Monokarboxylsyror och derivat
Filtrerade sökresultat
Isopropyl tetradecanoate, 98%
CAS: 110-27-0 Molekylformel: C17H34O2 Molekylvikt (g/mol): 270.457 MDL-nummer: MFCD00008982 InChI-nyckel: AXISYYRBXTVTFY-UHFFFAOYSA-N Synonym: isopropyl myristate,isopropyl tetradecanoate,estergel,bisomel,isomyst,promyr,tetradecanoic acid, 1-methylethyl ester,deltyl extra,kesscomir,tegester PubChem CID: 8042 IUPAC-namn: propan-2-yl-tetradekanoat LEDER: CCCCCCCCCCCCCC(=O)OC(C)C
| Molekylformel | C17H34O2 |
|---|---|
| PubChem CID | 8042 |
| MDL-nummer | MFCD00008982 |
| IUPAC-namn | propan-2-yl-tetradekanoat |
| CAS | 110-27-0 |
| InChI-nyckel | AXISYYRBXTVTFY-UHFFFAOYSA-N |
| LEDER | CCCCCCCCCCCCCC(=O)OC(C)C |
| Molekylvikt (g/mol) | 270.457 |
| Synonym | isopropyl myristate,isopropyl tetradecanoate,estergel,bisomel,isomyst,promyr,tetradecanoic acid, 1-methylethyl ester,deltyl extra,kesscomir,tegester |
Acetic acid, glacial, 99+%
CAS: 64-19-7 Molekylformel: C2H4O2 Molekylvikt (g/mol): 60.05 MDL-nummer: MFCD00036152 InChI-nyckel: QTBSBXVTEAMEQO-UHFFFAOYSA-N Synonym: ethanoic acid,ethylic acid,acetic acid, glacial,methanecarboxylic acid,vinegar acid,glacial,acetasol,acide acetique,essigsaeure PubChem CID: 176 ChEBI: CHEBI:15366 IUPAC-namn: ättiksyra LEDER: CC(O)=O
| Molekylformel | C2H4O2 |
|---|---|
| PubChem CID | 176 |
| MDL-nummer | MFCD00036152 |
| IUPAC-namn | ättiksyra |
| CAS | 64-19-7 |
| InChI-nyckel | QTBSBXVTEAMEQO-UHFFFAOYSA-N |
| LEDER | CC(O)=O |
| ChEBI | CHEBI:15366 |
| Molekylvikt (g/mol) | 60.05 |
| Synonym | ethanoic acid,ethylic acid,acetic acid, glacial,methanecarboxylic acid,vinegar acid,glacial,acetasol,acide acetique,essigsaeure |
Methacrylic acid, 99.5%, extra pure, stabilized
CAS: 79-41-4 Molekylvikt (g/mol): 86.09 MDL-nummer: MFCD00002651 InChI-nyckel: CERQOIWHTDAKMF-UHFFFAOYSA-N Synonym: methacrylic acid,2-methylacrylic acid,2-propenoic acid, 2-methyl,methylacrylic acid,2-methylpropenoic acid,2-methyl-2-propenoic acid,alpha-methacrylic acid,alpha-methylacrylic acid,2-methylenepropionic acid,acrylic acid, 2-methyl PubChem CID: 4093 ChEBI: CHEBI:25219 IUPAC-namn: 2-metylprop-2-ensyra LEDER: CC(=C)C(=O)O
| PubChem CID | 4093 |
|---|---|
| MDL-nummer | MFCD00002651 |
| IUPAC-namn | 2-metylprop-2-ensyra |
| CAS | 79-41-4 |
| InChI-nyckel | CERQOIWHTDAKMF-UHFFFAOYSA-N |
| LEDER | CC(=C)C(=O)O |
| ChEBI | CHEBI:25219 |
| Molekylvikt (g/mol) | 86.09 |
| Synonym | methacrylic acid,2-methylacrylic acid,2-propenoic acid, 2-methyl,methylacrylic acid,2-methylpropenoic acid,2-methyl-2-propenoic acid,alpha-methacrylic acid,alpha-methylacrylic acid,2-methylenepropionic acid,acrylic acid, 2-methyl |
Antimony(III) acetate, 97%
