Kolvätederivat
Filtrerade sökresultat
1-Hexadecanethiol, 97% (dry wt.), may cont. up to 4% water
CAS: 2917-26-2 Molekylformel: C16H34S Molekylvikt (g/mol): 258.508 MDL-nummer: MFCD00011677 InChI-nyckel: ORTRWBYBJVGVQC-UHFFFAOYSA-N Synonym: 1-hexadecanethiol,hexadecanethiol,n-hexadecanethiol,cetyl mercaptan,n-hexadecyl mercaptan,hexadecyl mercaptan,unii-qr98qio1ql,1-cetanethiol,qr98qio1ql,cetylmercaptan PubChem CID: 18015 IUPAC-namn: hexadekan-1-tiol LEDER: CCCCCCCCCCCCCCCCS
| Molekylformel | C16H34S |
|---|---|
| PubChem CID | 18015 |
| MDL-nummer | MFCD00011677 |
| IUPAC-namn | hexadekan-1-tiol |
| CAS | 2917-26-2 |
| InChI-nyckel | ORTRWBYBJVGVQC-UHFFFAOYSA-N |
| LEDER | CCCCCCCCCCCCCCCCS |
| Molekylvikt (g/mol) | 258.508 |
| Synonym | 1-hexadecanethiol,hexadecanethiol,n-hexadecanethiol,cetyl mercaptan,n-hexadecyl mercaptan,hexadecyl mercaptan,unii-qr98qio1ql,1-cetanethiol,qr98qio1ql,cetylmercaptan |
Ethyl vinyl ether, 99%, stab.
CAS: 109-92-2 Molekylformel: C4H8O Molekylvikt (g/mol): 72.11 MDL-nummer: MFCD00009248 InChI-nyckel: FJKIXWOMBXYWOQ-UHFFFAOYSA-N Synonym: ethyl vinyl ether,ethoxyethene,ethoxyethylene,ethene, ethoxy,1-ethoxyethene,1-ethoxyethylene,vinyl ethyl ether,vinamar,ether, ethyl vinyl,ether, vinyl ethyl PubChem CID: 8023 IUPAC-namn: etenoxietan LEDER: CCOC=C
| Molekylformel | C4H8O |
|---|---|
| PubChem CID | 8023 |
| MDL-nummer | MFCD00009248 |
| IUPAC-namn | etenoxietan |
| CAS | 109-92-2 |
| InChI-nyckel | FJKIXWOMBXYWOQ-UHFFFAOYSA-N |
| LEDER | CCOC=C |
| Molekylvikt (g/mol) | 72.11 |
| Synonym | ethyl vinyl ether,ethoxyethene,ethoxyethylene,ethene, ethoxy,1-ethoxyethene,1-ethoxyethylene,vinyl ethyl ether,vinamar,ether, ethyl vinyl,ether, vinyl ethyl |
Dietylklorfosfit, 90 %, tek., Thermo Scientific Chemicals
CAS: 589-57-1 Molekylformel: C4H10ClO2P Molekylvikt (g/mol): 156.55 MDL-nummer: MFCD00009074 InChI-nyckel: TXHWYSOQHNMOOU-UHFFFAOYSA-N Synonym: diethyl chlorophosphite,ethyl phosphorochloridite,diethyl phosphorochloridite,chlorodiethoxyphosphine,phosphorochloridous acid, diethyl ester,unii-f414s3v8k6,diethyl chlorophosphonite,chloro diethoxy phosphane,diethychlorophosphite,ethyl chlorophosphite PubChem CID: 68530 IUPAC-namn: klor(dietoxi)fosfan LEDER: CCOP(OCC)Cl
| Molekylformel | C4H10ClO2P |
|---|---|
| PubChem CID | 68530 |
