Etylenglykol
Filtrerade sökresultat
Etylenglykol, 95%, ren, Thermo Scientific Chemicals
CAS: 107-21-1 Molekylformel: C2H6O2 Molekylvikt (g/mol): 62.068 InChI-nyckel: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol PubChem CID: 174 ChEBI: CHEBI:30742 IUPAC-namn: etan-1,2-diol LEDER: C(CO)O
| Molekylformel | C2H6O2 |
|---|---|
| PubChem CID | 174 |
| IUPAC-namn | etan-1,2-diol |
| CAS | 107-21-1 |
| InChI-nyckel | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| LEDER | C(CO)O |
| ChEBI | CHEBI:30742 |
| Molekylvikt (g/mol) | 62.068 |
| Synonym | ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol |
Etylenglykol, Fisher BioReagents™
CAS: 107-21-1 Molekylformel: C2H6O2 Molekylvikt (g/mol): 62.068 InChI-nyckel: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol PubChem CID: 174 ChEBI: CHEBI:30742 IUPAC-namn: etan-1,2-diol LEDER: C(CO)O
| Molekylformel | C2H6O2 |
|---|---|
| PubChem CID | 174 |
| IUPAC-namn | etan-1,2-diol |
| CAS | 107-21-1 |
| InChI-nyckel | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| LEDER | C(CO)O |
| ChEBI | CHEBI:30742 |
| Molekylvikt (g/mol) | 62.068 |
| Synonym | ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol |
Etylenglykol, 99,5 %, för analys, Thermo Scientific Chemicals
CAS: 107-21-1 Molekylformel: C2H6O2 Molekylvikt (g/mol): 62.068 MDL-nummer: MFCD00002885 InChI-nyckel: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol PubChem CID: 174 ChEBI: CHEBI:30742 IUPAC-namn: etan-1,2-diol LEDER: C(CO)O
| Molekylformel | C2H6O2 |
|---|---|
| PubChem CID | 174 |
| MDL-nummer | MFCD00002885 |
| IUPAC-namn | etan-1,2-diol |
| CAS | 107-21-1 |
| InChI-nyckel | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| LEDER | C(CO)O |
| ChEBI | CHEBI:30742 |
| Molekylvikt (g/mol) | 62.068 |
| Synonym | ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol |
Ethylene glycol, 99+%, extra pure
CAS: 107-21-1 Molekylformel: C2H6O2 Molekylvikt (g/mol): 62.068 MDL-nummer: MFCD00002885 InChI-nyckel: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol PubChem CID: 174 ChEBI: CHEBI:30742 IUPAC-namn: etan-1,2-diol LEDER: C(CO)O
| Molekylformel | C2H6O2 |
|---|---|
| PubChem CID | 174 |
| MDL-nummer | MFCD00002885 |
| IUPAC-namn | etan-1,2-diol |
| CAS | 107-21-1 |
| InChI-nyckel | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| LEDER | C(CO)O |
| ChEBI | CHEBI:30742 |
| Molekylvikt (g/mol) | 62.068 |
| Synonym | ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol |
| CAS | 107-21-1 |
|---|---|
| Molekylvikt (g/mol) | 62.07 |
Etylenglykol, puriss. pa, Reag. Ph. Eur.,≥ 99,5 %, Honeywell™ Riedel-de Haen™
SureTRACE
Supporting your traceability needs through proactive availability of certificates and change notifications.
Learn More
Supporting your traceability needs through proactive availability of certificates and change notifications.
