Hartser och stöd
Filtrerade sökresultat
AmberChrom 50Wx8 100-200 (H), Thermo Scientific Chemicals
CAS: 11119-67-8 MDL-nummer: MFCD00132726 IUPAC-namn: AmberChrom™ 50WX8 jonbytarharts
| MDL-nummer | MFCD00132726 |
|---|---|
| IUPAC-namn | AmberChrom™ 50WX8 jonbytarharts |
| CAS | 11119-67-8 |
Amberlyst™ 15(H), jonbytarharts, Thermo Scientific Chemicals
CAS: 39389-20-3 Molekylformel: C18H18O3S Molekylvikt (g/mol): 314.399 MDL-nummer: MFCD00145841 InChI-nyckel: SIWVGXQOXWGJCI-UHFFFAOYSA-N Synonym: amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid PubChem CID: 170197 IUPAC-namn: 1,2-bis(etenyl)bensen;2-etenylbensensulfonsyra LEDER: C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O
| Molekylformel | C18H18O3S |
|---|---|
| PubChem CID | 170197 |
| MDL-nummer | MFCD00145841 |
| IUPAC-namn | 1,2-bis(etenyl)bensen;2-etenylbensensulfonsyra |
| CAS | 39389-20-3 |
| InChI-nyckel | SIWVGXQOXWGJCI-UHFFFAOYSA-N |
| LEDER | C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O |
| Molekylvikt (g/mol) | 314.399 |
| Synonym | amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid |
| MDL-nummer | MFCD00132705 |
|---|---|
| CAS | 37380-43-1 |
Amberlite™ IRN-78 jonbytarharts, OH-form, Thermo Scientific Chemicals
CAS: 11128-95-3 MDL-nummer: MFCD00145822
| MDL-nummer | MFCD00145822 |
|---|---|
| CAS | 11128-95-3 |
Amberlite™ IRA-67, jonbytarharts, Thermo Scientific Chemicals
CAS: 80747-90-6 MDL-nummer: MFCD00145567
| MDL-nummer | MFCD00145567 |
|---|---|
| CAS | 80747-90-6 |
Amberlite™ IRA-200C(Na), jonbytarharts, Thermo Scientific Chemicals
styren-DVB; Starkt surt makroretikulärt katjonbytarharts
| Färg | Bärnsten |
|---|---|
| Molekylformel | Styrene-DVB |
| Rekommenderad förvaring | Omgivningstemperaturer |
| MDL-nummer | MFCD01864001 |
| Odör | Odorless |
| TSCA | Yes |
| Kemiskt namn eller material | Amberlite IRA-200C(Na) |
| Löslighetsinformation | Insoluble in water. |
| Fysisk form | Pärlor |
AmberChrom™ , 50WX8 200-400 (H), Thermo Scientific Chemicals
CAS: 11119-67-8 MDL-nummer: MFCD00132726 IUPAC-namn: AmberChrom™ 50WX8 jonbytarharts
| MDL-nummer | MFCD00132726 |
|---|---|
| IUPAC-namn | AmberChrom™ 50WX8 jonbytarharts |
| CAS | 11119-67-8 |
| MDL-nummer | MFCD00132710 |
|---|---|
| CAS | 9002-26-0 |
Amberlite™ IRC-120(H), jonbytarharts, Thermo Scientific Chemicals
