Metalloidsalter
- (4)
- (1)
- (1)
- (1)
- (1)
- (1)
- (1)
- (4)
- (3)
- (2)
- (1)
- (1)
- (3)
- (3)
- (2)
- (1)
- (7)
- (6)
- (1)
- (1)
- (4)
- (1)
- (6)
- (2)
- (8)
- (3)
- (1)
- (1)
- (3)
- (2)
- (2)
- (3)
- (3)
- (1)
- (1)
- (1)
- (9)
- (3)
- (1)
- (1)
- (3)
- (2)
- (3)
- (2)
- (4)
- (5)
- (1)
- (6)
- (6)
- (13)
- (5)
- (1)
- (3)
- (3)
- (1)
- (2)
- (6)
- (1)
- (2)
- (4)
- (1)
- (1)
Filtrerade sökresultat
Dimethylphenylsilanol sodium salt, 97%
CAS: 7646-75-5 Molekylformel: C8H11NaOSi Molekylvikt (g/mol): 174.25 MDL-nummer: MFCD09266151 InChI-nyckel: NPZJKOMUCXNLBN-UHFFFAOYSA-N Synonym: dimethylphenylsilanol sodium salt,sodium dimethyl phenyl silanolate,sodium dimethylphenylsilanolate,amtsi046,sodium phenyldimethylsilanolate,dimethyl phenyl sodiooxy silane,sodium phenyl dimethylsilanolate PubChem CID: 23713317 IUPAC-namn: natrium;dimetyl-oxido-fenylsilan LEDER: C[Si](C)(C1=CC=CC=C1)[O-].[Na+]
| Molekylformel | C8H11NaOSi |
|---|---|
| PubChem CID | 23713317 |
| MDL-nummer | MFCD09266151 |
| IUPAC-namn | natrium;dimetyl-oxido-fenylsilan |
| CAS | 7646-75-5 |
| InChI-nyckel | NPZJKOMUCXNLBN-UHFFFAOYSA-N |
| LEDER | C[Si](C)(C1=CC=CC=C1)[O-].[Na+] |
| Molekylvikt (g/mol) | 174.25 |
| Synonym | dimethylphenylsilanol sodium salt,sodium dimethyl phenyl silanolate,sodium dimethylphenylsilanolate,amtsi046,sodium phenyldimethylsilanolate,dimethyl phenyl sodiooxy silane,sodium phenyl dimethylsilanolate |
Sand, vit kvarts, Honeywell Fluka™
CAS: 14808-60-7 Molekylformel: O2Si Molekylvikt (g/mol): 60.08 MDL-nummer: MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 InChI-nyckel: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 LEDER: O=[Si]=O
| Molekylformel | O2Si |
|---|---|
| PubChem CID | 24261 |
| MDL-nummer | MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 |
| CAS | 14808-60-7 |
| InChI-nyckel | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| LEDER | O=[Si]=O |
| ChEBI | CHEBI:30563 |
| Molekylvikt (g/mol) | 60.08 |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
Kiseldioxid, 99 %, Honeywell Fluka™
CAS: 14808-60-7 Molekylformel: O2Si Molekylvikt (g/mol): 60.08 MDL-nummer: MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 InChI-nyckel: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC-namn: dioxosilan LEDER: O=[Si]=O
| Molekylformel | O2Si |
|---|---|
| PubChem CID | 24261 |
| MDL-nummer | MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 |
| IUPAC-namn | dioxosilan |
| CAS | 14808-60-7 |
| InChI-nyckel | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| LEDER | O=[Si]=O |
| ChEBI | CHEBI:30563 |
| Molekylvikt (g/mol) | 60.08 |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
Sand, vit kvarts, Honeywell Fluka™
CAS: 14808-60-7 Molekylformel: O2Si Molekylvikt (g/mol): 60.08 MDL-nummer: MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 InChI-nyckel: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC-namn: dioxosilan LEDER: O=[Si]=O
| Molekylformel | O2Si |
|---|---|
| PubChem CID | 24261 |
| MDL-nummer | MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 |
