Filtrerade sökresultat
Sök resultat för "BDS Phenyl"
Thermo Scientific™ Hypersil™ PREP BDS Phenyl HPLC-kolonner
Uppnå unik selektivitet för aromatiska och lätt polära föreningar med en bas-deaktiverad Hypersil PREP Phenyl BDS prep LC-kolonn, lämplig för USP L11 applikationer.
| Temperatur | 60 °C |
|---|---|
| Partikelstorlek | 5 μm |
| Kolbelastning | 5% |
| Endcapped | Ja |
| USP typ | L11 |
| Kolumntyp | Omvänd fas |
| Ytarea | 185 m² /g |
| pH | 2 till 8 |
| Fas | Omvänd fas |
| Förpackningsmaterial | Sfärisk, helt porös, basdeaktiverad kiseldioxid |
| Stationär fas | Fenyl (Ph) |
| Porstorlek | 145Å |
Thermo Scientific™ Hypersil™ BDS Phenyl (Ph) omvänd fas HPLC-kolonn, 5μ m, 4 mm x 300 mm
Kolumnformat: Analytisk kolumn; Kolbelastning: 5%; Porstorlek: 130Å ; Kolumnfas: Omvänd fas
Thermo Scientific™ Hypersil™ Fenyl-BDS HPLC-kolonner
Använd som en robust kolonn för allmänt bruk med aromatisk selektivitet för QC/QA-labb.
| Temperatur | 60 °C |
|---|---|
| Kolbelastning | 5% |
| Endcapped | Ja |
| USP typ | L11 |
| Kolumntyp | Omvänd fas |
| Ytarea | 170 m² /g |
| Fas | Omvänd fas |
| Förpackningsmaterial | Sfärisk, helt porös, basdeaktiverad kiseldioxid |
| Stationär fas | Fenyl (Ph) |
| Max. Tryck | 5800 psi (400 bar) |
| Porstorlek | 130 Å |
2-Phenyl-1,3-propanediol, 98%
CAS: 1570-95-2 Molekylformel: C9H12O2 Molekylvikt (g/mol): 152.193 MDL-nummer: MFCD00236056 InChI-nyckel: BPBDZXFJDMJLIB-UHFFFAOYSA-N Synonym: 2-phenyl-1,3-propanediol,2-phenyl-1,3-propanediole,2-phenyl-propane-1,3-diol,2-phenyl-1,3-propane diol,unii-9f93674jbb,1,3-propanediol, 2-phenyl,phenylpropanediol,pubchem20386,rarechem al bd 1370,acmc-1bz5a PubChem CID: 254178 IUPAC-namn: 2-fenylpropan-1,3-diol LEDER: C1=CC=C(C=C1)C(CO)CO
| Molekylformel | C9H12O2 |
|---|---|
| PubChem CID | 254178 |
| MDL-nummer | MFCD00236056 |
| IUPAC-namn | 2-fenylpropan-1,3-diol |
| CAS | 1570-95-2 |
| InChI-nyckel | BPBDZXFJDMJLIB-UHFFFAOYSA-N |
| LEDER | C1=CC=C(C=C1)C(CO)CO |
| Molekylvikt (g/mol) | 152.193 |
| Synonym | 2-phenyl-1,3-propanediol,2-phenyl-1,3-propanediole,2-phenyl-propane-1,3-diol,2-phenyl-1,3-propane diol,unii-9f93674jbb,1,3-propanediol, 2-phenyl,phenylpropanediol,pubchem20386,rarechem al bd 1370,acmc-1bz5a |
Thermo Scientific™ Hypersil™ PREP BDS Si HPLC-kolonner
Separera opolära och måttligt polära organiska föreningar med normal fas Hypersil PREP Si BDS LC-kolonner i preparativ skala och XtendedLife-teknologi.
| Temperatur | 60 °C |
|---|---|
| Kolbelastning | 0% |
| Endcapped | Nej |
| USP typ | L3 |
| Kolumntyp | Normal fas |
| Ytarea | 185 m² /g |
| pH | 2 till 7 |
| Fas | Normal fas |
| Förpackningsmaterial | Sfärisk, helt porös, basdeaktiverad kiseldioxid |
| Stationär fas | Kiseldioxid |
| Porstorlek | 145Å |
3-klor-5-fluorbensylalkohol, 98+%, Thermo Scientific Chemicals
CAS: 79944-64-2 Molekylformel: C7H6ClFO Molekylvikt (g/mol): 160.57 MDL-nummer: MFCD03788554 InChI-nyckel: VJTJBAMDTCIMOB-UHFFFAOYSA-N Synonym: 3-chloro-5-fluorobenzyl alcohol,3-chloro-5-fluorophenyl methanol,3-chloro-5-fluoro-phenyl methanol,rarechem al bd 1247,benzenemethanol,3-chloro-5-fluoro,3-chloro-5-fluoro phenyl methanol,3-chloro-5-fluoro-phenyl-methanol,3-chloro-5-fluorophenyl methan-1-ol PubChem CID: 2734835 IUPAC-namn: (3-klor-5-fluorfenyl)metanol LEDER: OCC1=CC(F)=CC(Cl)=C1
| Molekylformel | C7H6ClFO |
|---|---|
| PubChem CID | 2734835 |
| MDL-nummer | MFCD03788554 |
| IUPAC-namn | (3-klor-5-fluorfenyl)metanol |
| CAS | 79944-64-2 |
| InChI-nyckel | VJTJBAMDTCIMOB-UHFFFAOYSA-N |
| LEDER | OCC1=CC(F)=CC(Cl)=C1 |
| Molekylvikt (g/mol) | 160.57 |
| Synonym | 3-chloro-5-fluorobenzyl alcohol,3-chloro-5-fluorophenyl methanol,3-chloro-5-fluoro-phenyl methanol,rarechem al bd 1247,benzenemethanol,3-chloro-5-fluoro,3-chloro-5-fluoro phenyl methanol,3-chloro-5-fluoro-phenyl-methanol,3-chloro-5-fluorophenyl methan-1-ol |
4-fluor-2-metylbensylalkohol, 99 %, Thermo Scientific Chemicals
CAS: 80141-91-9 Molekylformel: C8H9FO Molekylvikt (g/mol): 140.157 MDL-nummer: MFCD03701058 InChI-nyckel: YSULUXOLTMBSFF-UHFFFAOYSA-N Synonym: 4-fluoro-2-methylphenyl methanol,4-fluoro-2-methylbenzyl alcohol,4-fluoro-2-methylbenzylalcohol,rarechem al bd 0506,4-fluoro-2-methylbenzenemethanol,benzenemethanol, 4-fluoro-2-methyl,4-fluoro-2-methyl-phenyl-methanol,4-fluoro-2-methylphenyl methan-1-ol,4'-fluoro-2-methylbenzyl alcohol PubChem CID: 3872017 IUPAC-namn: (4-fluor-2-metylfenyl)metanol LEDER: CC1=C(C=CC(=C1)F)CO
| Molekylformel | C8H9FO |
|---|---|
| PubChem CID | 3872017 |
| MDL-nummer | MFCD03701058 |
| IUPAC-namn | (4-fluor-2-metylfenyl)metanol |
| CAS | 80141-91-9 |
| InChI-nyckel | YSULUXOLTMBSFF-UHFFFAOYSA-N |
| LEDER | CC1=C(C=CC(=C1)F)CO |
| Molekylvikt (g/mol) | 140.157 |
| Synonym | 4-fluoro-2-methylphenyl methanol,4-fluoro-2-methylbenzyl alcohol,4-fluoro-2-methylbenzylalcohol,rarechem al bd 0506,4-fluoro-2-methylbenzenemethanol,benzenemethanol, 4-fluoro-2-methyl,4-fluoro-2-methyl-phenyl-methanol,4-fluoro-2-methylphenyl methan-1-ol,4'-fluoro-2-methylbenzyl alcohol |
Fexofenadine Hydrochloride, Mikromol™
Discover Mikromol - your trusted source for high-quality pharmaceutical reference standards. Supporting accurate, compliant analysis with ISO 17034-accredited materials designed for confidence in every result.
