Difenylacetonitriler
- (2)
- (3)
- (4)
- (3)
- (3)
- (3)
- (3)
- (1)
- (1)
- (1)
- (4)
- (1)
- (1)
- (1)
- (2)
- (1)
- (2)
- (1)
- (1)
- (3)
- (1)
- (3)
- (3)
- (3)
- (2)
- (4)
- (3)
- (2)
- (4)
- (1)
- (3)
- (1)
Filtrerade sökresultat
Diphenylacetonitrile, 99%
CAS: 86-29-3 Molekylformel: C14H11N Molekylvikt (g/mol): 193.249 MDL-nummer: MFCD00001862 InChI-nyckel: NEBPTMCRLHKPOB-UHFFFAOYSA-N Synonym: diphenylacetonitrile,dipan,diphenatrile,benzhydrylcyanide,diphenylmethylcyanide,benzyhydrylcyanide,acetonitrile, diphenyl,benzeneacetonitrile, alpha-phenyl,usaf kf-13,difenylacetonitril PubChem CID: 6837 IUPAC-namn: 2,2-difenylacetonitril LEDER: C1=CC=C(C=C1)C(C#N)C2=CC=CC=C2
| Molekylformel | C14H11N |
|---|---|
| PubChem CID | 6837 |
| MDL-nummer | MFCD00001862 |
| IUPAC-namn | 2,2-difenylacetonitril |
| CAS | 86-29-3 |
| InChI-nyckel | NEBPTMCRLHKPOB-UHFFFAOYSA-N |
| LEDER | C1=CC=C(C=C1)C(C#N)C2=CC=CC=C2 |
| Molekylvikt (g/mol) | 193.249 |
| Synonym | diphenylacetonitrile,dipan,diphenatrile,benzhydrylcyanide,diphenylmethylcyanide,benzyhydrylcyanide,acetonitrile, diphenyl,benzeneacetonitrile, alpha-phenyl,usaf kf-13,difenylacetonitril |
Diphenylacetonitrile, 99+%
CAS: 86-29-3 Molekylformel: C14H11N Molekylvikt (g/mol): 193.25 InChI-nyckel: NEBPTMCRLHKPOB-UHFFFAOYSA-N Synonym: diphenylacetonitrile,dipan,diphenatrile,benzhydrylcyanide,diphenylmethylcyanide,benzyhydrylcyanide,acetonitrile, diphenyl,benzeneacetonitrile, alpha-phenyl,usaf kf-13,difenylacetonitril PubChem CID: 6837 IUPAC-namn: 2,2-difenylacetonitril LEDER: C1=CC=C(C=C1)C(C#N)C2=CC=CC=C2
| Molekylformel | C14H11N |
|---|---|
| PubChem CID | 6837 |
| IUPAC-namn | 2,2-difenylacetonitril |
| CAS | 86-29-3 |
| InChI-nyckel | NEBPTMCRLHKPOB-UHFFFAOYSA-N |
| LEDER | C1=CC=C(C=C1)C(C#N)C2=CC=CC=C2 |
| Molekylvikt (g/mol) | 193.25 |
| Synonym | diphenylacetonitrile,dipan,diphenatrile,benzhydrylcyanide,diphenylmethylcyanide,benzyhydrylcyanide,acetonitrile, diphenyl,benzeneacetonitrile, alpha-phenyl,usaf kf-13,difenylacetonitril |
2,2-Diphenylpropionitrile, 97%
CAS: 5558-67-8 Molekylformel: C15H13N Molekylvikt (g/mol): 207.276 MDL-nummer: MFCD00001846 InChI-nyckel: DPVHBXFSKLKYIQ-UHFFFAOYSA-N PubChem CID: 79677 IUPAC-namn: 2,2-difenylpropannitril LEDER: CC(C#N)(C1=CC=CC=C1)C2=CC=CC=C2
| Molekylformel | C15H13N |
|---|---|
| PubChem CID | 79677 |
| MDL-nummer | MFCD00001846 |
| IUPAC-namn | 2,2-difenylpropannitril |
| CAS | 5558-67-8 |
| InChI-nyckel | DPVHBXFSKLKYIQ-UHFFFAOYSA-N |
| LEDER | CC(C#N)(C1=CC=CC=C1)C2=CC=CC=C2 |
| Molekylvikt (g/mol) | 207.276 |
4-Bromo-2,2-diphenylbutyronitrile, 95%
CAS: 39186-58-8 Molekylformel: C16H14BrN Molekylvikt (g/mol): 300.199 MDL-nummer: MFCD00001845 InChI-nyckel: IGYSFJHVFHNOEI-UHFFFAOYSA-N Synonym: 4-bromo-2,2-diphenylbutyronitrile,2,2-diphenyl-4-bromobutyronitrile,4-bromo-2,2-diphenyl-butyronitrile,3-cyano-3,3-diphenylpropyl bromide,benzeneacetonitrile, .alpha.-2-bromoethyl-.alpha.-phenyl,acmc-1csza,butyronitrile,2-diphenyl,ksc495i2r,aronis25014,bromoethyl diphenyl acetonitrile PubChem CID: 96575 IUPAC-namn: 4-brom-2,2-difenylbutannitril LEDER: C1=CC=C(C=C1)C(CCBr)(C#N)C2=CC=CC=C2
| Molekylformel | C16H14BrN |
|---|---|
| PubChem CID | 96575 |
| MDL-nummer | MFCD00001845 |
| IUPAC-namn | 4-brom-2,2-difenylbutannitril |
| CAS | 39186-58-8 |
| InChI-nyckel | IGYSFJHVFHNOEI-UHFFFAOYSA-N |
| LEDER | C1=CC=C(C=C1)C(CCBr)(C#N)C2=CC=CC=C2 |
| Molekylvikt (g/mol) | 300.199 |
| Synonym | 4-bromo-2,2-diphenylbutyronitrile,2,2-diphenyl-4-bromobutyronitrile,4-bromo-2,2-diphenyl-butyronitrile,3-cyano-3,3-diphenylpropyl bromide,benzeneacetonitrile, .alpha.-2-bromoethyl-.alpha.-phenyl,acmc-1csza,butyronitrile,2-diphenyl,ksc495i2r,aronis25014,bromoethyl diphenyl acetonitrile |
Methyl-Alpha,Alpha-diphenyl-4-morpholinebutyronitrile(Regioisomer Mixture), TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
| Molekylformel | C21H24N2O |
|---|---|
| Rekommenderad förvaring | +4°C |
| InChI formel | InChI=1S/2C21H24N2O/c1-18(16-23-12-14-24-15-13-23)21(17-22,19-8-4-2-5-9-19)20-10-6-3-7-11-20;1-18(23-12-14-24-15-13-23)16-21(17-22,19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2*2-11,18H,12-16H2,1H3 |
| Formel vikt | 320.19 |
| LEDER | CC(C(C1=CC=CC=C1)(C2=CC=CC=C2)C#N)CN3CCOCC3.CC(CC(C4=CC=CC=C4)(C5=CC=CC=C5)C#N)N6CCOCC6 |
| Molekylvikt (g/mol) | 320.43 |
| Kemiskt namn eller material | Methyl-alpha,alpha-diphenyl-4-morpholinebutyronitrile(Regioisomer Mixture) |
Closantel, TRC
CAS: 57808-65-8 Molekylformel: C22 H14 Cl2 I2 N2 O2 Molekylvikt (g/mol): 663.07 Synonym: N-[5-chloro-4-[(4-chlorophenyl)cyanomethyl]-2-methylphenyl]-2-hydroxy-3,5-diiodobenzamide,Closantel,Clozantin,NSC 335306,Seponver,Zycloz IUPAC-namn: N-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]-2-hydroxy-3,5-diiodobenzamide LEDER: Cc1cc(C(C#N)c2ccc(Cl)cc2)c(Cl)cc1NC(=O)c3cc(I)cc(I)c3O
| Molekylformel | C22 H14 Cl2 I2 N2 O2 |
|---|---|
| IUPAC-namn | N-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]-2-hydroxy-3,5-diiodobenzamide |
| CAS | 57808-65-8 |
| LEDER | Cc1cc(C(C#N)c2ccc(Cl)cc2)c(Cl)cc1NC(=O)c3cc(I)cc(I)c3O |
| Molekylvikt (g/mol) | 663.07 |
| Synonym | N-[5-chloro-4-[(4-chlorophenyl)cyanomethyl]-2-methylphenyl]-2-hydroxy-3,5-diiodobenzamide,Closantel,Clozantin,NSC 335306,Seponver,Zycloz |
Diphenylacetonitrile, TRC
CAS: 86-29-3 Molekylformel: C14 H11 N Molekylvikt (g/mol): 193.24 Synonym: Diphenylacetonitrile,Methadone Hydrochoride Imp. E (EP) IUPAC-namn: 2,2-diphenylacetonitrile LEDER: N#CC(c1ccccc1)c2ccccc2
| Molekylformel | C14 H11 N |
|---|---|
| IUPAC-namn | 2,2-diphenylacetonitrile |
| CAS | 86-29-3 |
| LEDER | N#CC(c1ccccc1)c2ccccc2 |
| Molekylvikt (g/mol) | 193.24 |
| Synonym | Diphenylacetonitrile,Methadone Hydrochoride Imp. E (EP) |