| IUPAC-namn | dioxosilan |
| CAS | 14808-60-7 |
| InChI-nyckel | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| LEDER | O=[Si]=O |
| ChEBI | CHEBI:30563 |
| Molekylvikt (g/mol) | 60.08 |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
Kiseldioxid, purum pa, syrarenad, Honeywell Fluka™
CAS: 60676-86-0 Molekylformel: O2Si Molekylvikt (g/mol): 60.083 MDL-nummer: MFCD00011232 InChI-nyckel: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC-namn: dioxosilan LEDER: O=[Si]=O
| Molekylformel | O2Si |
|---|---|
| PubChem CID | 24261 |
| MDL-nummer | MFCD00011232 |
| IUPAC-namn | dioxosilan |
| CAS | 60676-86-0 |
| InChI-nyckel | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| LEDER | O=[Si]=O |
| ChEBI | CHEBI:30563 |
| Molekylvikt (g/mol) | 60.083 |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
Kiseldioxid, bränd, rå, Honeywell Fluka™
CAS: 14808-60-7 Molekylformel: O2Si Molekylvikt (g/mol): 60.08 MDL-nummer: MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 InChI-nyckel: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC-namn: dioxosilan LEDER: O=[Si]=O
| Molekylformel | O2Si |
|---|---|
| PubChem CID | 24261 |
| MDL-nummer | MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 |
| IUPAC-namn | dioxosilan |
| CAS | 14808-60-7 |
| InChI-nyckel | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| LEDER | O=[Si]=O |
| ChEBI | CHEBI:30563 |
| Molekylvikt (g/mol) | 60.08 |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
Boron trifluoride, 12% (1.5M) in methanol
Boron trifluoride, 12% (1.5M) in methanol, Quantity: 500g, Packaging: Glass bottle, Boiling Point: 65.0 deg.C, CAS: 373-57-9, 67-56-1, Amber to Colorless, Melting Point: -98.0 deg.C, Molecular Formula: BF3, Molecular Weight: 67.81, Percent Purity: 10 to 15% (w/v BF3) | CAS: 373-57-9 | BF3 | 67.81 g/mol
| Formel vikt | 67.81 |
|---|---|
| InChI-nyckel | WTEOIRVLGSZEPR-UHFFFAOYSA-N |
| Hälsofara 3 | GHS P Statement IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. Wear protective gloves/protective |
| Hälsofara 2 | GHS H Statement Highly flammable liquid and vapor. Causes severe skin burns and eye damage. Fatal if inhaled. Toxic if swallowed. Reacts violently with water. Toxic in contact with skin. Causes damage to organs |
| Hälsofara 1 | GHS-signalord: Fara |
| PubChem CID | 11062313 |
| Förpackning | Glasflaska |
| Linjär formel | BF3 |
| Namnnotering | 1.5M solution in methanol |
| LEDER | FB(F)F |
| RTECS-nummer | ED2275000 |
| Molekylvikt (g/mol) | 67.81 |
| Densitet | 0.8700g/mL |
| Molekylformel | BF3 |
| MDL-nummer | MFCD00011316 |
| Kokpunkt | 65.0°C |
| Löslighetsinformation | Solubility in water: may decompose |
| Merck Index | 14, 1349 |
| Fysisk form | Lösning |
| Färg | Bärnsten till färglös |
| Flampunkt | 4°C |
| Smältpunkt | -98.0°C |
| CAS | 67-56-1 |
| EINECS-nummer | 206-766-4 |
| Synonym | boron trifluoride-methanol solution,boron trifluoride-methanol complex,boron trifluoride methanol,boron trifluoride-methanol solution in methanol,bf3 methanol,.bf3 in methanol,boron fluoride methanol,bf3 meoh,borontrifluoride methanol,boron trifluoride solution |