Fexofenadine hydrochloride 100 μg/mL in Acetonitrile, Dr. Ehrenstorfer
Discover Dr. Ehrenstorfer’s certified reference materials: available in multiple formats, including multi-component regulatory mixtures, to power your food and environmental analysis with traceable, ISO-accredited quality
Thermo Scientific™ Hypersil™ BDS Phenyl Columns
Exceptional stability and alternative selectivity to C18 and C8 columns
| Partikelstorlek | 5 μm |
|---|---|
| Kolbelastning | 5% |
| USP typ | L11 |
| Kolumntyp | Reversed Phase |
| Fas | Reversed Phase |
| Förpackningsmaterial | Silica |
| Stationär fas | Phenyl (Ph) |
| Porstorlek | 130 Å |
Thermo Scientific™ Hypersil™ BDS 3μm Phenyl Columns
Exceptional stability and alternative selectivity to C18 and C8 columns
| Partikelstorlek | 3 μm |
|---|---|
| Kolbelastning | 5% |
| USP typ | L11 |
| Kolumntyp | Reversed Phase |
| Ytarea | 170 m²/g |
| Fas | Reversed Phase |
| Stationär fas | Phenyl (Ph) |
| Porstorlek | 130 Å |
Thermo Scientific™ Hypersil™ BDS 2.4μm Phenyl Columns
Exceptional stability and alternative selectivity to C18 and C8 columns
| Partikelstorlek | 2.4 μm |
|---|---|
| Kolbelastning | 5% |
| Endcapped | Yes |
| USP typ | L11 |
| Kolumntyp | Reversed Phase |
| Ytarea | 170 m²/g |
| pH | 2 to 9 |
| Fas | Reversed Phase |
| Förpackningsmaterial | Base-Deactivated Silica |
| Diameter (metrisk) | 4.6 mm |
| Stationär fas | Phenyl (Ph) |
| Porstorlek | 130 Å |
2-Phenyl-1,3-propanediol, 98%, Thermo Scientific™
CAS: 1570-95-2 Molekylformel: C9H12O2 Molekylvikt (g/mol): 152.19 InChI-nyckel: BPBDZXFJDMJLIB-UHFFFAOYSA-N Synonym: 2-phenyl-1,3-propanediol,2-phenyl-1,3-propanediole,2-phenyl-propane-1,3-diol,2-phenyl-1,3-propane diol,unii-9f93674jbb,1,3-propanediol, 2-phenyl,phenylpropanediol,pubchem20386,rarechem al bd 1370,acmc-1bz5a PubChem CID: 254178 IUPAC-namn: 2-phenylpropane-1,3-diol LEDER: C1=CC=C(C=C1)C(CO)CO
| Molekylformel | C9H12O2 |
|---|---|
| PubChem CID | 254178 |
| IUPAC-namn | 2-phenylpropane-1,3-diol |
| CAS | 1570-95-2 |
| InChI-nyckel | BPBDZXFJDMJLIB-UHFFFAOYSA-N |
| LEDER | C1=CC=C(C=C1)C(CO)CO |
| Molekylvikt (g/mol) | 152.19 |
| Synonym | 2-phenyl-1,3-propanediol,2-phenyl-1,3-propanediole,2-phenyl-propane-1,3-diol,2-phenyl-1,3-propane diol,unii-9f93674jbb,1,3-propanediol, 2-phenyl,phenylpropanediol,pubchem20386,rarechem al bd 1370,acmc-1bz5a |
2-Chloro-3-(trifluoromethyl)benzyl alcohol, 97+%, Thermo Scientific™
CAS: 261763-20-6 Molekylformel: C8H6ClF3O Molekylvikt (g/mol): 210.58 MDL-nummer: MFCD01631537 InChI-nyckel: MQUXXVLMXCHGDZ-UHFFFAOYSA-N Synonym: 2-chloro-3-trifluoromethyl benzyl alcohol,2-chloro-3-trifluoromethyl phenyl methanol,2-chloro-3-trifluoromethyl benzylalcohol,2-chloro-3-trifluoromethyl phenyl methan-1-ol,acmc-1coey,rarechem al bd 0475,rarechem al bd 1301,2-chloro-3-trifluoromethyl-benzylalcohol,2-chloro-3-trifluoromethylbenzyl alcohol PubChem CID: 2778108 IUPAC-namn: [2-chloro-3-(trifluoromethyl)phenyl]methanol LEDER: C1=CC(=C(C(=C1)C(F)(F)F)Cl)CO
| Molekylformel | C8H6ClF3O |
|---|---|
| PubChem CID | 2778108 |
| MDL-nummer | MFCD01631537 |
| IUPAC-namn | [2-chloro-3-(trifluoromethyl)phenyl]methanol |
| CAS | 261763-20-6 |
| InChI-nyckel | MQUXXVLMXCHGDZ-UHFFFAOYSA-N |
| LEDER | C1=CC(=C(C(=C1)C(F)(F)F)Cl)CO |
| Molekylvikt (g/mol) | 210.58 |
| Synonym | 2-chloro-3-trifluoromethyl benzyl alcohol,2-chloro-3-trifluoromethyl phenyl methanol,2-chloro-3-trifluoromethyl benzylalcohol,2-chloro-3-trifluoromethyl phenyl methan-1-ol,acmc-1coey,rarechem al bd 0475,rarechem al bd 1301,2-chloro-3-trifluoromethyl-benzylalcohol,2-chloro-3-trifluoromethylbenzyl alcohol |