Organiska fosforsyror och derivat
Filtrerade sökresultat
Thermo Scientific Chemicals Adenosin-5'-monofosforsyra, 99 % (torr vikt), vatten< 6 %
CAS: 61-19-8 Molekylformel: C10H14N5O7P Molekylvikt (g/mol): 347.22 MDL-nummer: MFCD00005750 InChI-nyckel: UDMBCSSLTHHNCD-YPLCUDRINA-N Synonym: adenosine 5'-monophosphate,5'-adenylic acid,adenosine monophosphate,adenosine phosphate,adenylic acid,adenylate,phosphaden,5'-amp,adenosine 5'-phosphate,phosphentaside PubChem CID: 6083 ChEBI: CHEBI:16027 IUPAC-namn: [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxioxolan-2-yl]metyldivätefosfat LEDER: NC1=C2N=CN([C@@H]3O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]3O)C2=NC=N1
| Molekylformel | C10H14N5O7P |
|---|---|
| PubChem CID | 6083 |
| MDL-nummer | MFCD00005750 |
| IUPAC-namn | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxioxolan-2-yl]metyldivätefosfat |
| CAS | 61-19-8 |
| InChI-nyckel | UDMBCSSLTHHNCD-YPLCUDRINA-N |
| LEDER | NC1=C2N=CN([C@@H]3O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]3O)C2=NC=N1 |
| ChEBI | CHEBI:16027 |
| Molekylvikt (g/mol) | 347.22 |
| Synonym | adenosine 5'-monophosphate,5'-adenylic acid,adenosine monophosphate,adenosine phosphate,adenylic acid,adenylate,phosphaden,5'-amp,adenosine 5'-phosphate,phosphentaside |
Phosphoric Acid Diethyl Ester, TRC
CAS: 598-02-7 Molekylformel: C4 H11 O4 P Molekylvikt (g/mol): 154.1 Synonym: Phosphoric acid, diethyl ester,Phosphoric acid diethyl ester,Ethyl phosphate ((C2H5O)2(HO)PO) (6CI),DEP,Diethyl acid phosphate,Diethyl hydrogen phosphate,Diethyl phosphate,Diethyl phosphoric acid,JP 502,NSC 97178,O,O-Diethyl hydrogen phosphate IUPAC-namn: diethyl hydrogen phosphate LEDER: CCOP(=O)(O)OCC
| Molekylformel | C4 H11 O4 P |
|---|---|
| IUPAC-namn | diethyl hydrogen phosphate |
| CAS | 598-02-7 |
| LEDER | CCOP(=O)(O)OCC |
| Molekylvikt (g/mol) | 154.1 |
| Synonym | Phosphoric acid, diethyl ester,Phosphoric acid diethyl ester,Ethyl phosphate ((C2H5O)2(HO)PO) (6CI),DEP,Diethyl acid phosphate,Diethyl hydrogen phosphate,Diethyl phosphate,Diethyl phosphoric acid,JP 502,NSC 97178,O,O-Diethyl hydrogen phosphate |
Phosphoric Acid Tributyl Ester, TRC
CAS: 126-73-8 Molekylformel: C12 H27 O4 P Molekylvikt (g/mol): 266.31 Synonym: Tri-n-butyl phosphate,Phosphoric acid tributyl ester,Tributyl Phosphate,Butyl phosphate ((BuO)3PO) (6CI, 7CI),Tributyl phosphate (ACI),941PL,Calloway 6814,Celluphos 4,Degressal SD 40,Disflamoll TB,DL 1157,DU 155,Moussex 941PL,NSC 8484,Phosflex 4,Phosphoric acid, tributyl ester,TBP,TBPA,Tri-n-butyl phosphate,Tributoxyphosphine oxide,X 8054 IUPAC-namn: tributyl phosphate LEDER: CCCCOP(=O)(OCCCC)OCCCC
| Molekylformel | C12 H27 O4 P |
|---|---|
| IUPAC-namn | tributyl phosphate |
| CAS | 126-73-8 |
| LEDER | CCCCOP(=O)(OCCCC)OCCCC |
| Molekylvikt (g/mol) | 266.31 |