| TSCA | TSCA |
| Kemiskt namn eller material | Boron trifluoride |
| Procent renhet | 10 to 15% (w/v BF3) |
(3-Aminopropyl)triethoxysilane, 98%
CAS: 919-30-2 Molekylformel: C9H23NO3Si Molekylvikt (g/mol): 221.37 MDL-nummer: MFCD00008207,MFCD01324904 InChI-nyckel: WYTZZXDRDKSJID-UHFFFAOYSA-N Synonym: 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane PubChem CID: 13521 IUPAC-namn: 3-trietoxisilylpropan-1-amin LEDER: CCO[Si](CCCN)(OCC)OCC
| Molekylformel | C9H23NO3Si |
|---|---|
| PubChem CID | 13521 |
| MDL-nummer | MFCD00008207,MFCD01324904 |
| IUPAC-namn | 3-trietoxisilylpropan-1-amin |
| CAS | 919-30-2 |
| InChI-nyckel | WYTZZXDRDKSJID-UHFFFAOYSA-N |
| LEDER | CCO[Si](CCCN)(OCC)OCC |
| Molekylvikt (g/mol) | 221.37 |
| Synonym | 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane |
Silicon(IV) oxide, powder, 0.5 micron, 99.9%
CAS: 7631-86-9 Molekylformel: O2Si Molekylvikt (g/mol): 60.08 MDL-nummer: MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 InChI-nyckel: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC-namn: dioxosilan LEDER: O=[Si]=O
| Molekylformel | O2Si |
|---|---|
| PubChem CID | 24261 |
| MDL-nummer | MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 |
| IUPAC-namn | dioxosilan |
| CAS | 7631-86-9 |
| InChI-nyckel | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| LEDER | O=[Si]=O |
| ChEBI | CHEBI:30563 |
| Molekylvikt (g/mol) | 60.08 |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
Trimethylsilanol, 95%
CAS: 1066-40-6 Molekylformel: C3H9LiOSi Molekylvikt (g/mol): 96.13 MDL-nummer: MFCD02751657 InChI-nyckel: OXOZHAWWRPCVGL-UHFFFAOYSA-N Synonym: trimethylsilanol,silanol, trimethyl,unii-z4bin3300p,trimethylhydroxysilane,ccris 1320,hydroxy trimethyl silane,silanol, 1,1,1-trimethyl,ksc504m9b,2004-14-0 lithium salt,10519-96-7 potassium salt PubChem CID: 66110 IUPAC-namn: hydroxi(trimetyl)silan LEDER: [Li+].C[Si](C)(C)[O-]
| Molekylformel | C3H9LiOSi |
|---|---|
| PubChem CID | 66110 |
| MDL-nummer | MFCD02751657 |
| IUPAC-namn | hydroxi(trimetyl)silan |
| CAS | 1066-40-6 |
| InChI-nyckel | OXOZHAWWRPCVGL-UHFFFAOYSA-N |
| LEDER | [Li+].C[Si](C)(C)[O-] |
| Molekylvikt (g/mol) | 96.13 |
| Synonym | trimethylsilanol,silanol, trimethyl,unii-z4bin3300p,trimethylhydroxysilane,ccris 1320,hydroxy trimethyl silane,silanol, 1,1,1-trimethyl,ksc504m9b,2004-14-0 lithium salt,10519-96-7 potassium salt |
Sodium selenite, 44-46% Se, anhydrous
CAS: 10102-18-8 Molekylformel: Na2O3Se Molekylvikt (g/mol): 172.94 MDL-nummer: MFCD00003489 InChI-nyckel: BVTBRVFYZUCAKH-UHFFFAOYSA-L Synonym: sodium selenite,disodium selenite,natriumselenit,selenious acid, disodium salt,natriumselenit german,disodium selenium trioxide,unii-hiw548rq3w,selenious acid disodium salt,ccris 1260,hsdb 768 PubChem CID: 24934 ChEBI: CHEBI:48843 IUPAC-namn: dinatrium;selenit LEDER: [O-][Se](=O)[O-].[Na+].[Na+]
| Molekylformel | Na2O3Se |
|---|---|
| PubChem CID | 24934 |
| MDL-nummer | MFCD00003489 |
| IUPAC-namn | dinatrium;selenit |
