OP Molekylvikt (g/mol): 286.685 MDL-nummer: MFCD00036298 InChI-nyckel: UXCDUFKZSUBXGM-UHFFFAOYSA-N Synonym: phosphorus oxybromide,phosphoric tribromide,phosphoryl bromide,phosphoryl tribromide,phosphorusoxybromide,phosphorus v oxybromide,unii-h98h8y87qq,phosphorousoxybromide,phosphoroyl tribromide,pobr3 PubChem CID: 24613 LEDER: O=P(Br)(Br)Br
| Molekylformel | Br3OP |
|---|---|
| PubChem CID | 24613 |
| MDL-nummer | MFCD00036298 |
| CAS | 7789-59-5 |
| InChI-nyckel | UXCDUFKZSUBXGM-UHFFFAOYSA-N |
| LEDER | O=P(Br)(Br)Br |
| Molekylvikt (g/mol) | 286.685 |
| Synonym | phosphorus oxybromide,phosphoric tribromide,phosphoryl bromide,phosphoryl tribromide,phosphorusoxybromide,phosphorus v oxybromide,unii-h98h8y87qq,phosphorousoxybromide,phosphoroyl tribromide,pobr3 |
Phosphorus(V) oxide, 99.99%
CAS: 1314-56-3 Molekylformel: O5P2 Molekylvikt (g/mol): 141.94 MDL-nummer: MFCD00011440 InChI-nyckel: DLYUQMMRRRQYAE-UHFFFAOYSA-N IUPAC-namn: tricyklo[3.3.1.13,7]tetrafosfoxan-1,3,5,7-tetron LEDER: O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3
| Molekylformel | O5P2 |
|---|---|
| MDL-nummer | MFCD00011440 |
| IUPAC-namn | tricyklo[3.3.1.13,7]tetrafosfoxan-1,3,5,7-tetron |
| CAS | 1314-56-3 |
| InChI-nyckel | DLYUQMMRRRQYAE-UHFFFAOYSA-N |
| LEDER | O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3 |
| Molekylvikt (g/mol) | 141.94 |
Sulfuryl chloride, 98.5%
CAS: 7791-25-5 Molekylformel: Cl2O2S Molekylvikt (g/mol): 134.96 MDL-nummer: MFCD00011451 InChI-nyckel: YBBRCQOCSYXUOC-UHFFFAOYSA-N Synonym: sulfuryl chloride,sulfonyl chloride,sulphuryl dichloride,sulphuryl chloride,sulfonyl dichloride,sulfuric dichloride,sulfuric oxychloride,sulfurylchlorid,caswell no. 816,sulfurylchloride PubChem CID: 24648 ChEBI: CHEBI:29291 IUPAC-namn: sulfuryldiklorid LEDER: ClS(Cl)(=O)=O
| Molekylformel | Cl2O2S |
|---|---|
| PubChem CID | 24648 |
| MDL-nummer | MFCD00011451 |
| IUPAC-namn | sulfuryldiklorid |
| CAS | 7791-25-5 |
| InChI-nyckel | YBBRCQOCSYXUOC-UHFFFAOYSA-N |
| LEDER | ClS(Cl)(=O)=O |
| ChEBI | CHEBI:29291 |
| Molekylvikt (g/mol) | 134.96 |
| Synonym | sulfuryl chloride,sulfonyl chloride,sulphuryl dichloride,sulphuryl chloride,sulfonyl dichloride,sulfuric dichloride,sulfuric oxychloride,sulfurylchlorid,caswell no. 816,sulfurylchloride |
Phosphorus pentabromide, 95%
CAS: 7789-69-7 Molekylformel: Br5P Molekylvikt (g/mol): 430.49 MDL-nummer: MFCD00011437 InChI-nyckel: QRKVRHZNLKTPGF-UHFFFAOYSA-N Synonym: phosphorus pentabromide,phosphorane, pentabromo,unii-3d9wis0bqw,pentabromophosphorane,phosphorus v bromide,3d9wis0bqw,pentabromo,phosphorpentabromid,phosphoruspentabromide,phosphorouspentabromide PubChem CID: 62678 IUPAC-namn: pentabrom-$l^{5}-fosfan LEDER: P(Br)(Br)(Br)(Br)Br
| Molekylformel | Br5P |
|---|---|
| PubChem CID | 62678 |
| MDL-nummer | MFCD00011437 |
| IUPAC-namn | pentabrom-$l^{5}-fosfan |
| CAS | 7789-69-7 |
| InChI-nyckel | QRKVRHZNLKTPGF-UHFFFAOYSA-N |
| LEDER | P(Br)(Br)(Br)(Br)Br |
| Molekylvikt (g/mol) | 430.49 |
| Synonym | phosphorus pentabromide,phosphorane, pentabromo,unii-3d9wis0bqw,pentabromophosphorane,phosphorus v bromide,3d9wis0bqw,pentabromo,phosphorpentabromid,phosphoruspentabromide,phosphorouspentabromide |
Fosfor(V)oxid, 98 %, Thermo Scientific Chemicals
CAS: 1314-56-3 Molekylformel: O5P2 Molekylvikt (g/mol): 141.94 MDL-nummer: MFCD00011440 InChI-nyckel: DLYUQMMRRRQYAE-UHFFFAOYSA-N Synonym: Phosphorus pentoxide IUPAC-namn: tricyklo[3.3.1.13,7]tetrafosfoxan-1,3,5,7-tetron LEDER: O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3
| Molekylformel | O5P2 |
|---|---|
| MDL-nummer | MFCD00011440 |
| IUPAC-namn | tricyklo[3.3.1.13,7]tetrafosfoxan-1,3,5,7-tetron |
| CAS | 1314-56-3 |
| InChI-nyckel | DLYUQMMRRRQYAE-UHFFFAOYSA-N |
| LEDER | O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3 |