| Synonym | Tri-n-butyl phosphate,Phosphoric acid tributyl ester,Tributyl Phosphate,Butyl phosphate ((BuO)3PO) (6CI, 7CI),Tributyl phosphate (ACI),941PL,Calloway 6814,Celluphos 4,Degressal SD 40,Disflamoll TB,DL 1157,DU 155,Moussex 941PL,NSC 8484,Phosflex 4,Phosphoric acid, tributyl ester,TBP,TBPA,Tri-n-butyl phosphate,Tributoxyphosphine oxide,X 8054 |
Phosphoric Acid Dibenzyl Ester, TRC
CAS: 1623-08-1 Molekylformel: C14H15O4P Molekylvikt (g/mol): 278.24 Synonym: Dibenzyl Hydrogen Phosphate,Dibenzyl Phosphate,Dibenzylphosphoric Acid IUPAC-namn: dibenzyl hydrogen phosphate LEDER: OP(=O)(OCc1ccccc1)OCc2ccccc2
| Molekylformel | C14H15O4P |
|---|---|
| IUPAC-namn | dibenzyl hydrogen phosphate |
| CAS | 1623-08-1 |
| LEDER | OP(=O)(OCc1ccccc1)OCc2ccccc2 |
| Molekylvikt (g/mol) | 278.24 |
| Synonym | Dibenzyl Hydrogen Phosphate,Dibenzyl Phosphate,Dibenzylphosphoric Acid |
Di-Beta,Beta'-Chloroethylphosphoric Acid, TRC
CAS: 3040-56-0 Molekylformel: C4H9Cl2O4P Molekylvikt (g/mol): 222.99 Synonym: Ethanol, 2-chloro-, hydrogen phosphate (7CI, 8CI, 9CI),Bis(2-chloroethyl) hydrogen phosphate,Bis(2-chloroethyl) phosphate,Bis(chloroethyl) phosphate,Bis(β-chloroethyl) phosphate,Bis(β-chloroethyl) phosphoric acid,Di-2-Chloroethyl phosphate,Di-β,β'-Chloroethylphosphoric acid IUPAC-namn: bis(2-chloroethyl) hydrogen phosphate LEDER: OP(=O)(OCCCl)OCCCl
| Molekylformel | C4H9Cl2O4P |
|---|---|
| IUPAC-namn | bis(2-chloroethyl) hydrogen phosphate |
| CAS | 3040-56-0 |
| LEDER | OP(=O)(OCCCl)OCCCl |
| Molekylvikt (g/mol) | 222.99 |
| Synonym | Ethanol, 2-chloro-, hydrogen phosphate (7CI, 8CI, 9CI),Bis(2-chloroethyl) hydrogen phosphate,Bis(2-chloroethyl) phosphate,Bis(chloroethyl) phosphate,Bis(β-chloroethyl) phosphate,Bis(β-chloroethyl) phosphoric acid,Di-2-Chloroethyl phosphate,Di-β,β'-Chloroethylphosphoric acid |
Phosphoric Acid Tris(2-methylpropyl) Ester, TRC
CAS: 126-71-6 Molekylformel: C12 H27 O4 P Molekylvikt (g/mol): 266.31 Synonym: Phosphoric acid, tris(2-methylpropyl) ester,Isobutyl phosphate ((C4H9O)3PO) (6CI,7CI),Phosphoric acid, triisobutyl ester (8CI),Antifoam TIP,Daiguard 400,NSC 62222,Reomol TIBP,Triisobutyl phosphate IUPAC-namn: tris(2-methylpropyl) phosphate LEDER: CC(C)COP(=O)(OCC(C)C)OCC(C)C
| Molekylformel | C12 H27 O4 P |
|---|---|
| IUPAC-namn | tris(2-methylpropyl) phosphate |
| CAS | 126-71-6 |
| LEDER | CC(C)COP(=O)(OCC(C)C)OCC(C)C |
| Molekylvikt (g/mol) | 266.31 |
| Synonym | Phosphoric acid, tris(2-methylpropyl) ester,Isobutyl phosphate ((C4H9O)3PO) (6CI,7CI),Phosphoric acid, triisobutyl ester (8CI),Antifoam TIP,Daiguard 400,NSC 62222,Reomol TIBP,Triisobutyl phosphate |
Phosphoric Acid Tris(2-methylphenyl) Ester, TRC
CAS: 78-30-8 Molekylformel: C21 H21 O4 P Molekylvikt (g/mol): 368.36 Synonym: Phosphoric acid, tris(2-methylphenyl) ester (9CI, ACI),Phosphoric acid, tri-o-tolyl ester (8CI),NSC 438,o-Cresyl phosphate,P(o-Tolyl)3,Phosflex 179C,TOCP,TOKF,TOTP,Tri-o-cresyl phosphate,Tri-o-tolyl phosphate,Tris(2-methylphenyl) phosphate,Tris(2-tolyl) phosphate,Tris(o-cresyl) phosphate,Tris(o-methylphenyl) phosphate,Tris(o-tolyl) phosphate,Tri-2-cresyl phosphate IUPAC-namn: tris(2-methylphenyl) phosphate LEDER: Cc1ccccc1OP(=O)(Oc2ccccc2C)Oc3ccccc3C
