Organo-metalloida föreningar
Filtrerade sökresultat
Oktadecyltrimetoxisilan, 90 %, Tech ., Thermo Scientific Chemicals
CAS: 3069-42-9 Molekylformel: C21H46O3Si Molekylvikt (g/mol): 374.69 MDL-nummer: MFCD00043060 InChI-nyckel: SLYCYWCVSGPDFR-UHFFFAOYSA-N Synonym: octadecyltrimethoxysilane,trimethoxy octadecyl silane,n-octadecyltrimethoxysilane,stearyltrimethoxysilane,silane, trimethoxyoctadecyl,octadecyl-trimethoxysilane,acmc-209hi7,ksc491g4l,trimethoxy octadecyl silane, technical grade PubChem CID: 76486 IUPAC-namn: trimetoxi(oktadecyl)silan LEDER: CCCCCCCCCCCCCCCCCC[Si](OC)(OC)OC
| Molekylformel | C21H46O3Si |
|---|---|
| PubChem CID | 76486 |
| MDL-nummer | MFCD00043060 |
| IUPAC-namn | trimetoxi(oktadecyl)silan |
| CAS | 3069-42-9 |
| InChI-nyckel | SLYCYWCVSGPDFR-UHFFFAOYSA-N |
| LEDER | CCCCCCCCCCCCCCCCCC[Si](OC)(OC)OC |
| Molekylvikt (g/mol) | 374.69 |
| Synonym | octadecyltrimethoxysilane,trimethoxy octadecyl silane,n-octadecyltrimethoxysilane,stearyltrimethoxysilane,silane, trimethoxyoctadecyl,octadecyl-trimethoxysilane,acmc-209hi7,ksc491g4l,trimethoxy octadecyl silane, technical grade |
Sodium tetraethylborate, 97%, pure, Thermo Scientific Chemicals
CAS: 15523-24-7 Molekylformel: C8H20BNa Molekylvikt (g/mol): 150.04 MDL-nummer: MFCD00061547 InChI-nyckel: SZSBMTRYJRHYNI-UHFFFAOYSA-N Synonym: sodium tetraethylborate,sodium tetraethylboranuide,borate 1-,tetraethyl-, sodium 1:1,sodium tetraethylborate 1-,et4bna,sodiotetraethylboron v,borate 1-, tetraethyl-, sodium,sodium tetraethylborate 1g PubChem CID: 23681030 IUPAC-namn: natrium;tetraetylboranuid LEDER: [B-](CC)(CC)(CC)CC.[Na+]
| Molekylformel | C8H20BNa |
|---|---|
| PubChem CID | 23681030 |
| MDL-nummer | MFCD00061547 |
| IUPAC-namn | natrium;tetraetylboranuid |
| CAS | 15523-24-7 |
| InChI-nyckel | SZSBMTRYJRHYNI-UHFFFAOYSA-N |
| LEDER | [B-](CC)(CC)(CC)CC.[Na+] |
| Molekylvikt (g/mol) | 150.04 |
| Synonym | sodium tetraethylborate,sodium tetraethylboranuide,borate 1-,tetraethyl-, sodium 1:1,sodium tetraethylborate 1-,et4bna,sodiotetraethylboron v,borate 1-, tetraethyl-, sodium,sodium tetraethylborate 1g |
| Molekylformel | C6H16BNa |
|---|---|
| Densitet | 0.89 |
| MDL-nummer | MFCD00011704 |
| Formel vikt | 121.99 |
| IUPAC-namn | natrium;trietylbor(1-) |
| InChI-nyckel | YDTZLEUIYNMRLQ-UHFFFAOYSA-N |
| Hälsofara 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Handle under inert gas. Protect from moisture |
| Hälsofara 2 | GHS H Statement Causes severe skin burns and eye damage. May cause respiratory irritation. In contact with water releases flammable gas. Highly flammable liquid and vapor. May form explosive peroxides. Reacts violentl |
| Hälsofara 1 | GHS-signalord: Fara |
| Löslighetsinformation | Solubility in water: rzacts. |
| Fysisk form | Lösning |
| Färg | Färglös |
| PubChem CID | 23667700 |
| Förpackning | AcroSeal™ Glasflaska |
| Flampunkt | −17°C |
| Linjär formel | NaB(C2H5)3H |
| CAS | 109-99-9 |
| Namnnotering | 1M solution in THF |
| LEDER | [Na+].CC[BH-](CC)CC |
| Molekylvikt (g/mol) | 121.99 |
| EINECS-nummer | 241-903-1 |
| Synonym | sodium triethylborohydride,sodium triethylborate,sodium triethylhydroborate,sodium triethylhydridoborate,sodium triethylhydroborate 1-,sodium triethylborohydride solution,sodium triethyl-? 2-boranuide,sodiumtriethylborohydride 1m in toluene |
| Kemiskt namn eller material | Sodium triethylborohydride |
Cyklohexylmetyldiklorsilan, 97+%, Thermo Scientific Chemicals
CAS: 5578-42-7 Molekylformel: C7H14Cl2Si Molekylvikt (g/mol): 197.18 InChI-nyckel: YUYHCACQLHNZLS-UHFFFAOYSA-N Synonym: methylcyclohexyldichlorosilane,silane, dichlorocyclohexylmethyl,dichloro cyclohexyl methyl silane,cyclohexylmethyldichlorosilane,cyclohexane, dichloromethylsilyl,methyl cyclohexyldichlorosilane,cyclohexyl methyl dichlorosilane,cyclohexyl-dichloro-methylsilane,cyclohexyl-methyl-dichlorosilane,dichloro cyclohexyl methylsilane PubChem CID: 79685 IUPAC-namn: diklor-cyklohexyl-metylsilan LEDER: C[Si](C1CCCCC1)(Cl)Cl
| Molekylformel | C7H14Cl2Si |
|---|---|
| PubChem CID | 79685 |
| IUPAC-namn | diklor-cyklohexyl-metylsilan |
| CAS | 5578-42-7 |
| InChI-nyckel | YUYHCACQLHNZLS-UHFFFAOYSA-N |
| LEDER | C[Si](C1CCCCC1)(Cl)Cl |
| Molekylvikt (g/mol) | 197.18 |
| Synonym | methylcyclohexyldichlorosilane,silane, dichlorocyclohexylmethyl,dichloro cyclohexyl methyl silane,cyclohexylmethyldichlorosilane,cyclohexane, dichloromethylsilyl,methyl cyclohexyldichlorosilane,cyclohexyl methyl dichlorosilane,cyclohexyl-dichloro-methylsilane,cyclohexyl-methyl-dichlorosilane,dichloro cyclohexyl methylsilane |
Triethoxyvinylsilane, 97%, Thermo Scientific Chemicals
CAS: 78-08-0 Molekylformel: C8H18O3Si Molekylvikt (g/mol): 190.31 MDL-nummer: MFCD00009063 InChI-nyckel: FWDBOZPQNFPOLF-UHFFFAOYSA-N Synonym: vinyltriethoxysilane,triethoxyvinylsilane,silane, ethenyltriethoxy,triethoxy vinyl silane,polyscience vtes,triethoxyvinylsilicane,vtes,silane a 151,ethenyl triethoxy silane,silane, triethoxyvinyl PubChem CID: 6516 LEDER: CCO[Si](OCC)(OCC)C=C
| Molekylformel | C8H18O3Si |
|---|---|
| PubChem CID | 6516 |
| MDL-nummer | MFCD00009063 |
| CAS | 78-08-0 |
| InChI-nyckel | FWDBOZPQNFPOLF-UHFFFAOYSA-N |
| LEDER | CCO[Si](OCC)(OCC)C=C |
| Molekylvikt (g/mol) | 190.31 |
| Synonym | vinyltriethoxysilane,triethoxyvinylsilane,silane, ethenyltriethoxy,triethoxy vinyl silane,polyscience vtes,triethoxyvinylsilicane,vtes,silane a 151,ethenyl triethoxy silane,silane, triethoxyvinyl |
Diklormetylvinylsilan, 97 %, Thermo Scientific Chemicals
