Rengöringsmedel och desinfektionsmedel
Filtrerade sökresultat
| Molekylformel | (C2H4O)y(C2H4O)w(C2H4O)x(C2H4O)zC18H34O6 |
|---|---|
| Densitet | 1.100g/cm³ |
| Rekommenderad förvaring | RT |
| MDL-nummer | MFCD00165986 |
| IUPAC-namn | 2-[2-[3,4-bis(2-hydroxietoxi)oxolan-2-yl]-2-(2-hydroxietoxi)etoxi]etyldodekanoat |
| InChI-nyckel | HMFKFHLTUCJZJO-UHFFFAOYNA-N |
| Viskositet | 400 mPa/s at 25°C |
| Hälsofara 3 | Emergency Overview May cause eye, skin, and respiratory tract irritation. Use personal protective equipment. Ensure adequate ventilation. Wash off immediately with plenty of water for at least 15 minutes. Get medical attention immediately if symptoms occur. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Obtain medical attention. Move to fresh air. If breathing is difficult, give oxygen. Get medical attention immediately if symptoms occur. Do not induce vomiting. Obtain medical attention. Obtain medical attention. . NFPA Health:1 Flammability:1 Instability:0 |
| Hälsofara 2 | CAUTION! |
| Kokpunkt | 100 °C |
| ChemAlert lagringssymbol | Gray |
| Identifiering | Pass Test |
| Tändningsrester | 0.25% max. |
| Fysisk form | Viskös vätska |
| Färg | Bärnsten |
| PubChem CID | 443314 |
| Hydroxylvärde | 96 to 108 |
| CAS | 9005-64-5 |
| LEDER | CCCCCCCCCCCC(=O)OCCOCC(OCCO)C1OCC(OCCO)C1OCCO |
| Molekylvikt (g/mol) | 522.68 |
| pH | 6 |
| Synonym | Polyoxyethylene-20-sorbitan Monolaurate,Polyoxyethylenesorbitan monolaurate |
| Vatten | 3% max. |
| Kemiskt namn eller material | Polysorbate 20 |
n-oktyl-β -D-glukopyranosid (vitt kristallint pulver), Fisher BioReagents
CAS: 29836-26-8 Molekylformel: C14H28O6 Molekylvikt (g/mol): 292.37 MDL-nummer: MFCD00063288 InChI-nyckel: HEGSGKPQLMEBJL-RKQHYHRCSA-N PubChem CID: 62852 LEDER: CCCCCCCCO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
| Molekylformel | C14H28O6 |
|---|---|
| PubChem CID | 62852 |
| MDL-nummer | MFCD00063288 |
| CAS | 29836-26-8 |
| InChI-nyckel | HEGSGKPQLMEBJL-RKQHYHRCSA-N |
| LEDER | CCCCCCCCO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| Molekylvikt (g/mol) | 292.37 |
Triton™ X-100 (Elektrofores), Fisher BioReagents™
CAS: 9002-93-1 Molekylformel: C16H26O2 Molekylvikt (g/mol): 250.38 MDL-nummer: MFCD00132505 InChI-nyckel: JYCQQPHGFMYQCF-UHFFFAOYSA-N Synonym: Polyethylene Glycol p-tert-Octylphenyl Ether PubChem CID: 5590 LEDER: CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1
| Molekylformel | C16H26O2 |
|---|---|
| PubChem CID | 5590 |
| MDL-nummer | MFCD00132505 |
| CAS | 9002-93-1 |
| InChI-nyckel | JYCQQPHGFMYQCF-UHFFFAOYSA-N |
| LEDER | CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1 |
| Molekylvikt (g/mol) | 250.38 |
| Synonym | Polyethylene Glycol p-tert-Octylphenyl Ether |
Sodium n-dodecyl sulfate, 97%, for electrophoresis
CAS: 151-21-3 Molekylformel: C12H25NaO4S Molekylvikt (g/mol): 288.38 MDL-nummer: MFCD00036175 InChI-nyckel: DBMJMQXJHONAFJ-UHFFFAOYSA-M Synonym: n-Dodecyl sulfate sodium salt; Sodium lauryl sulfate PubChem CID: 3423265 ChEBI: CHEBI:8984 LEDER: [Na+].CCCCCCCCCCCCOS([O-])(=O)=O
| Molekylformel | C12H25NaO4S |
|---|---|
| PubChem CID | 3423265 |
| MDL-nummer | MFCD00036175 |
| CAS | 151-21-3 |
| InChI-nyckel | DBMJMQXJHONAFJ-UHFFFAOYSA-M |
| LEDER | [Na+].CCCCCCCCCCCCOS([O-])(=O)=O |
| ChEBI | CHEBI:8984 |
| Molekylvikt (g/mol) | 288.38 |
| Synonym | n-Dodecyl sulfate sodium salt; Sodium lauryl sulfate |
Thermo Scientific Chemicals Dodecylsulfatnatriumsalt, 99+%, för molekylärbiologi, DNAs-, RNAse- och proteasfritt
CAS: 151-21-3 | C12H25NaO4S | 288.38 g/mol
| Abs. | (0.1 M in water),(0.1 M in water) at 0nm,0.05 max. at 260nm,0.05 max. at 280nm |
|---|---|
| Formel vikt | 288.38 |