| Molekylformel | C21 H21 O4 P |
|---|---|
| IUPAC-namn | tris(2-methylphenyl) phosphate |
| CAS | 78-30-8 |
| LEDER | Cc1ccccc1OP(=O)(Oc2ccccc2C)Oc3ccccc3C |
| Molekylvikt (g/mol) | 368.36 |
| Synonym | Phosphoric acid, tris(2-methylphenyl) ester (9CI, ACI),Phosphoric acid, tri-o-tolyl ester (8CI),NSC 438,o-Cresyl phosphate,P(o-Tolyl)3,Phosflex 179C,TOCP,TOKF,TOTP,Tri-o-cresyl phosphate,Tri-o-tolyl phosphate,Tris(2-methylphenyl) phosphate,Tris(2-tolyl) phosphate,Tris(o-cresyl) phosphate,Tris(o-methylphenyl) phosphate,Tris(o-tolyl) phosphate,Tri-2-cresyl phosphate |
Guanosin-5'-monofosfat, fri syra,≥ 98 %, MP Biomedicals™
CAS: 85-32-5 Molekylformel: C10H14N5O8P Molekylvikt (g/mol): 363.223 InChI-nyckel: RQFCJASXJCIDSX-UUOKFMHZSA-N Synonym: 5'-guanylic acid,guanosine monophosphate,guanylic acid,guanosine-5'-monophosphate,guanosine 5'-monophosphate,5'-gmp,guanosine 5'-phosphate,guanylate,guanidine monophosphate,guanosine-phosphate PubChem CID: 6804 ChEBI: CHEBI:17345 IUPAC-namn: [(2R,3S,4R,5R)-5-(2-amino-6-oxo-3H-purin-9-yl)-3,4-dihydroxioxolan-2-yl]metyldivätefosfat LEDER: C1=NC2=C(N1C3C(C(C(O3)COP(=O)(O)O)O)O)NC(=NC2=O)N
| Molekylformel | C10H14N5O8P |
|---|---|
| PubChem CID | 6804 |
| IUPAC-namn | [(2R,3S,4R,5R)-5-(2-amino-6-oxo-3H-purin-9-yl)-3,4-dihydroxioxolan-2-yl]metyldivätefosfat |
| CAS | 85-32-5 |
| InChI-nyckel | RQFCJASXJCIDSX-UUOKFMHZSA-N |
| LEDER | C1=NC2=C(N1C3C(C(C(O3)COP(=O)(O)O)O)O)NC(=NC2=O)N |
| ChEBI | CHEBI:17345 |
| Molekylvikt (g/mol) | 363.223 |
| Synonym | 5'-guanylic acid,guanosine monophosphate,guanylic acid,guanosine-5'-monophosphate,guanosine 5'-monophosphate,5'-gmp,guanosine 5'-phosphate,guanylate,guanidine monophosphate,guanosine-phosphate |
Phosphoric Acid Tris(3-methylphenyl) Ester, TRC
CAS: 563-04-2 Molekylformel: C21 H21 O4 P Molekylvikt (g/mol): 368.36 Synonym: Phosphoric acid, tris(3-methylphenyl) ester (9CI, ACI),m-Tolyl phosphate, (C7H7O)3PO (6CI),Phosphoric acid, tri-m-tolyl ester (8CI),NSC 4055,TMCP,Tri-m-cresyl phosphate,Tri-m-tolyl phosphate,Tris(3-methylphenyl) phosphate,Tris(m-tolyl) phosphate,Tris-m-cresyl phosphate,Tri-3-cresyl phosphate IUPAC-namn: tris(3-methylphenyl) phosphate LEDER: Cc1cccc(OP(=O)(Oc2cccc(C)c2)Oc3cccc(C)c3)c1
| Molekylformel | C21 H21 O4 P |
|---|---|
| IUPAC-namn | tris(3-methylphenyl) phosphate |
| CAS | 563-04-2 |
| LEDER | Cc1cccc(OP(=O)(Oc2cccc(C)c2)Oc3cccc(C)c3)c1 |
| Molekylvikt (g/mol) | 368.36 |
| Synonym | Phosphoric acid, tris(3-methylphenyl) ester (9CI, ACI),m-Tolyl phosphate, (C7H7O)3PO (6CI),Phosphoric acid, tri-m-tolyl ester (8CI),NSC 4055,TMCP,Tri-m-cresyl phosphate,Tri-m-tolyl phosphate,Tris(3-methylphenyl) phosphate,Tris(m-tolyl) phosphate,Tris-m-cresyl phosphate,Tri-3-cresyl phosphate |
Phosphoric Acid Tris(2-methylpropyl) Ester, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
Triethyl phosphate, 99+%
CAS: 78-40-0 Molekylformel: C6H15O4P Molekylvikt (g/mol): 182.16 MDL-nummer: MFCD00009077 InChI-nyckel: DQWPFSLDHJDLRL-UHFFFAOYSA-N Synonym: triethylphosphate,phosphoric acid, triethyl ester,tris ethyl phosphate,triethoxyphosphine oxide,triethylfosfat,ethyl phosphate eto 3po,triethylfosfat czech,ethyl phosphate van,unii-qih4k96k7j,phosphoric acid triethyl ester PubChem CID: 6535 ChEBI: CHEBI:45927 IUPAC-namn: trietylfosfat LEDER: CCOP(=O)(OCC)OCC
| Molekylformel | C6H15O4P |
|---|---|
| PubChem CID | 6535 |
| MDL-nummer | MFCD00009077 |
| IUPAC-namn | trietylfosfat |
| CAS | 78-40-0 |
| InChI-nyckel | DQWPFSLDHJDLRL-UHFFFAOYSA-N |
| LEDER | CCOP(=O)(OCC)OCC |
| ChEBI | CHEBI:45927 |
| Molekylvikt (g/mol) | 182.16 |
| Synonym | triethylphosphate,phosphoric acid, triethyl ester,tris ethyl phosphate,triethoxyphosphine oxide,triethylfosfat,ethyl phosphate eto 3po,triethylfosfat czech,ethyl phosphate van,unii-qih4k96k7j,phosphoric acid triethyl ester |
4-Nitrophenyl phosphate, disodium salt, hexahydrate, 98+%
CAS: 333338-18-4 Molekylformel: C6H4NNa2O6P Molekylvikt (g/mol): 263.05 MDL-nummer: MFCD00007319 InChI-nyckel: VIYFPAMJCJLZKD-UHFFFAOYSA-L Synonym: pnpp,disodium 4-nitrophenylphosphate,sodium 4-nitrophenyl phosphate,disodium 4-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, disodium salt,disodium p-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, sodium salt 1:2,p-nitrophenyl phosphate,pnpp liquid substrate system PubChem CID: 77949 IUPAC-namn: dinatrium;(4-nitrofenyl)fosfat LEDER: [Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1
| Molekylformel | C6H4NNa2O6P |
|---|---|
| PubChem CID | 77949 |
| MDL-nummer | MFCD00007319 |
| IUPAC-namn | dinatrium;(4-nitrofenyl)fosfat |
| CAS | 333338-18-4 |
| InChI-nyckel | VIYFPAMJCJLZKD-UHFFFAOYSA-L |
| LEDER | [Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1 |
| Molekylvikt (g/mol) | 263.05 |
| Synonym | pnpp,disodium 4-nitrophenylphosphate,sodium 4-nitrophenyl phosphate,disodium 4-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, disodium salt,disodium p-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, sodium salt 1:2,p-nitrophenyl phosphate,pnpp liquid substrate system |
Trimethyl phosphate, 99%
CAS: 512-56-1 Molekylformel: C3H9O4P Molekylvikt (g/mol): 140.08 MDL-nummer: MFCD00008348 InChI-nyckel: WVLBCYQITXONBZ-UHFFFAOYSA-N Synonym: trimethylphosphate,phosphoric acid, trimethyl ester,trimethyl orthophosphate,tmpo,trimethoxyphosphine oxide,phosphoric acid trimethyl ester,o,o,o-trimethyl phosphate,trimethylfosfat,phosphate, trimethyl,trimethylfosfat czech PubChem CID: 10541 ChEBI: CHEBI:46324 IUPAC-namn: trimetylfosfat LEDER: COP(=O)(OC)OC
| Molekylformel | C3H9O4P |
|---|---|