| Molekylvikt (g/mol) | 141.94 |
| Synonym | Phosphorus pentoxide |
Fosfonitrilkloridtrimer, 98 %, Thermo Scientific Chemicals
CAS: 940-71-6 Molekylformel: Cl6N3P3 Molekylvikt (g/mol): 347.642 MDL-nummer: MFCD00006474 InChI-nyckel: UBIJTWDKTYCPMQ-UHFFFAOYSA-N Synonym: phosphonitrilic chloride trimer,hexachlorocyclotriphosphazene,hexachlorophosphazene,triphosphonitrilic chloride,triphosphonitrile chloride,hexachlorotriphosphonitrile,cyclophosphazene dichloride trimer,hexachlorocyclophosphazatriene,hexachlorocyclotriphosphazatriene,phosphononitrilic chloride trimer PubChem CID: 220225 IUPAC-namn: 2,2,4,4,6,6-hexaklor-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-trifosfacyklohexa-1,3,5-trien LEDER: N1=P(N=P(N=P1(Cl)Cl)(Cl)Cl)(Cl)Cl
| Molekylformel | Cl6N3P3 |
|---|---|
| PubChem CID | 220225 |
| MDL-nummer | MFCD00006474 |
| IUPAC-namn | 2,2,4,4,6,6-hexaklor-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-trifosfacyklohexa-1,3,5-trien |
| CAS | 940-71-6 |
| InChI-nyckel | UBIJTWDKTYCPMQ-UHFFFAOYSA-N |
| LEDER | N1=P(N=P(N=P1(Cl)Cl)(Cl)Cl)(Cl)Cl |
| Molekylvikt (g/mol) | 347.642 |
| Synonym | phosphonitrilic chloride trimer,hexachlorocyclotriphosphazene,hexachlorophosphazene,triphosphonitrilic chloride,triphosphonitrile chloride,hexachlorotriphosphonitrile,cyclophosphazene dichloride trimer,hexachlorocyclophosphazatriene,hexachlorocyclotriphosphazatriene,phosphononitrilic chloride trimer |
Phosphorus(V) oxide, ACS, 98% min
CAS: 1314-56-3 Molekylformel: O5P2 Molekylvikt (g/mol): 141.94 MDL-nummer: MFCD00011440 InChI-nyckel: DLYUQMMRRRQYAE-UHFFFAOYSA-N IUPAC-namn: tricyklo[3.3.1.13,7]tetrafosfoxan-1,3,5,7-tetron LEDER: O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3
| Molekylformel | O5P2 |
|---|---|
| MDL-nummer | MFCD00011440 |
| IUPAC-namn | tricyklo[3.3.1.13,7]tetrafosfoxan-1,3,5,7-tetron |
| CAS | 1314-56-3 |
| InChI-nyckel | DLYUQMMRRRQYAE-UHFFFAOYSA-N |
| LEDER | O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3 |
| Molekylvikt (g/mol) | 141.94 |
Tiofosgen, 85 %, Thermo Scientific Chemicals
CAS: 463-71-8 MDL-nummer: MFCD00004918 InChI-nyckel: ZWZVWGITAAIFPS-UHFFFAOYSA-N Synonym: thiophosgene,carbonothioic dichloride,carbon chlorosulfide,thiocarbonyl chloride,thiocarbonic dichloride,dichlorothiocarbonyl,thiofosgen,phosgene, thio,thiokarbonylchlorid,carbonyl chloride, thio PubChem CID: 10040 ChEBI: CHEBI:29366 IUPAC-namn: tiokarbonyldiklorid LEDER: C(=S)(Cl)Cl
| PubChem CID | 10040 |
|---|---|
| MDL-nummer | MFCD00004918 |
| IUPAC-namn | tiokarbonyldiklorid |
| CAS | 463-71-8 |
| InChI-nyckel | ZWZVWGITAAIFPS-UHFFFAOYSA-N |
| LEDER | C(=S)(Cl)Cl |
| ChEBI | CHEBI:29366 |
| Synonym | thiophosgene,carbonothioic dichloride,carbon chlorosulfide,thiocarbonyl chloride,thiocarbonic dichloride,dichlorothiocarbonyl,thiofosgen,phosgene, thio,thiokarbonylchlorid,carbonyl chloride, thio |
Phosphorus(V) bromide, 95%
CAS: 7789-69-7 Molekylformel: Br5P Molekylvikt (g/mol): 430.494 MDL-nummer: MFCD00011437 InChI-nyckel: QRKVRHZNLKTPGF-UHFFFAOYSA-N Synonym: phosphorus pentabromide,phosphorane, pentabromo,unii-3d9wis0bqw,pentabromophosphorane,phosphorus v bromide,3d9wis0bqw,pentabromo,phosphorpentabromid,phosphoruspentabromide,phosphorouspentabromide PubChem CID: 62678 IUPAC-namn: pentabrom-$l^{5}-fosfan LEDER: P(Br)(Br)(Br)(Br)Br
| Molekylformel | Br5P |
|---|---|
| PubChem CID | 62678 |
| MDL-nummer | MFCD00011437 |
| IUPAC-namn | pentabrom-$l^{5}-fosfan |
| CAS | 7789-69-7 |
| InChI-nyckel | QRKVRHZNLKTPGF-UHFFFAOYSA-N |
| LEDER | P(Br)(Br)(Br)(Br)Br |
| Molekylvikt (g/mol) | 430.494 |
| Synonym | phosphorus pentabromide,phosphorane, pentabromo,unii-3d9wis0bqw,pentabromophosphorane,phosphorus v bromide,3d9wis0bqw,pentabromo,phosphorpentabromid,phosphoruspentabromide,phosphorouspentabromide |