Buffertar och standarder
Vätejonbuffertar innefattande en blandning av en svag syra och dess konjugatbas eller vice versa och som används för att stabilisera pH; även spädningsmedel, tvättlösningar och standardlösningar som används för ett brett spektrum av vetenskapliga kalibreringsändamål.
Buffertarna som används för att kalibrera pH-mätare kan vara certifierade och/eller spårbara till National Institute of Standards and Technology (NIST). Dessa buffertar kan också vara färgkodade för enkel identifiering:
- Röd: pH 4,0 Gul:
- pH 7,0 Blå:
- pH 10,0
Filtrerade sökresultat
| Kvalitet | Molekylärbiologi, Ultrapure |
|---|---|
| Rekommenderad förvaring | Omgivningstemperaturer |
| TSCA | Yes |
| Kemiskt namn eller material | TAE Buffer |
| Koncentration | 10X |
| Fysisk form | Lösning |
HEPES, 1M Solution, pH 7.3, Molecular Biology Grade, Ultrapure
CAS: 7365-45-9 Molekylformel: C8H18N2O4S Molekylvikt (g/mol): 238.30 MDL-nummer: MFCD00006158 InChI-nyckel: JKMHFZQWWAIEOD-UHFFFAOYSA-N PubChem CID: 23831 ChEBI: CHEBI:42334 LEDER: OCCN1CCN(CCS(O)(=O)=O)CC1
| Molekylformel | C8H18N2O4S |
|---|---|
| PubChem CID | 23831 |
| MDL-nummer | MFCD00006158 |
| CAS | 7365-45-9 |
| InChI-nyckel | JKMHFZQWWAIEOD-UHFFFAOYSA-N |
| LEDER | OCCN1CCN(CCS(O)(=O)=O)CC1 |
| ChEBI | CHEBI:42334 |
| Molekylvikt (g/mol) | 238.30 |
Tris hydroklorid (små vita flingor/molekylärbiologi), Fisher BioReagents
CAS: 1185-53-1 Molekylformel: C4H12ClNO3 Molekylvikt (g/mol): 157.594 InChI-nyckel: QKNYBSVHEMOAJP-UHFFFAOYSA-N Synonym: Tris(hydroxymethyl)aminomethane Hydrochloride PubChem CID: 93573 IUPAC-namn: 2-amino-2-(hydroximetyl)propan-1,3-diol;hydroklorid LEDER: C(C(CO)(CO)N)O.Cl
| Molekylformel | C4H12ClNO3 |
|---|---|
| PubChem CID | 93573 |
| IUPAC-namn | 2-amino-2-(hydroximetyl)propan-1,3-diol;hydroklorid |
| CAS | 1185-53-1 |
| InChI-nyckel | QKNYBSVHEMOAJP-UHFFFAOYSA-N |
| LEDER | C(C(CO)(CO)N)O.Cl |
| Molekylvikt (g/mol) | 157.594 |
| Synonym | Tris(hydroxymethyl)aminomethane Hydrochloride |
TE-buffert, 1X lösning pH 8,0, låg EDTA, molekylärbiologigrad, Thermo Scientific Chemicals
CAS: 1185-53-1 Molekylformel: C4H12ClNO3 Molekylvikt (g/mol): 157.594 InChI-nyckel: QKNYBSVHEMOAJP-UHFFFAOYSA-N PubChem CID: 93573 IUPAC-namn: 2-amino-2-(hydroximetyl)propan-1,3-diol;hydroklorid LEDER: C(C(CO)(CO)N)O.Cl
| Molekylformel | C4H12ClNO3 |
|---|---|
| PubChem CID | 93573 |
| IUPAC-namn | 2-amino-2-(hydroximetyl)propan-1,3-diol;hydroklorid |
| CAS | 1185-53-1 |
| InChI-nyckel | QKNYBSVHEMOAJP-UHFFFAOYSA-N |
| LEDER | C(C(CO)(CO)N)O.Cl |
| Molekylvikt (g/mol) | 157.594 |
Thermo Scientific Chemicals HEPES-natriumsalt, 99+%, för molekylärbiologi, DNAs-, RNAse- och proteasfritt
CAS: 75277-39-3 Molekylformel: C8H17N2NaO4S Molekylvikt (g/mol): 260.28 MDL-nummer: MFCD00036463 InChI-nyckel: RDZTWEVXRGYCFV-UHFFFAOYSA-M Synonym: 2-[4-(2-Hydroxyethyl)-1-piperazine]ethanesulfonic acid sodium salt PubChem CID: 2724248 ChEBI: CHEBI:46758 IUPAC-namn: natrium;2-[4-(2-hydroxietyl)piperazin-1-yl]etansulfonat LEDER: [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1
| Molekylformel | C8H17N2NaO4S |
|---|---|
| PubChem CID | 2724248 |
| MDL-nummer | MFCD00036463 |
| IUPAC-namn | natrium;2-[4-(2-hydroxietyl)piperazin-1-yl]etansulfonat |
| CAS | 75277-39-3 |
| InChI-nyckel | RDZTWEVXRGYCFV-UHFFFAOYSA-M |
| LEDER | [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1 |
| ChEBI | CHEBI:46758 |
| Molekylvikt (g/mol) | 260.28 |
| Synonym | 2-[4-(2-Hydroxyethyl)-1-piperazine]ethanesulfonic acid sodium salt |
Thermo Scientific Chemicals HEPES fri syra, 99+%, för molekylärbiologi, DNas-, RNAs- och proteasfri
CAS: 7365-45-9 Molekylformel: C8H18N2O4S Molekylvikt (g/mol): 238.30 MDL-nummer: MFCD00006158 InChI-nyckel: JKMHFZQWWAIEOD-UHFFFAOYSA-N Synonym: 2-[4-(2-Hydroxyethyl)-1-piperazine]ethanesulfonic acid PubChem CID: 23831 ChEBI: CHEBI:42334 IUPAC-namn: 2-[4-(2-hydroxietyl)piperazin-1-yl]etan-1-sulfonsyra LEDER: OCCN1CCN(CCS(O)(=O)=O)CC1
| Molekylformel | C8H18N2O4S |
|---|---|
| PubChem CID | 23831 |
| MDL-nummer | MFCD00006158 |
| IUPAC-namn | 2-[4-(2-hydroxietyl)piperazin-1-yl]etan-1-sulfonsyra |
| CAS | 7365-45-9 |
| InChI-nyckel | JKMHFZQWWAIEOD-UHFFFAOYSA-N |
| LEDER | OCCN1CCN(CCS(O)(=O)=O)CC1 |
| ChEBI | CHEBI:42334 |
| Molekylvikt (g/mol) | 238.30 |
| Synonym | 2-[4-(2-Hydroxyethyl)-1-piperazine]ethanesulfonic acid |
Thermo Scientific Chemicals MOPS, 99,5 %, för molekylärbiologi, Dnase, Rnase, Prot. gratis, för peptidsekvensering
CAS: 1132-61-2 Molekylformel: C7H15NO4S Molekylvikt (g/mol): 209.26 MDL-nummer: MFCD00006183 InChI-nyckel: DVLFYONBTKHTER-UHFFFAOYSA-N Synonym: 3-(N-Morpholino)propanesulfonic acid PubChem CID: 70807 ChEBI: CHEBI:44115 IUPAC-namn: 3-morfolin-4-ylpropan-1-sulfonsyra LEDER: [O-]S(=O)(=O)CCC[NH+]1CCOCC1
| Molekylformel | C7H15NO4S |
|---|---|
| PubChem CID | 70807 |
| MDL-nummer | MFCD00006183 |
| IUPAC-namn | 3-morfolin-4-ylpropan-1-sulfonsyra |
| CAS | 1132-61-2 |
| InChI-nyckel | DVLFYONBTKHTER-UHFFFAOYSA-N |
| LEDER | [O-]S(=O)(=O)CCC[NH+]1CCOCC1 |
| ChEBI | CHEBI:44115 |
| Molekylvikt (g/mol) | 209.26 |
| Synonym | 3-(N-Morpholino)propanesulfonic acid |
PBS, 10X Solution, Molecular Biology Grade
För biologisk forskning. Thermo Scientific™ PBS, 10X Solution, Molecular Biology Grade är μ0,2 m filtrerad och dispenserad i hållbara, fyrkantiga nalgenflaskor och upprättstående kartong.
| Rekommenderad förvaring | Omgivningstemperaturer |
|---|---|
| pH | 7.4 |
| Formulering | 80,6 mM natriumfosfat, 19,4 mM kaliumfosfat, 27 mM KCl och 1,37 M NaCl i hög renhet dH 2 O |
| Fysisk form | Lösning |
Tris-bas (vita kristaller eller kristallint pulver/molekylärbiologi), Fisher BioReagents™
CAS: 77-86-1 Molekylformel: C4H11NO3 Molekylvikt (g/mol): 121.136 InChI-nyckel: LENZDBCJOHFCAS-UHFFFAOYSA-N Synonym: Trimethylol Aminomethane,Tris(hydroxymethyl)aminomethane,2-Amino-2-(hydroxymethyl)-1,3-propanediol,THAM,Tris base,Trometamol PubChem CID: 6503 ChEBI: CHEBI:9754 IUPAC-namn: 2-amino-2-(hydroximetyl)propan-1,3-diol LEDER: C(C(CO)(CO)N)O
| Molekylformel | C4H11NO3 |
|---|---|
| PubChem CID | 6503 |
| IUPAC-namn | 2-amino-2-(hydroximetyl)propan-1,3-diol |
| CAS | 77-86-1 |
| InChI-nyckel | LENZDBCJOHFCAS-UHFFFAOYSA-N |
| LEDER | C(C(CO)(CO)N)O |
| ChEBI | CHEBI:9754 |
| Molekylvikt (g/mol) | 121.136 |
| Synonym | Trimethylol Aminomethane,Tris(hydroxymethyl)aminomethane,2-Amino-2-(hydroxymethyl)-1,3-propanediol,THAM,Tris base,Trometamol |
Corning™ Molecular Biology Reagents
SureTRACE
Supporting your traceability needs through proactive availability of certificates and change notifications.
