Filtrerade sökresultat
Gibco™ Destillerat vatten
Greener Choice Product
This product offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More About the Greener Choice Program
This product offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More About the Greener Choice Program
Vatten av hög kvalitet för användning som lösningsmedel vid beredning av cellodlingsmedia och laboratoriereagens
| Kvalitet | Cellkultur |
|---|---|
| Behandling(er) | Not DEPC-Treated |
| Förpackning | Flaska |
| Reningsmetod | Membrane-Filtered |
| Sterilitet | Sterile-filtered |
| Hållbarhet | 24 månader |
| Frakt skick | Rumstemperatur |
Invitrogen™ Nukleasfritt vatten (ej DEPC-behandlat)
Nukleasfritt vatten (ej DEPC-behandlat) har avjoniserats, filtrerats in i den slutliga flaskan och autoklaverats. Den är klar att använda och kräver ingen förberedelse, blandning eller autoklavering.
| Kvalitet | Molekylärbiologi |
|---|---|
| Rekommenderad förvaring | Förvaras vid rumstemperatur. |
| Behandling(er) | Not DEPC-Treated |
| Förpackning | Flaska |
| Reningsmetod | Autoclaved, Membrane-Filtered |
| Produktlinje | Ambion™ |
Stärkelse, Löslig, Reagens ACS, Thermo Scientific Chemicals
CAS: 9005-84-9 Molekylformel: C12H22O11 Molekylvikt (g/mol): 342.297 MDL-nummer: MFCD00082026 InChI-nyckel: GUBGYTABKSRVRQ-ASMJPISFSA-N Synonym: alpha-maltose,maltose,starch, soluble,glcalpha1-4glca,unii-15sug9ad26,glcalpha1-4glcalpha,amylodextrin,starch solution,alpha-malt sugar,4-o-alpha-d-glucopyranosyl-alpha-d-glucopyranose PubChem CID: 439341 ChEBI: CHEBI:18167 IUPAC-namn: (2R,3S,4S,5R,6R)-2-(hydroximetyl)-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxi-2-(hydroximetyl)oxan-3-yl]oxioxan-3,4,5-triol LEDER: C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O
| Molekylformel | C12H22O11 |
|---|---|
| PubChem CID | 439341 |
| MDL-nummer | MFCD00082026 |
| IUPAC-namn | (2R,3S,4S,5R,6R)-2-(hydroximetyl)-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxi-2-(hydroximetyl)oxan-3-yl]oxioxan-3,4,5-triol |
| CAS | 9005-84-9 |
| InChI-nyckel | GUBGYTABKSRVRQ-ASMJPISFSA-N |
| LEDER | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O |
| ChEBI | CHEBI:18167 |
| Molekylvikt (g/mol) | 342.297 |
| Synonym | alpha-maltose,maltose,starch, soluble,glcalpha1-4glca,unii-15sug9ad26,glcalpha1-4glcalpha,amylodextrin,starch solution,alpha-malt sugar,4-o-alpha-d-glucopyranosyl-alpha-d-glucopyranose |
Molekylsilar 4A, 8 till 12 mesh, Thermo Scientific Chemicals
CAS: 70955-01-0 Molekylformel: C20H25FN2O8 Molekylvikt (g/mol): 440.42 MDL-nummer: MFCD00131613 InChI-nyckel: FJUZEZRZKVMAMD-UHFFFAOYNA-N PubChem CID: 73906282 LEDER: COC(=O)C(C(C)C(NC(=O)C(CC1=CC(F)=CC=C1)NC(C)=O)C(O)=O)C(=O)OC
| Molekylformel | C20H25FN2O8 |
|---|---|
| PubChem CID | 73906282 |
| MDL-nummer | MFCD00131613 |
| CAS | 70955-01-0 |
| InChI-nyckel | FJUZEZRZKVMAMD-UHFFFAOYNA-N |