| InChI-nyckel | DBMJMQXJHONAFJ-UHFFFAOYSA-M |
| Hälsofara 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF ON SKIN: Wash with plenty of soap and water. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. |
| ChEBI | CHEBI:8984 |
| Hälsofara 2 | GHS H Statement Flammable solid. May cause respiratory irritation. Harmful if swallowed. Harmful if inhaled. Causes serious eye damage. Causes skin irritation. Harmful to aquatic life with long lasting effects. |
| Hälsofara 1 | Danger |
| Infrarött spektrum | Authentic |
| Kvalitet | Molekylärbiologi |
| PubChem CID | 3423265 |
| Linjär formel | CH3(CH2)11OSO3Na |
| LEDER | [Na+].CCCCCCCCCCCCOS([O-])(=O)=O |
| Molekylvikt (g/mol) | 288.38 |
| Molekylformel | C12H25NaO4S |
| MDL-nummer | MFCD00036175 |
| Löslighetsinformation | Solubility in water: 130g/L (20°C). Other solubilities: partly soluble in alcohol, soluble 75g/L in ethanol (20°C) |
| Fysisk form | Pulver |
| Färg | Vitt |
| Flampunkt | >150°C |
| Smältpunkt | 206,0 °C |
| CAS | 7647-14-5 |
| EINECS-nummer | 205-788-1 |
| Synonym | Dodecyl Sodium Sulfate,SDS,Sodium lauryl sulfate |
| TSCA | TSCA |
| Kemiskt namn eller material | Dodecyl sulfate, sodium salt |
| Procent renhet | ≥99% |
| Analysprocentintervall | 99+% |
Thermo Scientific Chemicals Litiumdodecylsulfat, +99 %
CAS: 2044-56-6 Molekylformel: C12H25LiO4S Molekylvikt (g/mol): 272.33 MDL-nummer: MFCD00007467 InChI-nyckel: YFVGRULMIQXYNE-UHFFFAOYSA-M Synonym: Dodecyl lithium sulfate,Lithium lauryl sulfate PubChem CID: 2735071 IUPAC-namn: litium(1+)dodecylsulfat LEDER: [Li+].CCCCCCCCCCCCOS([O-])(=O)=O
| Molekylformel | C12H25LiO4S |
|---|---|
| PubChem CID | 2735071 |
| MDL-nummer | MFCD00007467 |
| IUPAC-namn | litium(1+)dodecylsulfat |
| CAS | 2044-56-6 |
| InChI-nyckel | YFVGRULMIQXYNE-UHFFFAOYSA-M |
| LEDER | [Li+].CCCCCCCCCCCCOS([O-])(=O)=O |
| Molekylvikt (g/mol) | 272.33 |
| Synonym | Dodecyl lithium sulfate,Lithium lauryl sulfate |
Micronova™ MegaClean™ Kraftig rengöringsmedel
SureTRACE
Supporting your traceability needs through proactive availability of certificates and change notifications.
Learn More
Supporting your traceability needs through proactive availability of certificates and change notifications.
Learn More
Ett icke brännbart, kraftigt rengöringsmedel och avfettningsmedel som tar bort fett, lim och fotobeständiga fläckar från de flesta ytor. Finns i 1 eller 5 gallon flaskor och en 1 liter sprayflaska.
| Färgkodad | No |
|---|---|
| Sterilitet | Icke-steril |
| Typ av handtag | None |
| För användning med (utrustning) | Moppar och hinkar eller våtservetter och svamp |
| Beskrivning | Kraftig tvättmedel, avfettningsmedel |
| Produkttyp | MegaClean Rengöringsmedel |
CHAPS (White Crystalline Powder), Fisher BioReagents™
CAS: 75621-03-3 Molekylformel: C32H58N2O7S Molekylvikt (g/mol): 614.883 InChI-nyckel: UMCMPZBLKLEWAF-GBSSQDIOSA-N Synonym: 3-[(3-Cholamidopropyl) dimethylammonio]-1-propanesulfonate PubChem CID: 134129639 IUPAC-namn: 3-[dimethyl-[3-[[(4R)-4-[(3R,5S,7R,8R,9R,10S,12S,13R,14R,17S)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]propyl]azaniumyl]propane-1-sulfonate LEDER: CC(CCC(=O)NCCC[N+](C)(C)CCCS(=O)(=O)[O-])C1CCC2C1(C(CC3C2C(CC4C3(CCC(C4)O)C)O)O)C
| Molekylformel | C32H58N2O7S |
|---|---|
| PubChem CID | 134129639 |
| IUPAC-namn | 3-[dimethyl-[3-[[(4R)-4-[(3R,5S,7R,8R,9R,10S,12S,13R,14R,17S)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]propyl]azaniumyl]propane-1-sulfonate |
| CAS | 75621-03-3 |
| InChI-nyckel | UMCMPZBLKLEWAF-GBSSQDIOSA-N |
| LEDER | CC(CCC(=O)NCCC[N+](C)(C)CCCS(=O)(=O)[O-])C1CCC2C1(C(CC3C2C(CC4C3(CCC(C4)O)C)O)O)C |
| Molekylvikt (g/mol) | 614.883 |
| Synonym | 3-[(3-Cholamidopropyl) dimethylammonio]-1-propanesulfonate |