CAS: 6923-52-0 Molekylformel: C6H9O6Sb Molekylvikt (g/mol): 298.892 MDL-nummer: MFCD00014974 InChI-nyckel: JVLRYPRBKSMEBF-UHFFFAOYSA-K Synonym: antimony triacetate,antimony iii acetate,antimony acetate,acetic acid, antimony 3+ salt,octan antimonity czech,antimony 3+ triacetate,acetic acid, antimony 3+ salt 3:1,acetic acid, trianhydride with antimonic acid h3sbo3,acetic acid, antimony salt,octan antimonity PubChem CID: 23354 IUPAC-namn: antimon(3+);triacetat LEDER: CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].[Sb+3]
| Molekylformel | C6H9O6Sb |
|---|---|
| PubChem CID | 23354 |
| MDL-nummer | MFCD00014974 |
| IUPAC-namn | antimon(3+);triacetat |
| CAS | 6923-52-0 |
| InChI-nyckel | JVLRYPRBKSMEBF-UHFFFAOYSA-K |
| LEDER | CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].[Sb+3] |
| Molekylvikt (g/mol) | 298.892 |
| Synonym | antimony triacetate,antimony iii acetate,antimony acetate,acetic acid, antimony 3+ salt,octan antimonity czech,antimony 3+ triacetate,acetic acid, antimony 3+ salt 3:1,acetic acid, trianhydride with antimonic acid h3sbo3,acetic acid, antimony salt,octan antimonity |
Iso-Butyl Acetate, Extra Pure, SLR, Fisher Chemical™
CAS: 110-19-0 Molekylformel: C6H12O2 MDL-nummer: 8932
| Molekylformel | C6H12O2 |
|---|---|
| MDL-nummer | 8932 |
| CAS | 110-19-0 |
1-Cyclohexene-1-acetic acid
CAS: 18294-87-6 Molekylformel: C8H12O2 Molekylvikt (g/mol): 140.182 MDL-nummer: MFCD00015482 InChI-nyckel: KDFBPHXESBPHTK-UHFFFAOYSA-N Synonym: 1-cyclohexenylacetic acid,1-cyclohexene-1-acetic acid,2-cyclohex-1-en-1-yl acetic acid,cyclohex-1-enylacetic acid,1-cyclohexene-1-aceticacid,2-cyclohexen-1-yl acetic acid,2-cyclohex-1-enylacetic acid,cyclohex-1-en-1-ylacetic acid,1-cyclohexenylacetate,cyclohexenylacetic acid PubChem CID: 86699 IUPAC-namn: 2-(cyklohexen-1-yl)ättiksyra LEDER: C1CCC(=CC1)CC(=O)O
| Molekylformel | C8H12O2 |
|---|---|
| PubChem CID | 86699 |
| MDL-nummer | MFCD00015482 |
| IUPAC-namn | 2-(cyklohexen-1-yl)ättiksyra |
| CAS | 18294-87-6 |
| InChI-nyckel | KDFBPHXESBPHTK-UHFFFAOYSA-N |
| LEDER | C1CCC(=CC1)CC(=O)O |
| Molekylvikt (g/mol) | 140.182 |
| Synonym | 1-cyclohexenylacetic acid,1-cyclohexene-1-acetic acid,2-cyclohex-1-en-1-yl acetic acid,cyclohex-1-enylacetic acid,1-cyclohexene-1-aceticacid,2-cyclohexen-1-yl acetic acid,2-cyclohex-1-enylacetic acid,cyclohex-1-en-1-ylacetic acid,1-cyclohexenylacetate,cyclohexenylacetic acid |
n-Butyl acetate, HPLC Grade, 99.5+%
CAS: 123-86-4 Molekylformel: C6H12O2 Molekylvikt (g/mol): 116.16 MDL-nummer: MFCD00009445 InChI-nyckel: DKPFZGUDAPQIHT-UHFFFAOYSA-N Synonym: n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle PubChem CID: 31272 ChEBI: CHEBI:31328 IUPAC-namn: butylacetat LEDER: CCCCOC(C)=O
| Molekylformel | C6H12O2 |
|---|---|
| PubChem CID | 31272 |
| MDL-nummer | MFCD00009445 |
| IUPAC-namn | butylacetat |
| CAS | 123-86-4 |
| InChI-nyckel | DKPFZGUDAPQIHT-UHFFFAOYSA-N |
| LEDER | CCCCOC(C)=O |
| ChEBI | CHEBI:31328 |
| Molekylvikt (g/mol) | 116.16 |
| Synonym | n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle |
Tetramethylammonium formate, 30% w/w aq. soln.