CAS: 124-70-9 MDL-nummer: MFCD00000492 InChI-nyckel: YLJJAVFOBDSYAN-UHFFFAOYSA-N Synonym: dichloro methyl vinyl silane,methylvinyldichlorosilane,silane, dichloroethenylmethyl,vinylmethyldichlorosilane,methyldichlorovinylsilane,silane, dichloromethylvinyl,unii-b27y6f24py,ccris 2457,dichloromethylvinyl-silan,dichloromethylvinyl silane PubChem CID: 31299 IUPAC-namn: diklor-etenyl-metylsilan LEDER: C[Si](C=C)(Cl)Cl
| PubChem CID | 31299 |
|---|---|
| MDL-nummer | MFCD00000492 |
| IUPAC-namn | diklor-etenyl-metylsilan |
| CAS | 124-70-9 |
| InChI-nyckel | YLJJAVFOBDSYAN-UHFFFAOYSA-N |
| LEDER | C[Si](C=C)(Cl)Cl |
| Synonym | dichloro methyl vinyl silane,methylvinyldichlorosilane,silane, dichloroethenylmethyl,vinylmethyldichlorosilane,methyldichlorovinylsilane,silane, dichloromethylvinyl,unii-b27y6f24py,ccris 2457,dichloromethylvinyl-silan,dichloromethylvinyl silane |
Methyltrimethoxysilane, 97%, AcroSeal™, Thermo Scientific Chemicals
CAS: 1185-55-3 Molekylformel: C4H12O3Si Molekylvikt (g/mol): 136.22 InChI-nyckel: BFXIKLCIZHOAAZ-UHFFFAOYSA-N Synonym: methyltrimethoxysilane,trimethoxy methyl silane,silane, trimethoxymethyl,union carbide a-163,silane, methyltrimethoxy,methyl trimethoxysilane,silane a-163,dynasylan mtms,unii-0hi0d71mci,methyl-trimethoxysilane PubChem CID: 14456 IUPAC-namn: trimetoxi(metyl)silan LEDER: CO[Si](C)(OC)OC
| Molekylformel | C4H12O3Si |
|---|---|
| PubChem CID | 14456 |
| IUPAC-namn | trimetoxi(metyl)silan |
| CAS | 1185-55-3 |
| InChI-nyckel | BFXIKLCIZHOAAZ-UHFFFAOYSA-N |
| LEDER | CO[Si](C)(OC)OC |
| Molekylvikt (g/mol) | 136.22 |
| Synonym | methyltrimethoxysilane,trimethoxy methyl silane,silane, trimethoxymethyl,union carbide a-163,silane, methyltrimethoxy,methyl trimethoxysilane,silane a-163,dynasylan mtms,unii-0hi0d71mci,methyl-trimethoxysilane |
Trimetylsilanol, Thermo Scientific Chemicals
CAS: 1066-40-6 Molekylformel: C3H9LiOSi Molekylvikt (g/mol): 96.13 MDL-nummer: MFCD02751657 InChI-nyckel: OXOZHAWWRPCVGL-UHFFFAOYSA-N Synonym: trimethylsilanol,silanol, trimethyl,unii-z4bin3300p,trimethylhydroxysilane,ccris 1320,hydroxy trimethyl silane,silanol, 1,1,1-trimethyl,ksc504m9b,2004-14-0 lithium salt,10519-96-7 potassium salt PubChem CID: 66110 IUPAC-namn: hydroxi(trimetyl)silan LEDER: [Li+].C[Si](C)(C)[O-]
| Molekylformel | C3H9LiOSi |
|---|---|
| PubChem CID | 66110 |
| MDL-nummer | MFCD02751657 |
| IUPAC-namn | hydroxi(trimetyl)silan |
| CAS | 1066-40-6 |
| InChI-nyckel | OXOZHAWWRPCVGL-UHFFFAOYSA-N |
| LEDER | [Li+].C[Si](C)(C)[O-] |
| Molekylvikt (g/mol) | 96.13 |
| Synonym | trimethylsilanol,silanol, trimethyl,unii-z4bin3300p,trimethylhydroxysilane,ccris 1320,hydroxy trimethyl silane,silanol, 1,1,1-trimethyl,ksc504m9b,2004-14-0 lithium salt,10519-96-7 potassium salt |
(Ethylthio)trimethylsilane, 90%, Thermo Scientific Chemicals
CAS: 5573-62-6 Molekylformel: C5H14SSi Molekylvikt (g/mol): 134.31 MDL-nummer: MFCD00042890 InChI-nyckel: HXAFQWICVBBXMZ-UHFFFAOYSA-N Synonym: ethylthio trimethylsilane,ethylthiotrimethylsilane,ethylthio trimethylsilane, technical grade,acmc-20aplk,trimethyl ethylthio silane,ethyl thio trimethylsilane,ethyl trimethylsilyl sulfide,trimethylsilyl ethyl sulfide,ethylsulfanyl trimethylsilane,ethylsulfanyl trimethyl silane PubChem CID: 2733426 IUPAC-namn: etylsulfanyl(trimetyl)silan LEDER: CCS[Si](C)(C)C
| Molekylformel | C5H14SSi |
|---|---|
| PubChem CID | 2733426 |
| MDL-nummer | MFCD00042890 |
| IUPAC-namn | etylsulfanyl(trimetyl)silan |
| CAS | 5573-62-6 |
| InChI-nyckel | HXAFQWICVBBXMZ-UHFFFAOYSA-N |
| LEDER | CCS[Si](C)(C)C |
| Molekylvikt (g/mol) | 134.31 |
| Synonym | ethylthio trimethylsilane,ethylthiotrimethylsilane,ethylthio trimethylsilane, technical grade,acmc-20aplk,trimethyl ethylthio silane,ethyl thio trimethylsilane,ethyl trimethylsilyl sulfide,trimethylsilyl ethyl sulfide,ethylsulfanyl trimethylsilane,ethylsulfanyl trimethyl silane |
Potassium phenoxymethyltrifluoroborate, 95%, Thermo Scientific Chemicals
CAS: 1027642-30-3 Molekylformel: C7H7BF3KO Molekylvikt (g/mol): 214.036 MDL-nummer: MFCD10566516 InChI-nyckel: OVYSNXCRBZPJIG-UHFFFAOYSA-N Synonym: potassium phenoxy-methyltrifluoroborate,potassium trifluoro phenoxymethyl boranuide,pubchem11600,potassium phenoxymethyltrifluoroborate,potassium trifluoro phenoxymethyl borate,potassium trifluoro phenoxymethyl borate 1-,potassium phenoxymethyltrifluoroborate, contains kbr PubChem CID: 45479874 IUPAC-namn: kalium;trifluoro(fenoximetyl)boranuid LEDER: [B-](COC1=CC=CC=C1)(F)(F)F.[K+]
| Molekylformel | C7H7BF3KO |
|---|---|
| PubChem CID | 45479874 |
| MDL-nummer | MFCD10566516 |
| IUPAC-namn | kalium;trifluoro(fenoximetyl)boranuid |
| CAS | 1027642-30-3 |
| InChI-nyckel | OVYSNXCRBZPJIG-UHFFFAOYSA-N |
| LEDER | [B-](COC1=CC=CC=C1)(F)(F)F.[K+] |
| Molekylvikt (g/mol) | 214.036 |
| Synonym | potassium phenoxy-methyltrifluoroborate,potassium trifluoro phenoxymethyl boranuide,pubchem11600,potassium phenoxymethyltrifluoroborate,potassium trifluoro phenoxymethyl borate,potassium trifluoro phenoxymethyl borate 1-,potassium phenoxymethyltrifluoroborate, contains kbr |
Kaliumbrommetyltrifluorborat, 95 %, Thermo Scientific Chemicals
CAS: 888711-44-2 Molekylformel: CH2BBrF3K Molekylvikt (g/mol): 200.835 MDL-nummer: MFCD09265154 InChI-nyckel: AZDFPIRYUOCVCJ-UHFFFAOYSA-N Synonym: potassium bromomethyl trifluoroborate,potassium bromomethyltrifluoroborate,potassium bromomethyl trifluoroboranuide,potassium bromomethyl trifluoro boranuide,potassium bromomethyl trifluoro borate 1-,borate 1-, bromomethyl trifluoro-, potassium 1:1 , t-4,pubchem11564,bromomethyl potassium trifluoroborate,postassium bromomethyltrifluoroborate,trifluoro bromomethyl potassioboron v PubChem CID: 23690312 IUPAC-namn: kalium;brommetyl(trifluoro)boranuid LEDER: [B-](CBr)(F)(F)F.[K+]
| Molekylformel | CH2BBrF3K |
|---|---|
| PubChem CID | 23690312 |
| MDL-nummer | MFCD09265154 |
| IUPAC-namn | kalium;brommetyl(trifluoro)boranuid |
| CAS | 888711-44-2 |
| InChI-nyckel | AZDFPIRYUOCVCJ-UHFFFAOYSA-N |
| LEDER | [B-](CBr)(F)(F)F.[K+] |
| Molekylvikt (g/mol) | 200.835 |
| Synonym | potassium bromomethyl trifluoroborate,potassium bromomethyltrifluoroborate,potassium bromomethyl trifluoroboranuide,potassium bromomethyl trifluoro boranuide,potassium bromomethyl trifluoro borate 1-,borate 1-, bromomethyl trifluoro-, potassium 1:1 , t-4,pubchem11564,bromomethyl potassium trifluoroborate,postassium bromomethyltrifluoroborate,trifluoro bromomethyl potassioboron v |
Cyanopropylmetyldiklorsilan, 97 %, Thermo Scientific™
CAS: 1190-16-5 Molekylformel: C5H9Cl2NSi Molekylvikt (g/mol): 182.12 MDL-nummer: MFCD00019889 InChI-nyckel: UIFBMBZYGZSWQE-UHFFFAOYSA-N Synonym: 3-cyanopropyl methyldichlorosilane,3-cyanopropylmethyldichlorosilane,4-dichloromethylsilyl-butyronitrile,3-cyanopropyldichloromethylsilane,butanenitrile, 4-dichloromethylsilyl,unii-a09zd6eimj,4-dichloromethylsilyl butyronitrile,methylcyanopropyldichlorosilane,4-dichloro methyl silyl butanenitrile,dichlor-3-kyanpropyl-methylsilan PubChem CID: 14479 IUPAC-namn: 4-[diklor(metyl)silyl]butannitril LEDER: C[Si](Cl)(Cl)CCCC#N
| Molekylformel | C5H9Cl2NSi |
|---|---|
| PubChem CID | 14479 |
| MDL-nummer | MFCD00019889 |
| IUPAC-namn | 4-[diklor(metyl)silyl]butannitril |
| CAS | 1190-16-5 |
| InChI-nyckel | UIFBMBZYGZSWQE-UHFFFAOYSA-N |
| LEDER | C[Si](Cl)(Cl)CCCC#N |
| Molekylvikt (g/mol) | 182.12 |
| Synonym | 3-cyanopropyl methyldichlorosilane,3-cyanopropylmethyldichlorosilane,4-dichloromethylsilyl-butyronitrile,3-cyanopropyldichloromethylsilane,butanenitrile, 4-dichloromethylsilyl,unii-a09zd6eimj,4-dichloromethylsilyl butyronitrile,methylcyanopropyldichlorosilane,4-dichloro methyl silyl butanenitrile,dichlor-3-kyanpropyl-methylsilan |
Tetraetylortosilikat, 98 %, Thermo Scientific Chemicals
CAS: 78-10-4 Molekylformel: C8H20O4Si Molekylvikt (g/mol): 208.33 MDL-nummer: MFCD00009062 InChI-nyckel: BOTDANWDWHJENH-UHFFFAOYSA-N Synonym: tetraethyl orthosilicate,tetraethoxysilane,teos,ethyl silicate,silicon ethoxide,silicon tetraethoxide,silane, tetraethoxy,dynasil a,tetraethoxysilicon,ethyl orthosilicate PubChem CID: 6517 IUPAC-namn: tetraetylsilikat LEDER: CCO[Si](OCC)(OCC)OCC
| Molekylformel | C8H20O4Si |
|---|---|
| PubChem CID | 6517 |
| MDL-nummer | MFCD00009062 |
| IUPAC-namn | tetraetylsilikat |
| CAS | 78-10-4 |