| MDL-nummer | MFCD00009074 |
| IUPAC-namn | klor(dietoxi)fosfan |
| CAS | 589-57-1 |
| InChI-nyckel | TXHWYSOQHNMOOU-UHFFFAOYSA-N |
| LEDER | CCOP(OCC)Cl |
| Molekylvikt (g/mol) | 156.55 |
| Synonym | diethyl chlorophosphite,ethyl phosphorochloridite,diethyl phosphorochloridite,chlorodiethoxyphosphine,phosphorochloridous acid, diethyl ester,unii-f414s3v8k6,diethyl chlorophosphonite,chloro diethoxy phosphane,diethychlorophosphite,ethyl chlorophosphite |
n-Butyl vinyl ether, 98%, stab. with 0.01% KOH
CAS: 111-34-2 Molekylformel: C6H12O Molekylvikt (g/mol): 100.16 MDL-nummer: MFCD00009454 InChI-nyckel: UZKWTJUDCOPSNM-UHFFFAOYSA-N Synonym: n-butyl vinyl ether,butyl vinyl ether,vinyl butyl ether,butane, 1-ethenyloxy,butoxyethylene,1-ethenyloxy butane,butoxyethene,ether, butyl vinyl,vinyl n-butyl ether,ethenyl n-butyl ether PubChem CID: 8108 IUPAC-namn: 1-etenoxibutan LEDER: CCCCOC=C
| Molekylformel | C6H12O |
|---|---|
| PubChem CID | 8108 |
| MDL-nummer | MFCD00009454 |
| IUPAC-namn | 1-etenoxibutan |
| CAS | 111-34-2 |
| InChI-nyckel | UZKWTJUDCOPSNM-UHFFFAOYSA-N |
| LEDER | CCCCOC=C |
| Molekylvikt (g/mol) | 100.16 |
| Synonym | n-butyl vinyl ether,butyl vinyl ether,vinyl butyl ether,butane, 1-ethenyloxy,butoxyethylene,1-ethenyloxy butane,butoxyethene,ether, butyl vinyl,vinyl n-butyl ether,ethenyl n-butyl ether |
Allyl vinyl ether, 95% stab. with 0.1% potassium hydroxide
CAS: 3917-15-5 Molekylformel: C5H8O Molekylvikt (g/mol): 84.12 MDL-nummer: MFCD00039827 InChI-nyckel: ZXABMDQSAABDMG-UHFFFAOYSA-N Synonym: allyl vinyl ether,ether, allyl vinyl,vinyl allyl ether,1-propene, 3-ethenyloxy,allyl ethenyl ether,unii-fj2j0n55cs,fj2j0n55cs,allylvinylether,acmc-20alul,3-ethenoxy-1-propene PubChem CID: 221523 IUPAC-namn: 3-etenoxiprop-1-en LEDER: C=CCOC=C
| Molekylformel | C5H8O |
|---|---|
| PubChem CID | 221523 |
| MDL-nummer | MFCD00039827 |
| IUPAC-namn | 3-etenoxiprop-1-en |
| CAS | 3917-15-5 |
| InChI-nyckel | ZXABMDQSAABDMG-UHFFFAOYSA-N |
| LEDER | C=CCOC=C |
| Molekylvikt (g/mol) | 84.12 |
| Synonym | allyl vinyl ether,ether, allyl vinyl,vinyl allyl ether,1-propene, 3-ethenyloxy,allyl ethenyl ether,unii-fj2j0n55cs,fj2j0n55cs,allylvinylether,acmc-20alul,3-ethenoxy-1-propene |
2,3-Butanediol, 98%, mixture of racemic and meso forms, techn.
CAS: 513-85-9 Molekylformel: C4H10O2 Molekylvikt (g/mol): 90.12 InChI-nyckel: OWBTYPJTUOEWEK-UHFFFAOYSA-N Synonym: 2,3-butanediol,2,3-butylene glycol,2,3-dihydroxybutane,dimethylethylene glycol,dimethylene glycol,pseudobutylene glycol,sym-dimethylethylene glycol,ccris 5501,dl-2,3-butanediol,2,3-butanediol, r*,r*-.+/-. PubChem CID: 262 ChEBI: CHEBI:62064 IUPAC-namn: butan-2,3-diol LEDER: CC(C(C)O)O
| Molekylformel | C4H10O2 |
|---|---|
| PubChem CID | 262 |
| IUPAC-namn | butan-2,3-diol |
| CAS | 513-85-9 |
| InChI-nyckel | OWBTYPJTUOEWEK-UHFFFAOYSA-N |
| LEDER | CC(C(C)O)O |
| ChEBI | CHEBI:62064 |
| Molekylvikt (g/mol) | 90.12 |
| Synonym | 2,3-butanediol,2,3-butylene glycol,2,3-dihydroxybutane,dimethylethylene glycol,dimethylene glycol,pseudobutylene glycol,sym-dimethylethylene glycol,ccris 5501,dl-2,3-butanediol,2,3-butanediol, r*,r*-.+/-. |
tert-butylvinyleter, 98%, stab. med ca 0,1 % N,N-dietylanilin, Thermo Scientific Chemicals
CAS: 926-02-3 Molekylformel: C6H12O Molekylvikt (g/mol): 100.16 MDL-nummer: MFCD00048246 InChI-nyckel: PGYJSURPYAAOMM-UHFFFAOYSA-N Synonym: tert-butyl vinyl ether,2-ethenyloxy-2-methylpropane,propane, 2-ethenyloxy-2-methyl,propane,2-ethenyloxy-2-methyl,t-butyl vinyl ether,tert-butylvinyl ether,vinyltertiary-butylether,tertiarybutyl vinyl ether,vinyl tert.-butyl ether,tertiary butyl vinyl ether PubChem CID: 70220 IUPAC-namn: 2-etenoxi-2-metylpropan LEDER: CC(C)(C)OC=C
| Molekylformel | C6H12O |
|---|---|
| PubChem CID | 70220 |
| MDL-nummer | MFCD00048246 |
| IUPAC-namn | 2-etenoxi-2-metylpropan |
| CAS | 926-02-3 |
| InChI-nyckel | PGYJSURPYAAOMM-UHFFFAOYSA-N |
| LEDER | CC(C)(C)OC=C |
| Molekylvikt (g/mol) | 100.16 |
| Synonym | tert-butyl vinyl ether,2-ethenyloxy-2-methylpropane,propane, 2-ethenyloxy-2-methyl,propane,2-ethenyloxy-2-methyl,t-butyl vinyl ether,tert-butylvinyl ether,vinyltertiary-butylether,tertiarybutyl vinyl ether,vinyl tert.-butyl ether,tertiary butyl vinyl ether |
2-metoxipropen, 95 %, stabb. med ca 0,5 % kaliumkarbonat, Thermo Scientific Chemicals
CAS: 116-11-0 Molekylformel: C4H8O Molekylvikt (g/mol): 72.107 MDL-nummer: MFCD00014929 InChI-nyckel: YOWQWFMSQCOSBA-UHFFFAOYSA-N Synonym: 2-methoxypropene,isopropenyl methyl ether,1-propene, 2-methoxy,2-methoxy-1-propene,methyl isopropenyl ether,ether, isopropenyl methyl,propene, 2-methoxy,unii-15wbg0jt6b,2-methoxy propene,15wbg0jt6b PubChem CID: 8300 IUPAC-namn: 2-metoxiprop-1-en LEDER: CC(=C)OC
| Molekylformel | C4H8O |
|---|---|
| PubChem CID | 8300 |
| MDL-nummer | MFCD00014929 |
| IUPAC-namn | 2-metoxiprop-1-en |
| CAS | 116-11-0 |
| InChI-nyckel | YOWQWFMSQCOSBA-UHFFFAOYSA-N |
| LEDER | CC(=C)OC |
| Molekylvikt (g/mol) | 72.107 |
| Synonym | 2-methoxypropene,isopropenyl methyl ether,1-propene, 2-methoxy,2-methoxy-1-propene,methyl isopropenyl ether,ether, isopropenyl methyl,propene, 2-methoxy,unii-15wbg0jt6b,2-methoxy propene,15wbg0jt6b |
Difenylsilan, 97 %, Thermo Scientific Chemicals
CAS: 775-12-2 Molekylformel: C12H12Si Molekylvikt (g/mol): 184.31 MDL-nummer: MFCD00003002 InChI-nyckel: BPYFPNZHLXDIGA-UHFFFAOYSA-N Synonym: diphenylsilane,silane, diphenyl,diphenylsilicon,benzene, 1,1'-silylenebis,diphenyl silane,di phenyl silicon,diphenylsilylene radical,ph 2sih2 PubChem CID: 6327659 IUPAC-namn: cyklohexa-2,5-dien-1-yliden(fenyl)silanid LEDER: C1=CC=C(C=C1)[Si-]=C2C=C[CH+]C=C2
| Molekylformel | C12H12Si |
|---|---|
| PubChem CID | 6327659 |
| MDL-nummer | MFCD00003002 |
| IUPAC-namn | cyklohexa-2,5-dien-1-yliden(fenyl)silanid |
| CAS | 775-12-2 |
| InChI-nyckel | BPYFPNZHLXDIGA-UHFFFAOYSA-N |
| LEDER | C1=CC=C(C=C1)[Si-]=C2C=C[CH+]C=C2 |
| Molekylvikt (g/mol) | 184.31 |
| Synonym | diphenylsilane,silane, diphenyl,diphenylsilicon,benzene, 1,1'-silylenebis,diphenyl silane,di phenyl silicon,diphenylsilylene radical,ph 2sih2 |
1,4-Dithio-DL-treitol, elektroforesgrad, 99 %, Thermo Scientific Chemicals
CAS: 12-3-3483 Molekylformel: C4H10O2S2 Molekylvikt (g/mol): 154.24 MDL-nummer: MFCD00004877 InChI-nyckel: VHJLVAABSRFDPM-IMJSIDKUSA-N Synonym: dithiothreitol,dl-1,4-dithiothreitol,dl-dithiothreitol,1,4-dithio-dl-threitol,d-1,4-dithiothreitol,d-dtt,2s,3s-1,4-dimercaptobutane-2,3-diol,threo-1,4-dimercapto-2,3-butanediol,1,4-dithiothreitol,dtt PubChem CID: 446094 ChEBI: CHEBI:42170 IUPAC-namn: (2S,3S)-1,4-bis(sulfanyl)butan-2,3-diol LEDER: C(C(C(CS)O)O)S
| Molekylformel | C4H10O2S2 |
|---|---|
| PubChem CID | 446094 |
| MDL-nummer | MFCD00004877 |
| IUPAC-namn | (2S,3S)-1,4-bis(sulfanyl)butan-2,3-diol |
| CAS | 12-3-3483 |
| InChI-nyckel | VHJLVAABSRFDPM-IMJSIDKUSA-N |
| LEDER | C(C(C(CS)O)O)S |
| ChEBI | CHEBI:42170 |
| Molekylvikt (g/mol) | 154.24 |
| Synonym | dithiothreitol,dl-1,4-dithiothreitol,dl-dithiothreitol,1,4-dithio-dl-threitol,d-1,4-dithiothreitol,d-dtt,2s,3s-1,4-dimercaptobutane-2,3-diol,threo-1,4-dimercapto-2,3-butanediol,1,4-dithiothreitol,dtt |
4-metyl-2-pentanol, 99+%, Thermo Scientific Chemicals
