Karbonylföreningar
Filtrerade sökresultat
tert-butylacetoacetat, 97 %, Thermo Scientific Chemicals
CAS: 1694-31-1 Molekylformel: C8H14O3 Molekylvikt (g/mol): 158.2 MDL-nummer: MFCD00008811 InChI-nyckel: JKUYRAMKJLMYLO-UHFFFAOYSA-N Synonym: tert-butyl acetoacetate,t-butyl acetoacetate,butanoic acid, 3-oxo-, 1,1-dimethylethyl ester,acetoacetic acid, tert-butyl ester,tert-butyl 3-oxobutyrate,acetoacetic acid tert-butyl ester,unii-1d3dos61gx,tbaa,1d3dos61gx,t-butylacetoacetate PubChem CID: 15538 IUPAC-namn: tert-butyl-3-oxobutanoat LEDER: CC(=O)CC(=O)OC(C)(C)C
| Molekylformel | C8H14O3 |
|---|---|
| PubChem CID | 15538 |
| MDL-nummer | MFCD00008811 |
| IUPAC-namn | tert-butyl-3-oxobutanoat |
| CAS | 1694-31-1 |
| InChI-nyckel | JKUYRAMKJLMYLO-UHFFFAOYSA-N |
| LEDER | CC(=O)CC(=O)OC(C)(C)C |
| Molekylvikt (g/mol) | 158.2 |
| Synonym | tert-butyl acetoacetate,t-butyl acetoacetate,butanoic acid, 3-oxo-, 1,1-dimethylethyl ester,acetoacetic acid, tert-butyl ester,tert-butyl 3-oxobutyrate,acetoacetic acid tert-butyl ester,unii-1d3dos61gx,tbaa,1d3dos61gx,t-butylacetoacetate |
5-(hydroximetyl)furfural, 98 %, Thermo Scientific Chemicals
CAS: 67-47-0 Molekylformel: C6H6O3 Molekylvikt (g/mol): 126.11 InChI-nyckel: NOEGNKMFWQHSLB-UHFFFAOYSA-N Synonym: 5-hydroxymethylfurfural,5-hydroxymethyl-2-furaldehyde,5-hydroxymethyl furfural,5-hydroxymethyl furan-2-carbaldehyde,hydroxymethylfurfural,5-hydroxymethyl-2-furfural,5-oxymethylfurfurole,5-hydroxymethylfuraldehyde,hydroxymethylfurfurole PubChem CID: 237332 ChEBI: CHEBI:412516 IUPAC-namn: 5-(hydroximetyl)furan-2-karbaldehyd LEDER: C1=C(OC(=C1)C=O)CO
| Molekylformel | C6H6O3 |
|---|---|
| PubChem CID | 237332 |
| IUPAC-namn | 5-(hydroximetyl)furan-2-karbaldehyd |
| CAS | 67-47-0 |
| InChI-nyckel | NOEGNKMFWQHSLB-UHFFFAOYSA-N |
| LEDER | C1=C(OC(=C1)C=O)CO |
| ChEBI | CHEBI:412516 |
| Molekylvikt (g/mol) | 126.11 |
| Synonym | 5-hydroxymethylfurfural,5-hydroxymethyl-2-furaldehyde,5-hydroxymethyl furfural,5-hydroxymethyl furan-2-carbaldehyde,hydroxymethylfurfural,5-hydroxymethyl-2-furfural,5-oxymethylfurfurole,5-hydroxymethylfuraldehyde,hydroxymethylfurfurole |
Ethyl acetoacetate, 99%, pure