| LEDER | COC(=O)C(C(C)C(NC(=O)C(CC1=CC(F)=CC=C1)NC(C)=O)C(O)=O)C(=O)OC |
| Molekylvikt (g/mol) | 440.42 |
Gibco™ Destillerat vatten
Greener Choice Product
This product offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More About the Greener Choice Program
This product offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More About the Greener Choice Program
Thermo Scientific Chemicals L-tryptofan, 99 %
CAS: 73-22-3 Molekylformel: C11H12N2O2 Molekylvikt (g/mol): 204.23 MDL-nummer: MFCD00064340 InChI-nyckel: QIVBCDIJIAJPQS-VIFPVBQESA-N Synonym: l-tryptophan,tryptophan,l-tryptophane,s-tryptophan,tryptophane,h-trp-oh,optimax,trofan,tryptacin,ardeytropin PubChem CID: 6305 ChEBI: CHEBI:16828 IUPAC-namn: (2S)-2-amino-3-(lH-indol-3-yl)propansyra LEDER: N[C@@H](CC1=CNC2=CC=CC=C12)C(O)=O
| Molekylformel | C11H12N2O2 |
|---|---|
| PubChem CID | 6305 |
| MDL-nummer | MFCD00064340 |
| IUPAC-namn | (2S)-2-amino-3-(lH-indol-3-yl)propansyra |
| CAS | 73-22-3 |
| InChI-nyckel | QIVBCDIJIAJPQS-VIFPVBQESA-N |
| LEDER | N[C@@H](CC1=CNC2=CC=CC=C12)C(O)=O |
| ChEBI | CHEBI:16828 |
| Molekylvikt (g/mol) | 204.23 |
| Synonym | l-tryptophan,tryptophan,l-tryptophane,s-tryptophan,tryptophane,h-trp-oh,optimax,trofan,tryptacin,ardeytropin |
Thermo Scientific Chemicals L-arginin, 98+%
CAS: 74-79-3 Molekylformel: C6H14N4O2 Molekylvikt (g/mol): 174.20 MDL-nummer: MFCD00002635 InChI-nyckel: ODKSFYDXXFIFQN-UHFFFAOYNA-N Synonym: l-arginine,arginine,l-+-arginine,l-arg,l +-arginine,s-2-amino-5-guanidinopentanoic acid,h-arg-oh,arginina,arginine, l PubChem CID: 6322 ChEBI: CHEBI:16467 LEDER: NC(CCCN=C(N)N)C(O)=O
| Molekylformel | C6H14N4O2 |
|---|---|
| PubChem CID | 6322 |
| MDL-nummer | MFCD00002635 |
| CAS | 74-79-3 |
| InChI-nyckel | ODKSFYDXXFIFQN-UHFFFAOYNA-N |
| LEDER | NC(CCCN=C(N)N)C(O)=O |
| ChEBI | CHEBI:16467 |
| Molekylvikt (g/mol) | 174.20 |
| Synonym | l-arginine,arginine,l-+-arginine,l-arg,l +-arginine,s-2-amino-5-guanidinopentanoic acid,h-arg-oh,arginina,arginine, l |
Invitrogen™ DEPC-behandlat vatten
Ambion DEPC-behandlat vatten är certifierat nukleasfritt. DEPC-behandlat vatten autoklaveras för- och efterförpackning för att säkerställa sterilitet och inaktivering av DEPC.
| Kvalitet | Molekylärbiologi |
|---|---|
| Rekommenderad förvaring | Förvaras vid rumstemperatur. |
| Behandling(er) | DEPC-Treated |
| Förpackning | Flaska |
| Reningsmetod | Autoclaved, Membrane-Filtered |
| Produktlinje | Ambion™ |
Thermo Scientific Chemicals L-cysteinhydrokloridmonohydrat, 99 %
CAS: 4-6-7048 Molekylformel: C3H10ClNO3S Molekylvikt (g/mol): 175.63 MDL-nummer: MFCD00065606 InChI-nyckel: QIJRTFXNRTXDIP-JIZZDEOASA-N Synonym: l-cysteine hydrochloride monohydrate,h-cys-oh.hcl.h2o,l-cysteine hydrochloride hydrate,l-cysteine monohydrate monochloride,r-2-amino-3-mercaptopropanoic acid hydrochloride hydrate,unii-zt934n0x4w,l-cysteine hydrate hydrochloride,cysteine hydrochloride monohydrate, l,h-cys-ohhclh2o,cysteine hcl PubChem CID: 23462 IUPAC-namn: (2R)-2-amino-3-sulfanylpropansyra;hydrat;hydroklorid LEDER: C(C(C(=O)O)N)S.O.Cl
| Molekylformel | C3H10ClNO3S |
|---|---|
| PubChem CID | 23462 |
| MDL-nummer | MFCD00065606 |
| IUPAC-namn | (2R)-2-amino-3-sulfanylpropansyra;hydrat;hydroklorid |
| CAS | 4-6-7048 |
| InChI-nyckel | QIJRTFXNRTXDIP-JIZZDEOASA-N |
| LEDER | C(C(C(=O)O)N)S.O.Cl |
| Molekylvikt (g/mol) | 175.63 |
| Synonym | l-cysteine hydrochloride monohydrate,h-cys-oh.hcl.h2o,l-cysteine hydrochloride hydrate,l-cysteine monohydrate monochloride,r-2-amino-3-mercaptopropanoic acid hydrochloride hydrate,unii-zt934n0x4w,l-cysteine hydrate hydrochloride,cysteine hydrochloride monohydrate, l,h-cys-ohhclh2o,cysteine hcl |
Molecular sieves 4A, 4 to 8 mesh
CAS: 70955-01-0 Molekylformel: C20H25FN2O8 Molekylvikt (g/mol): 440.42 MDL-nummer: MFCD00131613 InChI-nyckel: FJUZEZRZKVMAMD-UHFFFAOYNA-N PubChem CID: 73906282 LEDER: COC(=O)C(C(C)C(NC(=O)C(CC1=CC(F)=CC=C1)NC(C)=O)C(O)=O)C(=O)OC
| Molekylformel | C20H25FN2O8 |
|---|---|
| PubChem CID | 73906282 |
| MDL-nummer | MFCD00131613 |
| CAS | 70955-01-0 |
| InChI-nyckel | FJUZEZRZKVMAMD-UHFFFAOYNA-N |
| LEDER | COC(=O)C(C(C)C(NC(=O)C(CC1=CC(F)=CC=C1)NC(C)=O)C(O)=O)C(=O)OC |
| Molekylvikt (g/mol) | 440.42 |
Amberlyst™ 15(H), wet, ion exchange resin
CAS: 39389-20-3 Molekylformel: C18H18O3S Molekylvikt (g/mol): 314.399 MDL-nummer: MFCD00145841 InChI-nyckel: SIWVGXQOXWGJCI-UHFFFAOYSA-N Synonym: amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid PubChem CID: 170197 IUPAC-namn: 1,2-bis(etenyl)bensen;2-etenylbensensulfonsyra LEDER: C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O
| Molekylformel | C18H18O3S |
|---|---|
| PubChem CID | 170197 |
| MDL-nummer | MFCD00145841 |
| IUPAC-namn | 1,2-bis(etenyl)bensen;2-etenylbensensulfonsyra |
| CAS | 39389-20-3 |
| InChI-nyckel | SIWVGXQOXWGJCI-UHFFFAOYSA-N |
| LEDER | C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O |
| Molekylvikt (g/mol) | 314.399 |
| Synonym | amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid |
Polysorbate 20
CAS: 9005-64-5 Molekylformel: (C2H4O)y(C2H4O)w(C2H4O)x(C2H4O)zC18H34O6 Molekylvikt (g/mol): 522.68 MDL-nummer: MFCD00165986 InChI-nyckel: HMFKFHLTUCJZJO-UHFFFAOYNA-N Synonym: tween 20,polysorbate 20,polyoxyethylene sorbitan monolaurate,polyoxyethylene 20 sorbitan monolaurate,polysorbate inn,2-2-3,4-bis 2-hydroxyethoxy oxolan-2-yl-2-2-hydroxyethoxy ethoxy ethyl dodecanoate,alkest tw 20,polysorbate 20 nf,polysorbate 40 nf PubChem CID: 443314 IUPAC-namn: 2-[2-[3,4-bis(2-hydroxietoxi)oxolan-2-yl]-2-(2-hydroxietoxi)etoxi]etyldodekanoat LEDER: CCCCCCCCCCCC(=O)OCCOCC(OCCO)C1OCC(OCCO)C1OCCO
| Molekylformel | (C2H4O)y(C2H4O)w(C2H4O)x(C2H4O)zC18H34O6 |
|---|---|