CAS: 108-11-2 Molekylformel: C6H14O Molekylvikt (g/mol): 102.18 MDL-nummer: MFCD00004550 InChI-nyckel: WVYWICLMDOOCFB-UHFFFAOYSA-N Synonym: 4-methyl-2-pentanol,2-pentanol, 4-methyl,isobutylmethylcarbinol,2-methyl-4-pentanol,methyl amyl alcohol,methyl isobutyl carbinol,mibc,1,3-dimethylbutanol,4-methylpentanol-2,isobutylmethylmethanol PubChem CID: 7910 IUPAC-namn: 4-metylpentan-2-ol LEDER: CC(C)CC(C)O
| Molekylformel | C6H14O |
|---|---|
| PubChem CID | 7910 |
| MDL-nummer | MFCD00004550 |
| IUPAC-namn | 4-metylpentan-2-ol |
| CAS | 108-11-2 |
| InChI-nyckel | WVYWICLMDOOCFB-UHFFFAOYSA-N |
| LEDER | CC(C)CC(C)O |
| Molekylvikt (g/mol) | 102.18 |
| Synonym | 4-methyl-2-pentanol,2-pentanol, 4-methyl,isobutylmethylcarbinol,2-methyl-4-pentanol,methyl amyl alcohol,methyl isobutyl carbinol,mibc,1,3-dimethylbutanol,4-methylpentanol-2,isobutylmethylmethanol |
Triethylaluminium, 0.6M solution in heptane, AcroSeal™
CAS: 97-93-8 Molekylformel: C6H15Al Molekylvikt (g/mol): 114.17 MDL-nummer: MFCD00009015 InChI-nyckel: VOITXYVAKOUIBA-UHFFFAOYSA-N Synonym: triethylaluminum,triethylaluminium,aluminum, triethyl,triethylalane,unii-h426e9h3tt,triethylaluminum solution, 1.0 m in hexanes,triethylaluminum solution, 25 wt. % in toluene,triethyl-aluminum,triethyl aluminum,triethyl-aluminum PubChem CID: 16682930 IUPAC-namn: trietylaluman LEDER: CC[Al](CC)CC
| Molekylformel | C6H15Al |
|---|---|
| PubChem CID | 16682930 |
| MDL-nummer | MFCD00009015 |
| IUPAC-namn | trietylaluman |
| CAS | 97-93-8 |
| InChI-nyckel | VOITXYVAKOUIBA-UHFFFAOYSA-N |
| LEDER | CC[Al](CC)CC |
| Molekylvikt (g/mol) | 114.17 |
| Synonym | triethylaluminum,triethylaluminium,aluminum, triethyl,triethylalane,unii-h426e9h3tt,triethylaluminum solution, 1.0 m in hexanes,triethylaluminum solution, 25 wt. % in toluene,triethyl-aluminum,triethyl aluminum,triethyl-aluminum |
2-Methyl-4-trimethylsilyl-1-buten-3-yne, 97%
CAS: 18387-60-5 Molekylformel: C8H14Si Molekylvikt (g/mol): 138.285 MDL-nummer: MFCD00190206 InChI-nyckel: HRGBALJHGYAWBL-UHFFFAOYSA-N Synonym: 2-methyl-4-trimethylsilyl-1-buten-3-yne,2-methyl-4-trimethylsilylbut-1-en-3-yne,acmc-1cdn8,trimethylsilylisopropenylacetylene,trimethyl 3-methylbut-3-en-1-ynyl silane,3-methyl-3-butene-1-ynyl trimethylsilane,trimethyl 3-methyl-3-buten-1-ynyl silane #,trimethyl 3-methylbut-3-en-1-yn-1-yl silane,silane,trimethyl 3-methyl-3-buten-1-yn-1-yl,2-methyl-4-trimethylsilyl-1-buten-3-yne, PubChem CID: 579646 IUPAC-namn: trimetyl(3-metylbut-3-en-1-ynyl)silan LEDER: CC(=C)C#C[Si](C)(C)C
| Molekylformel | C8H14Si |
|---|---|
| PubChem CID | 579646 |
| MDL-nummer | MFCD00190206 |