CAS: 141-97-9 Molekylformel: C6H10O3 Molekylvikt (g/mol): 130.14 MDL-nummer: MFCD00009199 InChI-nyckel: XYIBRDXRRQCHLP-UHFFFAOYSA-N Synonym: ethyl acetoacetate,ethyl acetylacetate,ethyl 3-oxobutyrate,diacetic ether,butanoic acid, 3-oxo-, ethyl ester,ethyl acetylacetonate,acetoacetic acid, ethyl ester,3-oxobutanoic acid ethyl ester,3-oxo-butyric acid ethyl ester,active acetylacetate PubChem CID: 8868 ChEBI: CHEBI:4893 IUPAC-namn: etyl-3-oxobutanoat LEDER: CCOC(=O)CC(=O)C
| Molekylformel | C6H10O3 |
|---|---|
| PubChem CID | 8868 |
| MDL-nummer | MFCD00009199 |
| IUPAC-namn | etyl-3-oxobutanoat |
| CAS | 141-97-9 |
| InChI-nyckel | XYIBRDXRRQCHLP-UHFFFAOYSA-N |
| LEDER | CCOC(=O)CC(=O)C |
| ChEBI | CHEBI:4893 |
| Molekylvikt (g/mol) | 130.14 |
| Synonym | ethyl acetoacetate,ethyl acetylacetate,ethyl 3-oxobutyrate,diacetic ether,butanoic acid, 3-oxo-, ethyl ester,ethyl acetylacetonate,acetoacetic acid, ethyl ester,3-oxobutanoic acid ethyl ester,3-oxo-butyric acid ethyl ester,active acetylacetate |
5-metylfurfural, 98+%, Thermo Scientific Chemicals
CAS: 620-02-0 Molekylformel: C6H6O2 Molekylvikt (g/mol): 110.11 MDL-nummer: MFCD00003232 InChI-nyckel: OUDFNZMQXZILJD-UHFFFAOYSA-N Synonym: 5-methylfurfural,5-methyl-2-furaldehyde,5-methyl furfural,5-methyl-2-furfural,2-furancarboxaldehyde, 5-methyl,5-methylfuran-2-al,5-methyl-2-furancarboxaldehyde,5-methylfurfuraldehyde,2-furaldehyde, 5-methyl,2-formyl-5-methylfuran PubChem CID: 12097 ChEBI: CHEBI:2091 IUPAC-namn: 5-metylfuran-2-karbaldehyd LEDER: CC1=CC=C(O1)C=O
| Molekylformel | C6H6O2 |
|---|---|
| PubChem CID | 12097 |
| MDL-nummer | MFCD00003232 |
| IUPAC-namn | 5-metylfuran-2-karbaldehyd |
| CAS | 620-02-0 |
| InChI-nyckel | OUDFNZMQXZILJD-UHFFFAOYSA-N |
| LEDER | CC1=CC=C(O1)C=O |
| ChEBI | CHEBI:2091 |
| Molekylvikt (g/mol) | 110.11 |
| Synonym | 5-methylfurfural,5-methyl-2-furaldehyde,5-methyl furfural,5-methyl-2-furfural,2-furancarboxaldehyde, 5-methyl,5-methylfuran-2-al,5-methyl-2-furancarboxaldehyde,5-methylfurfuraldehyde,2-furaldehyde, 5-methyl,2-formyl-5-methylfuran |
4'-Methylacetophenone, 95%
CAS: 122-00-9 Molekylformel: C9H10O Molekylvikt (g/mol): 134.18 MDL-nummer: MFCD00008751 InChI-nyckel: GNKZMNRKLCTJAY-UHFFFAOYSA-N Synonym: 4'-methylacetophenone,p-methylacetophenone,1-p-tolyl ethanone,1-p-tolylethanone,melilotal,4-methylacetophenone,4-acetyltoluene,1-4-methylphenyl ethanone,methyl p-tolyl ketone,p-acetotoluene PubChem CID: 8500 IUPAC-namn: 1-(4-metylfenyl)etanon LEDER: CC(=O)C1=CC=C(C)C=C1
| Molekylformel | C9H10O |
|---|---|
