Learn More
4,5-Imidazoledicarboxylic Acid 99%, ACROS Organics™
Brand: Acros Organics 412250250
Additional Details : CAS Number : 570-22-9 Weight : 0.07500kg
| Quantity | 25g |
|---|
Chemical Identifiers
| 4, 5-Imidazoledicarboxylic acid | |
| 570-22-9 | |
| 100.0 | |
| 99% | |
| MFCD00005200 |
| 99% | |
| 98.5 | |
| 99% | |
| C5H4N2O4 |
Specifications
| 4, 5-Imidazoledicarboxylic acid | |
| 99% | |
| 98.5 | |
| Authentic | |
| Fine Crystalline Powder | |
| 99% | |
| MFCD00005200 | |
| C1=NC(=C(N1)C(=O)O)C(=O)O | |
| 265.0°C | |
| 68442 | |
| 25g |
| 156.1 | |
| 570-22-9 | |
| 100.0 | |
| Glass bottle | |
| 99% | |
| C5H4N2O4 | |
| ZEVWQFWTGHFIDH-UHFFFAOYSA-N | |
| 1H-imidazole-4,5-dicarboxylic acid | |
| 156.097 | |
| Light yellow to yellow-brown |
Safety and Handling
- 4,5-Imidazoledicarboxylic acid
Signal Word
- Warning
Hazard Category
- Serious eye damage/eye irritation Category 2
- Skin corrosion/irritation Category 2
- Specific target organ toxicity Category 3
Hazard Statement
- H319-Causes serious eye irritation.
- H335-May cause respiratory irritation.
- H315-Causes skin irritation.
Precautionary Statement
- P261-Avoid breathing dust/fume/gas/mist/vapours/spray.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P302+P352-IF ON SKIN: Wash with plenty of water/.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.