Learn More
CAS: 107-21-1 Molekylformel: C2H6O2 Molekylvikt (g/mol): 62.068 MDL-nummer: MFCD00002885 InChI-nyckel: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol PubChem CID: 174 ChEBI: CHEBI:30742 IUPAC-namn: etan-1,2-diol LEDER: C(CO)O
| Molekylformel | C2H6O2 |
|---|---|
| PubChem CID | 174 |
| MDL-nummer | MFCD00002885 |
| IUPAC-namn | etan-1,2-diol |
| CAS | 107-21-1 |
| InChI-nyckel | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| LEDER | C(CO)O |
| ChEBI | CHEBI:30742 |
| Molekylvikt (g/mol) | 62.068 |
| Synonym | ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol |
Etylenglykol, reagenskvalitet,≥ 99 %, Honeywell™
CAS: 107-21-1 Molekylformel: C2H6O2 Molekylvikt (g/mol): 62.068 MDL-nummer: MFCD00002885 InChI-nyckel: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol PubChem CID: 174 ChEBI: CHEBI:30742 IUPAC-namn: etan-1,2-diol LEDER: C(CO)O
| Molekylformel | C2H6O2 |
|---|---|
| PubChem CID | 174 |
| MDL-nummer | MFCD00002885 |
| IUPAC-namn | etan-1,2-diol |
| CAS | 107-21-1 |
| InChI-nyckel | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| LEDER | C(CO)O |
| ChEBI | CHEBI:30742 |
| Molekylvikt (g/mol) | 62.068 |
| Synonym | ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol |
Ethylene Glycol, Technical, Honeywell™
CAS: 107-21-1 Molekylformel: C2H6O2 Molekylvikt (g/mol): 62.068 MDL-nummer: MFCD00002885 InChI-nyckel: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol PubChem CID: 174 ChEBI: CHEBI:30742 IUPAC-namn: etan-1,2-diol LEDER: C(CO)O
| Molekylformel | C2H6O2 |
|---|---|
| PubChem CID | 174 |
| MDL-nummer | MFCD00002885 |
| IUPAC-namn | etan-1,2-diol |
| CAS | 107-21-1 |
| InChI-nyckel | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| LEDER | C(CO)O |
| ChEBI | CHEBI:30742 |
| Molekylvikt (g/mol) | 62.068 |
| Synonym | ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol |
Etylenglykol, BAKER ANALYZED™ Reagens, J.T. Baker™
CAS: 107-21-1 Molekylformel: C2H6O2 Molekylvikt (g/mol): 62.068 InChI-nyckel: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol PubChem CID: 174 ChEBI: CHEBI:30742 IUPAC-namn: etan-1,2-diol LEDER: C(CO)O
| Molekylformel | C2H6O2 |
|---|---|
| PubChem CID | 174 |
| IUPAC-namn | etan-1,2-diol |
| CAS | 107-21-1 |
| InChI-nyckel | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| LEDER | C(CO)O |
| ChEBI | CHEBI:30742 |
| Molekylvikt (g/mol) | 62.068 |
| Synonym | ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol |
Ethylene Glycol, ≥99%, Spectrophotometric Grade, Honeywell Riedel-de Haën™
CAS: 107-21-1 Molekylformel: C2H6O2 Molekylvikt (g/mol): 62.068 MDL-nummer: MFCD00002885 InChI-nyckel: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol PubChem CID: 174 ChEBI: CHEBI:30742 IUPAC-namn: ethane-1,2-diol LEDER: C(CO)O
| Molekylformel | C2H6O2 |
|---|---|
| PubChem CID | 174 |
| MDL-nummer | MFCD00002885 |
| IUPAC-namn | ethane-1,2-diol |
| CAS | 107-21-1 |
| InChI-nyckel | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| LEDER | C(CO)O |
| ChEBI | CHEBI:30742 |
| Molekylvikt (g/mol) | 62.068 |
| Synonym | ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol |
Etylenglykol-bis(2-aminoetyleter)-N,N,N',N'-tetraättiksyra, Honeywell Fluka™
CAS: 67-42-5 Molekylformel: C14H24N2O10 Molekylvikt (g/mol): 380.35 MDL-nummer: MFCD00004291 InChI-nyckel: DEFVIWRASFVYLL-UHFFFAOYSA-N Synonym: egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn PubChem CID: 6207 ChEBI: CHEBI:30740 IUPAC-namn: 2-[2-[2-[2-[bis(karboximetyl)amino]etoxi]etoxi]etyl-(karboximetyl)amino]ättiksyra LEDER: C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O
| Molekylformel | C14H24N2O10 |
|---|---|
| PubChem CID | 6207 |
| MDL-nummer | MFCD00004291 |
| IUPAC-namn | 2-[2-[2-[2-[bis(karboximetyl)amino]etoxi]etoxi]etyl-(karboximetyl)amino]ättiksyra |
| CAS | 67-42-5 |
| InChI-nyckel | DEFVIWRASFVYLL-UHFFFAOYSA-N |
| LEDER | C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| ChEBI | CHEBI:30740 |
| Molekylvikt (g/mol) | 380.35 |
| Synonym | egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn |