Fenoxiföreningar
Filtrerade sökresultat
Veratrole, 99+%
CAS: 91-16-7 Molekylformel: C8H10O2 Molekylvikt (g/mol): 138.17 MDL-nummer: MFCD00008357 InChI-nyckel: ABDKAPXRBAPSQN-UHFFFAOYSA-N Synonym: veratrole,veratrol,pyrocatechol dimethyl ether,o-dimethoxybenzene,catechol dimethyl ether,benzene, 1,2-dimethoxy,2-methoxyanisole,o,o-dimethyl catechol,2-dimethoxybenzol,benzene, o-dimethoxy PubChem CID: 7043 ChEBI: CHEBI:59114 IUPAC-namn: 1,2-dimetoxibensen LEDER: COC1=CC=CC=C1OC
| Molekylformel | C8H10O2 |
|---|---|
| PubChem CID | 7043 |
| MDL-nummer | MFCD00008357 |
| IUPAC-namn | 1,2-dimetoxibensen |
| CAS | 91-16-7 |
| InChI-nyckel | ABDKAPXRBAPSQN-UHFFFAOYSA-N |
| LEDER | COC1=CC=CC=C1OC |
| ChEBI | CHEBI:59114 |
| Molekylvikt (g/mol) | 138.17 |
| Synonym | veratrole,veratrol,pyrocatechol dimethyl ether,o-dimethoxybenzene,catechol dimethyl ether,benzene, 1,2-dimethoxy,2-methoxyanisole,o,o-dimethyl catechol,2-dimethoxybenzol,benzene, o-dimethoxy |
2-Phenoxyethanol, 99%
CAS: 122-99-6 Molekylformel: C8H10O2 Molekylvikt (g/mol): 138.17 MDL-nummer: MFCD00002857 InChI-nyckel: QCDWFXQBSFUVSP-UHFFFAOYSA-N Synonym: phenoxyethanol,ethylene glycol monophenyl ether,phenyl cellosolve,ethanol, 2-phenoxy,phenoxytol,phenoxethol,phenoxetol,ethylene glycol phenyl ether,phenoxyethyl alcohol,1-hydroxy-2-phenoxyethane PubChem CID: 31236 ChEBI: CHEBI:64275 IUPAC-namn: 2-fenoxietanol LEDER: C1=CC=C(C=C1)OCCO
| Molekylformel | C8H10O2 |
|---|---|
| PubChem CID | 31236 |
| MDL-nummer | MFCD00002857 |
| IUPAC-namn | 2-fenoxietanol |
| CAS | 122-99-6 |
| InChI-nyckel | QCDWFXQBSFUVSP-UHFFFAOYSA-N |
| LEDER | C1=CC=C(C=C1)OCCO |
| ChEBI | CHEBI:64275 |
| Molekylvikt (g/mol) | 138.17 |
| Synonym | phenoxyethanol,ethylene glycol monophenyl ether,phenyl cellosolve,ethanol, 2-phenoxy,phenoxytol,phenoxethol,phenoxetol,ethylene glycol phenyl ether,phenoxyethyl alcohol,1-hydroxy-2-phenoxyethane |
3-(fenoximetyl)bensoesyra, 97 %, Thermo Scientific™
CAS: 31719-75-2 Molekylformel: C14H12O3 Molekylvikt (g/mol): 228.247 InChI-nyckel: URLYREZIPSJJQU-UHFFFAOYSA-N Synonym: 3-phenoxymethyl benzoic acid,benzoic acid,3-phenoxymethyl,4rg PubChem CID: 3729884 IUPAC-namn: 3-(fenoximetyl)bensoesyra LEDER: C1=CC=C(C=C1)OCC2=CC=CC(=C2)C(=O)O
| Molekylformel | C14H12O3 |
|---|---|
| PubChem CID | 3729884 |
| IUPAC-namn | 3-(fenoximetyl)bensoesyra |
| CAS | 31719-75-2 |
| InChI-nyckel | URLYREZIPSJJQU-UHFFFAOYSA-N |
| LEDER | C1=CC=C(C=C1)OCC2=CC=CC(=C2)C(=O)O |
| Molekylvikt (g/mol) | 228.247 |
| Synonym | 3-phenoxymethyl benzoic acid,benzoic acid,3-phenoxymethyl,4rg |
Diphenylcarbazone-mercuric Reagent (I+II) EU Pharmacopoeia, Fisher Chemical™
SureTRACE
Supporting your traceability needs through proactive availability of certificates and change notifications.
Learn More
Supporting your traceability needs through proactive availability of certificates and change notifications.
Learn More
Phenyl chloroformate, 99%
CAS: 1885-14-9 Molekylformel: C7H5ClO2 Molekylvikt (g/mol): 156.57 MDL-nummer: MFCD00000637 InChI-nyckel: AHWALFGBDFAJAI-UHFFFAOYSA-N Synonym: phenyl chloroformate,chloroformic acid phenyl ester,phenyl chlorocarbonate,carbonochloridic acid, phenyl ester,phenoxycarbonyl chloride,formic acid, chloro-, phenyl ester,fenylester kyseliny chlormravenci,phenylchloroformate,unii-6tnd0d6d3y,6tnd0d6d3y PubChem CID: 15891 IUPAC-namn: fenylkarbonkloridat LEDER: ClC(=O)OC1=CC=CC=C1
| Molekylformel | C7H5ClO2 |
|---|---|
| PubChem CID | 15891 |
| MDL-nummer | MFCD00000637 |
| IUPAC-namn | fenylkarbonkloridat |
| CAS | 1885-14-9 |
| InChI-nyckel | AHWALFGBDFAJAI-UHFFFAOYSA-N |
| LEDER | ClC(=O)OC1=CC=CC=C1 |
| Molekylvikt (g/mol) | 156.57 |
| Synonym | phenyl chloroformate,chloroformic acid phenyl ester,phenyl chlorocarbonate,carbonochloridic acid, phenyl ester,phenoxycarbonyl chloride,formic acid, chloro-, phenyl ester,fenylester kyseliny chlormravenci,phenylchloroformate,unii-6tnd0d6d3y,6tnd0d6d3y |
Phenyl chlorothionocarbonate, 99%
CAS: 1005-56-7 Molekylformel: C7H5ClOS Molekylvikt (g/mol): 172.63 MDL-nummer: MFCD00004920 InChI-nyckel: KOSYAAIZOGNATQ-UHFFFAOYSA-N Synonym: o-phenyl carbonochloridothioate,phenyl chlorothionoformate,o-phenyl chlorothioformate,phenyl chlorothioformate,phenyl thioxochloroformate,phenyl chlorothionocarbonate,phenoxythiocarbonyl chloride,chlorothioformic acid phenyl ester,o-phenyl chlorothionoformate,o-phenyl chlorothiocarbonate PubChem CID: 70498 IUPAC-namn: O-fenylklormetantioat LEDER: ClC(=S)OC1=CC=CC=C1
| Molekylformel | C7H5ClOS |
|---|---|
| PubChem CID | 70498 |
| MDL-nummer | MFCD00004920 |
| IUPAC-namn | O-fenylklormetantioat |
| CAS | 1005-56-7 |
| InChI-nyckel | KOSYAAIZOGNATQ-UHFFFAOYSA-N |
| LEDER | ClC(=S)OC1=CC=CC=C1 |
| Molekylvikt (g/mol) | 172.63 |
| Synonym | o-phenyl carbonochloridothioate,phenyl chlorothionoformate,o-phenyl chlorothioformate,phenyl chlorothioformate,phenyl thioxochloroformate,phenyl chlorothionocarbonate,phenoxythiocarbonyl chloride,chlorothioformic acid phenyl ester,o-phenyl chlorothionoformate,o-phenyl chlorothiocarbonate |
Trifenylfosfit, 99 %, Thermo Scientific Chemicals
CAS: 101-02-0 Molekylformel: C18H15O3P Molekylvikt (g/mol): 310.28 InChI-nyckel: HVLLSGMXQDNUAL-UHFFFAOYSA-N Synonym: phosphorous acid, triphenyl ester,advance tpp,triphenoxyphosphine,phenyl phosphite,stabilizer p 36,trifenoxyfosfin,trifenylfosfit,phosclere t 36,efed,mellite 310 PubChem CID: 7540 IUPAC-namn: trifenylfosfit LEDER: C1=CC=C(C=C1)OP(OC2=CC=CC=C2)OC3=CC=CC=C3
| Molekylformel | C18H15O3P |
|---|---|
| PubChem CID | 7540 |
| IUPAC-namn | trifenylfosfit |
| CAS | 101-02-0 |
| InChI-nyckel | HVLLSGMXQDNUAL-UHFFFAOYSA-N |
| LEDER | C1=CC=C(C=C1)OP(OC2=CC=CC=C2)OC3=CC=CC=C3 |
| Molekylvikt (g/mol) | 310.28 |
| Synonym | phosphorous acid, triphenyl ester,advance tpp,triphenoxyphosphine,phenyl phosphite,stabilizer p 36,trifenoxyfosfin,trifenylfosfit,phosclere t 36,efed,mellite 310 |
Fenetol, 98+%, Thermo Scientific Chemicals
CAS: 103-73-1 Molekylformel: C8H10O Molekylvikt (g/mol): 122.17 MDL-nummer: MFCD00009090 InChI-nyckel: DLRJIFUOBPOJNS-UHFFFAOYSA-N Synonym: phenetole,benzene, ethoxy,ethyl phenyl ether,phenetol,phenyl ethyl ether,phenoxyethane,a phenoxyethane,ether, ethyl phenyl,unii-rb8lu2c57f PubChem CID: 7674 ChEBI: CHEBI:67129 IUPAC-namn: etoxibensen LEDER: CCOC1=CC=CC=C1
| Molekylformel | C8H10O |
|---|---|
| PubChem CID | 7674 |
| MDL-nummer | MFCD00009090 |
| IUPAC-namn | etoxibensen |
| CAS | 103-73-1 |
| InChI-nyckel | DLRJIFUOBPOJNS-UHFFFAOYSA-N |
| LEDER | CCOC1=CC=CC=C1 |
| ChEBI | CHEBI:67129 |
| Molekylvikt (g/mol) | 122.17 |
| Synonym | phenetole,benzene, ethoxy,ethyl phenyl ether,phenetol,phenyl ethyl ether,phenoxyethane,a phenoxyethane,ether, ethyl phenyl,unii-rb8lu2c57f |
Hydrokinon bis(2-hydroxietyl)eter, 99+%, Thermo Scientific Chemicals
CAS: 104-38-1 Molekylformel: C10H14O4 Molekylvikt (g/mol): 198.22 MDL-nummer: MFCD00002861 InChI-nyckel: WTPYFJNYAMXZJG-UHFFFAOYSA-N Synonym: hydroquinone bis 2-hydroxyethyl ether,1,4-bis 2-hydroxyethoxy benzene,vernatzer 30/10,2,2'-1,4-phenylenebis oxy diethanol,hydroquinone di 2-hydroxyethyl ether,hydroquinone diethylol ether,2,2'-phenylenedioxy diethanol,2,2'-p-phenylenedioxy diethanol,2,2'-p-phenylenedioxydiethanol,2-4-2-hydroxyethoxy phenoxy ethanol PubChem CID: 66912 IUPAC-namn: 2-[4-(2-hydroxietoxi)fenoxi]etanol LEDER: C1=CC(=CC=C1OCCO)OCCO
| Molekylformel | C10H14O4 |
|---|---|
| PubChem CID | 66912 |
| MDL-nummer | MFCD00002861 |
| IUPAC-namn | 2-[4-(2-hydroxietoxi)fenoxi]etanol |
| CAS | 104-38-1 |
| InChI-nyckel | WTPYFJNYAMXZJG-UHFFFAOYSA-N |
| LEDER | C1=CC(=CC=C1OCCO)OCCO |