| PubChem CID | 8500 |
| MDL-nummer | MFCD00008751 |
| IUPAC-namn | 1-(4-metylfenyl)etanon |
| CAS | 122-00-9 |
| InChI-nyckel | GNKZMNRKLCTJAY-UHFFFAOYSA-N |
| LEDER | CC(=O)C1=CC=C(C)C=C1 |
| Molekylvikt (g/mol) | 134.18 |
| Synonym | 4'-methylacetophenone,p-methylacetophenone,1-p-tolyl ethanone,1-p-tolylethanone,melilotal,4-methylacetophenone,4-acetyltoluene,1-4-methylphenyl ethanone,methyl p-tolyl ketone,p-acetotoluene |
Benzil, 99+%
CAS: 134-81-6 Molekylformel: C14H10O2 Molekylvikt (g/mol): 210.23 MDL-nummer: MFCD00003080 InChI-nyckel: WURBFLDFSFBTLW-UHFFFAOYSA-N Synonym: benzil,diphenylethanedione,dibenzoyl,diphenylglyoxal,bibenzoyl,ethanedione, diphenyl,1,2-diphenylethanedione,diphenylethane-1,2-dione,glyoxal, diphenyl,diphenyldiketon PubChem CID: 8651 ChEBI: CHEBI:51507 IUPAC-namn: 1,2-difenyletan-1,2-dion LEDER: O=C(C(=O)C1=CC=CC=C1)C1=CC=CC=C1
| Molekylformel | C14H10O2 |
|---|---|
| PubChem CID | 8651 |
| MDL-nummer | MFCD00003080 |
| IUPAC-namn | 1,2-difenyletan-1,2-dion |
| CAS | 134-81-6 |
| InChI-nyckel | WURBFLDFSFBTLW-UHFFFAOYSA-N |
| LEDER | O=C(C(=O)C1=CC=CC=C1)C1=CC=CC=C1 |
| ChEBI | CHEBI:51507 |
| Molekylvikt (g/mol) | 210.23 |
| Synonym | benzil,diphenylethanedione,dibenzoyl,diphenylglyoxal,bibenzoyl,ethanedione, diphenyl,1,2-diphenylethanedione,diphenylethane-1,2-dione,glyoxal, diphenyl,diphenyldiketon |
3-Chloro-2,4-pentanedione, 98%
CAS: 1694-29-7 Molekylformel: C5H7ClO2 Molekylvikt (g/mol): 134.56 MDL-nummer: MFCD00009651 InChI-nyckel: VLRGXXKFHVJQOL-UHFFFAOYSA-N PubChem CID: 74328 IUPAC-namn: 3-klorpentan-2,4-dion LEDER: CC(=O)C(C(=O)C)Cl
| Molekylformel | C5H7ClO2 |
|---|---|
| PubChem CID | 74328 |
| MDL-nummer | MFCD00009651 |
| IUPAC-namn | 3-klorpentan-2,4-dion |
| CAS | 1694-29-7 |
| InChI-nyckel | VLRGXXKFHVJQOL-UHFFFAOYSA-N |
| LEDER | CC(=O)C(C(=O)C)Cl |
| Molekylvikt (g/mol) | 134.56 |
Ethyl acetoacetate, 99+%, extra pure
CAS: 141-97-9 Molekylformel: C6H10O3 Molekylvikt (g/mol): 130.14 MDL-nummer: MFCD00009199 InChI-nyckel: XYIBRDXRRQCHLP-UHFFFAOYSA-N Synonym: ethyl acetoacetate,ethyl acetylacetate,ethyl 3-oxobutyrate,diacetic ether,butanoic acid, 3-oxo-, ethyl ester,ethyl acetylacetonate,acetoacetic acid, ethyl ester,3-oxobutanoic acid ethyl ester,3-oxo-butyric acid ethyl ester,active acetylacetate PubChem CID: 8868 ChEBI: CHEBI:4893 IUPAC-namn: etyl-3-oxobutanoat LEDER: CCOC(=O)CC(=O)C