| InChI-nyckel | BOTDANWDWHJENH-UHFFFAOYSA-N |
| LEDER | CCO[Si](OCC)(OCC)OCC |
| Molekylvikt (g/mol) | 208.33 |
| Synonym | tetraethyl orthosilicate,tetraethoxysilane,teos,ethyl silicate,silicon ethoxide,silicon tetraethoxide,silane, tetraethoxy,dynasil a,tetraethoxysilicon,ethyl orthosilicate |
Oktadecyltriklorsilan, 95 %, Thermo Scientific Chemicals
CAS: 112-04-9 Molekylformel: C18H37Cl3Si Molekylvikt (g/mol): 387.94 MDL-nummer: MFCD00000484 InChI-nyckel: PYJJCSYBSYXGQQ-UHFFFAOYSA-N Synonym: octadecyltrichlorosilane,trichloro octadecyl silane,n-octadecyltrichlorosilane,silane, trichlorooctadecyl,silane, octadecyltrichloro,n-octadecyl trichlorosilane,stearyltrichlorosilane,unii-1qle771pke,trichlorostearylsilane,trichloroctadecylsilane PubChem CID: 8157 IUPAC-namn: triklor(oktadecyl)silan LEDER: CCCCCCCCCCCCCCCCCC[Si](Cl)(Cl)Cl
| Molekylformel | C18H37Cl3Si |
|---|---|
| PubChem CID | 8157 |
| MDL-nummer | MFCD00000484 |
| IUPAC-namn | triklor(oktadecyl)silan |
| CAS | 112-04-9 |
| InChI-nyckel | PYJJCSYBSYXGQQ-UHFFFAOYSA-N |
| LEDER | CCCCCCCCCCCCCCCCCC[Si](Cl)(Cl)Cl |
| Molekylvikt (g/mol) | 387.94 |
| Synonym | octadecyltrichlorosilane,trichloro octadecyl silane,n-octadecyltrichlorosilane,silane, trichlorooctadecyl,silane, octadecyltrichloro,n-octadecyl trichlorosilane,stearyltrichlorosilane,unii-1qle771pke,trichlorostearylsilane,trichloroctadecylsilane |
Litium tri-sek-butylborhydrid, 1 M lösning i THF, AcroSeal™ , Thermo Scientific Chemicals
CAS: 38721-52-7 Molekylformel: C12H28BLi Molekylvikt (g/mol): 190.11 MDL-nummer: MFCD00011708 InChI-nyckel: ACJKNTZKEFMEAK-UHFFFAOYNA-N Synonym: lithium tri-sec-butylhydroborate,l-selectridesolution,lithium tri-sec-butylborohydride solution,l-selectride™ solution,lithium tri butan-2-yl boron 1-,lithium tri-sec-butylborohydride l-selectride , 1m in thf,lithium tri-sec-butylborohydride 1.0 m solution in thf, spcseal,lithium tri-sec-butylborohydride, 1.0m solution in thf, packaged under argon in resealable chemseal bottles IUPAC-namn: litium(1+)-tris(butan-2-yl)boranuid LEDER: [Li+].CCC(C)[BH-](C(C)CC)C(C)CC
| Molekylformel | C12H28BLi |
|---|---|
| MDL-nummer | MFCD00011708 |
| IUPAC-namn | litium(1+)-tris(butan-2-yl)boranuid |
| CAS | 38721-52-7 |
| InChI-nyckel | ACJKNTZKEFMEAK-UHFFFAOYNA-N |
| LEDER | [Li+].CCC(C)[BH-](C(C)CC)C(C)CC |
| Molekylvikt (g/mol) | 190.11 |
| Synonym | lithium tri-sec-butylhydroborate,l-selectridesolution,lithium tri-sec-butylborohydride solution,l-selectride™ solution,lithium tri butan-2-yl boron 1-,lithium tri-sec-butylborohydride l-selectride , 1m in thf,lithium tri-sec-butylborohydride 1.0 m solution in thf, spcseal,lithium tri-sec-butylborohydride, 1.0m solution in thf, packaged under argon in resealable chemseal bottles |