| Molekylvikt (g/mol) | 198.22 |
| Synonym | hydroquinone bis 2-hydroxyethyl ether,1,4-bis 2-hydroxyethoxy benzene,vernatzer 30/10,2,2'-1,4-phenylenebis oxy diethanol,hydroquinone di 2-hydroxyethyl ether,hydroquinone diethylol ether,2,2'-phenylenedioxy diethanol,2,2'-p-phenylenedioxy diethanol,2,2'-p-phenylenedioxydiethanol,2-4-2-hydroxyethoxy phenoxy ethanol |
Diphenyl carbonate, 99%
CAS: 102-09-0 Molekylformel: C13H10O3 Molekylvikt (g/mol): 214.22 InChI-nyckel: ROORDVPLFPIABK-UHFFFAOYSA-N Synonym: carbonic acid, diphenyl ester,phenyl carbonate,diphenylcarbonate,carbonic acid diphenyl ester,phenyl carbonate pho 2co,unii-ywv401idyn,ph2co3,pho 2co,ywv401idyn,phenyl phenoxyformate PubChem CID: 7597 ChEBI: CHEBI:34722 IUPAC-namn: difenylkarbonat LEDER: C1=CC=C(C=C1)OC(=O)OC2=CC=CC=C2
| Molekylformel | C13H10O3 |
|---|---|
| PubChem CID | 7597 |
| IUPAC-namn | difenylkarbonat |
| CAS | 102-09-0 |
| InChI-nyckel | ROORDVPLFPIABK-UHFFFAOYSA-N |
| LEDER | C1=CC=C(C=C1)OC(=O)OC2=CC=CC=C2 |
| ChEBI | CHEBI:34722 |
| Molekylvikt (g/mol) | 214.22 |
| Synonym | carbonic acid, diphenyl ester,phenyl carbonate,diphenylcarbonate,carbonic acid diphenyl ester,phenyl carbonate pho 2co,unii-ywv401idyn,ph2co3,pho 2co,ywv401idyn,phenyl phenoxyformate |
Difenylfosforylazid, 98 %, Thermo Scientific Chemicals
CAS: 26386-88-9 Molekylformel: C12H10N3O3P Molekylvikt (g/mol): 275.20 MDL-nummer: MFCD00001987 InChI-nyckel: SORGEQQSQGNZFI-UHFFFAOYSA-N Synonym: diphenylphosphoryl azide,diphenyl azidophosphate,diphenylphosphonic azide,diphenyl phosphoryl azide,diphenyl phosphorazidate,phosphorazidic acid, diphenyl ester,azido phenoxy phosphoryl oxy benzene,dppa polymer-bound,diphenylphosphorazidate,unii-gxm91165av PubChem CID: 123414 IUPAC-namn: [azido(fenoxi)fosforyl]oxibensen LEDER: [N-]=[N+]=NP(=O)(OC1=CC=CC=C1)OC1=CC=CC=C1
| Molekylformel | C12H10N3O3P |
|---|---|
| PubChem CID | 123414 |
| MDL-nummer | MFCD00001987 |
| IUPAC-namn | [azido(fenoxi)fosforyl]oxibensen |
| CAS | 26386-88-9 |
| InChI-nyckel | SORGEQQSQGNZFI-UHFFFAOYSA-N |
| LEDER | [N-]=[N+]=NP(=O)(OC1=CC=CC=C1)OC1=CC=CC=C1 |
| Molekylvikt (g/mol) | 275.20 |
| Synonym | diphenylphosphoryl azide,diphenyl azidophosphate,diphenylphosphonic azide,diphenyl phosphoryl azide,diphenyl phosphorazidate,phosphorazidic acid, diphenyl ester,azido phenoxy phosphoryl oxy benzene,dppa polymer-bound,diphenylphosphorazidate,unii-gxm91165av |