| Molekylformel | C6H10O3 |
|---|---|
| PubChem CID | 8868 |
| MDL-nummer | MFCD00009199 |
| IUPAC-namn | etyl-3-oxobutanoat |
| CAS | 141-97-9 |
| InChI-nyckel | XYIBRDXRRQCHLP-UHFFFAOYSA-N |
| LEDER | CCOC(=O)CC(=O)C |
| ChEBI | CHEBI:4893 |
| Molekylvikt (g/mol) | 130.14 |
| Synonym | ethyl acetoacetate,ethyl acetylacetate,ethyl 3-oxobutyrate,diacetic ether,butanoic acid, 3-oxo-, ethyl ester,ethyl acetylacetonate,acetoacetic acid, ethyl ester,3-oxobutanoic acid ethyl ester,3-oxo-butyric acid ethyl ester,active acetylacetate |
Ethyl 2-oxocyclopentanecarboxylate, 95+%
CAS: 611-10-9 Molekylformel: C8H12O3 Molekylvikt (g/mol): 156.18 MDL-nummer: MFCD00001412 InChI-nyckel: JHZPNBKZPAWCJD-UHFFFAOYSA-N PubChem CID: 69136 IUPAC-namn: etyl-2-oxocyklopentan-1-karboxylat LEDER: CCOC(=O)C1CCCC1=O
| Molekylformel | C8H12O3 |
|---|---|
| PubChem CID | 69136 |
| MDL-nummer | MFCD00001412 |
| IUPAC-namn | etyl-2-oxocyklopentan-1-karboxylat |
| CAS | 611-10-9 |
| InChI-nyckel | JHZPNBKZPAWCJD-UHFFFAOYSA-N |
| LEDER | CCOC(=O)C1CCCC1=O |
| Molekylvikt (g/mol) | 156.18 |
Mesityl oxide, 99%, mixture of alpha- and beta-isomers
CAS: 141-79-7 Molekylformel: C6H10O Molekylvikt (g/mol): 98.14 InChI-nyckel: SHOJXDKTYKFBRD-UHFFFAOYSA-N Synonym: mesityl oxide,4-methyl-3-penten-2-one,3-penten-2-one, 4-methyl,isopropylideneacetone,isobutenyl methyl ketone,methyl isobutenyl ketone,mesityloxid,mesityloxyde,3-isohexen-2-one,isopropylidene acetone PubChem CID: 8858 IUPAC-namn: 4-metylpent-3-en-2-on LEDER: CC(=CC(=O)C)C
| Molekylformel | C6H10O |
|---|---|
| PubChem CID | 8858 |
| IUPAC-namn | 4-metylpent-3-en-2-on |
| CAS | 141-79-7 |
| InChI-nyckel | SHOJXDKTYKFBRD-UHFFFAOYSA-N |
| LEDER | CC(=CC(=O)C)C |
| Molekylvikt (g/mol) | 98.14 |
| Synonym | mesityl oxide,4-methyl-3-penten-2-one,3-penten-2-one, 4-methyl,isopropylideneacetone,isobutenyl methyl ketone,methyl isobutenyl ketone,mesityloxid,mesityloxyde,3-isohexen-2-one,isopropylidene acetone |
tert-Butyl ethyl malonate, 97%, Thermo Scientific Chemicals
CAS: 32864-38-3 Molekylformel: C9H16O4 Molekylvikt (g/mol): 188.22 MDL-nummer: MFCD00009193 InChI-nyckel: OCOBFMZGRJOSOU-UHFFFAOYSA-N Synonym: tert-butyl ethyl malonate,t-butyl ethyl malonate,propanedioic acid, 1,1-dimethylethyl ethyl ester,1-tert-butyl 3-ethyl propanedioate,tert-butyl ethyl propanedioate,malonic acid tert-butyl ethyl ester,tert-butyl ethyl propane-1,3-dioate,zlchem 692,acmc-1cjju,1-tert-butyl ethyl malonate PubChem CID: 96345 IUPAC-namn: 3-0-tert-butyl-1-O-etylpropandioat LEDER: CCOC(=O)CC(=O)OC(C)(C)C
| Molekylformel | C9H16O4 |
|---|---|
| PubChem CID | 96345 |
| MDL-nummer | MFCD00009193 |
| IUPAC-namn | 3-0-tert-butyl-1-O-etylpropandioat |
| CAS | 32864-38-3 |
| InChI-nyckel | OCOBFMZGRJOSOU-UHFFFAOYSA-N |
| LEDER | CCOC(=O)CC(=O)OC(C)(C)C |
| Molekylvikt (g/mol) | 188.22 |
| Synonym | tert-butyl ethyl malonate,t-butyl ethyl malonate,propanedioic acid, 1,1-dimethylethyl ethyl ester,1-tert-butyl 3-ethyl propanedioate,tert-butyl ethyl propanedioate,malonic acid tert-butyl ethyl ester,tert-butyl ethyl propane-1,3-dioate,zlchem 692,acmc-1cjju,1-tert-butyl ethyl malonate |
Ethyl 2-methylacetoacetate, 95%
CAS: 609-14-3 Molekylformel: C7H12O3 Molekylvikt (g/mol): 144.17 MDL-nummer: MFCD00009164 InChI-nyckel: FNENWZWNOPCZGK-UHFFFAOYSA-N Synonym: ethyl 2-methylacetoacetate,ethyl 2-acetylpropionate,ethyl-2-methyl acetoacetate,ethyl methylacetoacetate,ethyl 2-methyl-3-oxobutyrate,ethyl2-methylacetoacetate,butanoic acid, 2-methyl-3-oxo-, ethyl ester,2-methylacetoacetic acid ethyl ester,ethyl alpha-methylacetylacetate,2-methyl-3-oxobutanoic acid ethyl ester PubChem CID: 701 IUPAC-namn: etyl-2-metyl-3-oxobutanoat LEDER: CCOC(=O)C(C)C(=O)C
| Molekylformel | C7H12O3 |
|---|---|
| PubChem CID | 701 |
| MDL-nummer | MFCD00009164 |
| IUPAC-namn | etyl-2-metyl-3-oxobutanoat |
| CAS | 609-14-3 |
| InChI-nyckel | FNENWZWNOPCZGK-UHFFFAOYSA-N |
| LEDER | CCOC(=O)C(C)C(=O)C |
| Molekylvikt (g/mol) | 144.17 |
| Synonym | ethyl 2-methylacetoacetate,ethyl 2-acetylpropionate,ethyl-2-methyl acetoacetate,ethyl methylacetoacetate,ethyl 2-methyl-3-oxobutyrate,ethyl2-methylacetoacetate,butanoic acid, 2-methyl-3-oxo-, ethyl ester,2-methylacetoacetic acid ethyl ester,ethyl alpha-methylacetylacetate,2-methyl-3-oxobutanoic acid ethyl ester |
Valeraldehyde, 97%
CAS: 110-62-3 Molekylformel: C5H10O Molekylvikt (g/mol): 86.13 MDL-nummer: MFCD00007026 InChI-nyckel: HGBOYTHUEUWSSQ-UHFFFAOYSA-N Synonym: valeraldehyde,n-pentanal,n-valeraldehyde,valeric aldehyde,valeral,valeryl aldehyde,amylaldehyde,butyl formal,amyl aldehyde,valeric acid aldehyde PubChem CID: 8063 ChEBI: CHEBI:84069 IUPAC-namn: pentanal LEDER: CCCCC=O
| Molekylformel | C5H10O |
|---|---|
| PubChem CID | 8063 |
| MDL-nummer | MFCD00007026 |
| IUPAC-namn | pentanal |
| CAS | 110-62-3 |
| InChI-nyckel | HGBOYTHUEUWSSQ-UHFFFAOYSA-N |
| LEDER | CCCCC=O |
| ChEBI | CHEBI:84069 |
| Molekylvikt (g/mol) | 86.13 |
| Synonym | valeraldehyde,n-pentanal,n-valeraldehyde,valeric aldehyde,valeral,valeryl aldehyde,amylaldehyde,butyl formal,amyl aldehyde,valeric acid aldehyde |
2,5-dimetoxibensaldehyd, 97 %, Thermo Scientific Chemicals
CAS: 93-02-7 Molekylformel: C9H10O3 Molekylvikt (g/mol): 166.18 InChI-nyckel: AFUKNJHPZAVHGQ-UHFFFAOYSA-N Synonym: benzaldehyde, 2,5-dimethoxy,2,5-dimethoxy benzaldehyde,unii-w49s1ppl78,2,5-dimethoxybenzald,pubchem2176,gentisic aldehyde,5-dimethoxy benzaldehyde,2,5-dimethoxybenzaldehyd,2,5-dimethoxybenzaldehye,2.5-dimethoxybenzaldehyde PubChem CID: 66726 IUPAC-namn: 2,5-dimetoxibensaldehyd LEDER: COC1=CC(=C(C=C1)OC)C=O
| Molekylformel | C9H10O3 |
|---|---|
| PubChem CID | 66726 |
| IUPAC-namn | 2,5-dimetoxibensaldehyd |
| CAS | 93-02-7 |
| InChI-nyckel | AFUKNJHPZAVHGQ-UHFFFAOYSA-N |
| LEDER | COC1=CC(=C(C=C1)OC)C=O |
| Molekylvikt (g/mol) | 166.18 |
| Synonym | benzaldehyde, 2,5-dimethoxy,2,5-dimethoxy benzaldehyde,unii-w49s1ppl78,2,5-dimethoxybenzald,pubchem2176,gentisic aldehyde,5-dimethoxy benzaldehyde,2,5-dimethoxybenzaldehyd,2,5-dimethoxybenzaldehye,2.5-dimethoxybenzaldehyde |
Benzoylnitromethane, 98%
CAS: 614-21-1 Molekylformel: C8H7NO3 Molekylvikt (g/mol): 165.15 MDL-nummer: MFCD00010218 InChI-nyckel: JTWHVBNYYWFXSI-UHFFFAOYSA-N Synonym: benzoylnitromethane,ethanone, 2-nitro-1-phenyl,alpha-nitroacetophenone,2-nitro-1-phenylethanon,nitroacetophenone,alpha-nitro acetophenone,acmc-1bdpo,acetophenone, 2-nitro,nitromethyl phenyl ketone,.alpha.-nitroacetophenone PubChem CID: 94833 IUPAC-namn: 2-nitro-1-fenyletanon LEDER: C1=CC=C(C=C1)C(=O)C[N+](=O)[O-]
| Molekylformel | C8H7NO3 |
|---|---|
| PubChem CID | 94833 |
| MDL-nummer | MFCD00010218 |
| IUPAC-namn | 2-nitro-1-fenyletanon |
| CAS | 614-21-1 |
| InChI-nyckel | JTWHVBNYYWFXSI-UHFFFAOYSA-N |
| LEDER | C1=CC=C(C=C1)C(=O)C[N+](=O)[O-] |
| Molekylvikt (g/mol) | 165.15 |
| Synonym | benzoylnitromethane,ethanone, 2-nitro-1-phenyl,alpha-nitroacetophenone,2-nitro-1-phenylethanon,nitroacetophenone,alpha-nitro acetophenone,acmc-1bdpo,acetophenone, 2-nitro,nitromethyl phenyl ketone,.alpha.-nitroacetophenone |