CAS: 78922-04-0 Molekylformel: C13H10ClNO4S Molekylvikt (g/mol): 311.736 MDL-nummer: MFCD00132707 InChI-nyckel: APBOVLPLJFJSRI-UHFFFAOYSA-N Synonym: 3-3-chlorophenylsulfonamido benzoic acid,3-3-chloro-benzenesulfonylamino-benzoic acid,3-3-chlorophenyl sulfonyl amino benzoic acid,benzoicacid, 3-3-chlorophenyl sulfonyl amino,3-3-chlorobenzenesulfonamido benzoic acid,amberlite ir-120,3-3-chlorophenyl sulfonylamino benzoic acid,3-3-chlorophenyl sulfonamido benzoic acid PubChem CID: 8190984 IUPAC-namn: 3-[(3-klorfenyl)sulfonylamino]bensoesyra LEDER: C1=CC(=CC(=C1)NS(=O)(=O)C2=CC(=CC=C2)Cl)C(=O)O
| Molekylformel | C13H10ClNO4S |
|---|---|
| PubChem CID | 8190984 |
| MDL-nummer | MFCD00132707 |
| IUPAC-namn | 3-[(3-klorfenyl)sulfonylamino]bensoesyra |
| CAS | 78922-04-0 |
| InChI-nyckel | APBOVLPLJFJSRI-UHFFFAOYSA-N |
| LEDER | C1=CC(=CC(=C1)NS(=O)(=O)C2=CC(=CC=C2)Cl)C(=O)O |
| Molekylvikt (g/mol) | 311.736 |
| Synonym | 3-3-chlorophenylsulfonamido benzoic acid,3-3-chloro-benzenesulfonylamino-benzoic acid,3-3-chlorophenyl sulfonyl amino benzoic acid,benzoicacid, 3-3-chlorophenyl sulfonyl amino,3-3-chlorobenzenesulfonamido benzoic acid,amberlite ir-120,3-3-chlorophenyl sulfonylamino benzoic acid,3-3-chlorophenyl sulfonamido benzoic acid |
| MDL-nummer | 81645 |
|---|
| Belastning | 0.2 to 0.3mmol/g |
|---|---|
| Färg | Vitt till gult |
| MDL-nummer | MFCD00217899 |
| Partikelstorlek | 90 Micron |
| Synonym | O-(2-Aminoethyl)polyethylene glycol polymer bound |
| Kemiskt namn eller material | TentaGel™ S-NH2 |
| Fysisk form | Pulver |
Dowtherm™ A, Thermo Scientific Chemicals
CAS: 8004-13-5 Molekylformel: C24H20O Molekylvikt (g/mol): 324.423 MDL-nummer: MFCD00148859 InChI-nyckel: MHCVCKDNQYMGEX-UHFFFAOYSA-N Synonym: diphyl,dowtherm,dowtherm a,dinil,dinyl,therminol vp,phenyl ether-biphenyl mixture,phenyl ether-diphenyl mixture,biphenyl-diphenyl ether mixture,hsdb 137 PubChem CID: 24670 IUPAC-namn: 1,1'-bifenyl;fenoxibensen LEDER: C1=CC=C(C=C1)C2=CC=CC=C2.C1=CC=C(C=C1)OC2=CC=CC=C2
| Molekylformel | C24H20O |
|---|---|
| PubChem CID | 24670 |
| MDL-nummer | MFCD00148859 |
| IUPAC-namn | 1,1'-bifenyl;fenoxibensen |
| CAS | 8004-13-5 |
| InChI-nyckel | MHCVCKDNQYMGEX-UHFFFAOYSA-N |
| LEDER | C1=CC=C(C=C1)C2=CC=CC=C2.C1=CC=C(C=C1)OC2=CC=CC=C2 |
| Molekylvikt (g/mol) | 324.423 |
| Synonym | diphyl,dowtherm,dowtherm a,dinil,dinyl,therminol vp,phenyl ether-biphenyl mixture,phenyl ether-diphenyl mixture,biphenyl-diphenyl ether mixture,hsdb 137 |
TentaGel™ MB-Br, Thermo Scientific Chemicals
MDL-nummer: MFCD00217898 Synonym: O-(2-Bromoethyl)polyethylene glycol polymer bound
| MDL-nummer | MFCD00217898 |
|---|---|
| Synonym | O-(2-Bromoethyl)polyethylene glycol polymer bound |
| MDL-nummer | MFCD00145842 |
|---|---|
| CAS | 9049-93-8 |