CAS: 59138-84-0 Molekylformel: C5H13NO2 Molekylvikt (g/mol): 119.16 MDL-nummer: MFCD00054402 InChI-nyckel: WWIYWFVQZQOECA-UHFFFAOYSA-M Synonym: tetramethylammonium formate,fibrogenina,forgenin,tonoformina,methanaminium, n,n,n-trimethyl-, formate,tetramethylazanium formate,n,n,n-trimethylmethanaminium formate,ammonium, tetramethyl-, formate,methanaminium, n,n,n-trimethyl-, formate 1:1,c4h12n.cho2 PubChem CID: 42961 IUPAC-namn: tetrametylazan;formiat LEDER: [O-]C=O.C[N+](C)(C)C
| Molekylformel | C5H13NO2 |
|---|---|
| PubChem CID | 42961 |
| MDL-nummer | MFCD00054402 |
| IUPAC-namn | tetrametylazan;formiat |
| CAS | 59138-84-0 |
| InChI-nyckel | WWIYWFVQZQOECA-UHFFFAOYSA-M |
| LEDER | [O-]C=O.C[N+](C)(C)C |
| Molekylvikt (g/mol) | 119.16 |
| Synonym | tetramethylammonium formate,fibrogenina,forgenin,tonoformina,methanaminium, n,n,n-trimethyl-, formate,tetramethylazanium formate,n,n,n-trimethylmethanaminium formate,ammonium, tetramethyl-, formate,methanaminium, n,n,n-trimethyl-, formate 1:1,c4h12n.cho2 |
Copper(II) cyclohexanebutyrate, AAS, Cu 15.8%
CAS: 2218-80-6 Molekylformel: C20H36CuO4 Molekylvikt (g/mol): 404.05 MDL-nummer: MFCD00036399 InChI-nyckel: ZGMZTUJLZVTXNR-UHFFFAOYSA-N Synonym: cyclohexanebutyric acid, copper salt PubChem CID: 131876184 IUPAC-namn: koppar;4-cyklohexylbutansyra LEDER: C1CCC(CC1)CCCC(=O)O.C1CCC(CC1)CCCC(=O)O.[Cu]
| Molekylformel | C20H36CuO4 |
|---|---|
| PubChem CID | 131876184 |
| MDL-nummer | MFCD00036399 |
| IUPAC-namn | koppar;4-cyklohexylbutansyra |
| CAS | 2218-80-6 |
| InChI-nyckel | ZGMZTUJLZVTXNR-UHFFFAOYSA-N |
| LEDER | C1CCC(CC1)CCCC(=O)O.C1CCC(CC1)CCCC(=O)O.[Cu] |
| Molekylvikt (g/mol) | 404.05 |
| Synonym | cyclohexanebutyric acid, copper salt |
Allyl acetate, 97%
CAS: 591-87-7 Molekylformel: C5H8O2 Molekylvikt (g/mol): 100.117 MDL-nummer: MFCD00008721 InChI-nyckel: FWZUNOYOVVKUNF-UHFFFAOYSA-N Synonym: allyl acetate,3-acetoxypropene,acetic acid, 2-propenyl ester,2-propenyl acetate,2-propenyl ethanoate,3-acetoxy-1-propene,allylacetate,acetic acid, allyl ester,2-propenyl methanoate,unii-e4u5e5990i PubChem CID: 11584 IUPAC-namn: prop-2-enylacetat LEDER: CC(=O)OCC=C
| Molekylformel | C5H8O2 |
|---|---|
| PubChem CID | 11584 |
| MDL-nummer | MFCD00008721 |
| IUPAC-namn | prop-2-enylacetat |