| IUPAC-namn | trimetyl(3-metylbut-3-en-1-ynyl)silan |
| CAS | 18387-60-5 |
| InChI-nyckel | HRGBALJHGYAWBL-UHFFFAOYSA-N |
| LEDER | CC(=C)C#C[Si](C)(C)C |
| Molekylvikt (g/mol) | 138.285 |
| Synonym | 2-methyl-4-trimethylsilyl-1-buten-3-yne,2-methyl-4-trimethylsilylbut-1-en-3-yne,acmc-1cdn8,trimethylsilylisopropenylacetylene,trimethyl 3-methylbut-3-en-1-ynyl silane,3-methyl-3-butene-1-ynyl trimethylsilane,trimethyl 3-methyl-3-buten-1-ynyl silane #,trimethyl 3-methylbut-3-en-1-yn-1-yl silane,silane,trimethyl 3-methyl-3-buten-1-yn-1-yl,2-methyl-4-trimethylsilyl-1-buten-3-yne, |
1-Butanethiol, 98%
CAS: 109-79-5 Molekylformel: C4H10S Molekylvikt (g/mol): 90.184 MDL-nummer: MFCD00004905 InChI-nyckel: WQAQPCDUOCURKW-UHFFFAOYSA-N Synonym: 1-butanethiol,butanethiol,butyl mercaptan,n-butyl mercaptan,n-butanethiol,butylthiol,thiobutyl alcohol,n-butylmercaptan,1-mercaptobutane,1-butyl mercaptan PubChem CID: 8012 IUPAC-namn: butan-1-tiol LEDER: CCCCS
| Molekylformel | C4H10S |
|---|---|
| PubChem CID | 8012 |
| MDL-nummer | MFCD00004905 |
| IUPAC-namn | butan-1-tiol |
| CAS | 109-79-5 |
| InChI-nyckel | WQAQPCDUOCURKW-UHFFFAOYSA-N |
| LEDER | CCCCS |
| Molekylvikt (g/mol) | 90.184 |
| Synonym | 1-butanethiol,butanethiol,butyl mercaptan,n-butyl mercaptan,n-butanethiol,butylthiol,thiobutyl alcohol,n-butylmercaptan,1-mercaptobutane,1-butyl mercaptan |
Etyl-N-hydroxiacetimidat, 97 %, Thermo Scientific Chemicals
CAS: 10576-12-2 Molekylformel: C4H9NO2 Molekylvikt (g/mol): 103.12 MDL-nummer: MFCD00002114,MFCD00002114 InChI-nyckel: QWKAVVNRCKPKNM-SNAWJCMRSA-N Synonym: ethyl n-hydroxyacetimidate,n-hydroxyethanimidic acid, ethyl ester,ethyl acetohydroximate,ethyl n-hydroxyethanimidate,e-ethyl n-hydroxyethanimidate,e-ethyl n-hydroxyacetimidate,ethyl 1e-n-hydroxyethanimidate,snx`lfelmmpqh,ethyl acethydroxamate,1-ethoxyethanone oxime PubChem CID: 6386647 IUPAC-namn: etyl (lZ)-N-hydroxietanimidat LEDER: CCO\C(C)=N\O
| Molekylformel | C4H9NO2 |
|---|---|
| PubChem CID | 6386647 |
| MDL-nummer | MFCD00002114,MFCD00002114 |
| IUPAC-namn | etyl (lZ)-N-hydroxietanimidat |
| CAS | 10576-12-2 |
| InChI-nyckel | QWKAVVNRCKPKNM-SNAWJCMRSA-N |
| LEDER | CCO\C(C)=N\O |
| Molekylvikt (g/mol) | 103.12 |
| Synonym | ethyl n-hydroxyacetimidate,n-hydroxyethanimidic acid, ethyl ester,ethyl acetohydroximate,ethyl n-hydroxyethanimidate,e-ethyl n-hydroxyethanimidate,e-ethyl n-hydroxyacetimidate,ethyl 1e-n-hydroxyethanimidate,snx`lfelmmpqh,ethyl acethydroxamate,1-ethoxyethanone oxime |