| CAS | 10102-18-8 |
| InChI-nyckel | BVTBRVFYZUCAKH-UHFFFAOYSA-L |
| LEDER | [O-][Se](=O)[O-].[Na+].[Na+] |
| ChEBI | CHEBI:48843 |
| Molekylvikt (g/mol) | 172.94 |
| Synonym | sodium selenite,disodium selenite,natriumselenit,selenious acid, disodium salt,natriumselenit german,disodium selenium trioxide,unii-hiw548rq3w,selenious acid disodium salt,ccris 1260,hsdb 768 |
Boron nitride, low binder, 99.5% (metals basis), Thermo Scientific Chemicals
CAS: 10043-11-5 Molekylformel: BN Molekylvikt (g/mol): 24.82 MDL-nummer: MFCD00011317 InChI-nyckel: LNLSXDSWJBUPHM-UHFFFAOYSA-N Synonym: boron nitride,elbor,borazon,elboron,kubonit,wurzin,denka boron nitride gp,geksanit r,hexanite r PubChem CID: 66227 ChEBI: CHEBI:50883 IUPAC-namn: boranylidyneamin LEDER: B=N
| Molekylformel | BN |
|---|---|
| PubChem CID | 66227 |
| MDL-nummer | MFCD00011317 |
| IUPAC-namn | boranylidyneamin |
| CAS | 10043-11-5 |
| InChI-nyckel | LNLSXDSWJBUPHM-UHFFFAOYSA-N |
| LEDER | B=N |
| ChEBI | CHEBI:50883 |
| Molekylvikt (g/mol) | 24.82 |
| Synonym | boron nitride,elbor,borazon,elboron,kubonit,wurzin,denka boron nitride gp,geksanit r,hexanite r |
Potassium selenocyanate, 99%
CAS: 3425-46-5 Molekylformel: CKNSe Molekylvikt (g/mol): 144.08 MDL-nummer: MFCD00011366 InChI-nyckel: KYEKHFSRAXRJBR-UHFFFAOYSA-M Synonym: potassium selenocyanate,selenocyanic acid, potassium salt,potassium selenoisocyanate,ccris 7063,potassium ion selenocyanate,potassium selenocyanate 10g PubChem CID: 76960 IUPAC-namn: kalium;selenocyanat LEDER: C(#N)[Se-].[K+]
| Molekylformel | CKNSe |
|---|---|
| PubChem CID | 76960 |
| MDL-nummer | MFCD00011366 |
| IUPAC-namn | kalium;selenocyanat |
| CAS | 3425-46-5 |
| InChI-nyckel | KYEKHFSRAXRJBR-UHFFFAOYSA-M |
| LEDER | C(#N)[Se-].[K+] |
| Molekylvikt (g/mol) | 144.08 |
| Synonym | potassium selenocyanate,selenocyanic acid, potassium salt,potassium selenoisocyanate,ccris 7063,potassium ion selenocyanate,potassium selenocyanate 10g |
Sodium bis(trimethylsilyl)amide, 1M soln. in THF
CAS: 1070-89-9 Molekylformel: C6H18NNaSi2 Molekylvikt (g/mol): 183.377 MDL-nummer: MFCD00009835 InChI-nyckel: WRIKHQLVHPKCJU-UHFFFAOYSA-N Synonym: sodium bis trimethylsilyl amide,n-sodiohexamethyldisilazane,sodium hexamethyldisilazide,nahmds,sodiobis trimethylsilyl amine,sodium bis trimethylsilyl azanide,n-sodium hexamethyldisilazane,sodium-bis trimethylsilyl amide,hexamethyldisilazane sodium salt PubChem CID: 2724254 IUPAC-namn: natrium;bis(trimetylsilyl)azanid LEDER: C[Si](C)(C)[N-][Si](C)(C)C.[Na+]
| Molekylformel | C6H18NNaSi2 |
|---|---|
| PubChem CID | 2724254 |
| MDL-nummer | MFCD00009835 |
| IUPAC-namn | natrium;bis(trimetylsilyl)azanid |
| CAS | 1070-89-9 |
| InChI-nyckel | WRIKHQLVHPKCJU-UHFFFAOYSA-N |
| LEDER | C[Si](C)(C)[N-][Si](C)(C)C.[Na+] |
| Molekylvikt (g/mol) | 183.377 |
| Synonym | sodium bis trimethylsilyl amide,n-sodiohexamethyldisilazane,sodium hexamethyldisilazide,nahmds,sodiobis trimethylsilyl amine,sodium bis trimethylsilyl azanide,n-sodium hexamethyldisilazane,sodium-bis trimethylsilyl amide,hexamethyldisilazane sodium salt |