| CAS | 591-87-7 |
| InChI-nyckel | FWZUNOYOVVKUNF-UHFFFAOYSA-N |
| LEDER | CC(=O)OCC=C |
| Molekylvikt (g/mol) | 100.117 |
| Synonym | allyl acetate,3-acetoxypropene,acetic acid, 2-propenyl ester,2-propenyl acetate,2-propenyl ethanoate,3-acetoxy-1-propene,allylacetate,acetic acid, allyl ester,2-propenyl methanoate,unii-e4u5e5990i |
2,2,4-Trimethyl-1,3-pentanediol 1-monoisobutyrate
CAS: 25265-77-4 Molekylformel: C12H24O3 Molekylvikt (g/mol): 216.321 MDL-nummer: MFCD00148967 InChI-nyckel: DAFHKNAQFPVRKR-UHFFFAOYSA-N Synonym: texanol,2,2,4-trimethyl-1,3-pentanediol monoisobutyrate,chissocizer cs 12,propanoic acid, 2-methyl-, 3-hydroxy-2,2,4-trimethylpentyl ester,2,2,4-trimethylpentane-1,3-diol monoisobutyrate,3-hydroxy-2,2,4-trimethylpentyl isobutyrate,ccris 8966,isobutyraldehyde tishchenko trimer,propanoic acid, 2-methyl-, monoester with 2,2,4-trimethyl-1,3-pentanediol,2,2,4-trimethyl-1,3-pentanediolmono 2-methylpropanoate PubChem CID: 6490 IUPAC-namn: (3-hydroxi-2,2,4-trimetylpentyl)-2-metylpropanoat LEDER: CC(C)C(C(C)(C)COC(=O)C(C)C)O
| Molekylformel | C12H24O3 |
|---|---|
| PubChem CID | 6490 |
| MDL-nummer | MFCD00148967 |
| IUPAC-namn | (3-hydroxi-2,2,4-trimetylpentyl)-2-metylpropanoat |
| CAS | 25265-77-4 |
| InChI-nyckel | DAFHKNAQFPVRKR-UHFFFAOYSA-N |
| LEDER | CC(C)C(C(C)(C)COC(=O)C(C)C)O |
| Molekylvikt (g/mol) | 216.321 |
| Synonym | texanol,2,2,4-trimethyl-1,3-pentanediol monoisobutyrate,chissocizer cs 12,propanoic acid, 2-methyl-, 3-hydroxy-2,2,4-trimethylpentyl ester,2,2,4-trimethylpentane-1,3-diol monoisobutyrate,3-hydroxy-2,2,4-trimethylpentyl isobutyrate,ccris 8966,isobutyraldehyde tishchenko trimer,propanoic acid, 2-methyl-, monoester with 2,2,4-trimethyl-1,3-pentanediol,2,2,4-trimethyl-1,3-pentanediolmono 2-methylpropanoate |
Mangan(II)acetattetrahydrat, Mn 22% (typiskt), Thermo Scientific Chemicals
CAS: 6156-78-1 Molekylformel: C4H14MnO8 Molekylvikt (g/mol): 245.09 MDL-nummer: MFCD00062552 InChI-nyckel: CESXSDZNZGSWSP-UHFFFAOYSA-L Synonym: manganese ii acetate tetrahydrate,manganese acetate tetrahydrate,manganous acetate tetrahydrate,unii-9to51d176n,manganese diacetate, tetrahydrate,manganese 2+ diacetate tetrahydrate,acetic acid, manganese 2+ salt, tetrahydrate,manganese ii acetatetetrahydrate,acmc-20akkp PubChem CID: 93021 IUPAC-namn: mangan(2+);diacetat;tetrahydrat LEDER: O.O.O.O.[Mn++].CC([O-])=O.CC([O-])=O