Learn More
Supporting your traceability needs through proactive availability of certificates and change notifications.
Learn More
Used in molecular biology, nucleic acid purification applications
| Kvantitet | 6 x 1 L |
|---|
| Molekylformel | C8H18N2O4S |
|---|---|
| Rekommenderad förvaring | RT |
| MDL-nummer | MFCD00006158 |
| Abs. | 0.01 max. (0.1M solution) at 280nm |
| InChI-nyckel | JKMHFZQWWAIEOD-UHFFFAOYSA-N |
| Hälsofara 3 | Emergency Overview Causes eye, skin, and respiratory tract irritation. Use personal protective equipment. Ensure adequate ventilation. Wash off immediately with plenty of water for at least 15 minutes. Obtain medical attention. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Obtain medical attention. Move to fresh air. If breathing is difficult, give oxygen. Obtain medical attention. Do not induce vomiting. Obtain medical attention. Obtain medical attention. . NFPA Health:2 Flammability:1 Instability:1 |
| ChEBI | CHEBI:42334 |
| Hälsofara 2 | WARNING! |
| Löslighetsinformation | Soluble in water |
| Merck Index | 15, 4689 |
| ChemAlert lagringssymbol | Gray |
| Identifiering | Pass Test |
| Anteckningar om renhetsgrad | DNase-, RNase- and Protease-Free |
| Kvalitet | Molekylärbiologi |
| Färg | Vitt |
| PubChem CID | 23831 |
| CAS | 7365-45-9 |
| LEDER | OCCN1CCN(CCS(O)(=O)=O)CC1 |
| Molekylvikt (g/mol) | 238.30 |
| pH | 5.0 to 6.5 |
| Kemiskt namn eller material | HEPES |
| Procent renhet | ≥99% |
| Analysprocentintervall | ≥99 % |
| DNas | DNase-fri |
| Proteas | Protease free |
Tris-HCl, 1 M lösning, pH 8,0, molekylärbiologiska grader, Ultrapure , Thermo Scientific Chemicals
CAS: 1185-53-1 Molekylformel: C4H12ClNO3 Molekylvikt (g/mol): 157.594 InChI-nyckel: QKNYBSVHEMOAJP-UHFFFAOYSA-N PubChem CID: 93573 IUPAC-namn: 2-amino-2-(hydroximetyl)propan-1,3-diol;hydroklorid LEDER: C(C(CO)(CO)N)O.Cl
| Molekylformel | C4H12ClNO3 |
|---|---|
| PubChem CID | 93573 |
| IUPAC-namn | 2-amino-2-(hydroximetyl)propan-1,3-diol;hydroklorid |
| CAS | 1185-53-1 |
| InChI-nyckel | QKNYBSVHEMOAJP-UHFFFAOYSA-N |
| LEDER | C(C(CO)(CO)N)O.Cl |
| Molekylvikt (g/mol) | 157.594 |
| Rekommenderad förvaring | RT |
|---|---|
| Hälsofara 3 | Emergency Overview May cause eye, skin, and respiratory tract irritation. Avoid contact with skin and eyes. Do not breathe dust. Do not breathe vapors or spray mist. Wash off immediately with soap and plenty of water removing all contaminated clothes and shoes. Obtain medical attention. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Obtain medical attention. Remove from exposure, lie down. Move to fresh air. If breathing is difficult, give oxygen. If not breathing, give artificial respiration. If not breathing, give artificial respiration. Obtain medical attention. NFPA Health:1 Flammability:0 Instability:0 |
| Hälsofara 2 | CAUTION! |
| Genomfiltrerad | Filtreras genom ett 5-mikrons filter. |
| ChemAlert lagringssymbol | Gray |
| Fysisk form | Vätska |
| Kvalitet | Molekylärbiologi |
| Färg | Färglös |
| CAS | 7732-18-5 |
| Namnnotering | 1X Solution, pH 8.0 |
| pH | 7.4 to 8.1 |
| Synonym | TE |
| Kemiskt namn eller material | Tris-EDTA |
| DNas | DNase-fri |
| Proteas | Protease free |
TBS, Tris-buffrad saltlösning, 10X lösning, pH 7,4, molekylärbiologi, Fisher BioReagents™
| Rekommenderad förvaring | RT |
|---|---|
| Kokpunkt | 100 °C |
| ChemAlert lagringssymbol | Gray |
| Anteckningar om renhetsgrad | DNase-, RNase- and Protease-Free |
| Fysisk form | Vätska |
| Koncentration eller sammansättning (efter analyt eller komponenter) | 10X solution contains 1.37M Sodium Chloride, 0.027M Potassium Chloride, and 0.25M Tris/Tris-HCl. |
| Kvalitet | Molekylärbiologi |
| Färg | Färglös |
| CAS | 7732-18-5 |
| Namnnotering | 10X Solution |
| pH | 7.5 |
| Synonym | TBS |
| Kemiskt namn eller material | Tris Buffered Saline |
| DNas | DNase-fri |
| Proteas | Protease free |