| PubChem CID | 443314 |
| MDL-nummer | MFCD00165986 |
| IUPAC-namn | 2-[2-[3,4-bis(2-hydroxietoxi)oxolan-2-yl]-2-(2-hydroxietoxi)etoxi]etyldodekanoat |
| CAS | 9005-64-5 |
| InChI-nyckel | HMFKFHLTUCJZJO-UHFFFAOYNA-N |
| LEDER | CCCCCCCCCCCC(=O)OCCOCC(OCCO)C1OCC(OCCO)C1OCCO |
| Molekylvikt (g/mol) | 522.68 |
| Synonym | tween 20,polysorbate 20,polyoxyethylene sorbitan monolaurate,polyoxyethylene 20 sorbitan monolaurate,polysorbate inn,2-2-3,4-bis 2-hydroxyethoxy oxolan-2-yl-2-2-hydroxyethoxy ethoxy ethyl dodecanoate,alkest tw 20,polysorbate 20 nf,polysorbate 40 nf |
Thermo Scientific Chemicals L(+)-glutaminsyra, 99 %
CAS: 56-86-0 Molekylformel: C5H9NO4 Molekylvikt (g/mol): 147.13 MDL-nummer: MFCD00002634 InChI-nyckel: WHUUTDBJXJRKMK-UHFFFAOYNA-N Synonym: l-glutamic acid,glutamic acid,2s-2-aminopentanedioic acid,h-glu-oh,s-2-aminopentanedioic acid,glutaminol,l-glutaminic acid,glutacid,glutamicol,glutamidex PubChem CID: 33032 ChEBI: CHEBI:16015 IUPAC-namn: (2S)-2-aminopentandisyra LEDER: NC(CCC(O)=O)C(O)=O
| Molekylformel | C5H9NO4 |
|---|---|
| PubChem CID | 33032 |
| MDL-nummer | MFCD00002634 |
| IUPAC-namn | (2S)-2-aminopentandisyra |
| CAS | 56-86-0 |
| InChI-nyckel | WHUUTDBJXJRKMK-UHFFFAOYNA-N |
| LEDER | NC(CCC(O)=O)C(O)=O |
| ChEBI | CHEBI:16015 |
| Molekylvikt (g/mol) | 147.13 |
| Synonym | l-glutamic acid,glutamic acid,2s-2-aminopentanedioic acid,h-glu-oh,s-2-aminopentanedioic acid,glutaminol,l-glutaminic acid,glutacid,glutamicol,glutamidex |
Thermo Scientific Chemicals L-Histidin, 98 %
CAS: 71-00-1 Molekylformel: C6H9N3O2 Molekylvikt (g/mol): 155.16 MDL-nummer: MFCD00064315 InChI-nyckel: HNDVDQJCIGZPNO-UHFFFAOYNA-N Synonym: l-histidine,histidine,h-his-oh,glyoxaline-5-alanine,anti-rheuma,l---histidine,istidina,s-histidine,l-histidin PubChem CID: 6274 ChEBI: CHEBI:15971 IUPAC-namn: (2S)-2-amino-3-(lH-imidazol-5-yl)propansyra LEDER: NC(CC1=CN=CN1)C(O)=O
| Molekylformel | C6H9N3O2 |
|---|---|
| PubChem CID | 6274 |
| MDL-nummer | MFCD00064315 |
| IUPAC-namn | (2S)-2-amino-3-(lH-imidazol-5-yl)propansyra |
| CAS | 71-00-1 |
| InChI-nyckel | HNDVDQJCIGZPNO-UHFFFAOYNA-N |
| LEDER | NC(CC1=CN=CN1)C(O)=O |
| ChEBI | CHEBI:15971 |
| Molekylvikt (g/mol) | 155.16 |
| Synonym | l-histidine,histidine,h-his-oh,glyoxaline-5-alanine,anti-rheuma,l---histidine,istidina,s-histidine,l-histidin |
Polyetylenglykol 400, Thermo Scientific Chemicals
CAS: 25322-68-3 Molekylformel: (C2H4O)n Molekylvikt (g/mol): 62.07 MDL-nummer: MFCD01779601 InChI-nyckel: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: PEG 400 IUPAC-namn: etan-1,2-diol LEDER: [H]OCCO
| Molekylformel | (C2H4O)n |
|---|---|
| MDL-nummer | MFCD01779601 |
| IUPAC-namn | etan-1,2-diol |
| CAS | 25322-68-3 |
| InChI-nyckel | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| LEDER | [H]OCCO |
| Molekylvikt (g/mol) | 62.07 |
| Synonym | PEG 400 |