| PubChem CID | 10541 |
| MDL-nummer | MFCD00008348 |
| IUPAC-namn | trimetylfosfat |
| CAS | 512-56-1 |
| InChI-nyckel | WVLBCYQITXONBZ-UHFFFAOYSA-N |
| LEDER | COP(=O)(OC)OC |
| ChEBI | CHEBI:46324 |
| Molekylvikt (g/mol) | 140.08 |
| Synonym | trimethylphosphate,phosphoric acid, trimethyl ester,trimethyl orthophosphate,tmpo,trimethoxyphosphine oxide,phosphoric acid trimethyl ester,o,o,o-trimethyl phosphate,trimethylfosfat,phosphate, trimethyl,trimethylfosfat czech |
1-Naphthyl phosphate, monosodium salt monohydrate, 98+%
CAS: 81012-89-7 Molekylformel: C10H7O4P Molekylvikt (g/mol): 222.14 MDL-nummer: MFCD00150615 InChI-nyckel: YNXICDMQCQPQEW-UHFFFAOYSA-L Synonym: 1-naphthyl phosphate monosodium salt monohydrate,sodium naphthalen-1-yl hydrogenphosphate hydrate,alpha-naphthyl acid phosphate monosodium,sodium hydrate naphthalen-1-yl hydrogen phosphate,1-naphthyl phosphate sodium salt monohydrate,c10h8po4.na.h2o,sodium 1-naphthyl phosphate monohydrate,1-naphthyl phosphate, monosodium salt monohydrate,naphthalen-1-yloxy sodiooxy phosphinic acid hydrate,1-naphthyl phosphate monosodium salt monohydrate hplc PubChem CID: 45055387 LEDER: [O-]P([O-])(=O)OC1=C2C=CC=CC2=CC=C1
| Molekylformel | C10H7O4P |
|---|---|
| PubChem CID | 45055387 |
| MDL-nummer | MFCD00150615 |
| CAS | 81012-89-7 |
| InChI-nyckel | YNXICDMQCQPQEW-UHFFFAOYSA-L |
| LEDER | [O-]P([O-])(=O)OC1=C2C=CC=CC2=CC=C1 |
| Molekylvikt (g/mol) | 222.14 |
| Synonym | 1-naphthyl phosphate monosodium salt monohydrate,sodium naphthalen-1-yl hydrogenphosphate hydrate,alpha-naphthyl acid phosphate monosodium,sodium hydrate naphthalen-1-yl hydrogen phosphate,1-naphthyl phosphate sodium salt monohydrate,c10h8po4.na.h2o,sodium 1-naphthyl phosphate monohydrate,1-naphthyl phosphate, monosodium salt monohydrate,naphthalen-1-yloxy sodiooxy phosphinic acid hydrate,1-naphthyl phosphate monosodium salt monohydrate hplc |
Trietylfosfat, 99 %, Thermo Scientific Chemicals
CAS: 78-40-0 Molekylformel: C6H15O4P Molekylvikt (g/mol): 182.16 MDL-nummer: MFCD00009077 InChI-nyckel: DQWPFSLDHJDLRL-UHFFFAOYSA-N Synonym: triethylphosphate,phosphoric acid, triethyl ester,tris ethyl phosphate,triethoxyphosphine oxide,triethylfosfat,ethyl phosphate eto 3po,triethylfosfat czech,ethyl phosphate van,unii-qih4k96k7j,phosphoric acid triethyl ester PubChem CID: 6535 ChEBI: CHEBI:45927 IUPAC-namn: trietylfosfat LEDER: CCOP(=O)(OCC)OCC
| Molekylformel | C6H15O4P |
|---|---|
| PubChem CID | 6535 |
| MDL-nummer | MFCD00009077 |
| IUPAC-namn | trietylfosfat |
| CAS | 78-40-0 |
| InChI-nyckel | DQWPFSLDHJDLRL-UHFFFAOYSA-N |
| LEDER | CCOP(=O)(OCC)OCC |
| ChEBI | CHEBI:45927 |
| Molekylvikt (g/mol) | 182.16 |
| Synonym | triethylphosphate,phosphoric acid, triethyl ester,tris ethyl phosphate,triethoxyphosphine oxide,triethylfosfat,ethyl phosphate eto 3po,triethylfosfat czech,ethyl phosphate van,unii-qih4k96k7j,phosphoric acid triethyl ester |