| Molekylformel | C4H14MnO8 |
|---|---|
| PubChem CID | 93021 |
| MDL-nummer | MFCD00062552 |
| IUPAC-namn | mangan(2+);diacetat;tetrahydrat |
| CAS | 6156-78-1 |
| InChI-nyckel | CESXSDZNZGSWSP-UHFFFAOYSA-L |
| LEDER | O.O.O.O.[Mn++].CC([O-])=O.CC([O-])=O |
| Molekylvikt (g/mol) | 245.09 |
| Synonym | manganese ii acetate tetrahydrate,manganese acetate tetrahydrate,manganous acetate tetrahydrate,unii-9to51d176n,manganese diacetate, tetrahydrate,manganese 2+ diacetate tetrahydrate,acetic acid, manganese 2+ salt, tetrahydrate,manganese ii acetatetetrahydrate,acmc-20akkp |
Butylstearat, tech., Thermo Scientific Chemicals
CAS: 123-95-5 Molekylformel: C22H44O2 Molekylvikt (g/mol): 340.59 MDL-nummer: MFCD00026669 InChI-nyckel: ULBTUVJTXULMLP-UHFFFAOYSA-N Synonym: butyl stearate,n-butyl stearate,octadecanoic acid, butyl ester,kesscoflex bs,n-butyl octadecanoate,stearic acid, butyl ester,butyl octadecylate,kessco bsc,stearic acid n-butyl ester,polycizer 332 PubChem CID: 31278 ChEBI: CHEBI:85983 IUPAC-namn: butyloktadekanoat LEDER: CCCCCCCCCCCCCCCCCC(=O)OCCCC
| Molekylformel | C22H44O2 |
|---|---|
| PubChem CID | 31278 |
| MDL-nummer | MFCD00026669 |
| IUPAC-namn | butyloktadekanoat |
| CAS | 123-95-5 |
| InChI-nyckel | ULBTUVJTXULMLP-UHFFFAOYSA-N |
| LEDER | CCCCCCCCCCCCCCCCCC(=O)OCCCC |
| ChEBI | CHEBI:85983 |
| Molekylvikt (g/mol) | 340.59 |
| Synonym | butyl stearate,n-butyl stearate,octadecanoic acid, butyl ester,kesscoflex bs,n-butyl octadecanoate,stearic acid, butyl ester,butyl octadecylate,kessco bsc,stearic acid n-butyl ester,polycizer 332 |
Etyl-3-metyl-1H-pyrazol-5-karboxylat, 97 %, Thermo Scientific Chemicals
CAS: 4027-57-0 Molekylformel: C7H10N2O2 Molekylvikt (g/mol): 154.17 MDL-nummer: MFCD00052514 InChI-nyckel: BOTXQJAHRCGJEG-UHFFFAOYSA-N PubChem CID: 77645 IUPAC-namn: etyl-5-metyl-lH-pyrazol-3-karboxylat LEDER: CCOC(=O)C1=NNC(C)=C1
| Molekylformel | C7H10N2O2 |
|---|---|
| PubChem CID | 77645 |
| MDL-nummer | MFCD00052514 |
| IUPAC-namn | etyl-5-metyl-lH-pyrazol-3-karboxylat |
| CAS | 4027-57-0 |
| InChI-nyckel | BOTXQJAHRCGJEG-UHFFFAOYSA-N |
| LEDER | CCOC(=O)C1=NNC(C)=C1 |
| Molekylvikt (g/mol) | 154.17 |